CA1095307A - Photochromic borosilicate glass having a specific molar ratio of alkali metal and boron oxides - Google Patents
Photochromic borosilicate glass having a specific molar ratio of alkali metal and boron oxidesInfo
- Publication number
- CA1095307A CA1095307A CA323,627A CA323627A CA1095307A CA 1095307 A CA1095307 A CA 1095307A CA 323627 A CA323627 A CA 323627A CA 1095307 A CA1095307 A CA 1095307A
- Authority
- CA
- Canada
- Prior art keywords
- glass
- photochromic
- weight
- glasses
- alkali metal
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 229910000272 alkali metal oxide Inorganic materials 0.000 title claims abstract description 55
- 150000001340 alkali metals Chemical class 0.000 title claims abstract description 11
- 229910052810 boron oxide Inorganic materials 0.000 title 1
- 239000005388 borosilicate glass Substances 0.000 title 1
- MOWNZPNSYMGTMD-UHFFFAOYSA-N oxidoboron Chemical class O=[B] MOWNZPNSYMGTMD-UHFFFAOYSA-N 0.000 title 1
- 239000011521 glass Substances 0.000 claims abstract description 189
- 239000000203 mixture Substances 0.000 claims abstract description 73
- 239000002585 base Substances 0.000 claims abstract description 30
- 229910052709 silver Inorganic materials 0.000 claims abstract description 20
- 229910052783 alkali metal Inorganic materials 0.000 claims abstract description 10
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 claims abstract description 6
- 229910052593 corundum Inorganic materials 0.000 claims abstract description 6
- 229910001845 yogo sapphire Inorganic materials 0.000 claims abstract description 6
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 claims description 89
- 238000002834 transmittance Methods 0.000 claims description 49
- 229910052681 coesite Inorganic materials 0.000 claims description 44
- 229910052906 cristobalite Inorganic materials 0.000 claims description 44
- 229910052682 stishovite Inorganic materials 0.000 claims description 44
- 229910052905 tridymite Inorganic materials 0.000 claims description 44
- 239000000377 silicon dioxide Substances 0.000 claims description 43
- 235000012239 silicon dioxide Nutrition 0.000 claims description 43
- MCMNRKCIXSYSNV-UHFFFAOYSA-N Zirconium dioxide Chemical compound O=[Zr]=O MCMNRKCIXSYSNV-UHFFFAOYSA-N 0.000 claims description 42
- KKCBUQHMOMHUOY-UHFFFAOYSA-N Na2O Inorganic materials [O-2].[Na+].[Na+] KKCBUQHMOMHUOY-UHFFFAOYSA-N 0.000 claims description 40
- FUJCRWPEOMXPAD-UHFFFAOYSA-N Li2O Inorganic materials [Li+].[Li+].[O-2] FUJCRWPEOMXPAD-UHFFFAOYSA-N 0.000 claims description 37
- 230000005855 radiation Effects 0.000 claims description 36
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 claims description 34
- 239000006121 base glass Substances 0.000 claims description 25
- XUCJHNOBJLKZNU-UHFFFAOYSA-M dilithium;hydroxide Chemical compound [Li+].[Li+].[OH-] XUCJHNOBJLKZNU-UHFFFAOYSA-M 0.000 claims description 25
- 150000001768 cations Chemical class 0.000 claims description 24
- 239000004615 ingredient Substances 0.000 claims description 14
- ZKATWMILCYLAPD-UHFFFAOYSA-N niobium pentoxide Chemical compound O=[Nb](=O)O[Nb](=O)=O ZKATWMILCYLAPD-UHFFFAOYSA-N 0.000 claims description 13
- 229910052801 chlorine Inorganic materials 0.000 claims description 7
- 229910052794 bromium Inorganic materials 0.000 claims description 6
- KOPBYBDAPCDYFK-UHFFFAOYSA-N Cs2O Inorganic materials [O-2].[Cs+].[Cs+] KOPBYBDAPCDYFK-UHFFFAOYSA-N 0.000 claims description 5
- 229910052751 metal Inorganic materials 0.000 claims description 5
- 239000002184 metal Substances 0.000 claims description 5
- AKUNKIJLSDQFLS-UHFFFAOYSA-M dicesium;hydroxide Chemical compound [OH-].[Cs+].[Cs+] AKUNKIJLSDQFLS-UHFFFAOYSA-M 0.000 claims description 4
- 229910044991 metal oxide Inorganic materials 0.000 claims description 4
- 150000004706 metal oxides Chemical class 0.000 claims description 4
- 229910001404 rare earth metal oxide Inorganic materials 0.000 claims description 3
- 229910052731 fluorine Inorganic materials 0.000 claims description 2
- MRELNEQAGSRDBK-UHFFFAOYSA-N lanthanum oxide Inorganic materials [O-2].[O-2].[O-2].[La+3].[La+3] MRELNEQAGSRDBK-UHFFFAOYSA-N 0.000 claims description 2
- KTUFCUMIWABKDW-UHFFFAOYSA-N oxo(oxolanthaniooxy)lanthanum Chemical compound O=[La]O[La]=O KTUFCUMIWABKDW-UHFFFAOYSA-N 0.000 claims description 2
- 229910016341 Al2O3 ZrO2 Inorganic materials 0.000 claims 1
- 229910000314 transition metal oxide Inorganic materials 0.000 claims 1
- 238000005562 fading Methods 0.000 abstract description 19
- 239000004332 silver Substances 0.000 abstract description 15
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 abstract description 10
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 abstract description 8
- 239000013078 crystal Substances 0.000 abstract description 7
- 239000010949 copper Substances 0.000 abstract description 5
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 abstract description 4
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 abstract description 4
- 229910052802 copper Inorganic materials 0.000 abstract description 4
- 230000003287 optical effect Effects 0.000 abstract description 4
- 229910021607 Silver chloride Inorganic materials 0.000 abstract description 3
- 239000003795 chemical substances by application Substances 0.000 abstract description 3
- ADZWSOLPGZMUMY-UHFFFAOYSA-M silver bromide Chemical compound [Ag]Br ADZWSOLPGZMUMY-UHFFFAOYSA-M 0.000 abstract description 3
- HKZLPVFGJNLROG-UHFFFAOYSA-M silver monochloride Chemical compound [Cl-].[Ag+] HKZLPVFGJNLROG-UHFFFAOYSA-M 0.000 abstract description 3
- 239000003814 drug Substances 0.000 abstract description 2
- 229940079593 drug Drugs 0.000 abstract description 2
- 230000000704 physical effect Effects 0.000 abstract description 2
- JPVYNHNXODAKFH-UHFFFAOYSA-N Cu2+ Chemical compound [Cu+2] JPVYNHNXODAKFH-UHFFFAOYSA-N 0.000 abstract 1
- 229910001431 copper ion Inorganic materials 0.000 abstract 1
- 230000001235 sensitizing effect Effects 0.000 abstract 1
- 230000002277 temperature effect Effects 0.000 abstract 1
- 150000004820 halides Chemical class 0.000 description 23
- 238000002844 melting Methods 0.000 description 17
- 230000008018 melting Effects 0.000 description 17
- 238000010438 heat treatment Methods 0.000 description 16
- 230000000694 effects Effects 0.000 description 10
- 238000000034 method Methods 0.000 description 10
- -1 silver halide Chemical class 0.000 description 10
- 238000003426 chemical strengthening reaction Methods 0.000 description 9
- 239000000126 substance Substances 0.000 description 9
- 150000002500 ions Chemical class 0.000 description 8
- 238000011282 treatment Methods 0.000 description 8
- 101100086726 Homo sapiens RCC2 gene Proteins 0.000 description 7
- 102100039972 Protein RCC2 Human genes 0.000 description 7
- 239000000470 constituent Substances 0.000 description 7
- 230000008569 process Effects 0.000 description 7
- 238000007792 addition Methods 0.000 description 6
- 238000011160 research Methods 0.000 description 6
- 229910019142 PO4 Inorganic materials 0.000 description 5
- 239000003513 alkali Substances 0.000 description 5
- 238000004458 analytical method Methods 0.000 description 5
- 239000011022 opal Substances 0.000 description 5
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 5
- 239000010452 phosphate Substances 0.000 description 5
- 235000021317 phosphate Nutrition 0.000 description 5
- 230000009467 reduction Effects 0.000 description 5
- 238000006722 reduction reaction Methods 0.000 description 5
- 101000856746 Bos taurus Cytochrome c oxidase subunit 7A1, mitochondrial Proteins 0.000 description 4
- 230000008859 change Effects 0.000 description 4
- 238000011161 development Methods 0.000 description 4
- 238000005259 measurement Methods 0.000 description 4
- 239000000155 melt Substances 0.000 description 4
- 239000002245 particle Substances 0.000 description 4
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 4
- 150000003839 salts Chemical class 0.000 description 4
- 238000005496 tempering Methods 0.000 description 4
- 239000006105 batch ingredient Substances 0.000 description 3
- QDOXWKRWXJOMAK-UHFFFAOYSA-N chromium(III) oxide Inorganic materials O=[Cr]O[Cr]=O QDOXWKRWXJOMAK-UHFFFAOYSA-N 0.000 description 3
- 230000001419 dependent effect Effects 0.000 description 3
- 230000001747 exhibiting effect Effects 0.000 description 3
- 238000001228 spectrum Methods 0.000 description 3
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- 229910021612 Silver iodide Inorganic materials 0.000 description 2
- 229910000831 Steel Inorganic materials 0.000 description 2
- 230000009471 action Effects 0.000 description 2
- 230000002411 adverse Effects 0.000 description 2
- 230000008901 benefit Effects 0.000 description 2
- 229910052796 boron Inorganic materials 0.000 description 2
- 229910052729 chemical element Inorganic materials 0.000 description 2
- 239000003086 colorant Substances 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 230000003247 decreasing effect Effects 0.000 description 2
- 230000002939 deleterious effect Effects 0.000 description 2
- 230000002349 favourable effect Effects 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 229910052697 platinum Inorganic materials 0.000 description 2
- 238000001556 precipitation Methods 0.000 description 2
- 229910000108 silver(I,III) oxide Inorganic materials 0.000 description 2
- 239000010959 steel Substances 0.000 description 2
- 238000006467 substitution reaction Methods 0.000 description 2
- 238000012360 testing method Methods 0.000 description 2
- 238000004876 x-ray fluorescence Methods 0.000 description 2
- JKFYKCYQEWQPTM-UHFFFAOYSA-N 2-azaniumyl-2-(4-fluorophenyl)acetate Chemical compound OC(=O)C(N)C1=CC=C(F)C=C1 JKFYKCYQEWQPTM-UHFFFAOYSA-N 0.000 description 1
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical compound [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 241001050985 Disco Species 0.000 description 1
- 241000402754 Erythranthe moschata Species 0.000 description 1
- 206010056740 Genital discharge Diseases 0.000 description 1
- AYFVYJQAPQTCCC-GBXIJSLDSA-N L-threonine Chemical compound C[C@@H](O)[C@H](N)C(O)=O AYFVYJQAPQTCCC-GBXIJSLDSA-N 0.000 description 1
- 229910019704 Nb2O Inorganic materials 0.000 description 1
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical compound [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 229910001508 alkali metal halide Inorganic materials 0.000 description 1
- 150000008045 alkali metal halides Chemical class 0.000 description 1
- 229910001413 alkali metal ion Inorganic materials 0.000 description 1
- 229910000287 alkaline earth metal oxide Inorganic materials 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 239000005407 aluminoborosilicate glass Substances 0.000 description 1
- 238000013459 approach Methods 0.000 description 1
- 230000002238 attenuated effect Effects 0.000 description 1
- QVQLCTNNEUAWMS-UHFFFAOYSA-N barium oxide Inorganic materials [Ba]=O QVQLCTNNEUAWMS-UHFFFAOYSA-N 0.000 description 1
- 230000005540 biological transmission Effects 0.000 description 1
- 229910052793 cadmium Inorganic materials 0.000 description 1
- BBBFJLBPOGFECG-VJVYQDLKSA-N calcitonin Chemical compound N([C@H](C(=O)N[C@@H](CC(C)C)C(=O)NCC(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CO)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC=1NC=NC=1)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](CC=1C=CC(O)=CC=1)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H]([C@@H](C)O)C(=O)NCC(=O)N[C@@H](CO)C(=O)NCC(=O)N[C@@H]([C@@H](C)O)C(=O)N1[C@@H](CCC1)C(N)=O)C(C)C)C(=O)[C@@H]1CSSC[C@H](N)C(=O)N[C@@H](CO)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CO)C(=O)N[C@@H]([C@@H](C)O)C(=O)N1 BBBFJLBPOGFECG-VJVYQDLKSA-N 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 238000004737 colorimetric analysis Methods 0.000 description 1
- 238000004040 coloring Methods 0.000 description 1
- 239000013065 commercial product Substances 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 239000002131 composite material Substances 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 238000013480 data collection Methods 0.000 description 1
- 230000002950 deficient Effects 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- XUFQPHANEAPEMJ-UHFFFAOYSA-N famotidine Chemical compound NC(N)=NC1=NC(CSCCC(N)=NS(N)(=O)=O)=CS1 XUFQPHANEAPEMJ-UHFFFAOYSA-N 0.000 description 1
- 239000005350 fused silica glass Substances 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 239000010439 graphite Substances 0.000 description 1
- 229910002804 graphite Inorganic materials 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- VKYKSIONXSXAKP-UHFFFAOYSA-N hexamethylenetetramine Chemical compound C1N(C2)CN3CN1CN2C3 VKYKSIONXSXAKP-UHFFFAOYSA-N 0.000 description 1
- JYTUFVYWTIKZGR-UHFFFAOYSA-N holmium oxide Inorganic materials [O][Ho]O[Ho][O] JYTUFVYWTIKZGR-UHFFFAOYSA-N 0.000 description 1
- 238000007654 immersion Methods 0.000 description 1
- 230000006872 improvement Effects 0.000 description 1
- 238000010348 incorporation Methods 0.000 description 1
- 230000003993 interaction Effects 0.000 description 1
- 238000011835 investigation Methods 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 239000010410 layer Substances 0.000 description 1
- ZPPSOOVFTBGHBI-UHFFFAOYSA-N lead(2+);oxido(oxo)borane Chemical compound [Pb+2].[O-]B=O.[O-]B=O ZPPSOOVFTBGHBI-UHFFFAOYSA-N 0.000 description 1
- YEXPOXQUZXUXJW-UHFFFAOYSA-N lead(II) oxide Inorganic materials [Pb]=O YEXPOXQUZXUXJW-UHFFFAOYSA-N 0.000 description 1
- 230000007246 mechanism Effects 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- 239000010453 quartz Substances 0.000 description 1
- 230000036647 reaction Effects 0.000 description 1
- 238000012552 review Methods 0.000 description 1
- 229910001953 rubidium(I) oxide Inorganic materials 0.000 description 1
- 238000012163 sequencing technique Methods 0.000 description 1
- 239000005368 silicate glass Substances 0.000 description 1
- 229910052710 silicon Inorganic materials 0.000 description 1
- 239000010703 silicon Substances 0.000 description 1
- 229940045105 silver iodide Drugs 0.000 description 1
- VWDWKYIASSYTQR-UHFFFAOYSA-N sodium nitrate Inorganic materials [Na+].[O-][N+]([O-])=O VWDWKYIASSYTQR-UHFFFAOYSA-N 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 230000003595 spectral effect Effects 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000002344 surface layer Substances 0.000 description 1
- 230000009466 transformation Effects 0.000 description 1
- 229910052723 transition metal Inorganic materials 0.000 description 1
- 150000003624 transition metals Chemical class 0.000 description 1
- 238000010792 warming Methods 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
- 238000004846 x-ray emission Methods 0.000 description 1
- 229910052724 xenon Inorganic materials 0.000 description 1
- FHNFHKCVQCLJFQ-UHFFFAOYSA-N xenon atom Chemical compound [Xe] FHNFHKCVQCLJFQ-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C03—GLASS; MINERAL OR SLAG WOOL
- C03C—CHEMICAL COMPOSITION OF GLASSES, GLAZES OR VITREOUS ENAMELS; SURFACE TREATMENT OF GLASS; SURFACE TREATMENT OF FIBRES OR FILAMENTS MADE FROM GLASS, MINERALS OR SLAGS; JOINING GLASS TO GLASS OR OTHER MATERIALS
- C03C4/00—Compositions for glass with special properties
- C03C4/04—Compositions for glass with special properties for photosensitive glass
- C03C4/06—Compositions for glass with special properties for photosensitive glass for phototropic or photochromic glass
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10—TECHNICAL SUBJECTS COVERED BY FORMER USPC
- Y10S—TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10S501/00—Compositions: ceramic
- Y10S501/90—Optical glass, e.g. silent on refractive index and/or ABBE number
- Y10S501/903—Optical glass, e.g. silent on refractive index and/or ABBE number having refractive index less than 1.8 and ABBE number less than 70
Landscapes
- Chemical & Material Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Engineering & Computer Science (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Geochemistry & Mineralogy (AREA)
- Materials Engineering (AREA)
- Organic Chemistry (AREA)
- Glass Compositions (AREA)
- Eyeglasses (AREA)
- Surface Treatment Of Glass (AREA)
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US88767778A | 1978-03-17 | 1978-03-17 | |
| US887,677 | 1978-03-17 | ||
| US06/014,981 US4190451A (en) | 1978-03-17 | 1979-02-28 | Photochromic glass |
| US014,981 | 1993-02-08 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1095307A true CA1095307A (en) | 1981-02-10 |
Family
ID=26686800
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA323,627A Expired CA1095307A (en) | 1978-03-17 | 1979-03-15 | Photochromic borosilicate glass having a specific molar ratio of alkali metal and boron oxides |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US4190451A (enExample) |
| JP (1) | JPS54139624A (enExample) |
| AR (1) | AR229392A1 (enExample) |
| AU (1) | AU522765B2 (enExample) |
| BR (1) | BR7901630A (enExample) |
| CA (1) | CA1095307A (enExample) |
| DE (1) | DE2910006C2 (enExample) |
| GB (1) | GB2016441B (enExample) |
| IT (1) | IT1112379B (enExample) |
| MX (1) | MX151973A (enExample) |
Families Citing this family (68)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4211569A (en) * | 1979-03-09 | 1980-07-08 | Corning Glass Works | High index ophthalmic glasses |
| BR8006255A (pt) * | 1979-10-12 | 1981-04-14 | Pilkington Brothers Ltd | Vidro fotocromico de aluminio-fosfato |
| US4240836A (en) * | 1979-11-19 | 1980-12-23 | Corning Glass Works | Colored photochromic glasses and method |
| DE3042553C2 (de) * | 1979-11-19 | 1995-01-05 | Corning Glass Works | Silberhalogenid enthaltender photochromer Glaskörper |
| US4282022A (en) * | 1980-04-28 | 1981-08-04 | Corning Glass Works | Method for making polarizing glasses through extrusion |
| US4304584A (en) * | 1980-04-28 | 1981-12-08 | Corning Glass Works | Method for making polarizing glasses by extrusion |
| US4284686A (en) * | 1980-06-09 | 1981-08-18 | Corning Glass Works | Spectacle lenses to reduce discomfort from aphakia and certain eye diseases |
| US4358542A (en) * | 1981-04-08 | 1982-11-09 | Corning Glass Works | Photochromic glass suitable for microsheet and simultaneous heat treatment and shaping |
| DE3117000C2 (de) * | 1981-04-29 | 1986-05-28 | Schott Glaswerke, 6500 Mainz | Phototropes Glas mit einem Brechungsindex ≥ 1,59, einer Abbezahl ≥ 40 und einer Dichte ≦ 3,2 g/cm↑3↑ |
| US4374931A (en) * | 1982-01-08 | 1983-02-22 | Corning Glass Works | Photochromic glass suitable for ophthalmic applications |
| DE3206958C2 (de) * | 1982-02-26 | 1986-09-18 | Schott Glaswerke, 6500 Mainz | Phototropes Glas mit einem Brechungsindex ≥ 1,59, einer Abbezahl ≥ 44 und einer Dichte ≦ 3,0 g/cm↑3↑ |
| US4390635A (en) * | 1982-03-01 | 1983-06-28 | Corning Glass Works | Alkali metal aluminoborosilicate photochromic glasses |
| US4710430A (en) * | 1982-04-01 | 1987-12-01 | Corning Glass Works | Colored photochromic glasses and method |
| DE3220367A1 (de) * | 1982-05-29 | 1983-12-01 | Schott Glaswerke, 6500 Mainz | Phototropes glas mit brauntoenung im belichteten zustand |
| US4407966A (en) * | 1982-09-16 | 1983-10-04 | Corning Glass Works | Very fast fading photochromic glass |
| US4670366A (en) * | 1983-06-24 | 1987-06-02 | Canyon Materials Research & Engineering | High energy beam sensitive glasses |
| US4567104A (en) * | 1983-06-24 | 1986-01-28 | Canyon Materials Research & Engineering | High energy beam colored glasses exhibiting insensitivity to actinic radiation |
| US4894303A (en) * | 1983-06-24 | 1990-01-16 | Canyon Materials Research & Engineering | High energy beam-sensitive glasses |
| EP0399577A1 (en) * | 1983-06-24 | 1990-11-28 | Canyon Materials Inc. | A method for making high energy beam sensitive glasses |
| US4550087A (en) * | 1984-09-13 | 1985-10-29 | Corning Glass Works | Photochromic comfort glasses |
| FR2584706B1 (fr) * | 1985-07-11 | 1991-08-16 | Corning Glass Works | Verre photochromique a eclaircissement rapide |
| US4608349A (en) * | 1985-11-12 | 1986-08-26 | Corning Glass Works | Photochromic glass compositions for lightweight lenses |
| US4842632A (en) * | 1987-11-03 | 1989-06-27 | Corning Glass Works | Method of making multifocal lens blanks |
| US4832724A (en) * | 1988-02-26 | 1989-05-23 | Corning Glass Works | Method of making colored photochromic glasses |
| US4840655A (en) * | 1988-02-26 | 1989-06-20 | Corning Glass Works | Method for making colored photochromic glasses |
| US4854957A (en) * | 1988-04-13 | 1989-08-08 | Corning Incorporated | Method for modifying coloration in tinted photochromic glasses |
| DE3825210A1 (de) * | 1988-07-25 | 1990-02-08 | Deutsche Spezialglas Ag | Hochbrechendes phototropes glas niedriger dichte |
| US4908054A (en) * | 1989-02-21 | 1990-03-13 | Corning Incorporated | Method for making infrared polarizing glasses |
| US4980318A (en) * | 1989-05-10 | 1990-12-25 | Corning Incorporated | High refractive index photochromic glasses |
| FR2653239B1 (fr) * | 1989-10-12 | 1992-10-30 | Corning France | Verres photochromiques a indice de refraction eleve et a eclaircissement rapide. |
| JPH0794334B2 (ja) * | 1991-03-04 | 1995-10-11 | 五鈴精工硝子株式会社 | 着色ガラス |
| DE4213493C2 (de) * | 1992-04-24 | 1997-04-24 | Deutsche Spezialglas Ag | Indikator zum Nachweis von UV-B Strahlung |
| US5256601A (en) * | 1992-10-07 | 1993-10-26 | Corning Incorporated | Slow fading photochromic glass |
| US5381193A (en) * | 1993-02-22 | 1995-01-10 | Corning Incorporated | Protective filter lenses |
| US5482901A (en) * | 1994-07-15 | 1996-01-09 | Corning Incorporated | Amber photochromic glasses |
| US5534041A (en) * | 1994-11-07 | 1996-07-09 | Corning Incorporated | Method of making laser eyewear protection |
| US5491117A (en) * | 1995-01-23 | 1996-02-13 | Corning Incorporated | Optical filter glasses |
| US5639701A (en) * | 1996-01-09 | 1997-06-17 | Corning Incorporated | Permanent tint photochromic glasses |
| WO1998014409A1 (en) * | 1996-09-30 | 1998-04-09 | Corning Incorporated | Method of making a polarizing glass |
| EP0909744B1 (en) * | 1997-10-17 | 2001-12-05 | Corning Incorporated | Method of forming glass having integral polarizing and non-polarizing regions |
| JP2001522777A (ja) | 1997-11-07 | 2001-11-20 | コーニング インコーポレイテッド | フォトクロミックガラスおよびレンズ |
| US6165922A (en) * | 1997-11-07 | 2000-12-26 | Corning S.A. | Photochromic glass and lens |
| US6197711B1 (en) * | 1998-09-09 | 2001-03-06 | Corning S.A. | Protective filter lens |
| CA2343364A1 (en) * | 1998-09-09 | 2000-03-16 | Brent M. Wedding | Protective filter lens |
| US6536236B2 (en) | 1999-03-23 | 2003-03-25 | Corning, Incorporated | Method of making a polarizing glass |
| US6865318B1 (en) * | 2000-02-23 | 2005-03-08 | Schott Glass Technologies, Inc. | Athermal optical components |
| US6606885B2 (en) * | 2001-10-09 | 2003-08-19 | Corning Incorporated | Infrared, glass polarizer and method |
| US6811727B2 (en) * | 2002-01-09 | 2004-11-02 | Corning Incorporated | Ophthalmic filter materials |
| US6563639B1 (en) * | 2002-01-24 | 2003-05-13 | Corning Incorporated | Polarizing glasses |
| US9359251B2 (en) | 2012-02-29 | 2016-06-07 | Corning Incorporated | Ion exchanged glasses via non-error function compressive stress profiles |
| US9145330B2 (en) * | 2012-11-30 | 2015-09-29 | Corning Incorporated | Photochromic glasses |
| US11079309B2 (en) | 2013-07-26 | 2021-08-03 | Corning Incorporated | Strengthened glass articles having improved survivability |
| US9527769B2 (en) | 2013-10-09 | 2016-12-27 | Corning Incorporated | Reverse photochromic borosilicate glasses |
| US9517968B2 (en) | 2014-02-24 | 2016-12-13 | Corning Incorporated | Strengthened glass with deep depth of compression |
| TWI852054B (zh) | 2014-06-19 | 2024-08-11 | 美商康寧公司 | 無易碎應力分布曲線的玻璃 |
| KR20190090090A (ko) | 2014-10-08 | 2019-07-31 | 코닝 인코포레이티드 | 금속 산화물 농도 구배를 포함한 유리 및 유리 세라믹 |
| US10150698B2 (en) | 2014-10-31 | 2018-12-11 | Corning Incorporated | Strengthened glass with ultra deep depth of compression |
| TWI726720B (zh) | 2014-11-04 | 2021-05-01 | 美商康寧公司 | 深不易碎的應力分佈及其製造方法 |
| US9701569B2 (en) | 2015-07-21 | 2017-07-11 | Corning Incorporated | Glass articles exhibiting improved fracture performance |
| US11613103B2 (en) | 2015-07-21 | 2023-03-28 | Corning Incorporated | Glass articles exhibiting improved fracture performance |
| WO2017044606A1 (en) | 2015-09-11 | 2017-03-16 | Corning Incorporated | Photochromic multi-pane windows |
| KR102393206B1 (ko) | 2015-12-11 | 2022-05-03 | 코닝 인코포레이티드 | 금속 산화물 농도 구배를 포함하는 융합-형성가능한 유리계 제품 |
| WO2017132491A1 (en) | 2016-01-29 | 2017-08-03 | Corning Incorporated | Thermally strengthened photochromic glass and related systems and methods |
| CN109071316B (zh) | 2016-04-08 | 2020-03-27 | 康宁股份有限公司 | 包含金属氧化物浓度梯度的玻璃基制品 |
| KR20200091500A (ko) | 2016-04-08 | 2020-07-30 | 코닝 인코포레이티드 | 두 영역을 포함하는 응력 프로파일을 포함하는 유리-계 물품, 및 제조 방법 |
| WO2020150120A1 (en) * | 2019-01-18 | 2020-07-23 | Corning Incorporated | Photochromic glass and photochromic glass windows |
| CN112047625B (zh) * | 2020-09-17 | 2022-04-15 | 成都光明光电股份有限公司 | 透紫外光学玻璃 |
| KR102887990B1 (ko) * | 2022-03-03 | 2025-11-18 | 니토 보세키 가부시기가이샤 | 유리섬유용 유리 조성물, 유리섬유, 유리섬유 직물 및 유리섬유 강화 수지 조성물 |
Family Cites Families (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US14981A (en) * | 1856-05-27 | 1856-05-27 | Replaceable axle-box fob | |
| US887677A (en) * | 1905-02-16 | 1908-05-12 | Alfred Marcks | Chimnex. |
| US3208860A (en) * | 1962-07-31 | 1965-09-28 | Corning Glass Works | Phototropic material and article made therefrom |
| US3328182A (en) * | 1963-06-24 | 1967-06-27 | Corning Glass Works | Phototropic glass article and method |
| JPS4932297B1 (enExample) * | 1969-09-26 | 1974-08-29 | ||
| US4001019A (en) * | 1972-03-08 | 1977-01-04 | Hoya Glass Works, Ltd. | Reversible light sensitive glass |
| JPS5651143B2 (enExample) * | 1973-12-29 | 1981-12-03 | ||
| US3957499A (en) * | 1974-11-11 | 1976-05-18 | Corning Glass Works | Fast-fading index-corrected photochromic glass compositions |
| US4018965A (en) * | 1975-04-14 | 1977-04-19 | Corning Glass Works | Photochromic sheet glass compositions and articles |
| DE2535866C3 (de) | 1975-08-12 | 1978-10-12 | Jenaer Glaswerk Schott & Gen., 6500 Mainz | Phototropes Glas zur Herstellung von Brillen für Verkehrsteilnehmer in der Dämmerung und Nacht, sowie Verfahren zur Herstellung eines solchen Glases |
| CA1092876A (en) * | 1976-01-30 | 1981-01-06 | Edric Ellis | Photochromic alumino-phosphate glass having dispersed silver halide crystals |
| GB1515641A (en) * | 1976-01-30 | 1978-06-28 | Pilkington Brothers Ltd | Photochromic glasses |
| US4130437A (en) * | 1978-04-12 | 1978-12-19 | Corning Glass Works | Photochromic glasses suitable for simultaneous heat treatment and shaping |
-
1979
- 1979-02-28 US US06/014,981 patent/US4190451A/en not_active Expired - Lifetime
- 1979-03-09 AU AU44963/79A patent/AU522765B2/en not_active Expired
- 1979-03-12 AR AR275778A patent/AR229392A1/es active
- 1979-03-14 DE DE2910006A patent/DE2910006C2/de not_active Expired
- 1979-03-15 CA CA323,627A patent/CA1095307A/en not_active Expired
- 1979-03-16 MX MX176957A patent/MX151973A/es unknown
- 1979-03-16 GB GB7909399A patent/GB2016441B/en not_active Expired
- 1979-03-16 BR BR7901630A patent/BR7901630A/pt unknown
- 1979-03-16 IT IT21065/79A patent/IT1112379B/it active
- 1979-03-17 JP JP3165979A patent/JPS54139624A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| AR229392A1 (es) | 1983-08-15 |
| AU522765B2 (en) | 1982-06-24 |
| IT1112379B (it) | 1986-01-13 |
| IT7921065A0 (it) | 1979-03-16 |
| BR7901630A (pt) | 1979-10-16 |
| DE2910006A1 (de) | 1979-09-27 |
| AU4496379A (en) | 1979-09-20 |
| JPS6250421B2 (enExample) | 1987-10-24 |
| US4190451A (en) | 1980-02-26 |
| GB2016441B (en) | 1982-11-24 |
| DE2910006C2 (de) | 1987-12-23 |
| MX151973A (es) | 1985-05-23 |
| GB2016441A (en) | 1979-09-26 |
| JPS54139624A (en) | 1979-10-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1095307A (en) | Photochromic borosilicate glass having a specific molar ratio of alkali metal and boron oxides | |
| US4549894A (en) | Ultraviolet absorbing photochromic glass of low silver content | |
| US4212919A (en) | Strengthened polychromatic glasses | |
| US4251278A (en) | Photochromic glasses which darken to a brown hue | |
| US4980318A (en) | High refractive index photochromic glasses | |
| CA1118624A (en) | Photochromic glasses suitable for simultaneous heat treatment and shaping | |
| US4891336A (en) | High index photochromic glasses | |
| US5212120A (en) | Photosensitive glass | |
| CA1091498A (en) | Photochromic borosilicate glasses containing dispersed silver halide crystals | |
| US4374931A (en) | Photochromic glass suitable for ophthalmic applications | |
| US4407966A (en) | Very fast fading photochromic glass | |
| EP0156479B1 (en) | Lithium alumino-silicate glass ceramics | |
| US5268335A (en) | Fast strengthening glass lenses | |
| JPS60161351A (ja) | 眼科用ガラス | |
| US4940674A (en) | High strength, haze-free, transparent glass-ceramics | |
| US4022628A (en) | Ion exchange-strengthened silicate glass filter for ultraviolet light | |
| CA1232920A (en) | Transparent, mullite glass-ceramics containing zno and method | |
| US5403789A (en) | Ultraviolet absorbing, fixed tint brown sunglass | |
| EP0592864B1 (en) | Polarizing glasses | |
| US3663193A (en) | Strengthened photosensitive opal glass | |
| JPH0247416B2 (enExample) | ||
| JPH027893B2 (enExample) | ||
| AU640581B1 (en) | Alkali zinc aluminophosphate glass-ceramics | |
| US5064461A (en) | Blue/gray transparent glass-ceramic articles | |
| US3957499A (en) | Fast-fading index-corrected photochromic glass compositions |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |