CA1089488A - Process for the manufacture of (phenoxy or benzyl)- phenoxypropionic acid methyl esters - Google Patents
Process for the manufacture of (phenoxy or benzyl)- phenoxypropionic acid methyl estersInfo
- Publication number
- CA1089488A CA1089488A CA336,883A CA336883A CA1089488A CA 1089488 A CA1089488 A CA 1089488A CA 336883 A CA336883 A CA 336883A CA 1089488 A CA1089488 A CA 1089488A
- Authority
- CA
- Canada
- Prior art keywords
- phenoxy
- benzyl
- acid methyl
- methyl esters
- reaction
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title claims abstract description 9
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 title claims abstract description 6
- 238000004519 manufacturing process Methods 0.000 title claims abstract description 4
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 claims abstract description 17
- -1 alkali metal salts Chemical class 0.000 claims abstract description 6
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims abstract description 6
- 229910052783 alkali metal Inorganic materials 0.000 claims abstract description 4
- 238000006243 chemical reaction Methods 0.000 claims description 20
- 239000012454 non-polar solvent Substances 0.000 claims description 3
- JCXJVPUVTGWSNB-UHFFFAOYSA-N Nitrogen dioxide Chemical compound O=[N]=O JCXJVPUVTGWSNB-UHFFFAOYSA-N 0.000 claims description 2
- 125000000217 alkyl group Chemical group 0.000 claims description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 2
- 229910052736 halogen Inorganic materials 0.000 claims description 2
- 150000002367 halogens Chemical class 0.000 claims description 2
- 150000005826 halohydrocarbons Chemical class 0.000 claims description 2
- 229930195733 hydrocarbon Natural products 0.000 claims description 2
- 150000002430 hydrocarbons Chemical class 0.000 claims description 2
- 229910052760 oxygen Inorganic materials 0.000 claims description 2
- 239000001301 oxygen Substances 0.000 claims description 2
- 239000002904 solvent Substances 0.000 claims description 2
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 2
- 230000032050 esterification Effects 0.000 abstract description 2
- 238000005886 esterification reaction Methods 0.000 abstract description 2
- 230000000875 corresponding effect Effects 0.000 abstract 1
- 238000002844 melting Methods 0.000 description 8
- 230000008018 melting Effects 0.000 description 8
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 6
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 5
- 150000003839 salts Chemical class 0.000 description 5
- 239000008096 xylene Substances 0.000 description 5
- 150000001875 compounds Chemical class 0.000 description 4
- 239000000203 mixture Substances 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 230000029936 alkylation Effects 0.000 description 3
- 238000005804 alkylation reaction Methods 0.000 description 3
- JZMJDSHXVKJFKW-UHFFFAOYSA-N methyl sulfate Chemical class COS(O)(=O)=O JZMJDSHXVKJFKW-UHFFFAOYSA-N 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- 238000009835 boiling Methods 0.000 description 2
- 150000001734 carboxylic acid salts Chemical class 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- RWGFKTVRMDUZSP-UHFFFAOYSA-N cumene Chemical compound CC(C)C1=CC=CC=C1 RWGFKTVRMDUZSP-UHFFFAOYSA-N 0.000 description 2
- 239000012467 final product Substances 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- QPJVMBTYPHYUOC-UHFFFAOYSA-N methyl benzoate Chemical compound COC(=O)C1=CC=CC=C1 QPJVMBTYPHYUOC-UHFFFAOYSA-N 0.000 description 2
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 2
- 230000035484 reaction time Effects 0.000 description 2
- 238000000926 separation method Methods 0.000 description 2
- OCJBOOLMMGQPQU-UHFFFAOYSA-N 1,4-dichlorobenzene Chemical compound ClC1=CC=C(Cl)C=C1 OCJBOOLMMGQPQU-UHFFFAOYSA-N 0.000 description 1
- 244000025254 Cannabis sativa Species 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- 239000003568 Sodium, potassium and calcium salts of fatty acids Substances 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical class OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 150000001558 benzoic acid derivatives Chemical class 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- 238000005119 centrifugation Methods 0.000 description 1
- 150000008050 dialkyl sulfates Chemical class 0.000 description 1
- 229940117389 dichlorobenzene Drugs 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 238000010931 ester hydrolysis Methods 0.000 description 1
- 238000006266 etherification reaction Methods 0.000 description 1
- 235000019387 fatty acid methyl ester Nutrition 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000004009 herbicide Substances 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 229910000000 metal hydroxide Inorganic materials 0.000 description 1
- 150000004692 metal hydroxides Chemical class 0.000 description 1
- 150000004702 methyl esters Chemical class 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 230000020477 pH reduction Effects 0.000 description 1
- 235000011007 phosphoric acid Nutrition 0.000 description 1
- 229940103091 potassium benzoate Drugs 0.000 description 1
- 235000010235 potassium benzoate Nutrition 0.000 description 1
- 239000004300 potassium benzoate Substances 0.000 description 1
- 230000002035 prolonged effect Effects 0.000 description 1
- 235000013875 sodium salts of fatty acid Nutrition 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C69/00—Esters of carboxylic acids; Esters of carbonic or haloformic acids
- C07C69/66—Esters of carboxylic acids having esterified carboxylic groups bound to acyclic carbon atoms and having any of the groups OH, O—metal, —CHO, keto, ether, acyloxy, groups, groups, or in the acid moiety
- C07C69/67—Esters of carboxylic acids having esterified carboxylic groups bound to acyclic carbon atoms and having any of the groups OH, O—metal, —CHO, keto, ether, acyloxy, groups, groups, or in the acid moiety of saturated acids
- C07C69/708—Ethers
- C07C69/712—Ethers the hydroxy group of the ester being etherified with a hydroxy compound having the hydroxy group bound to a carbon atom of a six-membered aromatic ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19782843184 DE2843184A1 (de) | 1978-10-04 | 1978-10-04 | Verfahren zur herstellung von (phenoxi- bzw. benzyl)-phenoxipropionsaeuremethylestern |
| DEP2843184.7 | 1978-10-04 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1089488A true CA1089488A (en) | 1980-11-11 |
Family
ID=6051310
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA336,883A Expired CA1089488A (en) | 1978-10-04 | 1979-10-03 | Process for the manufacture of (phenoxy or benzyl)- phenoxypropionic acid methyl esters |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US4252980A (enFirst) |
| EP (1) | EP0009796B1 (enFirst) |
| JP (1) | JPS5551040A (enFirst) |
| AT (1) | ATE347T1 (enFirst) |
| CA (1) | CA1089488A (enFirst) |
| DE (2) | DE2843184A1 (enFirst) |
| IL (1) | IL58376A (enFirst) |
| SU (1) | SU931100A3 (enFirst) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5012017A (en) * | 1988-08-18 | 1991-04-30 | Dowelanco | Phenoxyphenoxypropionates, intermediates thereof and methods of preparation |
| JPH05175918A (ja) * | 1991-12-25 | 1993-07-13 | Yagi Antenna Co Ltd | 情報伝送装置 |
| JP4749347B2 (ja) * | 2007-01-18 | 2011-08-17 | 三菱電機エンジニアリング株式会社 | 電磁変換器 |
| CN109180491A (zh) * | 2018-10-29 | 2019-01-11 | 淮安万邦香料工业有限公司 | 一种菠萝醚的合成方法 |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1924575A (en) * | 1930-08-04 | 1933-08-29 | Doherty Res Co | Process of making organic esters |
| US3334125A (en) * | 1964-02-26 | 1967-08-01 | Velsicol Chemical Corp | Esters of 3-6-dichloro-2-methoxy-benzyl alcohol |
| DE2417487C2 (de) * | 1974-04-10 | 1983-01-20 | Hoechst Ag, 6000 Frankfurt | Benzyl-phenoxyalkancarbonsäuren, deren Derivate und Verfahren zu ihrer Herstellung |
| US4106925A (en) * | 1975-11-20 | 1978-08-15 | Ishihara Sangyo Kaisha Ltd. | Novel herbicidally active, nuclear-substituted phenoxy-phenoxy-alkanecarboxylic acid derivatives and use thereof for controlling grass-like weeds |
-
1978
- 1978-10-04 DE DE19782843184 patent/DE2843184A1/de not_active Withdrawn
-
1979
- 1979-10-01 AT AT79103731T patent/ATE347T1/de not_active IP Right Cessation
- 1979-10-01 EP EP79103731A patent/EP0009796B1/de not_active Expired
- 1979-10-01 DE DE7979103731T patent/DE2961267D1/de not_active Expired
- 1979-10-02 US US06/081,052 patent/US4252980A/en not_active Expired - Lifetime
- 1979-10-02 SU SU792818058A patent/SU931100A3/ru active
- 1979-10-03 JP JP12691779A patent/JPS5551040A/ja active Granted
- 1979-10-03 CA CA336,883A patent/CA1089488A/en not_active Expired
- 1979-10-03 IL IL58376A patent/IL58376A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| DE2843184A1 (de) | 1980-04-24 |
| ATE347T1 (de) | 1981-11-15 |
| JPS5551040A (en) | 1980-04-14 |
| JPS6244541B2 (enFirst) | 1987-09-21 |
| US4252980A (en) | 1981-02-24 |
| DE2961267D1 (en) | 1982-01-14 |
| IL58376A0 (en) | 1980-01-31 |
| SU931100A3 (ru) | 1982-05-23 |
| EP0009796A1 (de) | 1980-04-16 |
| IL58376A (en) | 1982-12-31 |
| EP0009796B1 (de) | 1981-11-04 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1212122A (en) | Alkanoyloxybenzenesulfonate salt production | |
| CA1089488A (en) | Process for the manufacture of (phenoxy or benzyl)- phenoxypropionic acid methyl esters | |
| CA1057777A (en) | Phenyl ethers and process for their manufacture | |
| US4144397A (en) | Preparation of 2-aryl-propionic acids by direct coupling utilizing a mixed magnesium halide complex | |
| US4489207A (en) | Preparation of 2-(hydroxyphenoxy)-carboxylates | |
| US4309547A (en) | Process for the preparation of phenoxypropionic acids and their alkali metal salts | |
| EP0123187A2 (de) | Verfahren zur Herstellung von fluorierten Phenylessigsäureestern und neue fluorierte Trichlorethylbenzole | |
| US4766220A (en) | Process for the preparation of optically active aryloxyalkanoic acid compounds | |
| US5162539A (en) | Preparation of 2-alkylthio-1,3,4-thiadiazoles | |
| EP0057281B1 (de) | Verfahren zur Herstellung von alpha-Hydroximethylenarylessigestern | |
| JPH0149253B2 (enFirst) | ||
| EP0665212B1 (de) | Verfahren zur Herstellung von 2,4,6-Trimethylphenylessigsäure | |
| CA1170271A (en) | Process for the manufacture of p-hydroxyphenylacetic acid | |
| EP0384043A2 (en) | Methods for the preparation of brominated intermediates | |
| EP0271307B1 (en) | Method for producing alkenylthiophenols and their esters | |
| CA1070322A (en) | Process for the production of o-derivatives of p-isopropenyl phenol | |
| US4508924A (en) | Preparation of o-acylphenols and p-acylphenols | |
| EP0238305B1 (en) | 4,4-bis(4-hydroxyphenyl)cyclohexanecarboxylic acid derivatives and process for preparing same | |
| JPS6193834A (ja) | 随時置換されていてもよいケイ皮酸の製造方法 | |
| US4377531A (en) | Method for the alkylation of phenylacetonitriles | |
| CA1144939A (en) | Process for producing meta-phenoxybenzoic acids and esters | |
| US5151540A (en) | Thio carbamates and their derivatives | |
| US4994623A (en) | Process for producing thioalkyl or thioarylphenones | |
| US4448982A (en) | Selective process for the preparation of hydroxy alkyl phenoxy benzoates | |
| EP0039812B1 (de) | Verfahren zur Herstellung von 3-Hydroxybenzoesäure |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |