CA1102808A - Substituted sulphoximides, a process for their preparation and pharmaceutical compositions containing these compounds - Google Patents
Substituted sulphoximides, a process for their preparation and pharmaceutical compositions containing these compoundsInfo
- Publication number
- CA1102808A CA1102808A CA260,429A CA260429A CA1102808A CA 1102808 A CA1102808 A CA 1102808A CA 260429 A CA260429 A CA 260429A CA 1102808 A CA1102808 A CA 1102808A
- Authority
- CA
- Canada
- Prior art keywords
- salt
- sulphoximide
- dimethylamino
- diphenyl
- methyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title claims description 26
- 238000002360 preparation method Methods 0.000 title claims description 7
- 150000001875 compounds Chemical class 0.000 title abstract description 9
- 239000008194 pharmaceutical composition Substances 0.000 title description 4
- 150000003839 salts Chemical class 0.000 claims abstract description 22
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 21
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims abstract description 8
- 239000002253 acid Substances 0.000 claims abstract description 4
- 150000001449 anionic compounds Chemical class 0.000 claims abstract description 4
- 125000004433 nitrogen atom Chemical group N* 0.000 claims abstract description 4
- 150000002891 organic anions Chemical class 0.000 claims abstract description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 claims description 36
- 239000000047 product Substances 0.000 claims description 16
- -1 alkali metal salt Chemical class 0.000 claims description 11
- 125000004432 carbon atom Chemical group C* 0.000 claims description 11
- AISMNBXOJRHCIA-UHFFFAOYSA-N trimethylazanium;bromide Chemical compound Br.CN(C)C AISMNBXOJRHCIA-UHFFFAOYSA-N 0.000 claims description 10
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 claims description 9
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 claims description 8
- 238000006243 chemical reaction Methods 0.000 claims description 8
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 8
- 239000000126 substance Substances 0.000 claims description 8
- 159000000000 sodium salts Chemical group 0.000 claims description 7
- 229910052783 alkali metal Inorganic materials 0.000 claims description 5
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical class CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 claims description 5
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 claims description 4
- 239000002270 dispersing agent Substances 0.000 claims description 4
- 150000007975 iminium salts Chemical class 0.000 claims description 4
- 239000002904 solvent Substances 0.000 claims description 4
- 150000001339 alkali metal compounds Chemical class 0.000 claims description 3
- 150000001450 anions Chemical class 0.000 claims description 3
- NDMMNVRSMCKNEO-UHFFFAOYSA-N n,n-dimethyl-1-[[oxo(diphenyl)-$l^{6}-sulfanylidene]amino]methanamine Chemical compound C=1C=CC=CC=1S(=O)(=NCN(C)C)C1=CC=CC=C1 NDMMNVRSMCKNEO-UHFFFAOYSA-N 0.000 claims description 3
- 229910052757 nitrogen Inorganic materials 0.000 claims description 3
- 239000007795 chemical reaction product Substances 0.000 claims description 2
- 239000000376 reactant Substances 0.000 claims description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 claims description 2
- 229910052739 hydrogen Inorganic materials 0.000 claims 2
- 239000001257 hydrogen Substances 0.000 claims 2
- 125000003386 piperidinyl group Chemical group 0.000 claims 1
- 125000003118 aryl group Chemical group 0.000 abstract description 6
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 abstract description 4
- 230000002048 spasmolytic effect Effects 0.000 abstract description 4
- 125000003710 aryl alkyl group Chemical group 0.000 abstract description 3
- 125000004122 cyclic group Chemical group 0.000 abstract description 3
- 125000000623 heterocyclic group Chemical group 0.000 abstract description 3
- 125000004429 atom Chemical group 0.000 abstract description 2
- 230000001813 broncholytic effect Effects 0.000 abstract description 2
- 239000000812 cholinergic antagonist Substances 0.000 abstract description 2
- 238000005304 joining Methods 0.000 abstract description 2
- 235000013350 formula milk Nutrition 0.000 description 19
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 14
- 101150041968 CDC13 gene Proteins 0.000 description 8
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 8
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 7
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 6
- 230000007717 exclusion Effects 0.000 description 6
- SKAOERQLLZRKGY-UHFFFAOYSA-N 1-methylpiperidin-1-ium;bromide Chemical compound [Br-].C[NH+]1CCCCC1 SKAOERQLLZRKGY-UHFFFAOYSA-N 0.000 description 5
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 5
- 239000000725 suspension Substances 0.000 description 5
- NTYJJOPFIAHURM-UHFFFAOYSA-N Histamine Chemical compound NCCC1=CN=CN1 NTYJJOPFIAHURM-UHFFFAOYSA-N 0.000 description 4
- GZUXJHMPEANEGY-UHFFFAOYSA-N bromomethane Chemical compound BrC GZUXJHMPEANEGY-UHFFFAOYSA-N 0.000 description 4
- 239000000460 chlorine Substances 0.000 description 4
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 4
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 4
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 4
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 4
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 4
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 4
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical compound OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 3
- 239000002585 base Substances 0.000 description 3
- 125000000753 cycloalkyl group Chemical group 0.000 description 3
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 3
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 3
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 description 3
- 238000004821 distillation Methods 0.000 description 3
- 125000001424 substituent group Chemical group 0.000 description 3
- FCEHBMOGCRZNNI-UHFFFAOYSA-N 1-benzothiophene Chemical compound C1=CC=C2SC=CC2=C1 FCEHBMOGCRZNNI-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- 229930003347 Atropine Natural products 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-WFGJKAKNSA-N Dimethyl sulfoxide Chemical compound [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] IAZDPXIOMUYVGZ-WFGJKAKNSA-N 0.000 description 2
- RKUNBYITZUJHSG-UHFFFAOYSA-N Hyosciamin-hydrochlorid Natural products CN1C(C2)CCC1CC2OC(=O)C(CO)C1=CC=CC=C1 RKUNBYITZUJHSG-UHFFFAOYSA-N 0.000 description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 2
- 208000007101 Muscle Cramp Diseases 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- 208000005392 Spasm Diseases 0.000 description 2
- 101100054666 Streptomyces halstedii sch3 gene Proteins 0.000 description 2
- 125000003545 alkoxy group Chemical group 0.000 description 2
- RKUNBYITZUJHSG-SPUOUPEWSA-N atropine Chemical compound O([C@H]1C[C@H]2CC[C@@H](C1)N2C)C(=O)C(CO)C1=CC=CC=C1 RKUNBYITZUJHSG-SPUOUPEWSA-N 0.000 description 2
- 229960000396 atropine Drugs 0.000 description 2
- 125000006267 biphenyl group Chemical group 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 125000000068 chlorophenyl group Chemical group 0.000 description 2
- IYYZUPMFVPLQIF-UHFFFAOYSA-N dibenzothiophene Chemical compound C1=CC=C2C3=CC=CC=C3SC2=C1 IYYZUPMFVPLQIF-UHFFFAOYSA-N 0.000 description 2
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 2
- 125000001153 fluoro group Chemical group F* 0.000 description 2
- 125000005843 halogen group Chemical group 0.000 description 2
- 229960001340 histamine Drugs 0.000 description 2
- YFYIDTVGWCYSEO-UHFFFAOYSA-N imino-methyl-oxo-phenyl-$l^{6}-sulfane Chemical compound CS(=N)(=O)C1=CC=CC=C1 YFYIDTVGWCYSEO-UHFFFAOYSA-N 0.000 description 2
- 239000007924 injection Substances 0.000 description 2
- 238000002347 injection Methods 0.000 description 2
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 2
- 229940102396 methyl bromide Drugs 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 125000001624 naphthyl group Chemical group 0.000 description 2
- VLTRZXGMWDSKGL-UHFFFAOYSA-M perchlorate Inorganic materials [O-]Cl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-M 0.000 description 2
- 239000003826 tablet Substances 0.000 description 2
- 125000003944 tolyl group Chemical group 0.000 description 2
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 2
- ZZQUQFZVCJWSER-UHFFFAOYSA-N 3,4-dihydro-1h-isothiochromene Chemical compound C1=CC=C2CSCCC2=C1 ZZQUQFZVCJWSER-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- PQJUJGAVDBINPI-UHFFFAOYSA-N 9H-thioxanthene Chemical compound C1=CC=C2CC3=CC=CC=C3SC2=C1 PQJUJGAVDBINPI-UHFFFAOYSA-N 0.000 description 1
- 208000009079 Bronchial Spasm Diseases 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- 241000699670 Mus sp. Species 0.000 description 1
- ZSCSGBAJPUDOCP-UHFFFAOYSA-N N=S(=O)CS(=N)=O.C1CCCCN1CN1CCCCC1 Chemical compound N=S(=O)CS(=N)=O.C1CCCCN1CN1CCCCC1 ZSCSGBAJPUDOCP-UHFFFAOYSA-N 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical group C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- YPWFISCTZQNZAU-UHFFFAOYSA-N Thiane Chemical compound C1CCSCC1 YPWFISCTZQNZAU-UHFFFAOYSA-N 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- OIPILFWXSMYKGL-UHFFFAOYSA-N acetylcholine Chemical compound CC(=O)OCC[N+](C)(C)C OIPILFWXSMYKGL-UHFFFAOYSA-N 0.000 description 1
- 229960004373 acetylcholine Drugs 0.000 description 1
- 230000007059 acute toxicity Effects 0.000 description 1
- 231100000403 acute toxicity Toxicity 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 230000003042 antagnostic effect Effects 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- WDIHJSXYQDMJHN-UHFFFAOYSA-L barium chloride Chemical compound [Cl-].[Cl-].[Ba+2] WDIHJSXYQDMJHN-UHFFFAOYSA-L 0.000 description 1
- 229910001626 barium chloride Inorganic materials 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- MNKJCBFFFCINRH-UHFFFAOYSA-N butyl-methyl-oxo-(piperidin-1-ylmethylimino)-$l^{6}-sulfane Chemical compound CCCCS(C)(=O)=NCN1CCCCC1 MNKJCBFFFCINRH-UHFFFAOYSA-N 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- JHPVVOXKINUOSC-UHFFFAOYSA-N diethyl(methyl)azanium;iodide Chemical compound [I-].CC[NH+](C)CC JHPVVOXKINUOSC-UHFFFAOYSA-N 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- MRYXBPRWRMSZGY-UHFFFAOYSA-N dimethyl-oxo-(piperidin-1-ylmethylimino)-$l^{6}-sulfane Chemical compound CS(C)(=O)=NCN1CCCCC1 MRYXBPRWRMSZGY-UHFFFAOYSA-N 0.000 description 1
- 239000006196 drop Substances 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 125000005842 heteroatom Chemical group 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- QDUXDCXILAPLAG-UHFFFAOYSA-N hydron;1-methylpiperidine;chloride Chemical compound Cl.CN1CCCCC1 QDUXDCXILAPLAG-UHFFFAOYSA-N 0.000 description 1
- 238000000338 in vitro Methods 0.000 description 1
- 238000001727 in vivo Methods 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 239000004310 lactic acid Substances 0.000 description 1
- 235000014655 lactic acid Nutrition 0.000 description 1
- 230000005923 long-lasting effect Effects 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- JZMJDSHXVKJFKW-UHFFFAOYSA-N methyl sulfate Chemical compound COS(O)(=O)=O JZMJDSHXVKJFKW-UHFFFAOYSA-N 0.000 description 1
- OFADYRMFVOVGEZ-UHFFFAOYSA-N methyl-oxo-phenyl-(piperidin-1-ylmethylimino)-$l^{6}-sulfane Chemical compound C=1C=CC=CC=1S(=O)(C)=NCN1CCCCC1 OFADYRMFVOVGEZ-UHFFFAOYSA-N 0.000 description 1
- 230000003170 musculotropic effect Effects 0.000 description 1
- WKJPWARSTZJWDU-UHFFFAOYSA-N n-ethyl-n-[[(1-methylcyclohexyl)-oxo-phenyl-$l^{6}-sulfanylidene]amino]ethanamine Chemical compound C1CCCCC1(C)S(=O)(=NN(CC)CC)C1=CC=CC=C1 WKJPWARSTZJWDU-UHFFFAOYSA-N 0.000 description 1
- XVRLJWBJJNWDFR-UHFFFAOYSA-N n-ethyl-n-[[(methyl-oxo-phenyl-$l^{6}-sulfanylidene)amino]methyl]ethanamine Chemical compound CCN(CC)CN=S(C)(=O)C1=CC=CC=C1 XVRLJWBJJNWDFR-UHFFFAOYSA-N 0.000 description 1
- INFSYNLQBZDWRI-UHFFFAOYSA-N n-ethyl-n-methylethanamine;hydrobromide Chemical compound [Br-].CC[NH+](C)CC INFSYNLQBZDWRI-UHFFFAOYSA-N 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- 239000000825 pharmaceutical preparation Substances 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 125000001484 phenothiazinyl group Chemical group C1(=CC=CC=2SC3=CC=CC=C3NC12)* 0.000 description 1
- 125000000286 phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- 238000005956 quaternization reaction Methods 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- RAOIDOHSFRTOEL-UHFFFAOYSA-N tetrahydrothiophene Chemical compound C1CCSC1 RAOIDOHSFRTOEL-UHFFFAOYSA-N 0.000 description 1
- GVIJJXMXTUZIOD-UHFFFAOYSA-N thianthrene Chemical compound C1=CC=C2SC3=CC=CC=C3SC2=C1 GVIJJXMXTUZIOD-UHFFFAOYSA-N 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/04—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms
- C07D295/12—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly or doubly bound nitrogen atoms
- C07D295/125—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly or doubly bound nitrogen atoms with the ring nitrogen atoms and the substituent nitrogen atoms attached to the same carbon chain, which is not interrupted by carbocyclic rings
- C07D295/13—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly or doubly bound nitrogen atoms with the ring nitrogen atoms and the substituent nitrogen atoms attached to the same carbon chain, which is not interrupted by carbocyclic rings to an acyclic saturated chain
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
- A61P25/04—Centrally acting analgesics, e.g. opioids
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D327/00—Heterocyclic compounds containing rings having oxygen and sulfur atoms as the only ring hetero atoms
- C07D327/02—Heterocyclic compounds containing rings having oxygen and sulfur atoms as the only ring hetero atoms one oxygen atom and one sulfur atom
- C07D327/06—Six-membered rings
- C07D327/08—[b,e]-condensed with two six-membered carbocyclic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D335/00—Heterocyclic compounds containing six-membered rings having one sulfur atom as the only ring hetero atom
- C07D335/04—Heterocyclic compounds containing six-membered rings having one sulfur atom as the only ring hetero atom condensed with carbocyclic rings or ring systems
- C07D335/10—Dibenzothiopyrans; Hydrogenated dibenzothiopyrans
- C07D335/12—Thioxanthenes
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- General Chemical & Material Sciences (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Biomedical Technology (AREA)
- Neurology (AREA)
- Neurosurgery (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Pain & Pain Management (AREA)
- Medicinal Chemistry (AREA)
- Engineering & Computer Science (AREA)
- Pharmacology & Pharmacy (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Medicinal Preparation (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19752539220 DE2539220A1 (de) | 1975-09-03 | 1975-09-03 | Substituierte sulfoximide, verfahren zu ihrer herstellung und diese verbindungen enthaltende arzneimittel |
| DEP2539220.5 | 1975-09-03 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1102808A true CA1102808A (en) | 1981-06-09 |
Family
ID=5955519
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA260,429A Expired CA1102808A (en) | 1975-09-03 | 1976-09-02 | Substituted sulphoximides, a process for their preparation and pharmaceutical compositions containing these compounds |
Country Status (19)
| Country | Link |
|---|---|
| US (1) | US4105795A (enExample) |
| JP (1) | JPS5239625A (enExample) |
| AR (1) | AR216058A1 (enExample) |
| AT (1) | AT352724B (enExample) |
| AU (1) | AU1735076A (enExample) |
| BE (1) | BE845856A (enExample) |
| CA (1) | CA1102808A (enExample) |
| CH (1) | CH627740A5 (enExample) |
| DE (1) | DE2539220A1 (enExample) |
| ES (1) | ES451209A1 (enExample) |
| FR (1) | FR2322589A1 (enExample) |
| GB (1) | GB1526996A (enExample) |
| GR (1) | GR65990B (enExample) |
| HU (1) | HU176675B (enExample) |
| IL (1) | IL50399A (enExample) |
| MX (1) | MX3845E (enExample) |
| NL (1) | NL7609598A (enExample) |
| PT (1) | PT65544B (enExample) |
| ZA (1) | ZA765176B (enExample) |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5531856A (en) * | 1978-08-28 | 1980-03-06 | Achilles Corp | Resin composition for electroconductive shoe |
| GB9000303D0 (en) * | 1990-01-06 | 1990-03-07 | Pfizer Ltd | Therapeutic agents |
| US5187189A (en) * | 1991-01-22 | 1993-02-16 | American Home Products Corporation | S-aminoalkyl-s-arylsulfoximines as antiarrhythmic agents |
| US5140026A (en) * | 1991-05-09 | 1992-08-18 | A. H. Robins Company, Incorporated | N-aminoalkyl-S-aryl-S-alkyl (or substituted alkyl) sulfoximines as antiarrhythmic agents |
| CN101528674B (zh) * | 2006-10-25 | 2015-04-29 | 汉高知识产权及控股有限公司 | 亚胺*盐和使用该新的亚胺*盐制备缺电子烯烃的方法 |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3637664A (en) * | 1966-12-22 | 1972-01-25 | Warner Lambert Co | N-substituted aminoalkyl-s s-diphenyl-sulfoximines and process for their production |
-
1975
- 1975-09-03 DE DE19752539220 patent/DE2539220A1/de not_active Withdrawn
-
1976
- 1976-08-18 CH CH1050876A patent/CH627740A5/de not_active IP Right Cessation
- 1976-08-30 ZA ZA765176A patent/ZA765176B/xx unknown
- 1976-08-30 NL NL7609598A patent/NL7609598A/xx not_active Application Discontinuation
- 1976-09-01 AT AT649576A patent/AT352724B/de not_active IP Right Cessation
- 1976-09-01 IL IL50399A patent/IL50399A/xx unknown
- 1976-09-01 AU AU17350/76A patent/AU1735076A/en not_active Expired
- 1976-09-01 GR GR51596A patent/GR65990B/el unknown
- 1976-09-02 CA CA260,429A patent/CA1102808A/en not_active Expired
- 1976-09-02 PT PT65544A patent/PT65544B/pt unknown
- 1976-09-02 US US05/719,970 patent/US4105795A/en not_active Expired - Lifetime
- 1976-09-02 AR AR264572A patent/AR216058A1/es active
- 1976-09-03 JP JP51106198A patent/JPS5239625A/ja active Pending
- 1976-09-03 HU HU76HE719A patent/HU176675B/hu unknown
- 1976-09-03 GB GB36589/76A patent/GB1526996A/en not_active Expired
- 1976-09-03 MX MX764883U patent/MX3845E/es unknown
- 1976-09-03 BE BE170357A patent/BE845856A/xx not_active IP Right Cessation
- 1976-09-03 ES ES451209A patent/ES451209A1/es not_active Expired
- 1976-09-03 FR FR7626691A patent/FR2322589A1/fr active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| IL50399A0 (en) | 1976-11-30 |
| PT65544B (de) | 1978-03-24 |
| US4105795A (en) | 1978-08-08 |
| DE2539220A1 (de) | 1977-03-17 |
| JPS5239625A (en) | 1977-03-28 |
| PT65544A (de) | 1976-10-01 |
| ES451209A1 (es) | 1977-12-16 |
| AU1735076A (en) | 1978-03-09 |
| ZA765176B (en) | 1977-08-31 |
| AR216058A1 (es) | 1979-11-30 |
| IL50399A (en) | 1981-10-30 |
| FR2322589B1 (enExample) | 1980-04-18 |
| CH627740A5 (de) | 1982-01-29 |
| HU176675B (en) | 1981-04-28 |
| MX3845E (es) | 1981-08-18 |
| FR2322589A1 (fr) | 1977-04-01 |
| NL7609598A (nl) | 1977-03-07 |
| ATA649576A (de) | 1979-03-15 |
| GB1526996A (en) | 1978-10-04 |
| AT352724B (de) | 1979-10-10 |
| BE845856A (fr) | 1976-12-31 |
| GR65990B (enExample) | 1981-01-13 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| ES479369A1 (es) | Metodo para preparar nuevas espiro (dihidrobenzofuran-pipe- ridinas y -pirrolidinas. | |
| JP2556722B2 (ja) | 新規なスルホンアミド化合物 | |
| IMMEDIATA et al. | β-Naphthyl derivatives of ethanolamine and n-substituted ethanolamines | |
| EP0496692A1 (en) | 2-Methoxyphenylpiperazine derivatives | |
| CA1102808A (en) | Substituted sulphoximides, a process for their preparation and pharmaceutical compositions containing these compounds | |
| US4032559A (en) | N,2-dicyanoacetimidates | |
| CS198297B2 (en) | Method of producing derivatives of urea | |
| US3985756A (en) | Process for producing azasulfonium salts and rearrangement thereof to thio-ethers | |
| US3905968A (en) | Preparation of 1,2-dichloro-3-amino propane derivatives | |
| EP0000355B1 (en) | New indole derivatives, processes for their preparation, and pharmaceutical compositions containing them. | |
| US4075409A (en) | Benzophenone derivatives | |
| EP0356152B1 (en) | Quaternary ammonium salts | |
| US3179665A (en) | 9-(n-ethyl and n-propyl piperidyl-3'-methyl)-thioxanthenes | |
| JPS5917106B2 (ja) | Ｎ−クロルホルミル−ｎ，ｎ’−二置換尿素誘導体の製法 | |
| SU747425A3 (ru) | Способ получени производных аминоалкоксибензофуранов | |
| US3894034A (en) | A process for producing azasulfonium salts | |
| JPH03200758A (ja) | スルホン酸エステル誘導体及び含窒素６員環化合物の製造方法 | |
| GB1577187A (en) | 2-sulphamamido-1,3,4,6,7,11b-hexahydro-2h-benzo(a)quinolizimes | |
| US3419559A (en) | 5-substituted-2-oxazolidinones | |
| US3432502A (en) | Preparation of pyrazinoylguanidine and pyrazinamidoguanidine products | |
| US4035375A (en) | N-Substituted amino pyridines and derivatives thereof | |
| US3299089A (en) | Derivatives of 5-methyloxazoline and 5-chloromethyloxazoline | |
| US3576819A (en) | Esters of alpha-(1-substituted-3-pyrrolidinyl)-alpha-phenyl acetic acid | |
| US3074850A (en) | Analgesic, antipyretic n-methyl-n'-halophenyl-urea | |
| JPS638114B2 (enExample) |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |