CA1121643A - Bleach-fix sheet containing a metallic silver bleaching agent, a silver salt fixing agent and a hydrophilic binder - Google Patents
Bleach-fix sheet containing a metallic silver bleaching agent, a silver salt fixing agent and a hydrophilic binderInfo
- Publication number
- CA1121643A CA1121643A CA000332380A CA332380A CA1121643A CA 1121643 A CA1121643 A CA 1121643A CA 000332380 A CA000332380 A CA 000332380A CA 332380 A CA332380 A CA 332380A CA 1121643 A CA1121643 A CA 1121643A
- Authority
- CA
- Canada
- Prior art keywords
- bleach
- layer
- silver
- film unit
- fix sheet
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000003795 chemical substances by application Substances 0.000 title claims abstract description 53
- 239000007844 bleaching agent Substances 0.000 title claims abstract description 50
- 239000011230 binding agent Substances 0.000 title claims abstract description 46
- 229910052709 silver Inorganic materials 0.000 title claims description 108
- 239000004332 silver Substances 0.000 title claims description 108
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 title claims description 50
- GGCZERPQGJTIQP-UHFFFAOYSA-N sodium;9,10-dioxoanthracene-2-sulfonic acid Chemical compound [Na+].C1=CC=C2C(=O)C3=CC(S(=O)(=O)O)=CC=C3C(=O)C2=C1 GGCZERPQGJTIQP-UHFFFAOYSA-N 0.000 title claims description 17
- 238000000034 method Methods 0.000 claims abstract description 40
- 230000008569 process Effects 0.000 claims abstract description 35
- 230000000717 retained effect Effects 0.000 claims abstract description 13
- 238000012546 transfer Methods 0.000 claims abstract description 8
- -1 poly(vinyl alcohol) Polymers 0.000 claims description 99
- 239000000975 dye Substances 0.000 claims description 77
- 239000000839 emulsion Substances 0.000 claims description 43
- 239000000463 material Substances 0.000 claims description 43
- 238000012545 processing Methods 0.000 claims description 26
- 239000000203 mixture Substances 0.000 claims description 24
- 239000002253 acid Substances 0.000 claims description 23
- 230000008961 swelling Effects 0.000 claims description 22
- 108010010803 Gelatin Proteins 0.000 claims description 21
- 229920000159 gelatin Polymers 0.000 claims description 21
- 239000008273 gelatin Substances 0.000 claims description 21
- 235000019322 gelatine Nutrition 0.000 claims description 21
- 235000011852 gelatine desserts Nutrition 0.000 claims description 21
- 239000004848 polyfunctional curative Substances 0.000 claims description 11
- 238000004061 bleaching Methods 0.000 claims description 10
- 229920002451 polyvinyl alcohol Polymers 0.000 claims description 10
- 229920002125 Sokalan® Polymers 0.000 claims description 8
- UOMQUZPKALKDCA-UHFFFAOYSA-K 2-[2-[bis(carboxylatomethyl)amino]ethyl-(carboxymethyl)amino]acetate;iron(3+) Chemical compound [Fe+3].OC(=O)CN(CC([O-])=O)CCN(CC([O-])=O)CC([O-])=O UOMQUZPKALKDCA-UHFFFAOYSA-K 0.000 claims description 7
- 239000004584 polyacrylic acid Substances 0.000 claims description 7
- 238000007599 discharging Methods 0.000 claims description 6
- 238000006243 chemical reaction Methods 0.000 claims description 5
- GSEJCLTVZPLZKY-UHFFFAOYSA-O triethanolammonium Chemical compound OCC[NH+](CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-O 0.000 claims description 5
- SAVMNSHHXUMFRQ-UHFFFAOYSA-N 1-[bis(ethenylsulfonyl)methoxy-ethenylsulfonylmethyl]sulfonylethene Chemical compound C=CS(=O)(=O)C(S(=O)(=O)C=C)OC(S(=O)(=O)C=C)S(=O)(=O)C=C SAVMNSHHXUMFRQ-UHFFFAOYSA-N 0.000 claims description 3
- YKMDNKRCCODWMG-UHFFFAOYSA-N 2,5-dinitrobenzoic acid Chemical compound OC(=O)C1=CC([N+]([O-])=O)=CC=C1[N+]([O-])=O YKMDNKRCCODWMG-UHFFFAOYSA-N 0.000 claims description 3
- 230000005670 electromagnetic radiation Effects 0.000 claims description 2
- 238000003384 imaging method Methods 0.000 claims description 2
- 238000010030 laminating Methods 0.000 claims description 2
- AJDUTMFFZHIJEM-UHFFFAOYSA-N n-(9,10-dioxoanthracen-1-yl)-4-[4-[[4-[4-[(9,10-dioxoanthracen-1-yl)carbamoyl]phenyl]phenyl]diazenyl]phenyl]benzamide Chemical compound O=C1C2=CC=CC=C2C(=O)C2=C1C=CC=C2NC(=O)C(C=C1)=CC=C1C(C=C1)=CC=C1N=NC(C=C1)=CC=C1C(C=C1)=CC=C1C(=O)NC1=CC=CC2=C1C(=O)C1=CC=CC=C1C2=O AJDUTMFFZHIJEM-UHFFFAOYSA-N 0.000 claims description 2
- 239000012466 permeate Substances 0.000 claims description 2
- 230000005855 radiation Effects 0.000 claims description 2
- 239000001043 yellow dye Substances 0.000 claims description 2
- 239000010410 layer Substances 0.000 claims 29
- 239000002356 single layer Substances 0.000 claims 5
- 230000001934 delay Effects 0.000 claims 3
- 241001061127 Thione Species 0.000 claims 1
- 238000009792 diffusion process Methods 0.000 abstract 1
- 150000001875 compounds Chemical class 0.000 description 32
- 239000000243 solution Substances 0.000 description 13
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 12
- 238000011161 development Methods 0.000 description 12
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 9
- 239000004372 Polyvinyl alcohol Substances 0.000 description 8
- 239000012190 activator Substances 0.000 description 8
- 229920000139 polyethylene terephthalate Polymers 0.000 description 8
- 239000005020 polyethylene terephthalate Substances 0.000 description 8
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 8
- 239000007864 aqueous solution Substances 0.000 description 7
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- 239000004354 Hydroxyethyl cellulose Substances 0.000 description 6
- 229920000663 Hydroxyethyl cellulose Polymers 0.000 description 6
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 6
- 238000000576 coating method Methods 0.000 description 6
- 239000003086 colorant Substances 0.000 description 6
- 235000019447 hydroxyethyl cellulose Nutrition 0.000 description 6
- 239000002243 precursor Substances 0.000 description 6
- 229910052717 sulfur Inorganic materials 0.000 description 6
- 239000011593 sulfur Substances 0.000 description 6
- SJSJAWHHGDPBOC-UHFFFAOYSA-N 4,4-dimethyl-1-phenylpyrazolidin-3-one Chemical compound N1C(=O)C(C)(C)CN1C1=CC=CC=C1 SJSJAWHHGDPBOC-UHFFFAOYSA-N 0.000 description 5
- 239000011248 coating agent Substances 0.000 description 5
- 229920000642 polymer Polymers 0.000 description 5
- NATVVRFRJHJKDJ-UHFFFAOYSA-N 5-(2-hydroxyethyl)-1,3,5-triazinane-2-thione Chemical compound OCCN1CNC(=S)NC1 NATVVRFRJHJKDJ-UHFFFAOYSA-N 0.000 description 4
- 125000000217 alkyl group Chemical group 0.000 description 4
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 4
- 125000004432 carbon atom Chemical group C* 0.000 description 4
- 238000009826 distribution Methods 0.000 description 4
- 229910052739 hydrogen Inorganic materials 0.000 description 4
- 239000001257 hydrogen Substances 0.000 description 4
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 description 4
- 229910052760 oxygen Inorganic materials 0.000 description 4
- 239000001301 oxygen Substances 0.000 description 4
- 125000004434 sulfur atom Chemical group 0.000 description 4
- 238000012360 testing method Methods 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- LCGLNKUTAGEVQW-UHFFFAOYSA-N Dimethyl ether Chemical compound COC LCGLNKUTAGEVQW-UHFFFAOYSA-N 0.000 description 3
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 3
- PDQAZBWRQCGBEV-UHFFFAOYSA-N Ethylenethiourea Chemical compound S=C1NCCN1 PDQAZBWRQCGBEV-UHFFFAOYSA-N 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- 229910052783 alkali metal Inorganic materials 0.000 description 3
- 150000001555 benzenes Chemical class 0.000 description 3
- 150000002009 diols Chemical class 0.000 description 3
- 230000006870 function Effects 0.000 description 3
- 150000004820 halides Chemical class 0.000 description 3
- 238000000926 separation method Methods 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- IANQTJSKSUMEQM-UHFFFAOYSA-N 1-benzofuran Chemical compound C1=CC=C2OC=CC2=C1 IANQTJSKSUMEQM-UHFFFAOYSA-N 0.000 description 2
- YPXQSGWOGQPLQO-UHFFFAOYSA-N 5-nitro-1,3-dihydrobenzimidazole-2-thione Chemical compound [O-][N+](=O)C1=CC=C2N=C(S)NC2=C1 YPXQSGWOGQPLQO-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 2
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 2
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 2
- 239000005977 Ethylene Substances 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 2
- DLRVVLDZNNYCBX-UHFFFAOYSA-N Polydextrose Polymers OC1C(O)C(O)C(CO)OC1OCC1C(O)C(O)C(O)C(O)O1 DLRVVLDZNNYCBX-UHFFFAOYSA-N 0.000 description 2
- 206010070834 Sensitisation Diseases 0.000 description 2
- FOIXSVOLVBLSDH-UHFFFAOYSA-N Silver ion Chemical compound [Ag+] FOIXSVOLVBLSDH-UHFFFAOYSA-N 0.000 description 2
- DWAQJAXMDSEUJJ-UHFFFAOYSA-M Sodium bisulfite Chemical compound [Na+].OS([O-])=O DWAQJAXMDSEUJJ-UHFFFAOYSA-M 0.000 description 2
- XYXNTHIYBIDHGM-UHFFFAOYSA-N ammonium thiosulfate Chemical compound [NH4+].[NH4+].[O-]S([O-])(=O)=S XYXNTHIYBIDHGM-UHFFFAOYSA-N 0.000 description 2
- 125000003118 aryl group Chemical group 0.000 description 2
- 125000002837 carbocyclic group Chemical group 0.000 description 2
- 239000008139 complexing agent Substances 0.000 description 2
- PKRGYJHUXHCUCN-UHFFFAOYSA-N cyclohexanehexone Chemical compound O=C1C(=O)C(=O)C(=O)C(=O)C1=O PKRGYJHUXHCUCN-UHFFFAOYSA-N 0.000 description 2
- 238000001739 density measurement Methods 0.000 description 2
- 125000002485 formyl group Chemical class [H]C(*)=O 0.000 description 2
- 239000000499 gel Substances 0.000 description 2
- 125000000623 heterocyclic group Chemical group 0.000 description 2
- NBGMRMDAEWWFIR-UHFFFAOYSA-N imidazole-2-thione Chemical compound S=C1N=CC=N1 NBGMRMDAEWWFIR-UHFFFAOYSA-N 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 238000005259 measurement Methods 0.000 description 2
- 239000003607 modifier Substances 0.000 description 2
- 230000003647 oxidation Effects 0.000 description 2
- 238000007254 oxidation reaction Methods 0.000 description 2
- XNGIFLGASWRNHJ-UHFFFAOYSA-N phthalic acid Chemical compound OC(=O)C1=CC=CC=C1C(O)=O XNGIFLGASWRNHJ-UHFFFAOYSA-N 0.000 description 2
- KMUONIBRACKNSN-UHFFFAOYSA-N potassium dichromate Chemical compound [K+].[K+].[O-][Cr](=O)(=O)O[Cr]([O-])(=O)=O KMUONIBRACKNSN-UHFFFAOYSA-N 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- JEXVQSWXXUJEMA-UHFFFAOYSA-N pyrazol-3-one Chemical class O=C1C=CN=N1 JEXVQSWXXUJEMA-UHFFFAOYSA-N 0.000 description 2
- 238000011160 research Methods 0.000 description 2
- 230000035945 sensitivity Effects 0.000 description 2
- 230000008313 sensitization Effects 0.000 description 2
- 235000010267 sodium hydrogen sulphite Nutrition 0.000 description 2
- 230000003595 spectral effect Effects 0.000 description 2
- 239000003381 stabilizer Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- YUKQRDCYNOVPGJ-UHFFFAOYSA-N thioacetamide Chemical compound CC(N)=S YUKQRDCYNOVPGJ-UHFFFAOYSA-N 0.000 description 2
- DLFVBJFMPXGRIB-UHFFFAOYSA-N thioacetamide Natural products CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 description 2
- 150000003573 thiols Chemical class 0.000 description 2
- UMGDCJDMYOKAJW-UHFFFAOYSA-N thiourea Chemical compound NC(N)=S UMGDCJDMYOKAJW-UHFFFAOYSA-N 0.000 description 2
- 229920002554 vinyl polymer Polymers 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- MKWJZTFMDWSRIH-UHFFFAOYSA-N (4-fluoro-3-nitrophenyl)methanol Chemical compound OCC1=CC=C(F)C([N+]([O-])=O)=C1 MKWJZTFMDWSRIH-UHFFFAOYSA-N 0.000 description 1
- AZQWKYJCGOJGHM-UHFFFAOYSA-N 1,4-benzoquinone Chemical compound O=C1C=CC(=O)C=C1 AZQWKYJCGOJGHM-UHFFFAOYSA-N 0.000 description 1
- KAMCBFNNGGVPPW-UHFFFAOYSA-N 1-(ethenylsulfonylmethoxymethylsulfonyl)ethene Chemical compound C=CS(=O)(=O)COCS(=O)(=O)C=C KAMCBFNNGGVPPW-UHFFFAOYSA-N 0.000 description 1
- CJAOGUFAAWZWNI-UHFFFAOYSA-N 1-n,1-n,4-n,4-n-tetramethylbenzene-1,4-diamine Chemical compound CN(C)C1=CC=C(N(C)C)C=C1 CJAOGUFAAWZWNI-UHFFFAOYSA-N 0.000 description 1
- KJCVRFUGPWSIIH-UHFFFAOYSA-N 1-naphthol Chemical compound C1=CC=C2C(O)=CC=CC2=C1 KJCVRFUGPWSIIH-UHFFFAOYSA-N 0.000 description 1
- ZKEGGSPWBGCPNF-UHFFFAOYSA-N 2,5-dihydroxy-5-methyl-3-(piperidin-1-ylamino)cyclopent-2-en-1-one Chemical compound O=C1C(C)(O)CC(NN2CCCCC2)=C1O ZKEGGSPWBGCPNF-UHFFFAOYSA-N 0.000 description 1
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 description 1
- HIXDQWDOVZUNNA-UHFFFAOYSA-N 2-(3,4-dimethoxyphenyl)-5-hydroxy-7-methoxychromen-4-one Chemical compound C=1C(OC)=CC(O)=C(C(C=2)=O)C=1OC=2C1=CC=C(OC)C(OC)=C1 HIXDQWDOVZUNNA-UHFFFAOYSA-N 0.000 description 1
- JHKKTXXMAQLGJB-UHFFFAOYSA-N 2-(methylamino)phenol Chemical compound CNC1=CC=CC=C1O JHKKTXXMAQLGJB-UHFFFAOYSA-N 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-N 2-Propenoic acid Natural products OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 1
- PDHFSBXFZGYBIP-UHFFFAOYSA-N 2-[2-(2-hydroxyethylsulfanyl)ethylsulfanyl]ethanol Chemical compound OCCSCCSCCO PDHFSBXFZGYBIP-UHFFFAOYSA-N 0.000 description 1
- VZYIKHZFVOUXKE-UHFFFAOYSA-N 2-[2-[2-(2-hydroxyethylsulfanyl)ethylsulfanyl]ethylsulfanyl]ethanol Chemical compound OCCSCCSCCSCCO VZYIKHZFVOUXKE-UHFFFAOYSA-N 0.000 description 1
- NJIAMNMXCYGBOW-UHFFFAOYSA-N 2-[2-[2-(carboxymethylsulfanyl)ethylsulfanyl]ethylsulfanyl]acetic acid Chemical compound OC(=O)CSCCSCCSCC(O)=O NJIAMNMXCYGBOW-UHFFFAOYSA-N 0.000 description 1
- PVDWSJKKDOJLNU-UHFFFAOYSA-N 2-[2-[2-[2-(2-hydroxyethoxy)ethylsulfanyl]ethylsulfanyl]ethoxy]ethanol Chemical compound OCCOCCSCCSCCOCCO PVDWSJKKDOJLNU-UHFFFAOYSA-N 0.000 description 1
- HSIQISXCSGZFCN-UHFFFAOYSA-N 2-[2-[2-[2-(2-hydroxyethylsulfanyl)ethylsulfanyl]ethoxy]ethoxy]ethanol Chemical compound OCCOCCOCCSCCSCCO HSIQISXCSGZFCN-UHFFFAOYSA-N 0.000 description 1
- OMNOPAUWOXOADS-UHFFFAOYSA-N 2-[2-[2-[2-(2-hydroxyethylsulfanyl)ethylsulfanyl]ethylsulfanyl]ethylsulfanyl]ethanol Chemical compound OCCSCCSCCSCCSCCO OMNOPAUWOXOADS-UHFFFAOYSA-N 0.000 description 1
- DONQBGKGBRGNOP-UHFFFAOYSA-N 2-[2-[2-[2-(carboxymethylsulfanyl)ethylsulfanyl]ethylsulfanyl]ethylsulfanyl]acetic acid Chemical compound OC(=O)CSCCSCCSCCSCC(O)=O DONQBGKGBRGNOP-UHFFFAOYSA-N 0.000 description 1
- MOXDGMSQFFMNHA-UHFFFAOYSA-N 2-hydroxybenzenesulfonamide Chemical compound NS(=O)(=O)C1=CC=CC=C1O MOXDGMSQFFMNHA-UHFFFAOYSA-N 0.000 description 1
- JHWIEAWILPSRMU-UHFFFAOYSA-N 2-methyl-3-pyrimidin-4-ylpropanoic acid Chemical compound OC(=O)C(C)CC1=CC=NC=N1 JHWIEAWILPSRMU-UHFFFAOYSA-N 0.000 description 1
- UDAIGHZFMLGNDQ-UHFFFAOYSA-N 2-nitroquinoline Chemical compound C1=CC=CC2=NC([N+](=O)[O-])=CC=C21 UDAIGHZFMLGNDQ-UHFFFAOYSA-N 0.000 description 1
- IQAFSFUPHSQKBY-UHFFFAOYSA-N 2-sulfanyltetrazole Chemical compound SN1N=CN=N1 IQAFSFUPHSQKBY-UHFFFAOYSA-N 0.000 description 1
- UJBDWOYYHFGTGA-UHFFFAOYSA-N 3,4-dihydropyrrole-2-thione Chemical compound S=C1CCC=N1 UJBDWOYYHFGTGA-UHFFFAOYSA-N 0.000 description 1
- VYWYYJYRVSBHJQ-UHFFFAOYSA-N 3,5-dinitrobenzoic acid Chemical compound OC(=O)C1=CC([N+]([O-])=O)=CC([N+]([O-])=O)=C1 VYWYYJYRVSBHJQ-UHFFFAOYSA-N 0.000 description 1
- OHELLDVEWGGEHW-UHFFFAOYSA-N 3-(4-sulfanylidene-1,3,5-triazinan-1-yl)propanoic acid Chemical compound OC(=O)CCN1CNC(=S)NC1 OHELLDVEWGGEHW-UHFFFAOYSA-N 0.000 description 1
- XRZDIHADHZSFBB-UHFFFAOYSA-N 3-oxo-n,3-diphenylpropanamide Chemical compound C=1C=CC=CC=1NC(=O)CC(=O)C1=CC=CC=C1 XRZDIHADHZSFBB-UHFFFAOYSA-N 0.000 description 1
- WFFZGYRTVIPBFN-UHFFFAOYSA-N 3h-indene-1,2-dione Chemical compound C1=CC=C2C(=O)C(=O)CC2=C1 WFFZGYRTVIPBFN-UHFFFAOYSA-N 0.000 description 1
- FJWJYHHBUMICTP-UHFFFAOYSA-N 4,4-dimethylpyrazolidin-3-one Chemical compound CC1(C)CNNC1=O FJWJYHHBUMICTP-UHFFFAOYSA-N 0.000 description 1
- DSVIHYOAKPVFEH-UHFFFAOYSA-N 4-(hydroxymethyl)-4-methyl-1-phenylpyrazolidin-3-one Chemical compound N1C(=O)C(C)(CO)CN1C1=CC=CC=C1 DSVIHYOAKPVFEH-UHFFFAOYSA-N 0.000 description 1
- CEXKMXQBLPBNMK-UHFFFAOYSA-N 4-(hydroxymethyl)-5h-1,3-thiazole-2-thione Chemical compound OCC1=NC(=S)SC1 CEXKMXQBLPBNMK-UHFFFAOYSA-N 0.000 description 1
- NGZJXCFNBVJLQN-UHFFFAOYSA-N 4-methylimidazolidine-2-thione Chemical compound CC1CNC(=S)N1 NGZJXCFNBVJLQN-UHFFFAOYSA-N 0.000 description 1
- ZIIGSRYPZWDGBT-UHFFFAOYSA-N 610-30-0 Chemical compound OC(=O)C1=CC=C([N+]([O-])=O)C=C1[N+]([O-])=O ZIIGSRYPZWDGBT-UHFFFAOYSA-N 0.000 description 1
- 241001125671 Eretmochelys imbricata Species 0.000 description 1
- 229930194542 Keto Natural products 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- 229920002845 Poly(methacrylic acid) Polymers 0.000 description 1
- 229920001100 Polydextrose Polymers 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- 239000004743 Polypropylene Substances 0.000 description 1
- 239000004793 Polystyrene Substances 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- ZMZDMBWJUHKJPS-UHFFFAOYSA-M Thiocyanate anion Chemical compound [S-]C#N ZMZDMBWJUHKJPS-UHFFFAOYSA-M 0.000 description 1
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Natural products NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 1
- 238000002441 X-ray diffraction Methods 0.000 description 1
- LGDAGYXJBDILKZ-UHFFFAOYSA-N [2-methyl-1,1-dioxo-3-(pyridin-2-ylcarbamoyl)-1$l^{6},2-benzothiazin-4-yl] 2,2-dimethylpropanoate Chemical compound CC(C)(C)C(=O)OC=1C2=CC=CC=C2S(=O)(=O)N(C)C=1C(=O)NC1=CC=CC=N1 LGDAGYXJBDILKZ-UHFFFAOYSA-N 0.000 description 1
- MPLZNPZPPXERDA-UHFFFAOYSA-N [4-(diethylamino)-2-methylphenyl]azanium;chloride Chemical compound [Cl-].CC[NH+](CC)C1=CC=C(N)C(C)=C1 MPLZNPZPPXERDA-UHFFFAOYSA-N 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 125000000218 acetic acid group Chemical group C(C)(=O)* 0.000 description 1
- VYTBPJNGNGMRFH-UHFFFAOYSA-N acetic acid;azane Chemical compound N.N.CC(O)=O.CC(O)=O.CC(O)=O.CC(O)=O VYTBPJNGNGMRFH-UHFFFAOYSA-N 0.000 description 1
- 125000002015 acyclic group Chemical group 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 239000012670 alkaline solution Substances 0.000 description 1
- 150000001336 alkenes Chemical class 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 125000005256 alkoxyacyl group Chemical group 0.000 description 1
- 125000003282 alkyl amino group Chemical group 0.000 description 1
- 125000004414 alkyl thio group Chemical group 0.000 description 1
- 125000003368 amide group Chemical group 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- SOIFLUNRINLCBN-UHFFFAOYSA-N ammonium thiocyanate Chemical compound [NH4+].[S-]C#N SOIFLUNRINLCBN-UHFFFAOYSA-N 0.000 description 1
- 229940051880 analgesics and antipyretics pyrazolones Drugs 0.000 description 1
- PYKYMHQGRFAEBM-UHFFFAOYSA-N anthraquinone Natural products CCC(=O)c1c(O)c2C(=O)C3C(C=CC=C3O)C(=O)c2cc1CC(=O)OC PYKYMHQGRFAEBM-UHFFFAOYSA-N 0.000 description 1
- 150000004056 anthraquinones Chemical class 0.000 description 1
- 238000000149 argon plasma sintering Methods 0.000 description 1
- 125000001769 aryl amino group Chemical group 0.000 description 1
- 125000004104 aryloxy group Chemical group 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- GUGSALPPFYFHAM-UHFFFAOYSA-N azanium;2-(4-sulfanylidene-1,3,5-triazinan-1-yl)ethanesulfonate Chemical compound [NH4+].[O-]S(=O)(=O)CCN1CNC(=S)NC1 GUGSALPPFYFHAM-UHFFFAOYSA-N 0.000 description 1
- 125000004069 aziridinyl group Chemical group 0.000 description 1
- 230000004888 barrier function Effects 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 229920002301 cellulose acetate Polymers 0.000 description 1
- 229920006217 cellulose acetate butyrate Polymers 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 229910052729 chemical element Inorganic materials 0.000 description 1
- 150000001860 citric acid derivatives Chemical class 0.000 description 1
- 230000000295 complement effect Effects 0.000 description 1
- 125000004093 cyano group Chemical group *C#N 0.000 description 1
- AFIYIMWYCCBPCD-UHFFFAOYSA-N diazanium;2,5-bis(sulfanyl)hexanedioate Chemical compound [NH4+].[NH4+].[O-]C(=O)C(S)CCC(S)C([O-])=O AFIYIMWYCCBPCD-UHFFFAOYSA-N 0.000 description 1
- ZTGHEYTXEWZOHM-UHFFFAOYSA-L dipotassium;2,5-bis(sulfanyl)hexanedioate Chemical compound [K+].[K+].[O-]C(=O)C(S)CCC(S)C([O-])=O ZTGHEYTXEWZOHM-UHFFFAOYSA-L 0.000 description 1
- FGRVOLIFQGXPCT-UHFFFAOYSA-L dipotassium;dioxido-oxo-sulfanylidene-$l^{6}-sulfane Chemical compound [K+].[K+].[O-]S([O-])(=O)=S FGRVOLIFQGXPCT-UHFFFAOYSA-L 0.000 description 1
- 230000008034 disappearance Effects 0.000 description 1
- SLYNARRRORMIHV-UHFFFAOYSA-L disodium;2,5-bis(sulfanyl)hexanedioate Chemical compound [Na+].[Na+].[O-]C(=O)C(S)CCC(S)C([O-])=O SLYNARRRORMIHV-UHFFFAOYSA-L 0.000 description 1
- BNOQSGWAWRCQRK-UHFFFAOYSA-L disodium;2-[2-[2-(carboxylatomethylsulfanyl)ethylsulfanyl]ethylsulfanyl]acetate Chemical compound [Na+].[Na+].[O-]C(=O)CSCCSCCSCC([O-])=O BNOQSGWAWRCQRK-UHFFFAOYSA-L 0.000 description 1
- NQTSMPMGYLBQMI-UHFFFAOYSA-L disodium;2-[2-[2-[2-(carboxylatomethylsulfanyl)ethylsulfanyl]ethylsulfanyl]ethylsulfanyl]acetate Chemical compound [Na+].[Na+].[O-]C(=O)CSCCSCCSCCSCC([O-])=O NQTSMPMGYLBQMI-UHFFFAOYSA-L 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 229960001484 edetic acid Drugs 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- KOWWOODYPWDWOJ-LVBPXUMQSA-N elatine Chemical compound C([C@]12CN(C3[C@@]45OCO[C@]44[C@H]6[C@@H](OC)[C@@H]([C@H](C4)OC)C[C@H]6[C@@]3([C@@H]1[C@@H]5OC)[C@@H](OC)CC2)CC)OC(=O)C1=CC=CC=C1N1C(=O)CC(C)C1=O KOWWOODYPWDWOJ-LVBPXUMQSA-N 0.000 description 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 125000000816 ethylene group Chemical group [H]C([H])([*:1])C([H])([H])[*:2] 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 150000002431 hydrogen Chemical group 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- ZMZDMBWJUHKJPS-UHFFFAOYSA-N hydrogen thiocyanate Natural products SC#N ZMZDMBWJUHKJPS-UHFFFAOYSA-N 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- APWIQNJBGHKQRN-UHFFFAOYSA-N imidazolidine-2-thiol Chemical compound SC1NCCN1 APWIQNJBGHKQRN-UHFFFAOYSA-N 0.000 description 1
- 238000007654 immersion Methods 0.000 description 1
- LOCAIGRSOJUCTB-UHFFFAOYSA-N indazol-3-one Chemical compound C1=CC=C2C(=O)N=NC2=C1 LOCAIGRSOJUCTB-UHFFFAOYSA-N 0.000 description 1
- RSAZYXZUJROYKR-UHFFFAOYSA-N indophenol Chemical compound C1=CC(O)=CC=C1N=C1C=CC(=O)C=C1 RSAZYXZUJROYKR-UHFFFAOYSA-N 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 125000000468 ketone group Chemical group 0.000 description 1
- 238000003475 lamination Methods 0.000 description 1
- 125000005647 linker group Chemical group 0.000 description 1
- WRIRWRKPLXCTFD-UHFFFAOYSA-N malonamide Chemical compound NC(=O)CC(N)=O WRIRWRKPLXCTFD-UHFFFAOYSA-N 0.000 description 1
- DZVCFNFOPIZQKX-LTHRDKTGSA-M merocyanine Chemical compound [Na+].O=C1N(CCCC)C(=O)N(CCCC)C(=O)C1=C\C=C\C=C/1N(CCCS([O-])(=O)=O)C2=CC=CC=C2O\1 DZVCFNFOPIZQKX-LTHRDKTGSA-M 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- WSFSSNUMVMOOMR-NJFSPNSNSA-N methanone Chemical compound O=[14CH2] WSFSSNUMVMOOMR-NJFSPNSNSA-N 0.000 description 1
- 230000005012 migration Effects 0.000 description 1
- 238000013508 migration Methods 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 125000000896 monocarboxylic acid group Chemical group 0.000 description 1
- YYAQOJILQOVUSK-UHFFFAOYSA-N n,n'-diphenylpropanediamide Chemical compound C=1C=CC=CC=1NC(=O)CC(=O)NC1=CC=CC=C1 YYAQOJILQOVUSK-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 150000002790 naphthalenes Chemical class 0.000 description 1
- 150000004780 naphthols Chemical class 0.000 description 1
- 239000005445 natural material Substances 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 230000003472 neutralizing effect Effects 0.000 description 1
- FEMOMIGRRWSMCU-UHFFFAOYSA-N ninhydrin Chemical compound C1=CC=C2C(=O)C(O)(O)C(=O)C2=C1 FEMOMIGRRWSMCU-UHFFFAOYSA-N 0.000 description 1
- 229920002114 octoxynol-9 Polymers 0.000 description 1
- FWFGVMYFCODZRD-UHFFFAOYSA-N oxidanium;hydrogen sulfate Chemical compound O.OS(O)(=O)=O FWFGVMYFCODZRD-UHFFFAOYSA-N 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- CMCWWLVWPDLCRM-UHFFFAOYSA-N phenidone Chemical compound N1C(=O)CCN1C1=CC=CC=C1 CMCWWLVWPDLCRM-UHFFFAOYSA-N 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- XNGIFLGASWRNHJ-UHFFFAOYSA-M phthalate(1-) Chemical compound OC(=O)C1=CC=CC=C1C([O-])=O XNGIFLGASWRNHJ-UHFFFAOYSA-M 0.000 description 1
- 229920000515 polycarbonate Polymers 0.000 description 1
- 239000004417 polycarbonate Substances 0.000 description 1
- 239000001259 polydextrose Substances 0.000 description 1
- 235000013856 polydextrose Nutrition 0.000 description 1
- 229940035035 polydextrose Drugs 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 229920001155 polypropylene Polymers 0.000 description 1
- 229920002223 polystyrene Polymers 0.000 description 1
- 229920002689 polyvinyl acetate Polymers 0.000 description 1
- 239000011118 polyvinyl acetate Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 150000003142 primary aromatic amines Chemical class 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 230000009257 reactivity Effects 0.000 description 1
- 238000009877 rendering Methods 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- ADZWSOLPGZMUMY-UHFFFAOYSA-M silver bromide Chemical compound [Ag]Br ADZWSOLPGZMUMY-UHFFFAOYSA-M 0.000 description 1
- VGTPCRGMBIAPIM-UHFFFAOYSA-M sodium thiocyanate Chemical compound [Na+].[S-]C#N VGTPCRGMBIAPIM-UHFFFAOYSA-M 0.000 description 1
- AKHNMLFCWUSKQB-UHFFFAOYSA-L sodium thiosulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=S AKHNMLFCWUSKQB-UHFFFAOYSA-L 0.000 description 1
- 235000019345 sodium thiosulphate Nutrition 0.000 description 1
- 230000003381 solubilizing effect Effects 0.000 description 1
- 230000007480 spreading Effects 0.000 description 1
- 238000003892 spreading Methods 0.000 description 1
- 230000000087 stabilizing effect Effects 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000000547 substituted alkyl group Chemical group 0.000 description 1
- 125000000475 sulfinyl group Chemical group [*:2]S([*:1])=O 0.000 description 1
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 description 1
- 239000004094 surface-active agent Substances 0.000 description 1
- 229920001059 synthetic polymer Polymers 0.000 description 1
- CBXCPBUEXACCNR-UHFFFAOYSA-N tetraethylammonium Chemical compound CC[N+](CC)(CC)CC CBXCPBUEXACCNR-UHFFFAOYSA-N 0.000 description 1
- ANRHNWWPFJCPAZ-UHFFFAOYSA-M thionine Chemical compound [Cl-].C1=CC(N)=CC2=[S+]C3=CC(N)=CC=C3N=C21 ANRHNWWPFJCPAZ-UHFFFAOYSA-M 0.000 description 1
- 150000004764 thiosulfuric acid derivatives Chemical class 0.000 description 1
- OAHWWXAJFXEIPX-UHFFFAOYSA-M tributyl(octadecyl)azanium;bromide Chemical compound [Br-].CCCCCCCCCCCCCCCCCC[N+](CCCC)(CCCC)CCCC OAHWWXAJFXEIPX-UHFFFAOYSA-M 0.000 description 1
- DCXPBOFGQPCWJY-UHFFFAOYSA-N trisodium;iron(3+);hexacyanide Chemical compound [Na+].[Na+].[Na+].[Fe+3].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-] DCXPBOFGQPCWJY-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03C—PHOTOSENSITIVE MATERIALS FOR PHOTOGRAPHIC PURPOSES; PHOTOGRAPHIC PROCESSES, e.g. CINE, X-RAY, COLOUR, STEREO-PHOTOGRAPHIC PROCESSES; AUXILIARY PROCESSES IN PHOTOGRAPHY
- G03C5/00—Photographic processes or agents therefor; Regeneration of such processing agents
- G03C5/26—Processes using silver-salt-containing photosensitive materials or agents therefor
- G03C5/261—Non-bath processes, e.g. using pastes, webs, viscous compositions
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03C—PHOTOSENSITIVE MATERIALS FOR PHOTOGRAPHIC PURPOSES; PHOTOGRAPHIC PROCESSES, e.g. CINE, X-RAY, COLOUR, STEREO-PHOTOGRAPHIC PROCESSES; AUXILIARY PROCESSES IN PHOTOGRAPHY
- G03C7/00—Multicolour photographic processes or agents therefor; Regeneration of such processing agents; Photosensitive materials for multicolour processes
- G03C7/30—Colour processes using colour-coupling substances; Materials therefor; Preparing or processing such materials
- G03C7/42—Bleach-fixing or agents therefor ; Desilvering processes
Landscapes
- Physics & Mathematics (AREA)
- General Physics & Mathematics (AREA)
- Silver Salt Photography Or Processing Solution Therefor (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/933,399 US4256826A (en) | 1978-08-14 | 1978-08-14 | Bleach-fix sheets |
| US933,399 | 1992-08-20 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1121643A true CA1121643A (en) | 1982-04-13 |
Family
ID=25463875
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000332380A Expired CA1121643A (en) | 1978-08-14 | 1979-07-23 | Bleach-fix sheet containing a metallic silver bleaching agent, a silver salt fixing agent and a hydrophilic binder |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US4256826A (en:Method) |
| EP (1) | EP0008144B1 (en:Method) |
| JP (1) | JPS5528098A (en:Method) |
| CA (1) | CA1121643A (en:Method) |
| DE (1) | DE2966348D1 (en:Method) |
| FR (1) | FR2433775A1 (en:Method) |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4357392A (en) * | 1980-08-04 | 1982-11-02 | Eastman Kodak Company | Coversheet for color transfer assemblages |
| FR2500179B1 (fr) * | 1981-02-13 | 1986-03-07 | Kodak Pathe | Procede de formation d'une image argentique avec stabilisation rapide et produit photographique pour la mise en oeuvre du procede |
| US4409315A (en) * | 1982-06-28 | 1983-10-11 | Eastman Kodak Company | Reducing post-process Dmin increase in positive redox dye-releasing image transfer systems using oxidants in cover sheets |
| US4480025A (en) * | 1983-01-13 | 1984-10-30 | Eastman Kodak Company | Water reservoir layers in bleach-fix sheets |
| KR870001490A (ko) * | 1985-07-18 | 1987-03-14 | 이떼 메구미 | 할로겐화은 컬러사진 감광재료의 처리방법 |
| DE3687573T2 (de) * | 1985-09-25 | 1993-06-09 | Konishiroku Photo Ind | Verfahren zur behandlung eines farbphotographischen lichtempfindlichen silberhalogenidmaterials. |
| EP0290077B1 (en) * | 1987-05-06 | 1995-07-05 | Agfa-Gevaert N.V. | A method for processing a photographic material |
| GB9827979D0 (en) * | 1998-12-19 | 1999-02-10 | Eastman Kodak Co | Method and apparatus for processing a photographic material |
Family Cites Families (21)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH115331A (de) * | 1924-05-27 | 1926-06-16 | P Westermann Albert | Verfahren zur Herstellung von Präparaten für die Photographie. |
| FR38581E (fr) * | 1930-01-03 | 1931-06-15 | Produit pour le virage-fixage des épreuves photographiques, procédé de fabrication et mode d'emploi | |
| US2059887A (en) * | 1935-02-27 | 1936-11-03 | Eastman Kodak Co | Differential treatment of multilayer films |
| US3053656A (en) * | 1954-07-01 | 1962-09-11 | Polaroid Corp | Photographic silver halide developers containing triazine rings |
| BE594237A (en:Method) * | 1959-08-24 | |||
| US3041952A (en) * | 1959-11-02 | 1962-07-03 | Specialties Inc | Combination camera and film developer |
| US3347675A (en) * | 1965-06-18 | 1967-10-17 | Eastman Kodak Co | Solid homogeneous compositions containing silver halide processing agents |
| US3414411A (en) * | 1965-12-10 | 1968-12-03 | Eastman Kodak Co | Dye bleach process |
| US3576632A (en) * | 1967-04-28 | 1971-04-27 | Elmer S Bornemisza | Multilayered photographic processing web |
| DE1772734A1 (de) * | 1968-06-27 | 1970-05-14 | Agfa Gevaert Ag | Photographisches Stabilisier- oder Fixierbad |
| US3689272A (en) * | 1971-01-25 | 1972-09-05 | Eastman Kodak Co | Photographic color processes which yield either positive or negative silver-transfer images |
| US3832179A (en) * | 1973-01-24 | 1974-08-27 | Eastman Kodak Co | Inhibition of fog in photographic color development |
| US3832181A (en) * | 1973-05-07 | 1974-08-27 | Eastman Kodak Co | Photosensitive silver halide material containing a hydrophilic colloid hardened with a combination of formaldehyde and bis(vinylsulfonyl-methyl)ether |
| JPS5057224A (en:Method) * | 1973-09-18 | 1975-05-19 | ||
| US3832199A (en) * | 1973-11-01 | 1974-08-27 | Westinghouse Electric Corp | Phosphor suspension containing hydroxyethyl cellulose |
| US3923510A (en) * | 1973-12-06 | 1975-12-02 | Eastman Kodak Co | Process for producing color images by bleaching redox diffusible dye releasers |
| US3907563A (en) * | 1973-12-13 | 1975-09-23 | Polaroid Corp | Diffusion transfer process using processing composition impregnated image-receiving element |
| US3954473A (en) * | 1974-06-24 | 1976-05-04 | Polaroid Corporation | Method of bleaching metallic silver |
| CA1057108A (en) * | 1975-08-06 | 1979-06-26 | Vernon L. Bissonette | Process of bleaching silver images to form dye images |
| GB1572658A (en) * | 1976-03-01 | 1980-07-30 | Eastman Kodak Co | Photographic silver dye-bleach process using heat |
| US4168169A (en) * | 1976-03-01 | 1979-09-18 | Eastman Kodak Company | Dry heat-activated bleaching of silver images |
-
1978
- 1978-08-14 US US05/933,399 patent/US4256826A/en not_active Expired - Lifetime
-
1979
- 1979-07-23 CA CA000332380A patent/CA1121643A/en not_active Expired
- 1979-07-30 DE DE7979200423T patent/DE2966348D1/de not_active Expired
- 1979-07-30 EP EP79200423A patent/EP0008144B1/en not_active Expired
- 1979-08-14 FR FR7920642A patent/FR2433775A1/fr active Granted
- 1979-08-14 JP JP10286079A patent/JPS5528098A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| US4256826A (en) | 1981-03-17 |
| FR2433775B1 (en:Method) | 1982-10-22 |
| DE2966348D1 (en) | 1983-12-01 |
| EP0008144A1 (en) | 1980-02-20 |
| FR2433775A1 (fr) | 1980-03-14 |
| JPS6326376B2 (en:Method) | 1988-05-30 |
| JPS5528098A (en) | 1980-02-28 |
| EP0008144B1 (en) | 1983-10-26 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US2756142A (en) | Photographic color reproduction process | |
| US3342599A (en) | Schiff base developing agent precursors | |
| US3185567A (en) | Photographic color process and product | |
| US4366236A (en) | Photographic materials | |
| CA1121643A (en) | Bleach-fix sheet containing a metallic silver bleaching agent, a silver salt fixing agent and a hydrophilic binder | |
| US4480025A (en) | Water reservoir layers in bleach-fix sheets | |
| US3087817A (en) | Process and product for forming color images from complete dyes | |
| US3993488A (en) | Photograhic film assembly comprising light intercepting elements located behind pressure plate | |
| GB519790A (en) | Colour photographic process | |
| CA2212621A1 (en) | Multicolor diffusion transfer photographic film elements | |
| US4269923A (en) | Photographic imaging process and materials suitable therefor | |
| US4036643A (en) | Diffusion transfer color process using lactone or sultone ring containing lipophilic non-diffusing color formers which yield diffusing dyes | |
| US2713305A (en) | Photographic dye transfer process | |
| CA1135107A (en) | Dye image reversal processes and image transfer film units using a competing substance which is preferentially cross oxidized by oxidized eta | |
| US4047952A (en) | Imagewise soluble silver salt intensification of diffusion transfer silver images | |
| US2940849A (en) | Planographic dye transfer process | |
| US3998637A (en) | Process for producing positive color diffusion transfer images using redox dye releasers | |
| GB878149A (en) | Improvements in the preparation of photographic dye images | |
| US3436219A (en) | Color photographic material | |
| JP3122140B2 (ja) | 写真処理方法及び写真処理材料 | |
| JPS5937498B2 (ja) | 写真画像を得る方法 | |
| CA1039995A (en) | Process for producing positive color diffusion transfer images | |
| GB2082340A (en) | Production of Photographic Masked Colour Images | |
| US4420557A (en) | Color photographic recording material containing a non-diffusible electron donor precursor compound | |
| US3900322A (en) | Diffusion transfer color photographic material having developement inhibitor precursor |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |