CA1107913A - Mixtures of optical brighteners - Google Patents
Mixtures of optical brightenersInfo
- Publication number
- CA1107913A CA1107913A CA303,000A CA303000A CA1107913A CA 1107913 A CA1107913 A CA 1107913A CA 303000 A CA303000 A CA 303000A CA 1107913 A CA1107913 A CA 1107913A
- Authority
- CA
- Canada
- Prior art keywords
- alkyl
- group
- formula
- hydrogen
- phenyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000000203 mixture Substances 0.000 title claims abstract description 22
- 230000003287 optical effect Effects 0.000 title claims abstract description 16
- 150000001875 compounds Chemical class 0.000 claims abstract description 39
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 59
- 229910052739 hydrogen Inorganic materials 0.000 claims description 35
- 239000001257 hydrogen Substances 0.000 claims description 26
- -1 phenyll C1-Cg-alkyl Chemical group 0.000 claims description 24
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims description 21
- 125000000217 alkyl group Chemical group 0.000 claims description 19
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 18
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 16
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 14
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 14
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 claims description 12
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 11
- 150000003254 radicals Chemical class 0.000 claims description 11
- 125000005605 benzo group Chemical group 0.000 claims description 9
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 claims description 8
- 125000004432 carbon atom Chemical group C* 0.000 claims description 8
- 229910052801 chlorine Inorganic materials 0.000 claims description 8
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 claims description 8
- 125000003545 alkoxy group Chemical group 0.000 claims description 7
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 7
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 6
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 claims description 6
- 239000000460 chlorine Substances 0.000 claims description 6
- 229910052731 fluorine Inorganic materials 0.000 claims description 6
- 239000011737 fluorine Substances 0.000 claims description 6
- 125000004193 piperazinyl group Chemical group 0.000 claims description 6
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 claims description 5
- BDAGIHXWWSANSR-UHFFFAOYSA-N Formic acid Chemical group OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 claims description 5
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 5
- 229910052740 iodine Inorganic materials 0.000 claims description 5
- 229910052760 oxygen Inorganic materials 0.000 claims description 5
- 229910052717 sulfur Chemical group 0.000 claims description 5
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 4
- 125000002947 alkylene group Chemical group 0.000 claims description 4
- 125000004429 atom Chemical group 0.000 claims description 4
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 4
- 125000005843 halogen group Chemical group 0.000 claims description 4
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 claims description 4
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims description 4
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 claims description 4
- 229910052757 nitrogen Inorganic materials 0.000 claims description 4
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 claims description 4
- 125000005037 alkyl phenyl group Chemical group 0.000 claims description 3
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 3
- 125000001188 haloalkyl group Chemical group 0.000 claims description 3
- 125000002768 hydroxyalkyl group Chemical group 0.000 claims description 3
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 3
- 239000001301 oxygen Substances 0.000 claims description 3
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 3
- 125000000229 (C1-C4)alkoxy group Chemical group 0.000 claims description 2
- 125000006701 (C1-C7) alkyl group Chemical group 0.000 claims description 2
- 125000004201 2,4-dichlorophenyl group Chemical group [H]C1=C([H])C(*)=C(Cl)C([H])=C1Cl 0.000 claims description 2
- 125000004182 2-chlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(*)C([H])=C1[H] 0.000 claims description 2
- 125000004183 alkoxy alkyl group Chemical group 0.000 claims description 2
- 125000000278 alkyl amino alkyl group Chemical group 0.000 claims description 2
- 125000002877 alkyl aryl group Chemical group 0.000 claims description 2
- 125000004414 alkyl thio group Chemical group 0.000 claims description 2
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 2
- 125000003118 aryl group Chemical group 0.000 claims description 2
- 150000005840 aryl radicals Chemical class 0.000 claims description 2
- 125000004104 aryloxy group Chemical group 0.000 claims description 2
- ZSIQJIWKELUFRJ-UHFFFAOYSA-N azepane Chemical compound C1CCCNCC1 ZSIQJIWKELUFRJ-UHFFFAOYSA-N 0.000 claims description 2
- 125000004181 carboxyalkyl group Chemical group 0.000 claims description 2
- 125000004218 chloromethyl group Chemical group [H]C([H])(Cl)* 0.000 claims description 2
- 125000000068 chlorophenyl group Chemical group 0.000 claims description 2
- 125000004985 dialkyl amino alkyl group Chemical group 0.000 claims description 2
- 125000004663 dialkyl amino group Chemical group 0.000 claims description 2
- 125000004188 dichlorophenyl group Chemical group 0.000 claims description 2
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 claims description 2
- 125000006203 morpholinoethyl group Chemical group [H]C([H])(*)C([H])([H])N1C([H])([H])C([H])([H])OC([H])([H])C1([H])[H] 0.000 claims description 2
- 125000003261 o-tolyl group Chemical group [H]C1=C([H])C(*)=C(C([H])=C1[H])C([H])([H])[H] 0.000 claims description 2
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 claims description 2
- 125000004434 sulfur atom Chemical group 0.000 claims description 2
- 125000006702 (C1-C18) alkyl group Chemical group 0.000 claims 1
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 claims 1
- 125000003342 alkenyl group Chemical group 0.000 claims 1
- 125000000753 cycloalkyl group Chemical group 0.000 claims 1
- LNLKMNLWDKXOOJ-UHFFFAOYSA-N 2-[2-(2-phenylethenyl)phenyl]-1,3-benzothiazole Chemical class C=1C=CC=C(C=2SC3=CC=CC=C3N=2)C=1C=CC1=CC=CC=C1 LNLKMNLWDKXOOJ-UHFFFAOYSA-N 0.000 abstract 2
- GLIKXZUJKIVGIE-UHFFFAOYSA-N 2-[2-(2-phenylethenyl)phenyl]-1,3-benzoxazole Chemical group C=1C=CC=C(C=2OC3=CC=CC=C3N=2)C=1C=CC1=CC=CC=C1 GLIKXZUJKIVGIE-UHFFFAOYSA-N 0.000 abstract 2
- 125000004076 pyridyl group Chemical group 0.000 abstract 2
- APFMPAFOMJHHBR-UHFFFAOYSA-N 2-[2-(1,3-benzothiazol-2-yl)-1,2-diphenylethenyl]-1,3-benzothiazole Chemical class C1=CC=CC=C1C(C=1SC2=CC=CC=C2N=1)=C(C=1C=CC=CC=1)C1=NC2=CC=CC=C2S1 APFMPAFOMJHHBR-UHFFFAOYSA-N 0.000 abstract 1
- 235000013350 formula milk Nutrition 0.000 description 47
- 230000000875 corresponding effect Effects 0.000 description 9
- 238000006243 chemical reaction Methods 0.000 description 7
- 238000000034 method Methods 0.000 description 7
- 239000004744 fabric Substances 0.000 description 6
- 229920000728 polyester Polymers 0.000 description 6
- 238000005282 brightening Methods 0.000 description 5
- 239000000463 material Substances 0.000 description 5
- 238000004043 dyeing Methods 0.000 description 4
- 150000002431 hydrogen Chemical class 0.000 description 4
- 239000004753 textile Substances 0.000 description 4
- 239000006185 dispersion Substances 0.000 description 3
- 239000000835 fiber Substances 0.000 description 3
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical group [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 125000002252 acyl group Chemical group 0.000 description 2
- 229910052783 alkali metal Inorganic materials 0.000 description 2
- 150000001340 alkali metals Chemical class 0.000 description 2
- 125000003277 amino group Chemical group 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 125000003262 carboxylic acid ester group Chemical class [H]C([H])([*:2])OC(=O)C([H])([H])[*:1] 0.000 description 2
- 150000001768 cations Chemical class 0.000 description 2
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 2
- 125000005842 heteroatom Chemical group 0.000 description 2
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 229940113083 morpholine Drugs 0.000 description 2
- WCPAKWJPBJAGKN-UHFFFAOYSA-N oxadiazole Chemical group C1=CON=N1 WCPAKWJPBJAGKN-UHFFFAOYSA-N 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- 125000000565 sulfonamide group Chemical group 0.000 description 2
- 125000002130 sulfonic acid ester group Chemical group 0.000 description 2
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 2
- 125000002861 (C1-C4) alkanoyl group Chemical group 0.000 description 1
- ZCNQCNJDMLKRSN-UHFFFAOYSA-N (butoxy-ethoxy-propoxymethyl)-(diethylamino)-(dimethylamino-hexoxy-pentoxymethyl)-(methoxymethyl)azanium Chemical compound COC[N+](C(N(C)C)(OCCCCCC)OCCCCC)(C(OCCCC)(OCCC)OCC)N(CC)CC ZCNQCNJDMLKRSN-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- 101150002460 COQ4 gene Proteins 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- XGCJRRDNIMSYNC-INVBOZNNSA-N Coenzyme Q4 Chemical compound COC1=C(OC)C(=O)C(C\C=C(/C)CC\C=C(/C)CC\C=C(/C)CCC=C(C)C)=C(C)C1=O XGCJRRDNIMSYNC-INVBOZNNSA-N 0.000 description 1
- 229920000742 Cotton Polymers 0.000 description 1
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 description 1
- CYTYCFOTNPOANT-UHFFFAOYSA-N Perchloroethylene Chemical group ClC(Cl)=C(Cl)Cl CYTYCFOTNPOANT-UHFFFAOYSA-N 0.000 description 1
- 239000004952 Polyamide Substances 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- SMEGJBVQLJJKKX-HOTMZDKISA-N [(2R,3S,4S,5R,6R)-5-acetyloxy-3,4,6-trihydroxyoxan-2-yl]methyl acetate Chemical compound CC(=O)OC[C@@H]1[C@H]([C@@H]([C@H]([C@@H](O1)O)OC(=O)C)O)O SMEGJBVQLJJKKX-HOTMZDKISA-N 0.000 description 1
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 description 1
- 229940081735 acetylcellulose Drugs 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 150000003855 acyl compounds Chemical class 0.000 description 1
- 125000005036 alkoxyphenyl group Chemical group 0.000 description 1
- 125000005422 alkyl sulfonamido group Chemical group 0.000 description 1
- 125000004422 alkyl sulphonamide group Chemical class 0.000 description 1
- 150000001412 amines Chemical group 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 239000011324 bead Substances 0.000 description 1
- 125000004541 benzoxazolyl group Chemical group O1C(=NC2=C1C=CC=C2)* 0.000 description 1
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 235000010290 biphenyl Nutrition 0.000 description 1
- 239000004305 biphenyl Substances 0.000 description 1
- 125000006267 biphenyl group Chemical group 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 229920002301 cellulose acetate Polymers 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 125000004965 chloroalkyl group Chemical group 0.000 description 1
- 239000000084 colloidal system Substances 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 230000009977 dual effect Effects 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 239000002657 fibrous material Substances 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 230000026030 halogenation Effects 0.000 description 1
- 238000005658 halogenation reaction Methods 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- LMAZKPOSWVOFGY-FBAUPLQOSA-N orine Natural products CO[C@H]1C[C@H](O[C@H]2CC[C@]3(C)[C@H]4C[C@@H](OC(=O)C=Cc5ccccc5)[C@]6(C)[C@@](O)(CC[C@]6(O)[C@]4(O)CC=C3C2)[C@H](C)OC(=O)C=Cc7ccccc7)O[C@H](C)[C@H]1O LMAZKPOSWVOFGY-FBAUPLQOSA-N 0.000 description 1
- 125000005429 oxyalkyl group Chemical group 0.000 description 1
- 125000005359 phenoxyalkyl group Chemical group 0.000 description 1
- 125000003884 phenylalkyl group Chemical group 0.000 description 1
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N phenylbenzene Natural products C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 1
- 229920002647 polyamide Polymers 0.000 description 1
- 229920000137 polyphosphoric acid Polymers 0.000 description 1
- 239000000344 soap Substances 0.000 description 1
- UKLNMMHNWFDKNT-UHFFFAOYSA-M sodium chlorite Chemical compound [Na+].[O-]Cl=O UKLNMMHNWFDKNT-UHFFFAOYSA-M 0.000 description 1
- 229960002218 sodium chlorite Drugs 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 230000002195 synergetic effect Effects 0.000 description 1
- ZMANZCXQSJIPKH-UHFFFAOYSA-O triethylammonium ion Chemical compound CC[NH+](CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-O 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
- 235000005074 zinc chloride Nutrition 0.000 description 1
- 239000011592 zinc chloride Substances 0.000 description 1
Classifications
-
- D—TEXTILES; PAPER
- D06—TREATMENT OF TEXTILES OR THE LIKE; LAUNDERING; FLEXIBLE MATERIALS NOT OTHERWISE PROVIDED FOR
- D06L—DRY-CLEANING, WASHING OR BLEACHING FIBRES, FILAMENTS, THREADS, YARNS, FABRICS, FEATHERS OR MADE-UP FIBROUS GOODS; BLEACHING LEATHER OR FURS
- D06L4/00—Bleaching fibres, filaments, threads, yarns, fabrics, feathers or made-up fibrous goods; Bleaching leather or furs
- D06L4/60—Optical bleaching or brightening
- D06L4/65—Optical bleaching or brightening with mixtures of optical brighteners
Landscapes
- Engineering & Computer Science (AREA)
- Textile Engineering (AREA)
- Detergent Compositions (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Paper (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Coloring (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
Applications Claiming Priority (2)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
DE2721084A DE2721084C3 (de) | 1977-05-11 | 1977-05-11 | Mischungen von optischen Aufhellern |
DEP2721084.0 | 1977-05-11 |
Publications (1)
Publication Number | Publication Date |
---|---|
CA1107913A true CA1107913A (en) | 1981-09-01 |
Family
ID=6008566
Family Applications (1)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
CA303,000A Expired CA1107913A (en) | 1977-05-11 | 1978-05-10 | Mixtures of optical brighteners |
Country Status (13)
Families Citing this family (18)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
DE2839936C2 (de) * | 1978-09-14 | 1983-11-10 | Hoechst Ag, 6230 Frankfurt | Mischungen von optischen Aufhellern und deren Verwendung zum optischen Aufhellen |
DE3008812A1 (de) * | 1980-03-07 | 1981-09-24 | Hoechst Ag, 6000 Frankfurt | Mischungen von optischen aufhellern |
DE3104992A1 (de) * | 1981-02-12 | 1982-08-26 | Hoechst Ag, 6000 Frankfurt | "mischungen von optischen aufhellern" |
US4830763A (en) * | 1987-02-26 | 1989-05-16 | Ciba-Geigy Corporation | Process for increasing the degree of whiteness of polyester-containing textile material |
US6030443A (en) * | 1999-04-29 | 2000-02-29 | Hercules Incorporated | Paper coating composition with improved optical brightener carriers |
US6492032B1 (en) | 2000-10-12 | 2002-12-10 | Eastman Chemical Company | Multi-component optically brightened polyolefin blend |
US7638016B2 (en) * | 2005-02-19 | 2009-12-29 | International Paper Company | Method for treating kraft pulp with optical brighteners after chlorine bleaching to increase brightness |
US7682438B2 (en) | 2005-11-01 | 2010-03-23 | International Paper Company | Paper substrate having enhanced print density |
US7622022B2 (en) | 2006-06-01 | 2009-11-24 | Benny J Skaggs | Surface treatment of substrate or paper/paperboard products using optical brightening agent |
US7967948B2 (en) * | 2006-06-02 | 2011-06-28 | International Paper Company | Process for non-chlorine oxidative bleaching of mechanical pulp in the presence of optical brightening agents |
US20070284425A1 (en) * | 2006-06-13 | 2007-12-13 | John Raymond Garvey | Blank and gable top carton thereof |
US8425723B2 (en) * | 2007-04-05 | 2013-04-23 | Akzo Nobel N.V. | Process for improving optical properties of paper |
EP2152522A1 (en) * | 2007-05-21 | 2010-02-17 | International Paper Company | Recording sheet with improved image waterfastness, surface strength, and runnability |
WO2009085308A2 (en) | 2007-12-26 | 2009-07-09 | International Paper Company | A paper substrate containing a wetting agent and having improved print mottle |
CA2738923C (en) * | 2008-10-01 | 2016-06-21 | International Paper Company | A paper substrate containing a wetting agent and having improved printability |
US20130189457A1 (en) | 2012-01-23 | 2013-07-25 | International Paper Company | SEPARATED TREATMENT OF PAPER SUBSTRATE WITH MULTIVALENT METAL SALTS AND OBAs |
EP3334862A2 (en) | 2015-08-14 | 2018-06-20 | Basf Se | Aqueous surface treatment composition for paper and board |
CN109208098B (zh) * | 2017-07-06 | 2021-09-10 | 中国石化仪征化纤有限责任公司 | 一种荧光增白剂、母粒及钛系增白涤纶短纤维的制备方法 |
Family Cites Families (7)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
US3260715A (en) * | 1962-12-17 | 1966-07-12 | Eastman Kodak Co | Fluorescent bis-benzoxazolyl stilbenes |
FR1440678A (fr) * | 1964-06-30 | 1966-06-03 | Nippon Kayaku Kk | Agent d'avivage optique |
US3595801A (en) * | 1967-12-29 | 1971-07-27 | Hoechst Ag | Aqueous dispersions of mixtures of benzoxazole derivatives and their use as optical brighteners |
US3711474A (en) * | 1969-07-31 | 1973-01-16 | Procter & Gamble | Heterocyclic nitrogen-and sulfur-containing optical brightener compounds and detergents and bleach compositions containing same |
US4105399A (en) * | 1973-09-05 | 1978-08-08 | Ciba-Geigy Corporation | Optically brightening with a synergistic mixture |
JPS5652065B2 (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) * | 1974-01-17 | 1981-12-09 | ||
DE2629703C3 (de) * | 1976-07-02 | 1981-07-23 | Hoechst Ag, 6000 Frankfurt | Aufhellermischungen und deren Verwendung |
-
1977
- 1977-05-11 DE DE2721084A patent/DE2721084C3/de not_active Expired
-
1978
- 1978-05-08 US US05/903,606 patent/US4169810A/en not_active Expired - Lifetime
- 1978-05-08 CH CH498978A patent/CH647912GA3/de unknown
- 1978-05-09 IT IT23196/78A patent/IT1094602B/it active
- 1978-05-09 GB GB18452/78A patent/GB1588687A/en not_active Expired
- 1978-05-10 NL NL7805039A patent/NL7805039A/xx not_active Application Discontinuation
- 1978-05-10 CA CA303,000A patent/CA1107913A/en not_active Expired
- 1978-05-10 BR BR7802937A patent/BR7802937A/pt unknown
- 1978-05-10 JP JP5455578A patent/JPS53139635A/ja active Pending
- 1978-05-10 PH PH21123A patent/PH15034A/en unknown
- 1978-05-11 FR FR7813972A patent/FR2390537A1/fr active Granted
- 1978-05-11 SE SE7805451A patent/SE7805451L/xx unknown
- 1978-05-11 BE BE187609A patent/BE866964A/xx not_active IP Right Cessation
Also Published As
Publication number | Publication date |
---|---|
DE2721084C3 (de) | 1981-02-26 |
IT7823196A0 (it) | 1978-05-09 |
DE2721084B2 (de) | 1980-06-26 |
BR7802937A (pt) | 1979-01-02 |
SE7805451L (sv) | 1978-11-12 |
NL7805039A (nl) | 1978-11-14 |
IT1094602B (it) | 1985-08-02 |
PH15034A (en) | 1982-05-20 |
US4169810A (en) | 1979-10-02 |
CH647912GA3 (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | 1985-02-28 |
FR2390537A1 (fr) | 1978-12-08 |
JPS53139635A (en) | 1978-12-06 |
BE866964A (fr) | 1978-11-13 |
DE2721084A1 (de) | 1978-11-23 |
GB1588687A (en) | 1981-04-29 |
FR2390537B1 (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | 1983-05-20 |
Similar Documents
Publication | Publication Date | Title |
---|---|---|
CA1107913A (en) | Mixtures of optical brighteners | |
CA1099727A (en) | Benzofuranyl-benzimidazoles | |
CA1151806A (en) | Mixtures of optical brighteners | |
GB1590228A (en) | Benzoxazole compounds | |
US3900419A (en) | Benzofurans | |
EP0136259B1 (de) | 4-Heterocyclylvinyl-4'-styryl-biphenyle | |
US3865816A (en) | 3-(3{40 ,4{40 -Dichloro-6{40 -alkyl-phenyl)-delta, 2-pyrazoline derivatives | |
US3560485A (en) | Delta 2-pyrazoline optical brighteners | |
US3429877A (en) | Azole compounds | |
GB1574891A (en) | Phenylbenzimidazolyl-furanes | |
US4129412A (en) | Brightener mixtures and their use | |
US4363744A (en) | Mixtures of optical brighteners and their use for the optical brightening | |
US4400294A (en) | Mixtures of optical brighteners | |
US4220760A (en) | Diamino-1,3,5-triazinylstilbene compounds and process for preparing same | |
US3328310A (en) | Optically brightened organic compositions | |
EP0027897A1 (de) | Quaternierte, verbrückte Benzimidazolyl-benzimidazole, Verfahren zu deren Herstellung und deren Verwendung | |
US4508900A (en) | Cationic compounds of the naphthalimide series, process for their preparation and their use | |
US4271293A (en) | Benzofuranyl-benzimidazoles | |
US3836522A (en) | Process for the manufacture of 1,3-diphenyl-4-methyl-5-alkyl-pyrazolines | |
US3598810A (en) | Fluorescent 1-(pyrazolinylphenylsulphonyl)-piperazines | |
US4009994A (en) | Process and product of optical brightening with quaternized benzofuranyl-benzimidazoles | |
CA1136356A (en) | Mixtures of optical brighteners and their use for the optical brightening | |
US4231741A (en) | Mixtures of optical brighteners | |
US3957815A (en) | 3-[3',4'-Dichloro-6'-alkyl-phenyl]-Δ2 -pyrazoline derivatives and their use as optical brighteners | |
US3442886A (en) | Benzothiazolyl-azo-aniline dyestuffs containing an n-alkylene oxoalkanoate group |
Legal Events
Date | Code | Title | Description |
---|---|---|---|
MKEX | Expiry |