CA1117141A - Process for the manufacture of oxygen-containing carbon compounds from synthesis gas - Google Patents
Process for the manufacture of oxygen-containing carbon compounds from synthesis gasInfo
- Publication number
- CA1117141A CA1117141A CA000324836A CA324836A CA1117141A CA 1117141 A CA1117141 A CA 1117141A CA 000324836 A CA000324836 A CA 000324836A CA 324836 A CA324836 A CA 324836A CA 1117141 A CA1117141 A CA 1117141A
- Authority
- CA
- Canada
- Prior art keywords
- magnesium
- hydrogen
- catalyst
- reaction
- compounds
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title claims description 23
- 230000008569 process Effects 0.000 title claims description 19
- 239000007789 gas Substances 0.000 title description 71
- 229910052760 oxygen Inorganic materials 0.000 title description 31
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 title description 30
- 239000001301 oxygen Substances 0.000 title description 30
- 230000015572 biosynthetic process Effects 0.000 title description 21
- 238000003786 synthesis reaction Methods 0.000 title description 19
- 238000004519 manufacturing process Methods 0.000 title description 4
- 150000001722 carbon compounds Chemical class 0.000 title 1
- 239000003054 catalyst Substances 0.000 claims abstract description 75
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims abstract description 57
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 claims abstract description 49
- 239000010948 rhodium Substances 0.000 claims abstract description 42
- 239000011777 magnesium Substances 0.000 claims abstract description 36
- IKHGUXGNUITLKF-UHFFFAOYSA-N Acetaldehyde Chemical compound CC=O IKHGUXGNUITLKF-UHFFFAOYSA-N 0.000 claims abstract description 32
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 claims abstract description 29
- 229910052749 magnesium Inorganic materials 0.000 claims abstract description 29
- 150000001875 compounds Chemical class 0.000 claims abstract description 24
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 24
- 239000001257 hydrogen Substances 0.000 claims abstract description 24
- UGFAIRIUMAVXCW-UHFFFAOYSA-N Carbon monoxide Chemical compound [O+]#[C-] UGFAIRIUMAVXCW-UHFFFAOYSA-N 0.000 claims abstract description 23
- 229910002091 carbon monoxide Inorganic materials 0.000 claims abstract description 22
- 229910052703 rhodium Inorganic materials 0.000 claims abstract description 20
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 claims abstract description 20
- -1 halide ions Chemical class 0.000 claims abstract description 19
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims abstract description 13
- 159000000003 magnesium salts Chemical class 0.000 claims abstract description 10
- 230000000737 periodic effect Effects 0.000 claims abstract description 8
- 238000006243 chemical reaction Methods 0.000 claims description 52
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 32
- 235000001055 magnesium Nutrition 0.000 claims description 27
- 229940091250 magnesium supplement Drugs 0.000 claims description 27
- 150000002681 magnesium compounds Chemical class 0.000 claims description 19
- TWRXJAOTZQYOKJ-UHFFFAOYSA-L Magnesium chloride Chemical compound [Mg+2].[Cl-].[Cl-] TWRXJAOTZQYOKJ-UHFFFAOYSA-L 0.000 claims description 18
- 229910052757 nitrogen Inorganic materials 0.000 claims description 16
- 235000012239 silicon dioxide Nutrition 0.000 claims description 15
- 229910000039 hydrogen halide Inorganic materials 0.000 claims description 14
- 239000012433 hydrogen halide Substances 0.000 claims description 14
- 150000002896 organic halogen compounds Chemical class 0.000 claims description 10
- 229910001629 magnesium chloride Inorganic materials 0.000 claims description 9
- 150000002431 hydrogen Chemical class 0.000 claims description 7
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical group Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 6
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 claims description 4
- 239000012346 acetyl chloride Substances 0.000 claims description 4
- UEGPKNKPLBYCNK-UHFFFAOYSA-L magnesium acetate Chemical group [Mg+2].CC([O-])=O.CC([O-])=O UEGPKNKPLBYCNK-UHFFFAOYSA-L 0.000 claims description 4
- 239000011654 magnesium acetate Substances 0.000 claims description 4
- 235000011285 magnesium acetate Nutrition 0.000 claims description 4
- 229940069446 magnesium acetate Drugs 0.000 claims description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 claims description 3
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 3
- 229910000041 hydrogen chloride Inorganic materials 0.000 claims description 3
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 claims description 3
- 238000002360 preparation method Methods 0.000 claims description 3
- 239000011593 sulfur Substances 0.000 claims description 3
- 229910052717 sulfur Inorganic materials 0.000 claims description 3
- HCWCAKKEBCNQJP-UHFFFAOYSA-N magnesium orthosilicate Chemical group [Mg+2].[Mg+2].[O-][Si]([O-])([O-])[O-] HCWCAKKEBCNQJP-UHFFFAOYSA-N 0.000 claims description 2
- 239000000391 magnesium silicate Substances 0.000 claims description 2
- 229910052919 magnesium silicate Inorganic materials 0.000 claims description 2
- 235000019792 magnesium silicate Nutrition 0.000 claims description 2
- 229940053326 magnesium salt Drugs 0.000 claims 2
- BPQQTUXANYXVAA-UHFFFAOYSA-N Orthosilicate Chemical compound [O-][Si]([O-])([O-])[O-] BPQQTUXANYXVAA-UHFFFAOYSA-N 0.000 claims 1
- 125000005624 silicic acid group Chemical group 0.000 claims 1
- 238000006555 catalytic reaction Methods 0.000 abstract 1
- 229910001868 water Inorganic materials 0.000 description 39
- 239000000203 mixture Substances 0.000 description 33
- 239000000047 product Substances 0.000 description 31
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 26
- 239000000243 solution Substances 0.000 description 25
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 18
- 229940105305 carbon monoxide Drugs 0.000 description 18
- 229960004756 ethanol Drugs 0.000 description 17
- 235000019441 ethanol Nutrition 0.000 description 17
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 15
- 229960005419 nitrogen Drugs 0.000 description 15
- 229960000583 acetic acid Drugs 0.000 description 14
- 235000011054 acetic acid Nutrition 0.000 description 14
- 150000004820 halides Chemical class 0.000 description 12
- RMAQACBXLXPBSY-UHFFFAOYSA-N silicic acid Chemical compound O[Si](O)(O)O RMAQACBXLXPBSY-UHFFFAOYSA-N 0.000 description 11
- 229960004029 silicic acid Drugs 0.000 description 11
- 238000012360 testing method Methods 0.000 description 11
- 230000009467 reduction Effects 0.000 description 10
- DHKHKXVYLBGOIT-UHFFFAOYSA-N 1,1-Diethoxyethane Chemical compound CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 description 8
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 8
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 8
- 229910052799 carbon Inorganic materials 0.000 description 8
- 239000000969 carrier Substances 0.000 description 8
- 235000011147 magnesium chloride Nutrition 0.000 description 8
- 230000000694 effects Effects 0.000 description 7
- 239000000376 reactant Substances 0.000 description 7
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 6
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 6
- 229910002092 carbon dioxide Inorganic materials 0.000 description 6
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 6
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 5
- PWHULOQIROXLJO-UHFFFAOYSA-N Manganese Chemical compound [Mn] PWHULOQIROXLJO-UHFFFAOYSA-N 0.000 description 5
- 239000002253 acid Substances 0.000 description 5
- 125000004432 carbon atom Chemical group C* 0.000 description 5
- 230000000052 comparative effect Effects 0.000 description 5
- 238000001816 cooling Methods 0.000 description 5
- 229960002337 magnesium chloride Drugs 0.000 description 5
- 229910052748 manganese Inorganic materials 0.000 description 5
- 239000011572 manganese Substances 0.000 description 5
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 4
- 229910021604 Rhodium(III) chloride Inorganic materials 0.000 description 4
- SPEUIVXLLWOEMJ-UHFFFAOYSA-N acetaldehyde dimethyl acetal Natural products COC(C)OC SPEUIVXLLWOEMJ-UHFFFAOYSA-N 0.000 description 4
- 239000006227 byproduct Substances 0.000 description 4
- 239000007795 chemical reaction product Substances 0.000 description 4
- 238000011010 flushing procedure Methods 0.000 description 4
- 239000011521 glass Substances 0.000 description 4
- 229910052736 halogen Inorganic materials 0.000 description 4
- 150000002367 halogens Chemical class 0.000 description 4
- 150000002500 ions Chemical class 0.000 description 4
- 229910052751 metal Inorganic materials 0.000 description 4
- 239000002184 metal Substances 0.000 description 4
- 239000011148 porous material Substances 0.000 description 4
- SONJTKJMTWTJCT-UHFFFAOYSA-K rhodium(iii) chloride Chemical compound [Cl-].[Cl-].[Cl-].[Rh+3] SONJTKJMTWTJCT-UHFFFAOYSA-K 0.000 description 4
- 150000003839 salts Chemical class 0.000 description 4
- 239000007787 solid Substances 0.000 description 4
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- 239000001569 carbon dioxide Substances 0.000 description 3
- 229910052681 coesite Inorganic materials 0.000 description 3
- 239000000306 component Substances 0.000 description 3
- 229910052906 cristobalite Inorganic materials 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- 229930195733 hydrocarbon Natural products 0.000 description 3
- 150000002430 hydrocarbons Chemical class 0.000 description 3
- 229910052742 iron Inorganic materials 0.000 description 3
- 230000002035 prolonged effect Effects 0.000 description 3
- 238000000926 separation method Methods 0.000 description 3
- 239000000377 silicon dioxide Substances 0.000 description 3
- 229910052682 stishovite Inorganic materials 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- 229910052905 tridymite Inorganic materials 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 2
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 2
- 229910000831 Steel Inorganic materials 0.000 description 2
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 2
- 230000009471 action Effects 0.000 description 2
- 229910052782 aluminium Inorganic materials 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 125000003118 aryl group Chemical group 0.000 description 2
- 230000008901 benefit Effects 0.000 description 2
- 239000012267 brine Substances 0.000 description 2
- 239000012876 carrier material Substances 0.000 description 2
- 239000003610 charcoal Substances 0.000 description 2
- 239000003638 chemical reducing agent Substances 0.000 description 2
- 230000000875 corresponding effect Effects 0.000 description 2
- 238000005260 corrosion Methods 0.000 description 2
- 230000007797 corrosion Effects 0.000 description 2
- 230000007423 decrease Effects 0.000 description 2
- 239000012153 distilled water Substances 0.000 description 2
- GNTDGMZSJNCJKK-UHFFFAOYSA-N divanadium pentaoxide Chemical compound O=[V](=O)O[V](=O)=O GNTDGMZSJNCJKK-UHFFFAOYSA-N 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 239000007792 gaseous phase Substances 0.000 description 2
- 238000012812 general test Methods 0.000 description 2
- 150000002366 halogen compounds Chemical class 0.000 description 2
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 150000002894 organic compounds Chemical class 0.000 description 2
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 2
- RVTZCBVAJQQJTK-UHFFFAOYSA-N oxygen(2-);zirconium(4+) Chemical compound [O-2].[O-2].[Zr+4] RVTZCBVAJQQJTK-UHFFFAOYSA-N 0.000 description 2
- 230000001105 regulatory effect Effects 0.000 description 2
- 150000003284 rhodium compounds Chemical class 0.000 description 2
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 2
- 239000010959 steel Substances 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- 239000002912 waste gas Substances 0.000 description 2
- XBOTUWGQYMHUFO-IHWYPQMZSA-N (z)-3-chlorobut-2-enoic acid Chemical compound C\C(Cl)=C\C(O)=O XBOTUWGQYMHUFO-IHWYPQMZSA-N 0.000 description 1
- POILWHVDKZOXJZ-ARJAWSKDSA-M (z)-4-oxopent-2-en-2-olate Chemical compound C\C([O-])=C\C(C)=O POILWHVDKZOXJZ-ARJAWSKDSA-M 0.000 description 1
- FXKCXGBBUBCRPU-GBOPCIDUSA-N 2-[(2r,4ar,8s,8ar)-8-hydroxy-4a,8-dimethyl-1,2,3,4,5,6,7,8a-octahydronaphthalen-2-yl]prop-2-enoic acid Chemical compound C1C[C@@H](C(=C)C(O)=O)C[C@H]2[C@@](C)(O)CCC[C@@]21C FXKCXGBBUBCRPU-GBOPCIDUSA-N 0.000 description 1
- XRHGYUZYPHTUJZ-UHFFFAOYSA-N 4-chlorobenzoic acid Chemical compound OC(=O)C1=CC=C(Cl)C=C1 XRHGYUZYPHTUJZ-UHFFFAOYSA-N 0.000 description 1
- OSDWBNJEKMUWAV-UHFFFAOYSA-N Allyl chloride Chemical compound ClCC=C OSDWBNJEKMUWAV-UHFFFAOYSA-N 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- BDAGIHXWWSANSR-UHFFFAOYSA-M Formate Chemical compound [O-]C=O BDAGIHXWWSANSR-UHFFFAOYSA-M 0.000 description 1
- QNVBIDULDLPCDQ-UHFFFAOYSA-N Ilicic acid Natural products CC1(O)CCC2(C)CCC(CC2C1)C(=C)C(=O)O QNVBIDULDLPCDQ-UHFFFAOYSA-N 0.000 description 1
- 229910021025 KMgCl3 Inorganic materials 0.000 description 1
- 229910002651 NO3 Inorganic materials 0.000 description 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 1
- 206010037211 Psychomotor hyperactivity Diseases 0.000 description 1
- 208000036366 Sensation of pressure Diseases 0.000 description 1
- 241000212342 Sium Species 0.000 description 1
- 229910010066 TiC14 Inorganic materials 0.000 description 1
- QCWXUUIWCKQGHC-UHFFFAOYSA-N Zirconium Chemical compound [Zr] QCWXUUIWCKQGHC-UHFFFAOYSA-N 0.000 description 1
- MCMNRKCIXSYSNV-UHFFFAOYSA-N ZrO2 Inorganic materials O=[Zr]=O MCMNRKCIXSYSNV-UHFFFAOYSA-N 0.000 description 1
- IKHGUXGNUITLKF-XPULMUKRSA-N acetaldehyde Chemical compound [14CH]([14CH3])=O IKHGUXGNUITLKF-XPULMUKRSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 230000004075 alteration Effects 0.000 description 1
- 150000004645 aluminates Chemical class 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 229910052786 argon Inorganic materials 0.000 description 1
- KCXMKQUNVWSEMD-UHFFFAOYSA-N benzyl chloride Chemical compound ClCC1=CC=CC=C1 KCXMKQUNVWSEMD-UHFFFAOYSA-N 0.000 description 1
- 229940073608 benzyl chloride Drugs 0.000 description 1
- 150000001649 bromium compounds Chemical class 0.000 description 1
- 244000309464 bull Species 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 150000007942 carboxylates Chemical class 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- 229910052729 chemical element Inorganic materials 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- FOCAUTSVDIKZOP-UHFFFAOYSA-N chloroacetic acid Chemical compound OC(=O)CCl FOCAUTSVDIKZOP-UHFFFAOYSA-N 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 150000003977 halocarboxylic acids Chemical class 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 150000003944 halohydrins Chemical class 0.000 description 1
- 125000005283 haloketone group Chemical group 0.000 description 1
- 230000017525 heat dissipation Effects 0.000 description 1
- 229910000042 hydrogen bromide Inorganic materials 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N hydrogen bromide Substances Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- 229910000043 hydrogen iodide Inorganic materials 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 239000011261 inert gas Substances 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-M iodide Chemical compound [I-] XMBWDFGMSWQBCA-UHFFFAOYSA-M 0.000 description 1
- 150000004694 iodide salts Chemical class 0.000 description 1
- HVTICUPFWKNHNG-UHFFFAOYSA-N iodoethane Chemical compound CCI HVTICUPFWKNHNG-UHFFFAOYSA-N 0.000 description 1
- 159000000014 iron salts Chemical class 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- MGIUUAHJVPPFEV-ABXDCCGRSA-N magainin ii Chemical compound C([C@H](NC(=O)[C@H](CCCCN)NC(=O)CNC(=O)[C@@H](NC(=O)CN)[C@@H](C)CC)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC=1NC=NC=1)C(=O)N[C@@H](CO)C(=O)N[C@@H](C)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC=1C=CC=CC=1)C(=O)NCC(=O)N[C@@H](CCCCN)C(=O)N[C@@H](C)C(=O)N[C@@H](CC=1C=CC=CC=1)C(=O)N[C@@H](C(C)C)C(=O)NCC(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CCSC)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CO)C(O)=O)C1=CC=CC=C1 MGIUUAHJVPPFEV-ABXDCCGRSA-N 0.000 description 1
- OTCKOJUMXQWKQG-UHFFFAOYSA-L magnesium bromide Chemical compound [Mg+2].[Br-].[Br-] OTCKOJUMXQWKQG-UHFFFAOYSA-L 0.000 description 1
- 229910001623 magnesium bromide Inorganic materials 0.000 description 1
- YIXJRHPUWRPCBB-UHFFFAOYSA-N magnesium nitrate Inorganic materials [Mg+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O YIXJRHPUWRPCBB-UHFFFAOYSA-N 0.000 description 1
- AKTIAGQCYPCKFX-FDGPNNRMSA-L magnesium;(z)-4-oxopent-2-en-2-olate Chemical compound [Mg+2].C\C([O-])=C\C(C)=O.C\C([O-])=C\C(C)=O AKTIAGQCYPCKFX-FDGPNNRMSA-L 0.000 description 1
- JNZGLUUWTFPBKG-UHFFFAOYSA-K magnesium;potassium;trichloride Chemical compound [Mg+2].[Cl-].[Cl-].[Cl-].[K+] JNZGLUUWTFPBKG-UHFFFAOYSA-K 0.000 description 1
- 230000007246 mechanism Effects 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 239000002808 molecular sieve Substances 0.000 description 1
- 229910052605 nesosilicate Inorganic materials 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 229910052756 noble gas Inorganic materials 0.000 description 1
- 150000002835 noble gases Chemical class 0.000 description 1
- 239000013110 organic ligand Substances 0.000 description 1
- 150000004762 orthosilicates Chemical class 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- 230000001698 pyrogenic effect Effects 0.000 description 1
- 230000036647 reaction Effects 0.000 description 1
- 239000012495 reaction gas Substances 0.000 description 1
- 238000004064 recycling Methods 0.000 description 1
- LMHHRCOWPQNFTF-UHFFFAOYSA-N s-propan-2-yl azepane-1-carbothioate Chemical compound CC(C)SC(=O)N1CCCCCC1 LMHHRCOWPQNFTF-UHFFFAOYSA-N 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- 238000005245 sintering Methods 0.000 description 1
- URGAHOPLAPQHLN-UHFFFAOYSA-N sodium aluminosilicate Chemical compound [Na+].[Al+3].[O-][Si]([O-])=O.[O-][Si]([O-])=O URGAHOPLAPQHLN-UHFFFAOYSA-N 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 229910052566 spinel group Inorganic materials 0.000 description 1
- NBRKLOOSMBRFMH-UHFFFAOYSA-N tert-butyl chloride Chemical compound CC(C)(C)Cl NBRKLOOSMBRFMH-UHFFFAOYSA-N 0.000 description 1
- ZCUFMDLYAMJYST-UHFFFAOYSA-N thorium dioxide Chemical compound O=[Th]=O ZCUFMDLYAMJYST-UHFFFAOYSA-N 0.000 description 1
- 229910003452 thorium oxide Inorganic materials 0.000 description 1
- 239000004408 titanium dioxide Substances 0.000 description 1
- YNJBWRMUSHSURL-UHFFFAOYSA-N trichloroacetic acid Chemical compound OC(=O)C(Cl)(Cl)Cl YNJBWRMUSHSURL-UHFFFAOYSA-N 0.000 description 1
- PVFOMCVHYWHZJE-UHFFFAOYSA-N trichloroacetyl chloride Chemical compound ClC(=O)C(Cl)(Cl)Cl PVFOMCVHYWHZJE-UHFFFAOYSA-N 0.000 description 1
- 239000010457 zeolite Substances 0.000 description 1
- 229910052726 zirconium Inorganic materials 0.000 description 1
- 229910001928 zirconium oxide Inorganic materials 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/49—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reaction with carbon monoxide
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C29/00—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom not belonging to a six-membered aromatic ring
- C07C29/15—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom not belonging to a six-membered aromatic ring by reduction of oxides of carbon exclusively
- C07C29/151—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom not belonging to a six-membered aromatic ring by reduction of oxides of carbon exclusively with hydrogen or hydrogen-containing gases
- C07C29/153—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom not belonging to a six-membered aromatic ring by reduction of oxides of carbon exclusively with hydrogen or hydrogen-containing gases characterised by the catalyst used
- C07C29/156—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom not belonging to a six-membered aromatic ring by reduction of oxides of carbon exclusively with hydrogen or hydrogen-containing gases characterised by the catalyst used containing iron group metals, platinum group metals or compounds thereof
- C07C29/157—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom not belonging to a six-membered aromatic ring by reduction of oxides of carbon exclusively with hydrogen or hydrogen-containing gases characterised by the catalyst used containing iron group metals, platinum group metals or compounds thereof containing platinum group metals or compounds thereof
- C07C29/158—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom not belonging to a six-membered aromatic ring by reduction of oxides of carbon exclusively with hydrogen or hydrogen-containing gases characterised by the catalyst used containing iron group metals, platinum group metals or compounds thereof containing platinum group metals or compounds thereof containing rhodium or compounds thereof
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C51/00—Preparation of carboxylic acids or their salts, halides or anhydrides
- C07C51/10—Preparation of carboxylic acids or their salts, halides or anhydrides by reaction with carbon monoxide
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Engineering & Computer Science (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Catalysts (AREA)
Applications Claiming Priority (6)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19782814427 DE2814427A1 (de) | 1978-04-04 | 1978-04-04 | Verfahren zur herstellung sauerstoffhaltiger kohlenstoffverbindungen aus synthesegas |
| DEP2814427.6 | 1978-04-04 | ||
| DEP2825598.3 | 1978-06-10 | ||
| DE19782825598 DE2825598A1 (de) | 1978-06-10 | 1978-06-10 | Verfahren zur herstellung sauerstoffhaltiger kohlenstoffverbindungen aus synthesegas |
| DEP2850201.4 | 1978-11-18 | ||
| DE19782850201 DE2850201A1 (de) | 1978-11-18 | 1978-11-18 | Verfahren zur herstellung sauerstoffhaltiger kohlenstoffverbindungen aus synthesegas |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1117141A true CA1117141A (en) | 1982-01-26 |
Family
ID=27187511
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000324836A Expired CA1117141A (en) | 1978-04-04 | 1979-04-03 | Process for the manufacture of oxygen-containing carbon compounds from synthesis gas |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US4224236A (Direct) |
| EP (1) | EP0004656B1 (Direct) |
| JP (1) | JPS54138504A (Direct) |
| AU (1) | AU525478B2 (Direct) |
| CA (1) | CA1117141A (Direct) |
| DD (1) | DD142707A5 (Direct) |
| DE (1) | DE2960923D1 (Direct) |
| PL (1) | PL121837B1 (Direct) |
| SU (1) | SU1042609A3 (Direct) |
Families Citing this family (23)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2846148A1 (de) * | 1978-10-24 | 1980-05-08 | Hoechst Ag | Verfahren zur herstellung von ethanol aus synthesegas |
| ZA802237B (en) * | 1979-04-24 | 1981-11-25 | British Petroleum Co | Process for the production of c1 to c4 oxygenated hydrocarbons |
| DE2924962A1 (de) * | 1979-06-21 | 1981-01-29 | Hoechst Ag | Verfahren zur herstellung von sauerstoffhaltigen kohlenstoffverbindungen und olefinen aus synthesegas |
| US4235798A (en) * | 1979-06-28 | 1980-11-25 | Union Carbide Corporation | Process for producing two-carbon atom oxygenated compounds from synthesis gas with minimal production of methane |
| US4446251A (en) * | 1980-02-15 | 1984-05-01 | Union Carbide Corporation | Process for producing two-carbon atom oxygenated compounds from synthesis gas with minimal production of methane |
| US4471075A (en) * | 1979-06-28 | 1984-09-11 | Union Carbide Corporation | Process for producing two-carbon atom oxygenated compounds from synthesis gas with minimal production of methane |
| PT71476A (en) * | 1979-07-03 | 1980-08-01 | Sagami Chem Res | Process for producing oxygen-containing hydrocarbon compounds |
| US4506033A (en) * | 1979-07-03 | 1985-03-19 | Sagami Chemical Research Center | Process for producing oxygen-containing hydrocarbon compounds |
| NZ195461A (en) * | 1979-11-27 | 1983-06-14 | British Petroleum Co | Producing oxygenated hydrocarbon product containing ethanol |
| US4463105A (en) * | 1980-04-21 | 1984-07-31 | Sagami Chemical Research Center | Process for producing oxygen-containing hydrocarbon compounds |
| DE3038448A1 (de) * | 1980-10-11 | 1982-06-03 | Hoechst Ag, 6000 Frankfurt | Verfahren zur herstellung von essigsaeure, acetaldehyd und ethanol aus synthesegas |
| US4482647A (en) * | 1981-12-03 | 1984-11-13 | National Distillers And Chemical Corporation | Manufacture of oxygenated compounds |
| US4478955A (en) * | 1981-12-21 | 1984-10-23 | The Standard Oil Company | Upgrading synthesis gas |
| DE3203060A1 (de) * | 1982-01-30 | 1983-08-04 | Hoechst Ag, 6230 Frankfurt | Verfahren zur herstellung von essigsaeure, acetaldehyd und ethanol |
| DE3361904D1 (en) * | 1982-05-11 | 1986-03-06 | Ici Plc | Process for the production of unsaturated mono or saturated dialdehydes and acetals thereof |
| WO2005056366A1 (en) * | 2003-12-08 | 2005-06-23 | Delphi Technologies, Inc. | Tilt control lever assembly for steering column |
| US7475614B2 (en) * | 2005-01-18 | 2009-01-13 | Delphi Technologies, Inc. | Tiltable steering column |
| AU2006248728B2 (en) * | 2005-05-20 | 2011-12-01 | Bp Chemicals Limited | Process for the conversion of synthesis gas to oxygenates |
| GB0510356D0 (en) | 2005-05-20 | 2005-06-29 | Bp Chem Int Ltd | Process for the conversion of synthesis gas to oxygenate |
| EP1881949A1 (en) * | 2005-05-20 | 2008-01-30 | BP Chemicals Limited | Process for the conversion of synthesis gas to oxygenates |
| RU2483104C2 (ru) * | 2010-11-09 | 2013-05-27 | Ламберов Александр Адольфович | Способ производства натурального биохимического уксуса |
| ES2546118B1 (es) | 2013-01-24 | 2016-08-09 | Abengoa Bioenergía Nuevas Tecnologías, S.A | Catalizador de rodio promovido para la conversión selectiva de gas de síntesis en etanol |
| CN108410513B (zh) * | 2018-03-23 | 2024-01-16 | 广东国能中林实业有限公司 | 一种生物质分级气化工艺及系统 |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3957857A (en) * | 1973-06-19 | 1976-05-18 | Union Carbide Corporation | Catalytic process for polyhydric alcohols and derivatives |
| US3940432A (en) * | 1973-06-19 | 1976-02-24 | Union Carbide Corporation | Process for making ethylene glycol |
| JPS5441568B2 (Direct) * | 1974-01-28 | 1979-12-08 | ||
| US3968136A (en) * | 1974-07-12 | 1976-07-06 | Union Carbide Corporation | Catalytic process for polyhydric alcohols and derivatives |
| US4014913A (en) * | 1975-06-26 | 1977-03-29 | Union Carbide Corporation | Process for producing oxygenated two carbon compounds |
| AU514985B2 (en) * | 1975-06-26 | 1981-03-12 | Union Carbide Corporation | Making oxygenated carbon compounds |
| US4096164A (en) * | 1976-08-30 | 1978-06-20 | Union Carbide Corporation | Process for producing ethanol, acetic acid and/or acetaldehyde, from synthesis gas |
| US4101450A (en) * | 1977-05-09 | 1978-07-18 | Celanese Corporation | Catalyst for production of acetic acid |
-
1979
- 1979-03-29 US US06/025,032 patent/US4224236A/en not_active Expired - Lifetime
- 1979-03-31 EP EP79100995A patent/EP0004656B1/de not_active Expired
- 1979-03-31 DE DE7979100995T patent/DE2960923D1/de not_active Expired
- 1979-04-02 DD DD79211951A patent/DD142707A5/de unknown
- 1979-04-03 CA CA000324836A patent/CA1117141A/en not_active Expired
- 1979-04-03 PL PL1979214643A patent/PL121837B1/pl unknown
- 1979-04-03 JP JP3937679A patent/JPS54138504A/ja active Pending
- 1979-04-03 SU SU792746997A patent/SU1042609A3/ru active
- 1979-04-12 AU AU46055/79A patent/AU525478B2/en not_active Ceased
Also Published As
| Publication number | Publication date |
|---|---|
| DD142707A5 (de) | 1980-07-09 |
| SU1042609A3 (ru) | 1983-09-15 |
| PL121837B1 (en) | 1982-05-31 |
| PL214643A1 (Direct) | 1980-01-02 |
| AU4605579A (en) | 1979-10-11 |
| EP0004656A1 (de) | 1979-10-17 |
| JPS54138504A (en) | 1979-10-27 |
| US4224236A (en) | 1980-09-23 |
| AU525478B2 (en) | 1982-11-11 |
| DE2960923D1 (en) | 1981-12-17 |
| EP0004656B1 (de) | 1981-10-07 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1117141A (en) | Process for the manufacture of oxygen-containing carbon compounds from synthesis gas | |
| EP1059278B1 (en) | Process for producing epichlorohydrin and intermediate thereof | |
| US4086188A (en) | Catalyst for aldol condensations | |
| US3536763A (en) | Hydration of acrolein to hydracrylaldehyde | |
| US3901947A (en) | Production of 2,6-xylenol | |
| EP0204046B1 (en) | Process and catalyst for the conversion of cyclohexanol to cyclohexanone | |
| US4467124A (en) | Preparation of 1,1,1,3,3,3-hexafluoropropane-2-ol by vapor phase catalytic reaction of hexafluoroacetone hydrate with hydrogen | |
| EP0037149B1 (en) | Method for the preparation of aldehydes | |
| TWI222438B (en) | Ester synthesis | |
| US2985668A (en) | Preparation of olefin oxides | |
| KR870000057B1 (ko) | 옥살산 디에스테르의 제법 | |
| US4288558A (en) | Process for the manufacture of oxygen-containing carbon compounds from synthesis gas | |
| US3629354A (en) | Halogenated hydrocarbons | |
| US4912270A (en) | Chromia aerogel, method of producing same and fluorination process utilizing same | |
| US4482753A (en) | Catalyst for use in the hydrogenolysis of methyl glycol formals | |
| US4433174A (en) | Process for preparation of alpha, beta-unsaturated aldehydes using AMS-1B borosilicate crystalline molecular sieve | |
| US6184420B1 (en) | Preparation of unsaturated ketones | |
| EP0636599B1 (en) | Process for the production of acetic acid | |
| US4668819A (en) | Process for the manufacture of unsaturated esters of carboxylic acids | |
| CA1269401A (en) | Process of producing a mixture of methanol and higher alcohols | |
| US4482758A (en) | Process for the orthomethylation of phenolic compounds | |
| WO2010119448A1 (en) | An 'in-situ' prepared, improved catalyst for low pressure continuous butynediol synthesis | |
| KR100908419B1 (ko) | 에틸렌의 1,2-디클로로에탄으로의 옥시염소화용 촉매 | |
| US4301308A (en) | Process for the preparation of o-cresol and 2,6-xylenol | |
| EP0421677A1 (en) | Process for the preparation of glycol ethers |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |