CA1096096A - Siloxane elastomer prepared from mercaptoorganopolysiloxanes - Google Patents
Siloxane elastomer prepared from mercaptoorganopolysiloxanesInfo
- Publication number
- CA1096096A CA1096096A CA286,882A CA286882A CA1096096A CA 1096096 A CA1096096 A CA 1096096A CA 286882 A CA286882 A CA 286882A CA 1096096 A CA1096096 A CA 1096096A
- Authority
- CA
- Canada
- Prior art keywords
- units
- weight
- parts
- formula
- siloxane units
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 229920001971 elastomer Polymers 0.000 title claims abstract description 14
- 239000000806 elastomer Substances 0.000 title claims abstract description 12
- KPUWHANPEXNPJT-UHFFFAOYSA-N disiloxane Chemical class [SiH3]O[SiH3] KPUWHANPEXNPJT-UHFFFAOYSA-N 0.000 title description 3
- 239000000203 mixture Substances 0.000 claims abstract description 41
- 239000000945 filler Substances 0.000 claims abstract description 14
- 238000002156 mixing Methods 0.000 claims abstract description 13
- 150000001451 organic peroxides Chemical class 0.000 claims abstract description 10
- -1 dimethyl-siloxane units Chemical group 0.000 claims description 39
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 5
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 4
- 239000000463 material Substances 0.000 claims description 4
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 3
- 125000004432 carbon atom Chemical group C* 0.000 claims description 3
- 229910052717 sulfur Inorganic materials 0.000 claims description 3
- 239000011593 sulfur Substances 0.000 claims description 3
- 229920001296 polysiloxane Polymers 0.000 claims 2
- 229910020447 SiO2/2 Inorganic materials 0.000 claims 1
- 239000000565 sealant Substances 0.000 abstract description 7
- 238000010438 heat treatment Methods 0.000 abstract description 4
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 13
- 150000002978 peroxides Chemical class 0.000 description 8
- 235000013870 dimethyl polysiloxane Nutrition 0.000 description 6
- 239000004205 dimethyl polysiloxane Substances 0.000 description 5
- 229920000435 poly(dimethylsiloxane) Polymers 0.000 description 5
- DOIRQSBPFJWKBE-UHFFFAOYSA-N dibutyl phthalate Chemical compound CCCCOC(=O)C1=CC=CC=C1C(=O)OCCCC DOIRQSBPFJWKBE-UHFFFAOYSA-N 0.000 description 4
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 4
- 239000010453 quartz Substances 0.000 description 4
- 239000000377 silicon dioxide Substances 0.000 description 4
- 125000003396 thiol group Chemical class [H]S* 0.000 description 4
- WRXCBRHBHGNNQA-UHFFFAOYSA-N (2,4-dichlorobenzoyl) 2,4-dichlorobenzenecarboperoxoate Chemical compound ClC1=CC(Cl)=CC=C1C(=O)OOC(=O)C1=CC=C(Cl)C=C1Cl WRXCBRHBHGNNQA-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- 239000003054 catalyst Substances 0.000 description 3
- 239000003517 fume Substances 0.000 description 3
- 230000005764 inhibitory process Effects 0.000 description 3
- 238000000034 method Methods 0.000 description 3
- FRIBMENBGGCKPD-UHFFFAOYSA-N 3-(2,3-dimethoxyphenyl)prop-2-enal Chemical compound COC1=CC=CC(C=CC=O)=C1OC FRIBMENBGGCKPD-UHFFFAOYSA-N 0.000 description 2
- 239000004342 Benzoyl peroxide Substances 0.000 description 2
- OMPJBNCRMGITSC-UHFFFAOYSA-N Benzoylperoxide Chemical compound C=1C=CC=CC=1C(=O)OOC(=O)C1=CC=CC=C1 OMPJBNCRMGITSC-UHFFFAOYSA-N 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- 235000019400 benzoyl peroxide Nutrition 0.000 description 2
- 229960002380 dibutyl phthalate Drugs 0.000 description 2
- 238000001879 gelation Methods 0.000 description 2
- QUPCNWFFTANZPX-UHFFFAOYSA-M paramenthane hydroperoxide Chemical compound [O-]O.CC(C)C1CCC(C)CC1 QUPCNWFFTANZPX-UHFFFAOYSA-M 0.000 description 2
- 229910052697 platinum Inorganic materials 0.000 description 2
- IALUUOKJPBOFJL-UHFFFAOYSA-N potassium oxidosilane Chemical compound [K+].[SiH3][O-] IALUUOKJPBOFJL-UHFFFAOYSA-N 0.000 description 2
- 229920002379 silicone rubber Polymers 0.000 description 2
- 125000004434 sulfur atom Chemical group 0.000 description 2
- GJBRNHKUVLOCEB-UHFFFAOYSA-N tert-butyl benzenecarboperoxoate Chemical compound CC(C)(C)OOC(=O)C1=CC=CC=C1 GJBRNHKUVLOCEB-UHFFFAOYSA-N 0.000 description 2
- CIHOLLKRGTVIJN-UHFFFAOYSA-N tert‐butyl hydroperoxide Chemical compound CC(C)(C)OO CIHOLLKRGTVIJN-UHFFFAOYSA-N 0.000 description 2
- 238000004073 vulcanization Methods 0.000 description 2
- DMWVYCCGCQPJEA-UHFFFAOYSA-N 2,5-bis(tert-butylperoxy)-2,5-dimethylhexane Chemical compound CC(C)(C)OOC(C)(C)CCC(C)(C)OOC(C)(C)C DMWVYCCGCQPJEA-UHFFFAOYSA-N 0.000 description 1
- XMNIXWIUMCBBBL-UHFFFAOYSA-N 2-(2-phenylpropan-2-ylperoxy)propan-2-ylbenzene Chemical compound C=1C=CC=CC=1C(C)(C)OOC(C)(C)C1=CC=CC=C1 XMNIXWIUMCBBBL-UHFFFAOYSA-N 0.000 description 1
- 101100087530 Caenorhabditis elegans rom-1 gene Proteins 0.000 description 1
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- 101100305983 Mus musculus Rom1 gene Proteins 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- 229910004674 SiO0.5 Inorganic materials 0.000 description 1
- 229910020175 SiOH Inorganic materials 0.000 description 1
- DHXVGJBLRPWPCS-UHFFFAOYSA-N Tetrahydropyran Chemical compound C1CCOCC1 DHXVGJBLRPWPCS-UHFFFAOYSA-N 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- 239000006229 carbon black Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 238000013329 compounding Methods 0.000 description 1
- 238000005260 corrosion Methods 0.000 description 1
- 230000007797 corrosion Effects 0.000 description 1
- 238000004132 cross linking Methods 0.000 description 1
- LSXWFXONGKSEMY-UHFFFAOYSA-N di-tert-butyl peroxide Chemical compound CC(C)(C)OOC(C)(C)C LSXWFXONGKSEMY-UHFFFAOYSA-N 0.000 description 1
- 239000012969 di-tertiary-butyl peroxide Substances 0.000 description 1
- 229910001882 dioxygen Inorganic materials 0.000 description 1
- 150000002432 hydroperoxides Chemical class 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 238000011068 loading method Methods 0.000 description 1
- 125000005358 mercaptoalkyl group Chemical group 0.000 description 1
- 125000005375 organosiloxane group Chemical group 0.000 description 1
- 125000000864 peroxy group Chemical group O(O*)* 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- 230000037452 priming Effects 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 150000004756 silanes Chemical class 0.000 description 1
- 239000004945 silicone rubber Substances 0.000 description 1
- 229910052709 silver Inorganic materials 0.000 description 1
- 239000004332 silver Substances 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
- 238000004381 surface treatment Methods 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K5/00—Use of organic ingredients
- C08K5/04—Oxygen-containing compounds
- C08K5/14—Peroxides
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Compositions Of Macromolecular Compounds (AREA)
- Sealing Material Composition (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US756,294 | 1977-01-03 | ||
| US05/756,294 US4070329A (en) | 1977-01-03 | 1977-01-03 | Siloxane elastomer prepared from mercaptoorg anopolysiloxanes |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1096096A true CA1096096A (en) | 1981-02-17 |
Family
ID=25042848
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA286,882A Expired CA1096096A (en) | 1977-01-03 | 1977-09-16 | Siloxane elastomer prepared from mercaptoorganopolysiloxanes |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US4070329A (enExample) |
| JP (1) | JPS5385847A (enExample) |
| CA (1) | CA1096096A (enExample) |
| DE (1) | DE2754702C3 (enExample) |
| FR (1) | FR2376186A1 (enExample) |
| GB (1) | GB1590109A (enExample) |
Families Citing this family (20)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4239674A (en) * | 1979-08-02 | 1980-12-16 | Dow Corning Corporation | Oxygen-curable mercaptoorganosiloxane compositions catalyzed by cobaltocene compounds and method of forming higher molecular weight products therefrom |
| US4269963A (en) * | 1979-12-03 | 1981-05-26 | Dow Corning Corporation | Mercaptoorganopolysiloxanes and curable compositions including same |
| US4293676A (en) * | 1979-12-03 | 1981-10-06 | Dow Corning Corporation | Oxygen-curable mercaptoorganosiloxane compositions containing both redox and iron carbonyl compounds and method of forming higher molecular weight products therefrom |
| US4269741A (en) * | 1979-12-03 | 1981-05-26 | Dow Corning Corporation | Oxygen-curable mercaptoorganosiloxane compositions possessing rapid surface reaction and method of forming higher molecular weight products therefrom |
| US4268655A (en) * | 1979-12-03 | 1981-05-19 | Dow Corning Corporation | Ferrocene catalyzed elastomer formation |
| US4279792A (en) * | 1979-12-03 | 1981-07-21 | Dow Corning Corporation | Compositions including mercaptoorganopolysiloxanes and stannous salts of carboxylic acids |
| US4252932A (en) * | 1979-12-03 | 1981-02-24 | Dow Corning Corporation | Oxygen-curable mercaptoorganosiloxane compositions catalyzed by metal carbonyl compounds and method of forming higher molecular weight products therefrom |
| US4272415A (en) * | 1979-12-03 | 1981-06-09 | Dow Corning Corporation | Compositions including mercaptoorganopolysiloxanes and metal salts of carboxylic acids |
| US4284539A (en) * | 1979-12-03 | 1981-08-18 | Dow Corning Corporation | Compositions including mercaptoorganopolysiloxanes, aliphatically unsaturated polydiorganosiloxanes and carboxylic acid salts of metals |
| US4272623A (en) * | 1979-12-03 | 1981-06-09 | Dow Corning Corporation | Mercaptoorganopolysiloxane elastomers catalyzed by metallic compounds in the presence of peroxides |
| US4292422A (en) * | 1979-12-03 | 1981-09-29 | Dow Corning Corporation | Oxygen-curable mercapto-functional organosilicon-organic compound compositions catalyzed by metal carbonyl compounds and method of forming higher molecular weight products therefrom |
| US4265792A (en) * | 1979-12-03 | 1981-05-05 | Dow Corning Corporation | Compositions including mercaptoorganopolysiloxanes and stannic salts of carboxylic acids |
| US4292223A (en) * | 1980-01-04 | 1981-09-29 | Ford Motor Company | Highly filled thermally conductive elastomers I |
| US4292224A (en) * | 1980-01-04 | 1981-09-29 | Ford Motor Company | Highly filled thermally conductive elastomers II |
| US4293477A (en) * | 1980-01-04 | 1981-10-06 | Ford Motor Company | Highly filled thermally conductive elastomers III |
| US4292225A (en) * | 1980-01-04 | 1981-09-29 | Ford Motor Company | Highly filled thermally conductive elastomers IV |
| US4526954A (en) * | 1983-12-28 | 1985-07-02 | Union Carbide Corporation | Organosiloxane polymers and compositions containing same curable upon exposure to gaseous oxygen |
| DE4135142A1 (de) * | 1991-10-24 | 1993-04-29 | Wacker Chemie Gmbh | S-alkylthiosulfatgruppen aufweisende organosiliciumverbindungen, verfahren zu ihrer herstellung und verwendung dieser organosiliciumverbindungen |
| DE10132942A1 (de) * | 2001-07-06 | 2003-01-23 | Degussa | Siloxan-Oligomere, Verfahren zu deren Herstellung und deren Verwendung |
| JPWO2024190331A1 (enExample) * | 2023-03-16 | 2024-09-19 |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3382196A (en) * | 1965-06-03 | 1968-05-07 | Dow Corning | Organic rubbers with mercaptoorganosiloxanes having improved elongation |
| US3925331A (en) * | 1971-06-03 | 1975-12-09 | Albright & Wilson | Polymeric sealants |
| US3873499A (en) * | 1973-11-29 | 1975-03-25 | Dow Corning | Fast curing mercaptoalkyl vinyl siloxane resins |
| JPS5312958A (en) * | 1976-07-22 | 1978-02-06 | Shin Etsu Chem Co Ltd | Mercapto group-containing silicone rubber composition |
| JPS5331902A (en) * | 1976-09-04 | 1978-03-25 | Matsushita Electric Ind Co Ltd | High-frequency electric wave shielding body |
-
1977
- 1977-01-03 US US05/756,294 patent/US4070329A/en not_active Expired - Lifetime
- 1977-09-16 CA CA286,882A patent/CA1096096A/en not_active Expired
- 1977-11-21 JP JP13980077A patent/JPS5385847A/ja active Granted
- 1977-12-08 DE DE2754702A patent/DE2754702C3/de not_active Expired
- 1977-12-30 GB GB54286/77A patent/GB1590109A/en not_active Expired
- 1977-12-30 FR FR7739814A patent/FR2376186A1/fr active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| DE2754702A1 (de) | 1978-07-06 |
| DE2754702B2 (de) | 1979-09-13 |
| JPS5385847A (en) | 1978-07-28 |
| JPS5539262B2 (enExample) | 1980-10-09 |
| US4070329A (en) | 1978-01-24 |
| DE2754702C3 (de) | 1980-06-04 |
| GB1590109A (en) | 1981-05-28 |
| FR2376186B1 (enExample) | 1980-08-22 |
| FR2376186A1 (fr) | 1978-07-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1096096A (en) | Siloxane elastomer prepared from mercaptoorganopolysiloxanes | |
| CA1315453C (en) | Method for preparing clear polyorganosiloxane elastomers | |
| AU597511B2 (en) | Curable organosiloxane compositions | |
| US4539357A (en) | Peroxide curing polysiloxane compositions having a high tear strength | |
| US4585848A (en) | Fluorosilicone rubber composition, process and polymer | |
| US4066603A (en) | Sulfur containing silicone elastomer and method of preparation | |
| US4355121A (en) | Heat strength curable silicone rubber compositions | |
| US5081172A (en) | Method to reduce compression set in silanol-containing silicone elastomer bases | |
| US4039505A (en) | Siloxane elastomers containing sulfur and method of preparation | |
| CA1096095A (en) | Mercaptoorganopolysiloxanes cured to elastomers with peroxides and nitrogen compounds | |
| US6753400B2 (en) | Room temperature curing organopolysiloxane composition | |
| EP0489391A2 (en) | Extrudable curable organosiloxane compositions | |
| CA1073586A (en) | Method of increasing the molecular weight of hydroxyl endblocked polydiorganosiloxanes | |
| EP0903379A2 (en) | High consistency elastomer for fluid handling applications | |
| CA1055636A (en) | Vinyl polydiorganosiloxane-mercaptoorganosiloxaneorganic peroxide composition curable to elastomer and method therefor | |
| US4144206A (en) | Static dissipating heat curable silicone rubber compositions | |
| US5206329A (en) | One part heat curable organopolysiloxane compositions | |
| US5674935A (en) | Vinyl-containing silanol-terminated silicone compositions for treatment of fillers | |
| RU2189995C2 (ru) | Органополисилоксановые материалы, которые могут быть поперечно сшиты расщепляющими спиртами в эластомеры | |
| EP0489518A1 (en) | Extrudable curable organosiloxane compositions exhibiting reduced compression set | |
| GB2096631A (en) | Fluorosilicone rubber composition process and polymer | |
| CA1138592A (en) | Oxygen-curable mercaptoorganosiloxane compositions catalyzed by cobaltocene compounds and method of forming higher molecular weight products therefrom | |
| AU622893B2 (en) | Transparent flame-retardant silicone rubber compositions | |
| GB2091281A (en) | Pasty organipolysiloxane compositions undergoing thermisetting to form elastomers | |
| US5183873A (en) | Room temperature stable organopolysiloxane compositions |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |