CA1116001A - Misfocus prevention means for cameras having unidirectional automatic focusing - Google Patents
Misfocus prevention means for cameras having unidirectional automatic focusingInfo
- Publication number
- CA1116001A CA1116001A CA318,866A CA318866A CA1116001A CA 1116001 A CA1116001 A CA 1116001A CA 318866 A CA318866 A CA 318866A CA 1116001 A CA1116001 A CA 1116001A
- Authority
- CA
- Canada
- Prior art keywords
- lens
- switch
- region
- camera
- state
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 230000002265 prevention Effects 0.000 title 1
- 230000033001 locomotion Effects 0.000 claims description 49
- 238000006073 displacement reaction Methods 0.000 claims description 14
- 238000009877 rendering Methods 0.000 claims description 6
- 230000004044 response Effects 0.000 claims description 5
- 230000000694 effects Effects 0.000 claims description 4
- 230000006872 improvement Effects 0.000 claims description 3
- 230000008878 coupling Effects 0.000 claims 4
- 238000010168 coupling process Methods 0.000 claims 4
- 238000005859 coupling reaction Methods 0.000 claims 4
- 230000002596 correlated effect Effects 0.000 claims 2
- 230000000875 corresponding effect Effects 0.000 claims 1
- 230000007246 mechanism Effects 0.000 description 8
- 238000010586 diagram Methods 0.000 description 4
- 244000187656 Eucalyptus cornuta Species 0.000 description 3
- 230000001419 dependent effect Effects 0.000 description 3
- 230000004888 barrier function Effects 0.000 description 2
- 230000002457 bidirectional effect Effects 0.000 description 2
- NLZUEZXRPGMBCV-UHFFFAOYSA-N Butylhydroxytoluene Chemical compound CC1=CC(C(C)(C)C)=C(O)C(C(C)(C)C)=C1 NLZUEZXRPGMBCV-UHFFFAOYSA-N 0.000 description 1
- 208000003251 Pruritus Diseases 0.000 description 1
- 230000003213 activating effect Effects 0.000 description 1
- 230000000977 initiatory effect Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 230000002311 subsequent effect Effects 0.000 description 1
Classifications
-
- G—PHYSICS
- G02—OPTICS
- G02B—OPTICAL ELEMENTS, SYSTEMS OR APPARATUS
- G02B7/00—Mountings, adjusting means, or light-tight connections, for optical elements
- G02B7/28—Systems for automatic generation of focusing signals
- G02B7/40—Systems for automatic generation of focusing signals using time delay of the reflected waves, e.g. of ultrasonic waves
Landscapes
- Physics & Mathematics (AREA)
- General Physics & Mathematics (AREA)
- Optics & Photonics (AREA)
- Focusing (AREA)
- Lens Barrels (AREA)
- Cameras In General (AREA)
- Automatic Focus Adjustment (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US865,854 | 1977-12-30 | ||
| US05/865,854 US4149792A (en) | 1977-12-30 | 1977-12-30 | Misfocus prevention means for cameras having unidirectional automatic focusing |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1116001A true CA1116001A (en) | 1982-01-12 |
Family
ID=25346390
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA318,866A Expired CA1116001A (en) | 1977-12-30 | 1978-12-29 | Misfocus prevention means for cameras having unidirectional automatic focusing |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US4149792A (enFirst) |
| JP (1) | JPS54100720A (enFirst) |
| AT (1) | AT373086B (enFirst) |
| AU (1) | AU526585B2 (enFirst) |
| CA (1) | CA1116001A (enFirst) |
| CH (1) | CH636974A5 (enFirst) |
| DE (1) | DE2856803A1 (enFirst) |
| FR (1) | FR2413679A1 (enFirst) |
| GB (1) | GB2012061B (enFirst) |
| IE (1) | IE47625B1 (enFirst) |
Families Citing this family (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3019671A1 (de) * | 1974-05-17 | 1980-12-04 | Canon Kk | Kamera mit halbautomatischer scharfeinstellvorrichtung |
| US4188103A (en) * | 1978-04-21 | 1980-02-12 | Polaroid Corporation | Range synchronized flash photographic apparatus and method for achieving optimum flash exposure |
| US4272174A (en) * | 1978-11-25 | 1981-06-09 | Minolta Camera Kabushiki Kaisha | Automatic and manual focus control lens barrel structure |
| FR2477292A1 (fr) * | 1980-03-03 | 1981-09-04 | Polaroid Corp | Systeme de mise au point pour appareil de prise de vues photographiques |
| JPS644084Y2 (enFirst) * | 1980-09-11 | 1989-02-02 | ||
| US4291965A (en) * | 1980-10-06 | 1981-09-29 | Polaroid Corporation | Apparatus for automatically selecting a preselected focal position for a lens system |
| US4420714A (en) * | 1981-10-02 | 1983-12-13 | Polaroid Corporation | Apparatus for continuously incrementing an output member |
| JPS59125718A (ja) * | 1983-01-06 | 1984-07-20 | Canon Inc | 複写装置 |
| CA1267026A (en) * | 1985-10-08 | 1990-03-27 | Wai C. Wong | Automatic focusing mechanism for camera |
| DE3745162B4 (de) * | 1986-03-03 | 2006-06-14 | Canon K.K. | Einrichtung für eine Kamera und Kamera |
| US5752096A (en) * | 1991-02-14 | 1998-05-12 | Canon Kabushiki Kaisha | Camera featuring a single drive source and a plurality of selectable drive transmission mechanisms |
| JP3324565B2 (ja) * | 1999-05-27 | 2002-09-17 | ミノルタ株式会社 | レンズ駆動装置 |
| US7598996B2 (en) * | 2004-11-16 | 2009-10-06 | Aptina Imaging Corporation | System and method for focusing a digital camera |
Family Cites Families (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1198667B (de) * | 1962-04-04 | 1965-08-12 | Voigtlaender Ag | Photographische Kamera mit einem auf verschiedene Entfernungswerte einstellbaren Objektiv |
| US3435744A (en) * | 1966-05-31 | 1969-04-01 | Eastman Kodak Co | Automatic focusing system |
| US3442193A (en) * | 1966-05-31 | 1969-05-06 | Eastman Kodak Co | Automatic focusing system |
| US3443502A (en) * | 1966-08-23 | 1969-05-13 | Eastman Kodak Co | Automatic focusing for cameras |
| US3522764A (en) * | 1968-03-25 | 1970-08-04 | Polaroid Corp | Rangefinding and focusing system for photographic cameras and the like |
| US3618499A (en) * | 1969-04-04 | 1971-11-09 | Eastman Kodak Co | Camera with coordinated aperture and focus adjustment means |
| DE2105288B2 (de) * | 1970-02-14 | 1973-03-15 | Kabushiki Kaisha Ricoh, Tokio | Kamera mit automatischer scharfeinstellung |
| US3917395A (en) * | 1973-06-28 | 1975-11-04 | Honeywell Inc | Control circuit for photographic apparatus |
| US4040065A (en) * | 1976-01-14 | 1977-08-02 | Addressograph Multigraph Corporation | Photocomposer optical system with a negative collimating lens |
| US4080531A (en) * | 1976-06-29 | 1978-03-21 | Honeywell Inc. | Single pass distance determining and automatic focusing apparatus with separately adjusted optical element |
| CA1099554A (en) * | 1976-10-04 | 1981-04-21 | Polaroid Corporation | Automatic range finding and focussing camera |
-
1977
- 1977-12-30 US US05/865,854 patent/US4149792A/en not_active Expired - Lifetime
-
1978
- 1978-12-18 GB GB7848906A patent/GB2012061B/en not_active Expired
- 1978-12-27 JP JP16439478A patent/JPS54100720A/ja active Granted
- 1978-12-28 CH CH1321078A patent/CH636974A5/de not_active IP Right Cessation
- 1978-12-28 IE IE2564/78A patent/IE47625B1/en unknown
- 1978-12-29 DE DE19782856803 patent/DE2856803A1/de not_active Ceased
- 1978-12-29 CA CA318,866A patent/CA1116001A/en not_active Expired
-
1979
- 1979-01-02 FR FR7900018A patent/FR2413679A1/fr active Granted
- 1979-01-02 AU AU43059/79A patent/AU526585B2/en not_active Ceased
- 1979-01-02 AT AT0001379A patent/AT373086B/de not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| GB2012061B (en) | 1982-06-09 |
| JPS54100720A (en) | 1979-08-08 |
| FR2413679A1 (fr) | 1979-07-27 |
| AU526585B2 (en) | 1983-01-20 |
| IE782564L (en) | 1979-06-30 |
| IE47625B1 (en) | 1984-05-02 |
| JPS6219729B2 (enFirst) | 1987-04-30 |
| FR2413679B1 (enFirst) | 1984-11-02 |
| ATA1379A (de) | 1983-04-15 |
| AT373086B (de) | 1983-12-12 |
| DE2856803A1 (de) | 1979-07-12 |
| AU4305979A (en) | 1979-07-05 |
| CH636974A5 (de) | 1983-06-30 |
| GB2012061A (en) | 1979-07-18 |
| US4149792A (en) | 1979-04-17 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4348089A (en) | Lens movement actuated reference and sequencing means for cameras having unidirectional automatic focusing | |
| CA1116001A (en) | Misfocus prevention means for cameras having unidirectional automatic focusing | |
| US4182563A (en) | Focus control system for interchangeable adjustable focus lenses | |
| US4160590A (en) | Removable (lens position limiting) stop for auto-manual focusing cameras | |
| CA1133305A (en) | Auto focus movie camera having improved focus response | |
| US4309098A (en) | Autofocus cine camera having automatic variable speed focusing | |
| US4362372A (en) | Focusing system and method with adjustment for lens depth of focus | |
| US4153903A (en) | Lens shield actuated auto/manual focus control inhibit/override | |
| US4531822A (en) | Extended sonic acceptance angle | |
| CA1133741A (en) | Autofocus movie camera having focus correction means | |
| CA1133304A (en) | Auto focus movie camera having pulsed terminal drive means | |
| JPH0149921B2 (enFirst) | ||
| US4319820A (en) | Auto/manual focus control inhibit/override | |
| US5073790A (en) | Position sensing device | |
| JPS6444428A (en) | Zoom camera | |
| US4525053A (en) | Motor-drivable photographing lens assembly | |
| US4374613A (en) | Auto/manual camera employing common lens focusing data | |
| CA1122455A (en) | Lens movement actuated reference and sequencing means for cameras having unidirectional automatic focusing | |
| GB1208388A (en) | Semi-automatic motor driven lens focusing mechanism | |
| CA1122454A (en) | Auto/manual focus control inhibit/override | |
| USRE31362E (en) | Autofocus movie camera having pulsed terminal drive means | |
| US4227790A (en) | Auto/manual focus control mode selector | |
| JPS58150921A (ja) | 自動合焦カメラ | |
| US5243374A (en) | Lens barrel having a power zooming function and a camera system | |
| JP2855550B2 (ja) | カメラ用連動装置 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |