CA1127320A - Ptc devices comprising oxygen barriers - Google Patents
Ptc devices comprising oxygen barriersInfo
- Publication number
- CA1127320A CA1127320A CA340,963A CA340963A CA1127320A CA 1127320 A CA1127320 A CA 1127320A CA 340963 A CA340963 A CA 340963A CA 1127320 A CA1127320 A CA 1127320A
- Authority
- CA
- Canada
- Prior art keywords
- barrier
- ptc element
- temperature
- electrodes
- ptc
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 230000004888 barrier function Effects 0.000 title claims abstract description 42
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 title claims abstract description 19
- 239000001301 oxygen Substances 0.000 title claims abstract description 19
- 229910052760 oxygen Inorganic materials 0.000 title claims abstract description 19
- 239000000203 mixture Substances 0.000 claims abstract description 22
- 229920000642 polymer Polymers 0.000 claims abstract description 17
- 239000002184 metal Substances 0.000 claims abstract description 14
- 229910052751 metal Inorganic materials 0.000 claims abstract description 14
- 229920001940 conductive polymer Polymers 0.000 claims abstract description 7
- 239000000463 material Substances 0.000 claims description 17
- 230000032683 aging Effects 0.000 claims description 10
- 229920001577 copolymer Polymers 0.000 claims description 8
- 229910052799 carbon Inorganic materials 0.000 claims description 6
- 239000002245 particle Substances 0.000 claims description 6
- -1 polyethylene terephthalate Polymers 0.000 claims description 6
- 230000008859 change Effects 0.000 claims description 5
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 claims description 4
- 239000003822 epoxy resin Substances 0.000 claims description 4
- 230000035699 permeability Effects 0.000 claims description 4
- 229920000647 polyepoxide Polymers 0.000 claims description 4
- 238000010438 heat treatment Methods 0.000 claims description 3
- BQCIDUSAKPWEOX-UHFFFAOYSA-N 1,1-Difluoroethene Chemical compound FC(F)=C BQCIDUSAKPWEOX-UHFFFAOYSA-N 0.000 claims description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 2
- VQTUBCCKSQIDNK-UHFFFAOYSA-N Isobutene Chemical group CC(C)=C VQTUBCCKSQIDNK-UHFFFAOYSA-N 0.000 claims description 2
- RRHGJUQNOFWUDK-UHFFFAOYSA-N Isoprene Natural products CC(=C)C=C RRHGJUQNOFWUDK-UHFFFAOYSA-N 0.000 claims description 2
- 239000004952 Polyamide Substances 0.000 claims description 2
- 239000004793 Polystyrene Substances 0.000 claims description 2
- 229920001328 Polyvinylidene chloride Polymers 0.000 claims description 2
- 239000000919 ceramic Substances 0.000 claims description 2
- 229920001971 elastomer Polymers 0.000 claims description 2
- LNEPOXFFQSENCJ-UHFFFAOYSA-N haloperidol Chemical compound C1CC(O)(C=2C=CC(Cl)=CC=2)CCN1CCCC(=O)C1=CC=C(F)C=C1 LNEPOXFFQSENCJ-UHFFFAOYSA-N 0.000 claims description 2
- HCDGVLDPFQMKDK-UHFFFAOYSA-N hexafluoropropylene Chemical group FC(F)=C(F)C(F)(F)F HCDGVLDPFQMKDK-UHFFFAOYSA-N 0.000 claims description 2
- 229920001568 phenolic resin Polymers 0.000 claims description 2
- 239000004033 plastic Substances 0.000 claims description 2
- 229920003023 plastic Polymers 0.000 claims description 2
- 229920002493 poly(chlorotrifluoroethylene) Polymers 0.000 claims description 2
- 229920002647 polyamide Polymers 0.000 claims description 2
- 239000004417 polycarbonate Substances 0.000 claims description 2
- 229920000515 polycarbonate Polymers 0.000 claims description 2
- 239000005023 polychlorotrifluoroethylene (PCTFE) polymer Substances 0.000 claims description 2
- 229920000139 polyethylene terephthalate Polymers 0.000 claims description 2
- 239000005020 polyethylene terephthalate Substances 0.000 claims description 2
- 229920002223 polystyrene Polymers 0.000 claims description 2
- 229920002620 polyvinyl fluoride Polymers 0.000 claims description 2
- 239000005033 polyvinylidene chloride Substances 0.000 claims description 2
- KAKZBPTYRLMSJV-UHFFFAOYSA-N Butadiene Chemical compound C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 claims 2
- 229920002301 cellulose acetate Polymers 0.000 claims 1
- 239000003963 antioxidant agent Substances 0.000 abstract description 5
- 239000000654 additive Substances 0.000 abstract description 4
- 230000000996 additive effect Effects 0.000 abstract description 3
- 230000003078 antioxidant effect Effects 0.000 abstract description 3
- 230000015556 catabolic process Effects 0.000 abstract description 3
- 239000006229 carbon black Substances 0.000 abstract description 2
- 238000006731 degradation reaction Methods 0.000 abstract description 2
- 239000011261 inert gas Substances 0.000 abstract description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 4
- 230000000694 effects Effects 0.000 description 3
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 2
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 2
- XLOMVQKBTHCTTD-UHFFFAOYSA-N Zinc monoxide Chemical compound [Zn]=O XLOMVQKBTHCTTD-UHFFFAOYSA-N 0.000 description 2
- 230000002411 adverse Effects 0.000 description 2
- 229910052802 copper Inorganic materials 0.000 description 2
- 239000010949 copper Substances 0.000 description 2
- 150000002739 metals Chemical class 0.000 description 2
- 229910052759 nickel Inorganic materials 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 238000007789 sealing Methods 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 239000004593 Epoxy Substances 0.000 description 1
- OWYWGLHRNBIFJP-UHFFFAOYSA-N Ipazine Chemical compound CCN(CC)C1=NC(Cl)=NC(NC(C)C)=N1 OWYWGLHRNBIFJP-UHFFFAOYSA-N 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 description 1
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 1
- 229910052787 antimony Inorganic materials 0.000 description 1
- WATWJIUSRGPENY-UHFFFAOYSA-N antimony atom Chemical compound [Sb] WATWJIUSRGPENY-UHFFFAOYSA-N 0.000 description 1
- 229910052786 argon Inorganic materials 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000004927 clay Substances 0.000 description 1
- 230000006835 compression Effects 0.000 description 1
- 238000007906 compression Methods 0.000 description 1
- 239000004020 conductor Substances 0.000 description 1
- 239000002360 explosive Substances 0.000 description 1
- 230000004907 flux Effects 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- PCHJSUWPFVWCPO-UHFFFAOYSA-N gold Chemical compound [Au] PCHJSUWPFVWCPO-UHFFFAOYSA-N 0.000 description 1
- 229910052737 gold Inorganic materials 0.000 description 1
- 239000010931 gold Substances 0.000 description 1
- 229910002804 graphite Inorganic materials 0.000 description 1
- 239000010439 graphite Substances 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 239000011256 inorganic filler Substances 0.000 description 1
- 229910003475 inorganic filler Inorganic materials 0.000 description 1
- 229910052753 mercury Inorganic materials 0.000 description 1
- 229910044991 metal oxide Inorganic materials 0.000 description 1
- 150000004706 metal oxides Chemical class 0.000 description 1
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- 238000000465 moulding Methods 0.000 description 1
- 229920000620 organic polymer Polymers 0.000 description 1
- 238000010525 oxidative degradation reaction Methods 0.000 description 1
- 230000002093 peripheral effect Effects 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 229920002050 silicone resin Polymers 0.000 description 1
- 229910052709 silver Inorganic materials 0.000 description 1
- 239000004332 silver Substances 0.000 description 1
- 230000035882 stress Effects 0.000 description 1
- 229910052718 tin Inorganic materials 0.000 description 1
- 239000011135 tin Substances 0.000 description 1
- 239000011787 zinc oxide Substances 0.000 description 1
Landscapes
- Thermistors And Varistors (AREA)
- Conductive Materials (AREA)
- Resistance Heating (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US96534578A | 1978-12-01 | 1978-12-01 | |
| US965,345 | 1992-10-23 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1127320A true CA1127320A (en) | 1982-07-06 |
Family
ID=25509838
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA340,963A Expired CA1127320A (en) | 1978-12-01 | 1979-11-30 | Ptc devices comprising oxygen barriers |
Country Status (2)
| Country | Link |
|---|---|
| JP (1) | JPS5598801A (enExample) |
| CA (1) | CA1127320A (enExample) |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO2011008294A3 (en) * | 2009-07-17 | 2011-03-17 | Tyco Electronics Corporation | Oxygen-barrier packaged surface mount device |
| US9136195B2 (en) | 2009-07-17 | 2015-09-15 | Tyco Electronics Corporation | Oxygen barrier compositions and related methods |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPH0310634Y2 (enExample) * | 1985-05-20 | 1991-03-15 | ||
| US7371459B2 (en) * | 2004-09-03 | 2008-05-13 | Tyco Electronics Corporation | Electrical devices having an oxygen barrier coating |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3138686A (en) * | 1961-02-01 | 1964-06-23 | Gen Electric | Thermal switch device |
| GB1005459A (en) * | 1964-01-08 | 1965-09-22 | Polyelectric Corp | Improved resistor element |
| DE1613895A1 (de) * | 1966-06-10 | 1971-06-03 | Texas Instruments Inc | Strombegrenzungsvorrichtung |
| JPS4982734A (enExample) * | 1972-12-13 | 1974-08-09 | ||
| JPS5610352B2 (enExample) * | 1972-12-13 | 1981-03-07 | ||
| US4188276A (en) * | 1975-08-04 | 1980-02-12 | Raychem Corporation | Voltage stable positive temperature coefficient of resistance crosslinked compositions |
| JPS53122942A (en) * | 1977-04-04 | 1978-10-26 | Mitsui Petrochemical Ind | Laminated heating unit |
| JPS53146341A (en) * | 1977-05-26 | 1978-12-20 | Matsushita Electric Ind Co Ltd | Heating element |
-
1979
- 1979-11-30 CA CA340,963A patent/CA1127320A/en not_active Expired
- 1979-12-01 JP JP15628979A patent/JPS5598801A/ja active Granted
Cited By (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO2011008294A3 (en) * | 2009-07-17 | 2011-03-17 | Tyco Electronics Corporation | Oxygen-barrier packaged surface mount device |
| US8525635B2 (en) | 2009-07-17 | 2013-09-03 | Tyco Electronics Corporation | Oxygen-barrier packaged surface mount device |
| US9136195B2 (en) | 2009-07-17 | 2015-09-15 | Tyco Electronics Corporation | Oxygen barrier compositions and related methods |
| US9695334B2 (en) | 2009-07-17 | 2017-07-04 | Littlefuse, Inc. | Oxygen barrier compositions and related methods |
Also Published As
| Publication number | Publication date |
|---|---|
| JPH0151041B2 (enExample) | 1989-11-01 |
| JPS5598801A (en) | 1980-07-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4315237A (en) | PTC Devices comprising oxygen barrier layers | |
| US5378407A (en) | Conductive polymer composition | |
| US4237441A (en) | Low resistivity PTC compositions | |
| CA1237760A (en) | Planar resistance heating element | |
| US5886324A (en) | Electrode attachment for high power current limiting polymer devices | |
| US4907340A (en) | Electrical device comprising conductive polymers | |
| CA1240407A (en) | Electrical devices comprising cross-linked conductive polymers | |
| US6274852B1 (en) | Conductive polymer compositions containing N-N-M-phenylenedimaleimide and devices | |
| JPH06202744A (ja) | Ptc素子を有する電気回路 | |
| CA1176453A (en) | Conductive polymer compositions having improved properties under electrical stress | |
| JP2000516391A (ja) | 導電性ポリマー組成物およびデバイス | |
| CA2289824A1 (en) | Conductive polymer materials for high voltage ptc devices | |
| WO1989012308A1 (en) | Polymeric ptc composition and electrical device thereof | |
| GB2038549A (en) | PTC devices having oxygen barrier encapsulation | |
| JPH0969420A (ja) | 電気回路保護装置 | |
| EP0912631A1 (en) | Ptc conductive polymer compositions containing high molecular weight polymer materials | |
| CA2081029C (en) | Elongated electrical resistance heater | |
| CA1127320A (en) | Ptc devices comprising oxygen barriers | |
| US6359544B1 (en) | Conductive polymer compositions containing surface treated kaolin clay and devices | |
| US6197220B1 (en) | Conductive polymer compositions containing fibrillated fibers and devices | |
| EP1042765B1 (en) | Method of making an electrical device | |
| KR830001452B1 (ko) | 산소 배리어(Barrier)로 구성된 PTC장치 | |
| WO1991003822A1 (en) | Conductive polymer device | |
| CA2373531A1 (en) | Electrical device | |
| JP2002064004A (ja) | Ptc素子及びその製造方法 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |