CA1085822A - Cephalosporin compounds - Google Patents
Cephalosporin compoundsInfo
- Publication number
- CA1085822A CA1085822A CA240,739A CA240739A CA1085822A CA 1085822 A CA1085822 A CA 1085822A CA 240739 A CA240739 A CA 240739A CA 1085822 A CA1085822 A CA 1085822A
- Authority
- CA
- Canada
- Prior art keywords
- triazol
- cephem
- carboxylic acid
- ylthiomethyl
- amino
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- -1 Cephalosporin compounds Chemical class 0.000 title claims description 30
- 229930186147 Cephalosporin Natural products 0.000 title abstract description 11
- 229940124587 cephalosporin Drugs 0.000 title abstract description 11
- 150000001875 compounds Chemical class 0.000 claims abstract description 54
- 238000000034 method Methods 0.000 claims description 41
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 claims description 30
- 229910052739 hydrogen Inorganic materials 0.000 claims description 25
- 125000004356 hydroxy functional group Chemical group O* 0.000 claims description 18
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 17
- YGBFLZPYDUKSPT-MRVPVSSYSA-N cephalosporanic acid Chemical compound S1CC(COC(=O)C)=C(C(O)=O)N2C(=O)C[C@H]21 YGBFLZPYDUKSPT-MRVPVSSYSA-N 0.000 claims description 15
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 15
- 125000006239 protecting group Chemical group 0.000 claims description 15
- 150000003839 salts Chemical class 0.000 claims description 11
- 239000002253 acid Substances 0.000 claims description 9
- 125000003545 alkoxy group Chemical group 0.000 claims description 8
- 125000003282 alkyl amino group Chemical group 0.000 claims description 7
- 239000001257 hydrogen Substances 0.000 claims description 7
- 231100000252 nontoxic Toxicity 0.000 claims description 7
- 230000003000 nontoxic effect Effects 0.000 claims description 7
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 claims description 5
- 125000001399 1,2,3-triazolyl group Chemical group N1N=NC(=C1)* 0.000 claims description 4
- 125000001376 1,2,4-triazolyl group Chemical group N1N=C(N=C1)* 0.000 claims description 4
- QTYWFECBUFITDU-UHFFFAOYSA-N ethyl 5-sulfanylidene-1,2-dihydrotriazole-4-carboxylate;sodium Chemical compound [Na].[Na].CCOC(=O)C1=NNNC1=S QTYWFECBUFITDU-UHFFFAOYSA-N 0.000 claims description 4
- 125000004203 4-hydroxyphenyl group Chemical group [H]OC1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 3
- WMKSZVIZDUBXTK-UHFFFAOYSA-L [Na+].[Na+].C(=O)([O-])CC1=NNC(=N1)S.C(=O)([O-])CC1=NNC(=N1)S Chemical compound [Na+].[Na+].C(=O)([O-])CC1=NNC(=N1)S.C(=O)([O-])CC1=NNC(=N1)S WMKSZVIZDUBXTK-UHFFFAOYSA-L 0.000 claims description 3
- UGEPMKRKOXXFCS-OMNKOJBGSA-N (6r)-7-amino-3-[[5-(carboxymethyl)-1h-1,2,4-triazol-3-yl]sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound S([C@@H]1C(C(N1C=1C(O)=O)=O)N)CC=1CSC1=NNC(CC(O)=O)=N1 UGEPMKRKOXXFCS-OMNKOJBGSA-N 0.000 claims description 2
- 125000004185 ester group Chemical group 0.000 claims description 2
- MFAIJECDSMWTSI-UHFFFAOYSA-N ethyl 2-(5-sulfanylidene-1,2-dihydro-1,2,4-triazol-3-yl)acetate;sodium Chemical compound [Na].CCOC(=O)CC1=NC(=S)NN1 MFAIJECDSMWTSI-UHFFFAOYSA-N 0.000 claims description 2
- SKMDLXMIOJGLBV-UHFFFAOYSA-N sodium;5-sulfanylidene-1,2-dihydrotriazole-4-carboxamide Chemical compound [Na].NC(=O)C1=NNNC1=S SKMDLXMIOJGLBV-UHFFFAOYSA-N 0.000 claims description 2
- 239000000126 substance Substances 0.000 claims 14
- 238000004519 manufacturing process Methods 0.000 claims 9
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims 3
- MTCIBUZGOQMCDQ-FWXSHLFISA-N (6R)-3-[(5-carboxy-2H-triazol-4-yl)sulfanylmethyl]-7-[(2-hydroxy-2-phenylacetyl)amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound C(C(O)C1=CC=CC=C1)(=O)NC1[C@@H]2N(C(=C(CS2)CSC2=C(N=NN2)C(=O)O)C(=O)O)C1=O MTCIBUZGOQMCDQ-FWXSHLFISA-N 0.000 claims 2
- HSNZGBNPDURTRW-LEHRNKBSSA-N (6R)-3-[[5-(carboxymethyl)-1H-1,2,4-triazol-3-yl]sulfanylmethyl]-7-[(2-hydroxy-2-phenylacetyl)amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound C(C(O)C1=CC=CC=C1)(=O)NC1[C@@H]2N(C(=C(CS2)CSC2=NNC(=N2)CC(=O)O)C(=O)O)C1=O HSNZGBNPDURTRW-LEHRNKBSSA-N 0.000 claims 2
- AEMRFAOFKBGASW-UHFFFAOYSA-N Glycolic acid Chemical group OCC(O)=O AEMRFAOFKBGASW-UHFFFAOYSA-N 0.000 claims 2
- 229960004275 glycolic acid Drugs 0.000 claims 1
- 230000000844 anti-bacterial effect Effects 0.000 abstract description 7
- 150000001780 cephalosporins Chemical class 0.000 abstract description 6
- 150000001782 cephems Chemical class 0.000 abstract description 6
- 125000001425 triazolyl group Chemical group 0.000 abstract description 4
- 239000000543 intermediate Substances 0.000 abstract description 2
- 238000002360 preparation method Methods 0.000 abstract description 2
- 125000004055 thiomethyl group Chemical group [H]SC([H])([H])* 0.000 abstract description 2
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 45
- 239000000243 solution Substances 0.000 description 25
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 20
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 19
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 18
- 229910052799 carbon Inorganic materials 0.000 description 18
- 239000000203 mixture Substances 0.000 description 16
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 16
- 229910001868 water Inorganic materials 0.000 description 15
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 14
- 239000011541 reaction mixture Substances 0.000 description 12
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- 229910052757 nitrogen Inorganic materials 0.000 description 9
- HSHGZXNAXBPPDL-HZGVNTEJSA-N 7beta-aminocephalosporanic acid Chemical compound S1CC(COC(=O)C)=C(C([O-])=O)N2C(=O)[C@@H]([NH3+])[C@@H]12 HSHGZXNAXBPPDL-HZGVNTEJSA-N 0.000 description 8
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 8
- 238000006243 chemical reaction Methods 0.000 description 8
- 229960000443 hydrochloric acid Drugs 0.000 description 8
- 235000011167 hydrochloric acid Nutrition 0.000 description 8
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 6
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- 239000007787 solid Substances 0.000 description 6
- 238000006467 substitution reaction Methods 0.000 description 6
- DLYUQMMRRRQYAE-UHFFFAOYSA-N tetraphosphorus decaoxide Chemical compound O1P(O2)(=O)OP3(=O)OP1(=O)OP2(=O)O3 DLYUQMMRRRQYAE-UHFFFAOYSA-N 0.000 description 6
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 5
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 5
- 239000011734 sodium Substances 0.000 description 5
- SMJRBWINMFUUDS-UHFFFAOYSA-N 2-thienylacetic acid Chemical compound OC(=O)CC1=CC=CS1 SMJRBWINMFUUDS-UHFFFAOYSA-N 0.000 description 4
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 4
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 4
- RDOXTESZEPMUJZ-UHFFFAOYSA-N anisole Chemical compound COC1=CC=CC=C1 RDOXTESZEPMUJZ-UHFFFAOYSA-N 0.000 description 4
- 239000008346 aqueous phase Substances 0.000 description 4
- 239000007864 aqueous solution Substances 0.000 description 4
- 235000019341 magnesium sulphate Nutrition 0.000 description 4
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 4
- 229910052708 sodium Inorganic materials 0.000 description 4
- 239000000725 suspension Substances 0.000 description 4
- HSNZGBNPDURTRW-HQKHBYFDSA-N (6R)-3-[[5-(carboxymethyl)-1H-1,2,4-triazol-3-yl]sulfanylmethyl]-7-[[(2R)-2-hydroxy-2-phenylacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound C([C@H](O)C1=CC=CC=C1)(=O)NC1[C@@H]2N(C(=C(CS2)CSC2=NNC(=N2)CC(=O)O)C(=O)O)C1=O HSNZGBNPDURTRW-HQKHBYFDSA-N 0.000 description 3
- BIJXGTVFMOVDBB-KISVTORNSA-N (6r)-7-amino-3-[(5-carboxy-2h-triazol-4-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound S([C@@H]1C(C(N1C=1C(O)=O)=O)N)CC=1CSC1=NNN=C1C(O)=O BIJXGTVFMOVDBB-KISVTORNSA-N 0.000 description 3
- NWUYHJFMYQTDRP-UHFFFAOYSA-N 1,2-bis(ethenyl)benzene;1-ethenyl-2-ethylbenzene;styrene Chemical compound C=CC1=CC=CC=C1.CCC1=CC=CC=C1C=C.C=CC1=CC=CC=C1C=C NWUYHJFMYQTDRP-UHFFFAOYSA-N 0.000 description 3
- QWENRTYMTSOGBR-UHFFFAOYSA-N 1H-1,2,3-Triazole Chemical compound C=1C=NNN=1 QWENRTYMTSOGBR-UHFFFAOYSA-N 0.000 description 3
- OYLWNIRWHSRRDC-UHFFFAOYSA-N 2-(5-sulfanylidene-1,2-dihydro-1,2,4-triazol-3-yl)acetic acid Chemical compound OC(=O)CC1=NN=C(S)N1 OYLWNIRWHSRRDC-UHFFFAOYSA-N 0.000 description 3
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 3
- 229960001701 chloroform Drugs 0.000 description 3
- 239000000284 extract Substances 0.000 description 3
- 150000002431 hydrogen Chemical group 0.000 description 3
- 239000003456 ion exchange resin Substances 0.000 description 3
- 229920003303 ion-exchange polymer Polymers 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 239000008194 pharmaceutical composition Substances 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 3
- OIPVMBNARBTYPI-OMNKOJBGSA-N (6R)-7-amino-3-[[4-(carboxymethyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound NC1[C@@H]2N(C(=C(CS2)CSC2=NN=CN2CC(=O)O)C(=O)O)C1=O OIPVMBNARBTYPI-OMNKOJBGSA-N 0.000 description 2
- SFPDTKUEAKCDEK-MGAKOFKPSA-N (6r)-7-amino-3-[(5-ethoxycarbonyl-2h-triazol-4-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound CCOC(=O)C1=NNN=C1SCC1=C(C(O)=O)N2C(=O)C(N)[C@H]2SC1 SFPDTKUEAKCDEK-MGAKOFKPSA-N 0.000 description 2
- QNUJYABKHKIWJF-FFFFSGIJSA-N (6r)-7-amino-3-[[5-(2-ethoxy-2-oxoethyl)-1h-1,2,4-triazol-3-yl]sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound N1C(CC(=O)OCC)=NC(SCC=2CS[C@H]3N(C(C3N)=O)C=2C(O)=O)=N1 QNUJYABKHKIWJF-FFFFSGIJSA-N 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- HRDIKQFHFOTXDL-UHFFFAOYSA-N 1-o,1-o-diethyl 3-o-methyl propane-1,1,3-tricarboxylate Chemical compound CCOC(=O)C(C(=O)OCC)CCC(=O)OC HRDIKQFHFOTXDL-UHFFFAOYSA-N 0.000 description 2
- GNVKJHXSZWAYFR-UHFFFAOYSA-N 2-(5-sulfanylidene-1h-1,2,4-triazol-4-yl)acetic acid Chemical compound OC(=O)CN1C=NN=C1S GNVKJHXSZWAYFR-UHFFFAOYSA-N 0.000 description 2
- VOSDAYCDYGSFSE-UHFFFAOYSA-N 3-(5-sulfanylidene-1,2-dihydrotriazol-4-yl)propanoic acid Chemical compound OC(=O)CCC=1N=NNC=1S VOSDAYCDYGSFSE-UHFFFAOYSA-N 0.000 description 2
- FTGCTSTYQFWNKR-UHFFFAOYSA-N 4-(5-sulfanylidene-1,2-dihydrotriazol-4-yl)butanoic acid Chemical compound OC(=O)CCCC=1N=NNC=1S FTGCTSTYQFWNKR-UHFFFAOYSA-N 0.000 description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 2
- QTYQFUBNXJBJMI-UHFFFAOYSA-N O.[Na].[Na].CCOC(=O)c1n[nH][nH]c1=S Chemical compound O.[Na].[Na].CCOC(=O)c1n[nH][nH]c1=S QTYQFUBNXJBJMI-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 230000010933 acylation Effects 0.000 description 2
- 238000005917 acylation reaction Methods 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- 239000002775 capsule Substances 0.000 description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 2
- 229920001429 chelating resin Polymers 0.000 description 2
- ZUGOHJWUTNKRMG-UHFFFAOYSA-N ethyl 5-aminothiadiazole-4-carboxylate Chemical compound CCOC(=O)C=1N=NSC=1N ZUGOHJWUTNKRMG-UHFFFAOYSA-N 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- ZZUFCTLCJUWOSV-UHFFFAOYSA-N furosemide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC(C(O)=O)=C1NCC1=CC=CO1 ZZUFCTLCJUWOSV-UHFFFAOYSA-N 0.000 description 2
- 239000007924 injection Substances 0.000 description 2
- 238000002347 injection Methods 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- UZKWTJUDCOPSNM-UHFFFAOYSA-N methoxybenzene Substances CCCCOC=C UZKWTJUDCOPSNM-UHFFFAOYSA-N 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 235000017557 sodium bicarbonate Nutrition 0.000 description 2
- 238000010561 standard procedure Methods 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- OBETXYAYXDNJHR-SSDOTTSWSA-M (2r)-2-ethylhexanoate Chemical compound CCCC[C@@H](CC)C([O-])=O OBETXYAYXDNJHR-SSDOTTSWSA-M 0.000 description 1
- COHAQGFVBQZYLC-NWLOPNIYSA-N (6R)-3-[(5-ethoxycarbonyl-2H-triazol-4-yl)sulfanylmethyl]-7-[[(2R)-2-hydroxy-2-phenylacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound C([C@H](O)C1=CC=CC=C1)(=O)NC1[C@@H]2N(C(=C(CS2)CSC2=C(N=NN2)C(=O)OCC)C(=O)O)C1=O COHAQGFVBQZYLC-NWLOPNIYSA-N 0.000 description 1
- UDNNSZLJGQVQOX-HQKHBYFDSA-N (6R)-3-[[4-(carboxymethyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-7-[[(2R)-2-hydroxy-2-phenylacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound C([C@H](O)C1=CC=CC=C1)(=O)NC1[C@@H]2N(C(=C(CS2)CSC2=NN=CN2CC(=O)O)C(=O)O)C1=O UDNNSZLJGQVQOX-HQKHBYFDSA-N 0.000 description 1
- NUBDGFNAOUOWQL-LQRGHNGLSA-N (6R)-3-[[5-(2-ethoxy-2-oxoethyl)-1H-1,2,4-triazol-3-yl]sulfanylmethyl]-7-[[(2R)-2-hydroxy-2-phenylacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound C([C@H](O)C1=CC=CC=C1)(=O)NC1[C@@H]2N(C(=C(CS2)CSC2=NNC(=N2)CC(=O)OCC)C(=O)O)C1=O NUBDGFNAOUOWQL-LQRGHNGLSA-N 0.000 description 1
- PWLGUVUWISJQSV-LESKNEHBSA-N (6r)-7-amino-3-[[5-(2-carboxyethyl)-2h-triazol-4-yl]sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound S([C@@H]1C(C(N1C=1C(O)=O)=O)N)CC=1CSC1=NNN=C1CCC(O)=O PWLGUVUWISJQSV-LESKNEHBSA-N 0.000 description 1
- IKWLIQXIPRUIDU-ZCFIWIBFSA-N (6r)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound OC(=O)C1=CCS[C@@H]2CC(=O)N12 IKWLIQXIPRUIDU-ZCFIWIBFSA-N 0.000 description 1
- HDEKIFQKPRTYFW-UHFFFAOYSA-N 1,2-dihydrotriazole-5-thione;sodium Chemical compound [Na].[Na].S=C1C=NNN1 HDEKIFQKPRTYFW-UHFFFAOYSA-N 0.000 description 1
- QUKGLNCXGVWCJX-UHFFFAOYSA-N 1,3,4-thiadiazol-2-amine Chemical class NC1=NN=CS1 QUKGLNCXGVWCJX-UHFFFAOYSA-N 0.000 description 1
- LLCOQBODWBFTDD-UHFFFAOYSA-N 1h-triazol-1-ium-4-thiolate Chemical compound SC1=CNN=N1 LLCOQBODWBFTDD-UHFFFAOYSA-N 0.000 description 1
- RHJDIDBHTPSUBU-UHFFFAOYSA-N 2-(5-sulfanylidene-1,2-dihydrotriazol-4-yl)acetic acid Chemical compound OC(=O)CC=1N=NNC=1S RHJDIDBHTPSUBU-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- GOLXRNDWAUTYKT-UHFFFAOYSA-N 3-(1H-indol-3-yl)propanoic acid Chemical compound C1=CC=C2C(CCC(=O)O)=CNC2=C1 GOLXRNDWAUTYKT-UHFFFAOYSA-N 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 1
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical compound S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 description 1
- 241000588724 Escherichia coli Species 0.000 description 1
- 101100295738 Gallus gallus COR3 gene Proteins 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- 241000283986 Lepus Species 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- WRQNANDWMGAFTP-UHFFFAOYSA-N Methylacetoacetic acid Chemical compound COC(=O)CC(C)=O WRQNANDWMGAFTP-UHFFFAOYSA-N 0.000 description 1
- MZENALQWKIAWTA-YXILKXBUSA-L O.[Na+].[Na+].C([C@H](O)C1=CC=CC=C1)(=O)NC1[C@@H]2N(C(=C(CS2)CSC2=C(N=NN2)C(=O)[O-])C(=O)[O-])C1=O Chemical compound O.[Na+].[Na+].C([C@H](O)C1=CC=CC=C1)(=O)NC1[C@@H]2N(C(=C(CS2)CSC2=C(N=NN2)C(=O)[O-])C(=O)[O-])C1=O MZENALQWKIAWTA-YXILKXBUSA-L 0.000 description 1
- ZREDENZRJAVARE-UHFFFAOYSA-N OC1=C(CCC(=O)OCC)N=NN1CC1=CC=CC=C1 Chemical compound OC1=C(CCC(=O)OCC)N=NN1CC1=CC=CC=C1 ZREDENZRJAVARE-UHFFFAOYSA-N 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 1
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 description 1
- PJEAPIJXIUOBNG-UHFFFAOYSA-M [Na+].C(C1=CC=CC=C1)N1N=NC(=C1S)CCC(=O)[O-] Chemical compound [Na+].C(C1=CC=CC=C1)N1N=NC(=C1S)CCC(=O)[O-] PJEAPIJXIUOBNG-UHFFFAOYSA-M 0.000 description 1
- OOYUQRIUQPTKKK-UHFFFAOYSA-L [Na+].[Na+].C(=O)([O-])CC=1N=NNC1S.C(=O)([O-])CC=1N=NNC1S Chemical compound [Na+].[Na+].C(=O)([O-])CC=1N=NNC1S.C(=O)([O-])CC=1N=NNC1S OOYUQRIUQPTKKK-UHFFFAOYSA-L 0.000 description 1
- WEDARISDOCFDIG-UHFFFAOYSA-L [Na+].[Na+].C(=O)([O-])CCCC=1N=NNC1S.C(=O)([O-])CCCC=1N=NNC1S Chemical compound [Na+].[Na+].C(=O)([O-])CCCC=1N=NNC1S.C(=O)([O-])CCCC=1N=NNC1S WEDARISDOCFDIG-UHFFFAOYSA-L 0.000 description 1
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 description 1
- 229960000583 acetic acid Drugs 0.000 description 1
- 235000011054 acetic acid Nutrition 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- OBETXYAYXDNJHR-UHFFFAOYSA-N alpha-ethylcaproic acid Natural products CCCCC(CC)C(O)=O OBETXYAYXDNJHR-UHFFFAOYSA-N 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 150000001540 azides Chemical class 0.000 description 1
- UDLLFLQFQMACJB-UHFFFAOYSA-N azidomethylbenzene Chemical compound [N-]=[N+]=NCC1=CC=CC=C1 UDLLFLQFQMACJB-UHFFFAOYSA-N 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 125000006297 carbonyl amino group Chemical group [H]N([*:2])C([*:1])=O 0.000 description 1
- PFKFTWBEEFSNDU-UHFFFAOYSA-N carbonyldiimidazole Chemical compound C1=CN=CN1C(=O)N1C=CN=C1 PFKFTWBEEFSNDU-UHFFFAOYSA-N 0.000 description 1
- 125000002843 carboxylic acid group Chemical group 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 238000005660 chlorination reaction Methods 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- YJLZLUSKICMKJX-UHFFFAOYSA-N chloroform;formic acid;propan-2-ol Chemical compound OC=O.CC(C)O.ClC(Cl)Cl YJLZLUSKICMKJX-UHFFFAOYSA-N 0.000 description 1
- JNGZXGGOCLZBFB-IVCQMTBJSA-N compound E Chemical compound N([C@@H](C)C(=O)N[C@@H]1C(N(C)C2=CC=CC=C2C(C=2C=CC=CC=2)=N1)=O)C(=O)CC1=CC(F)=CC(F)=C1 JNGZXGGOCLZBFB-IVCQMTBJSA-N 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- WZHCOOQXZCIUNC-UHFFFAOYSA-N cyclandelate Chemical class C1C(C)(C)CC(C)CC1OC(=O)C(O)C1=CC=CC=C1 WZHCOOQXZCIUNC-UHFFFAOYSA-N 0.000 description 1
- 238000006264 debenzylation reaction Methods 0.000 description 1
- 238000006114 decarboxylation reaction Methods 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- ZZVUWRFHKOJYTH-UHFFFAOYSA-N diphenhydramine Chemical group C=1C=CC=CC=1C(OCCN(C)C)C1=CC=CC=C1 ZZVUWRFHKOJYTH-UHFFFAOYSA-N 0.000 description 1
- BZPLDKXTJYSOJL-UHFFFAOYSA-L disodium;2-(5-sulfanylidene-1h-1,2,4-triazol-4-yl)acetate Chemical compound [Na+].[Na+].[O-]C(=O)CN1C=NNC1=S.[O-]C(=O)CN1C=NNC1=S BZPLDKXTJYSOJL-UHFFFAOYSA-L 0.000 description 1
- 238000006073 displacement reaction Methods 0.000 description 1
- 239000003937 drug carrier Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 238000010931 ester hydrolysis Methods 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- QWKGDUKXNRZJDH-UHFFFAOYSA-N ethyl 2-(1h-1,2,4-triazol-5-yl)acetate Chemical compound CCOC(=O)CC1=NC=NN1 QWKGDUKXNRZJDH-UHFFFAOYSA-N 0.000 description 1
- RWNUUHHGEGCALW-UHFFFAOYSA-N ethyl 2-(5-sulfanylidene-1,2-dihydrotriazol-4-yl)acetate;sodium Chemical compound [Na].CCOC(=O)CC1=NNNC1=S RWNUUHHGEGCALW-UHFFFAOYSA-N 0.000 description 1
- RILMKAAORQSFPK-UHFFFAOYSA-N ethyl 2-[2-(formylcarbamothioyl)hydrazinyl]acetate Chemical compound CCOC(=O)CNNC(=S)NC=O RILMKAAORQSFPK-UHFFFAOYSA-N 0.000 description 1
- ORPRVDCFUJMTEZ-UHFFFAOYSA-N ethyl 3-(1-benzyl-5-chlorotriazol-4-yl)propanoate Chemical compound ClC1=C(CCC(=O)OCC)N=NN1CC1=CC=CC=C1 ORPRVDCFUJMTEZ-UHFFFAOYSA-N 0.000 description 1
- YPGZWCZEQRYJBP-UHFFFAOYSA-N ethyl 3-(5-sulfanylidene-1,2-dihydrotriazol-4-yl)propanoate Chemical compound CCOC(=O)CCC=1N=NNC=1S YPGZWCZEQRYJBP-UHFFFAOYSA-N 0.000 description 1
- VAZLEOYNPUBHIY-UHFFFAOYSA-N ethyl 4-(5-sulfanylidene-1,2-dihydrotriazol-4-yl)butanoate Chemical compound CCOC(=O)CCCC=1N=NNC=1S VAZLEOYNPUBHIY-UHFFFAOYSA-N 0.000 description 1
- VKCPSIBSXBWQEJ-UHFFFAOYSA-N ethyl 4-(5-sulfanylidene-1,2-dihydrotriazol-4-yl)butanoate;sodium Chemical compound [Na].CCOC(=O)CCCC1=NNNC1=S VKCPSIBSXBWQEJ-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 125000001153 fluoro group Chemical group F* 0.000 description 1
- XZBIXDPGRMLSTC-UHFFFAOYSA-N formohydrazide Chemical compound NNC=O XZBIXDPGRMLSTC-UHFFFAOYSA-N 0.000 description 1
- 238000001640 fractional crystallisation Methods 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 229910000037 hydrogen sulfide Inorganic materials 0.000 description 1
- 238000000338 in vitro Methods 0.000 description 1
- 238000001727 in vivo Methods 0.000 description 1
- 208000015181 infectious disease Diseases 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 125000000636 p-nitrophenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)[N+]([O-])=O 0.000 description 1
- 230000020477 pH reduction Effects 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 150000005331 phenylglycines Chemical class 0.000 description 1
- UYWQUFXKFGHYNT-UHFFFAOYSA-N phenylmethyl ester of formic acid Natural products O=COCC1=CC=CC=C1 UYWQUFXKFGHYNT-UHFFFAOYSA-N 0.000 description 1
- 239000008055 phosphate buffer solution Substances 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 102000004196 processed proteins & peptides Human genes 0.000 description 1
- 108090000765 processed proteins & peptides Proteins 0.000 description 1
- UORVCLMRJXCDCP-UHFFFAOYSA-N propynoic acid Chemical compound OC(=O)C#C UORVCLMRJXCDCP-UHFFFAOYSA-N 0.000 description 1
- 230000004224 protection Effects 0.000 description 1
- 230000008707 rearrangement Effects 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 239000011343 solid material Substances 0.000 description 1
- 239000012265 solid product Substances 0.000 description 1
- 239000008174 sterile solution Substances 0.000 description 1
- 239000008223 sterile water Substances 0.000 description 1
- 239000012258 stirred mixture Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 150000003573 thiols Chemical class 0.000 description 1
- 125000006000 trichloroethyl group Chemical group 0.000 description 1
- WNBQNJANYUENGZ-UHFFFAOYSA-N triethyl butane-1,1,4-tricarboxylate Chemical compound CCOC(=O)CCCC(C(=O)OCC)C(=O)OCC WNBQNJANYUENGZ-UHFFFAOYSA-N 0.000 description 1
- CTFRGNLAGFUMHR-UHFFFAOYSA-N triethyl ethane-1,1,1-tricarboxylate Chemical compound CCOC(=O)C(C)(C(=O)OCC)C(=O)OCC CTFRGNLAGFUMHR-UHFFFAOYSA-N 0.000 description 1
- 238000001665 trituration Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D501/00—Heterocyclic compounds containing 5-thia-1-azabicyclo [4.2.0] octane ring systems, i.e. compounds containing a ring system of the formula:, e.g. cephalosporins; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
- C07D501/14—Compounds having a nitrogen atom directly attached in position 7
- C07D501/16—Compounds having a nitrogen atom directly attached in position 7 with a double bond between positions 2 and 3
- C07D501/20—7-Acylaminocephalosporanic or substituted 7-acylaminocephalosporanic acids in which the acyl radicals are derived from carboxylic acids
- C07D501/24—7-Acylaminocephalosporanic or substituted 7-acylaminocephalosporanic acids in which the acyl radicals are derived from carboxylic acids with hydrocarbon radicals, substituted by hetero atoms or hetero rings, attached in position 3
- C07D501/36—Methylene radicals, substituted by sulfur atoms
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/54—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with at least one nitrogen and one sulfur as the ring hetero atoms, e.g. sulthiame
- A61K31/542—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with at least one nitrogen and one sulfur as the ring hetero atoms, e.g. sulthiame ortho- or peri-condensed with heterocyclic ring systems
- A61K31/545—Compounds containing 5-thia-1-azabicyclo [4.2.0] octane ring systems, i.e. compounds containing a ring system of the formula:, e.g. cephalosporins, cefaclor, or cephalexine
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D249/00—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms
- C07D249/02—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms not condensed with other rings
- C07D249/04—1,2,3-Triazoles; Hydrogenated 1,2,3-triazoles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D249/00—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms
- C07D249/02—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms not condensed with other rings
- C07D249/08—1,2,4-Triazoles; Hydrogenated 1,2,4-triazoles
- C07D249/10—1,2,4-Triazoles; Hydrogenated 1,2,4-triazoles with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D249/12—Oxygen or sulfur atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Medicinal Chemistry (AREA)
- Pharmacology & Pharmacy (AREA)
- Epidemiology (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Cephalosporin Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US536,759 | 1974-12-27 | ||
| US05/536,759 US3989694A (en) | 1974-12-27 | 1974-12-27 | 7-Acyl-3-(substituted triazolyl thiomethyl)cephalosporins |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1085822A true CA1085822A (en) | 1980-09-16 |
Family
ID=24139827
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA240,739A Expired CA1085822A (en) | 1974-12-27 | 1975-11-28 | Cephalosporin compounds |
Country Status (14)
| Country | Link |
|---|---|
| US (2) | US3989694A (enExample) |
| JP (1) | JPS5188989A (enExample) |
| AU (1) | AU8789275A (enExample) |
| BE (1) | BE837071A (enExample) |
| CA (1) | CA1085822A (enExample) |
| CH (1) | CH622262A5 (enExample) |
| DE (1) | DE2558024A1 (enExample) |
| ES (2) | ES442100A1 (enExample) |
| FR (2) | FR2313068A1 (enExample) |
| GB (2) | GB1539517A (enExample) |
| IE (1) | IE43127B1 (enExample) |
| IT (1) | IT1051939B (enExample) |
| NL (1) | NL7513872A (enExample) |
| ZA (1) | ZA756192B (enExample) |
Families Citing this family (18)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS612674B2 (enExample) * | 1974-06-20 | 1986-01-27 | Meiji Seika Co | |
| US4172196A (en) * | 1974-09-03 | 1979-10-23 | Bristol-Myers Company | Certain 7-α-substituted-α-hydroxyacetamido-3-(1-carboxymethyltetrazol-5-yl-thiomethyl)-3-cephem-4-carboxylic acids |
| US4182863A (en) * | 1974-09-03 | 1980-01-08 | Bristol-Myers Company | 7-Amino-3-(1-carboxymethyltetrazol-5-ylthiomethyl)-3-cephem-4-carboxylic acid |
| US3989694A (en) * | 1974-12-27 | 1976-11-02 | Smithkline Corporation | 7-Acyl-3-(substituted triazolyl thiomethyl)cephalosporins |
| IL49183A0 (en) * | 1975-03-27 | 1976-05-31 | Pfizer | Novel cephalosporin derivatives,their preparation and pharmaceutical compositions containing them |
| US4183925A (en) * | 1975-03-27 | 1980-01-15 | Pfizer Inc. | 7-Aminophenylacetamido-Δ3 -cephem antibacterial agents and method of use |
| US4220644A (en) * | 1976-05-03 | 1980-09-02 | Smithkline Corporation | 7-Acylamino-3-(substituted tetrazolyl thiomethyl) cephalosporins |
| US4082912A (en) * | 1976-06-30 | 1978-04-04 | Bristol-Myers Company | Certain 7-acylamido-3-(2-carboxyalkyl-2,3-dihydro-s-triazolo[4,3-b]pyridazin-3-on-6-ylmethyl)-3-cephem-4-carboxylic acids their salts and easily hydrolyzed esters |
| JPS5321191A (en) * | 1976-08-10 | 1978-02-27 | Shionogi & Co Ltd | 7-arylmalonamidocephem derivatives |
| US4057631A (en) * | 1976-09-02 | 1977-11-08 | Smithkline Corporation | 7-(α-Substituted phenylacetamido)-3-(1-carboxymethylthioethyltetrazolyl-5-thiomethyl)-3-cephem-4-carboxylic acids |
| US4083975A (en) * | 1976-09-24 | 1978-04-11 | Smithkline Corporation | 7-Acylamino-3-(3-sulfomethyl-1,2,4-triazol-5-ylthiomethyl)-3-cephem-4-carboxylic acids |
| US4174324A (en) * | 1977-06-30 | 1979-11-13 | Smithkline Corporation | 3-(Carboxymethyl)thio-1H-1,2,4-triazol-5-thione |
| US4117124A (en) * | 1977-06-30 | 1978-09-26 | Smithkline Corporation | 7-Acylamino-3-[[3-(carboxymethyl)thio-1H-1,2,4-triazol-5-yl]thiomethyl]-3-cephem-4-carboxylic acids |
| US4197240A (en) * | 1977-12-23 | 1980-04-08 | Yeda Research And Development Co. Ltd. | Penicillin derivatives |
| US4229575A (en) * | 1978-02-27 | 1980-10-21 | Richardson-Merrell Inc. | 7-(2,3-Dihydrobenzo-5-furanyl)-acetamido cephalosporin derivatives |
| US4219648A (en) * | 1978-03-06 | 1980-08-26 | Richardson-Merrell Inc. | 7-[[Amino(1,3-dihydrobenzo[c]thienyl)acetyl]amino]cephalosporin derivatives |
| US4749522A (en) * | 1985-10-31 | 1988-06-07 | Angio-Medical Corporation | Supercritical fluid extraction of animal derived materials |
| PT87616B (pt) | 1987-06-24 | 1992-09-30 | Smithkline Beecham Corp | Processo de preparacao de antagonistas do leucotrieno e de composicoes farmaceuticas |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL173169C (nl) | 1969-10-27 | 1983-12-16 | Fujisawa Pharmaceutical Co | Werkwijze voor het bereiden van een farmaceutisch preparaat met antibacteriele werking en werkwijze voor het bereiden van het daarvoor benodigde cephalosporinederivaat. |
| US3759904A (en) * | 1971-07-29 | 1973-09-18 | Bristol Myers Co | Ds and salts thereof 3 - (s-(1,2,3-triazole-5-yl)thiomethyl)-3 - cephem - 4-carboxylic aci7-(d-(alpha-amino-alpha-phenyl-, 2-thienyl- and 3-thienylacetamido))- |
| US3796801A (en) * | 1971-11-04 | 1974-03-12 | Smithkline Corp | Method of combating enterobacter infections |
| BE793037A (fr) * | 1971-12-23 | 1973-06-20 | Fujisawa Pharmaceutical Co | Procede de preparation de derives d'acide 7-acylamino-3-substitue-3-cephem-4-carboxylique et nouveaux produits ainsi obtenus |
| US3813388A (en) * | 1972-01-31 | 1974-05-28 | L Crast | 7-(d-(alpha-amino-alpha-phenyl-,2-thienyl-and 3-thienyl-acetamido))-3-(s-(2-methyl-1,2,3-triazole-4-yl)thiomethyl)-3-cephem-4-carboxylic acids |
| US4007173A (en) | 1973-05-07 | 1977-02-08 | Smithkline Corporation | α-amino-α-(ureidophenyl)acetamidocephalosporins |
| JPS5653557B2 (enExample) * | 1973-10-15 | 1981-12-19 | ||
| GB1476981A (en) * | 1974-06-05 | 1977-06-16 | Bristol Myers Co | Substituted penicillanic acids |
| US3989694A (en) * | 1974-12-27 | 1976-11-02 | Smithkline Corporation | 7-Acyl-3-(substituted triazolyl thiomethyl)cephalosporins |
-
1974
- 1974-12-27 US US05/536,759 patent/US3989694A/en not_active Expired - Lifetime
-
1975
- 1975-09-30 ZA ZA00756192A patent/ZA756192B/xx unknown
- 1975-10-25 ES ES442100A patent/ES442100A1/es not_active Expired
- 1975-11-27 NL NL7513872A patent/NL7513872A/xx not_active Application Discontinuation
- 1975-11-28 CA CA240,739A patent/CA1085822A/en not_active Expired
- 1975-12-16 CH CH1630975A patent/CH622262A5/de not_active IP Right Cessation
- 1975-12-17 GB GB51600/75A patent/GB1539517A/en not_active Expired
- 1975-12-17 FR FR7538677A patent/FR2313068A1/fr active Granted
- 1975-12-17 GB GB35032/78A patent/GB1539518A/en not_active Expired
- 1975-12-19 IE IE2785/75A patent/IE43127B1/en unknown
- 1975-12-19 JP JP50152717A patent/JPS5188989A/ja active Pending
- 1975-12-22 DE DE19752558024 patent/DE2558024A1/de not_active Withdrawn
- 1975-12-23 IT IT30742/75A patent/IT1051939B/it active
- 1975-12-24 AU AU87892/75A patent/AU8789275A/en not_active Expired
- 1975-12-24 BE BE163107A patent/BE837071A/xx not_active IP Right Cessation
-
1976
- 1976-06-03 FR FR7616857A patent/FR2303807A1/fr active Granted
- 1976-10-12 US US05/731,387 patent/US4142046A/en not_active Expired - Lifetime
-
1977
- 1977-02-26 ES ES456340A patent/ES456340A1/es not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| JPS5188989A (enExample) | 1976-08-04 |
| ES442100A1 (es) | 1977-07-01 |
| GB1539518A (en) | 1979-01-31 |
| IE43127B1 (en) | 1980-12-31 |
| FR2313068A1 (fr) | 1976-12-31 |
| FR2303807B1 (enExample) | 1980-10-24 |
| NL7513872A (nl) | 1976-06-29 |
| DE2558024A1 (de) | 1976-07-08 |
| US3989694A (en) | 1976-11-02 |
| FR2303807A1 (fr) | 1976-10-08 |
| ZA756192B (en) | 1976-09-29 |
| AU8789275A (en) | 1977-06-30 |
| FR2313068B1 (enExample) | 1979-09-28 |
| IT1051939B (it) | 1981-05-20 |
| CH622262A5 (enExample) | 1981-03-31 |
| US4142046A (en) | 1979-02-27 |
| IE43127L (en) | 1976-06-27 |
| BE837071A (fr) | 1976-06-24 |
| ES456340A1 (es) | 1978-01-16 |
| GB1539517A (en) | 1979-01-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1085822A (en) | Cephalosporin compounds | |
| US3828037A (en) | Trifluoromethylmercaptoacetamidocephalosporins | |
| FR2509310A1 (fr) | Nouvelles cephalosporines, leur procede de preparation et leur application en therapeutique | |
| US4048311A (en) | 7-Acyl-3-(sulfonic acid and sulfamoyl substituted tetrazolyl thiomethyl)cephalosporins | |
| US4025626A (en) | 7-Acyl-3-(ureidoalkyl substituted tetrazolylthiomethyl)-cephalosporins | |
| US4286089A (en) | 7-Acyl-3-(substituted tetrazolyl thiomethyl)cephalosporins | |
| US4220644A (en) | 7-Acylamino-3-(substituted tetrazolyl thiomethyl) cephalosporins | |
| CA1059989A (en) | Cephamycins | |
| US4140694A (en) | Intermediates for preparing 7-acyl-3-(sulfonic acid and sulfamoyl substituted tetrazolylthiomethyl)cephalosporins | |
| US4041162A (en) | 7-Acyl-3-(sulfoalkyl substituted oxadiazolylthiomethyl) cephalosporins | |
| US4126682A (en) | 7-acyl-3-(carboxyalkyl and carbamoylalkyl substituted oxadiazolylthiomethyl) cephalosporins and antibacterial compositions and methods employing them | |
| US4060610A (en) | Pharmaceutical compositions comprising 7-acyl-3-(substituted triazolyl thiomethyl)-cephalosporins and methods of treating bacterial infections | |
| US3943129A (en) | 7-Amino-3-(1,3,4-thiadiazolinylthio-methyl) cephalosporins | |
| US4159373A (en) | 7-Acyl-3-(sulfonic acid and sulfamoyl substituted tetrazolyl thiomethyl) cephalosporins | |
| EP0000285B1 (en) | 7-acylamino-3-((3-(carboxymethyl) thio-1 h-1,2,4-triazol-5-yl) thiomethyl)-3-cephem-4-carboxylic acid derivatives, processes for their preparation and compositions containing them | |
| CA1072543A (en) | Cephalosporin compounds | |
| US4137314A (en) | 7-Dithioacetamido cephalosporins and pharmaceutical compositions and methods employing them having antibacterial activity | |
| US3946005A (en) | 7-Amino-3-(1,2,4-triazolinylthiomethyl)cephalosporins | |
| US4092480A (en) | Intermediates for preparing substituted phenylglycylcephalosporins | |
| IL45321A (en) | Phenylglycylphalosporins are converted | |
| JPS6156238B2 (enExample) | ||
| US4118491A (en) | 7-Acyl-3-(sulfaminoalkyl substituted tetrazolylthiomethyl)cephalosporins, antibacterial compositions containing them and methods of treating bacterial infections with them | |
| US3898221A (en) | Trifluoromethylmercaptoacetamidocephalosporins | |
| US4133882A (en) | 7-Hydroxyhalophenylacetamido-3-heterocyclicthiomethyl cephalosporins | |
| US3898220A (en) | Trifluoromethylmercaptoacetamidocephalosporins |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |