CA1082189A - Herbicidal sulfonamides - Google Patents
Herbicidal sulfonamidesInfo
- Publication number
- CA1082189A CA1082189A CA275,660A CA275660A CA1082189A CA 1082189 A CA1082189 A CA 1082189A CA 275660 A CA275660 A CA 275660A CA 1082189 A CA1082189 A CA 1082189A
- Authority
- CA
- Canada
- Prior art keywords
- compound
- growth
- effective amount
- locus
- comprises applying
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 229940124530 sulfonamide Drugs 0.000 title description 8
- 150000003456 sulfonamides Chemical class 0.000 title description 7
- 230000002363 herbicidal effect Effects 0.000 title description 4
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 claims abstract description 39
- 244000075634 Cyperus rotundus Species 0.000 claims abstract description 31
- 235000005853 Cyperus esculentus Nutrition 0.000 claims abstract description 28
- PUEXGEZHERTEAV-UHFFFAOYSA-N 1-(benzenesulfonyl)-3-(4,6-dimethylpyrimidin-2-yl)urea Chemical compound CC1=CC(C)=NC(NC(=O)NS(=O)(=O)C=2C=CC=CC=2)=N1 PUEXGEZHERTEAV-UHFFFAOYSA-N 0.000 claims abstract 2
- 239000000460 chlorine Substances 0.000 claims description 502
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 392
- 150000001875 compounds Chemical class 0.000 claims description 206
- 238000000034 method Methods 0.000 claims description 118
- 230000012010 growth Effects 0.000 claims description 105
- 229910052739 hydrogen Inorganic materials 0.000 claims description 82
- 239000001257 hydrogen Substances 0.000 claims description 81
- 229910052801 chlorine Inorganic materials 0.000 claims description 61
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 59
- 150000002431 hydrogen Chemical class 0.000 claims description 57
- 125000004432 carbon atom Chemical group C* 0.000 claims description 47
- -1 4,6-dimethylpyrimidin-2-yl Chemical group 0.000 claims description 43
- 239000011737 fluorine Substances 0.000 claims description 43
- 229910052731 fluorine Inorganic materials 0.000 claims description 43
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 39
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 36
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 33
- 241000209140 Triticum Species 0.000 claims description 33
- 235000021307 Triticum Nutrition 0.000 claims description 33
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 31
- 229910052794 bromium Inorganic materials 0.000 claims description 31
- 125000003545 alkoxy group Chemical group 0.000 claims description 30
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 23
- 125000000217 alkyl group Chemical group 0.000 claims description 20
- 150000003839 salts Chemical class 0.000 claims description 20
- 241000234653 Cyperus Species 0.000 claims description 18
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 18
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 14
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 13
- QSLPNSWXUQHVLP-UHFFFAOYSA-N $l^{1}-sulfanylmethane Chemical compound [S]C QSLPNSWXUQHVLP-UHFFFAOYSA-N 0.000 claims description 11
- 125000001153 fluoro group Chemical group F* 0.000 claims description 7
- 229910052760 oxygen Inorganic materials 0.000 claims description 7
- 229910052717 sulfur Inorganic materials 0.000 claims description 7
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 6
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 6
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 6
- 239000001301 oxygen Substances 0.000 claims description 6
- 239000011593 sulfur Substances 0.000 claims description 6
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 5
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 3
- 230000001276 controlling effect Effects 0.000 claims 78
- 230000001105 regulatory effect Effects 0.000 claims 15
- 241000169203 Eichhornia Species 0.000 claims 6
- WYRSGXAIHNMKOL-UHFFFAOYSA-N $l^{1}-sulfanylethane Chemical compound CC[S] WYRSGXAIHNMKOL-UHFFFAOYSA-N 0.000 claims 2
- 125000002653 sulfanylmethyl group Chemical group [H]SC([H])([H])[*] 0.000 claims 2
- XHIBLMGCOLIHDE-UHFFFAOYSA-N 1-(2,5-dichlorophenyl)sulfonyl-3-(4,6-dimethoxypyrimidin-2-yl)urea Chemical compound COC1=CC(OC)=NC(NC(=O)NS(=O)(=O)C=2C(=CC=C(Cl)C=2)Cl)=N1 XHIBLMGCOLIHDE-UHFFFAOYSA-N 0.000 claims 1
- FVODUZFOZVJEBM-UHFFFAOYSA-N 1-(2-chloro-5-methoxyphenyl)sulfonyl-3-(4-methoxy-6-methylpyrimidin-2-yl)urea Chemical compound COC1=CC=C(Cl)C(S(=O)(=O)NC(=O)NC=2N=C(OC)C=C(C)N=2)=C1 FVODUZFOZVJEBM-UHFFFAOYSA-N 0.000 claims 1
- MKRAPJFQEAATPC-UHFFFAOYSA-N 1-(2-chlorophenyl)sulfonyl-3-(4,6-dimethoxy-1,3,5-triazin-2-yl)urea Chemical compound COC1=NC(OC)=NC(NC(=O)NS(=O)(=O)C=2C(=CC=CC=2)Cl)=N1 MKRAPJFQEAATPC-UHFFFAOYSA-N 0.000 claims 1
- IBDCEWGNSYXESG-UHFFFAOYSA-N 1-(4,6-dimethylpyrimidin-2-yl)-3-thiophen-2-ylsulfonylurea Chemical compound CC1=CC(C)=NC(NC(=O)NS(=O)(=O)C=2SC=CC=2)=N1 IBDCEWGNSYXESG-UHFFFAOYSA-N 0.000 claims 1
- CSLLNEGBOBCILO-UHFFFAOYSA-N 1-(4-methoxy-6-methylpyrimidin-2-yl)-3-(2-methylphenyl)sulfonylurea Chemical compound COC1=CC(C)=NC(NC(=O)NS(=O)(=O)C=2C(=CC=CC=2)C)=N1 CSLLNEGBOBCILO-UHFFFAOYSA-N 0.000 claims 1
- NMJNNILJNXDRKY-UHFFFAOYSA-N 1-(benzenesulfonyl)-3-(4,6-dimethyl-1,3,5-triazin-2-yl)urea Chemical compound CC1=NC(C)=NC(NC(=O)NS(=O)(=O)C=2C=CC=CC=2)=N1 NMJNNILJNXDRKY-UHFFFAOYSA-N 0.000 claims 1
- JHUGAQBJCJJUFK-UHFFFAOYSA-N 1-(benzenesulfonyl)-3-(4-methoxy-6-methyl-1,3,5-triazin-2-yl)urea Chemical compound COC1=NC(C)=NC(NC(=O)NS(=O)(=O)C=2C=CC=CC=2)=N1 JHUGAQBJCJJUFK-UHFFFAOYSA-N 0.000 claims 1
- VJYIFXVZLXQVHO-UHFFFAOYSA-N chlorsulfuron Chemical compound COC1=NC(C)=NC(NC(=O)NS(=O)(=O)C=2C(=CC=CC=2)Cl)=N1 VJYIFXVZLXQVHO-UHFFFAOYSA-N 0.000 claims 1
- 239000004009 herbicide Substances 0.000 abstract description 10
- 230000008635 plant growth Effects 0.000 abstract description 6
- KHBQMWCZKVMBLN-UHFFFAOYSA-N Benzenesulfonamide Chemical compound NS(=O)(=O)C1=CC=CC=C1 KHBQMWCZKVMBLN-UHFFFAOYSA-N 0.000 abstract description 2
- 125000004421 aryl sulphonamide group Chemical group 0.000 abstract description 2
- 241000196324 Embryophyta Species 0.000 description 32
- 239000008187 granular material Substances 0.000 description 30
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 26
- 239000000047 product Substances 0.000 description 25
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 25
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 24
- 239000000463 material Substances 0.000 description 24
- 239000000203 mixture Substances 0.000 description 22
- 239000002904 solvent Substances 0.000 description 22
- RAHZWNYVWXNFOC-UHFFFAOYSA-N Sulphur dioxide Chemical compound O=S=O RAHZWNYVWXNFOC-UHFFFAOYSA-N 0.000 description 21
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 20
- 239000004615 ingredient Substances 0.000 description 20
- 238000012360 testing method Methods 0.000 description 19
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 18
- 239000007787 solid Substances 0.000 description 18
- 241000209094 Oryza Species 0.000 description 13
- 239000003921 oil Substances 0.000 description 13
- 239000002689 soil Substances 0.000 description 13
- 235000007164 Oryza sativa Nutrition 0.000 description 12
- 239000002245 particle Substances 0.000 description 12
- 235000009566 rice Nutrition 0.000 description 12
- 238000011282 treatment Methods 0.000 description 12
- USQCUKQZXOWUDF-YWZLYKJASA-N 6-chloro-n-[(3s)-1-[(2s)-1-(4-methyl-5-oxo-1,4-diazepan-1-yl)-1-oxopropan-2-yl]-2-oxopyrrolidin-3-yl]naphthalene-2-sulfonamide Chemical compound O=C([C@@H](N1C([C@@H](NS(=O)(=O)C=2C=C3C=CC(Cl)=CC3=CC=2)CC1)=O)C)N1CCN(C)C(=O)CC1 USQCUKQZXOWUDF-YWZLYKJASA-N 0.000 description 11
- 239000012948 isocyanate Substances 0.000 description 11
- 239000000725 suspension Substances 0.000 description 11
- 235000007320 Avena fatua Nutrition 0.000 description 10
- 235000011684 Sorghum saccharatum Nutrition 0.000 description 10
- 150000002513 isocyanates Chemical class 0.000 description 10
- 239000007921 spray Substances 0.000 description 10
- 240000008042 Zea mays Species 0.000 description 9
- 229960000892 attapulgite Drugs 0.000 description 9
- 229910052625 palygorskite Inorganic materials 0.000 description 9
- 235000010469 Glycine max Nutrition 0.000 description 8
- 244000068988 Glycine max Species 0.000 description 8
- 244000299507 Gossypium hirsutum Species 0.000 description 8
- RSPISYXLHRIGJD-UHFFFAOYSA-N OOOO Chemical compound OOOO RSPISYXLHRIGJD-UHFFFAOYSA-N 0.000 description 8
- KUGRPPRAQNPSQD-UHFFFAOYSA-N OOOOO Chemical compound OOOOO KUGRPPRAQNPSQD-UHFFFAOYSA-N 0.000 description 8
- 235000005824 Zea mays ssp. parviglumis Nutrition 0.000 description 8
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 8
- 229910052799 carbon Inorganic materials 0.000 description 8
- 235000005822 corn Nutrition 0.000 description 8
- 230000000694 effects Effects 0.000 description 8
- BUXTXUBQAKIQKS-UHFFFAOYSA-N sulfuryl diisocyanate Chemical class O=C=NS(=O)(=O)N=C=O BUXTXUBQAKIQKS-UHFFFAOYSA-N 0.000 description 8
- 244000075850 Avena orientalis Species 0.000 description 7
- 229920000742 Cotton Polymers 0.000 description 7
- 240000006394 Sorghum bicolor Species 0.000 description 7
- 241000894007 species Species 0.000 description 7
- 238000005507 spraying Methods 0.000 description 7
- 238000003756 stirring Methods 0.000 description 7
- 239000004563 wettable powder Substances 0.000 description 7
- 241001148727 Bromus tectorum Species 0.000 description 6
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 6
- 244000058871 Echinochloa crus-galli Species 0.000 description 6
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 6
- 235000005373 Uvularia sessilifolia Nutrition 0.000 description 6
- 241001506766 Xanthium Species 0.000 description 6
- 239000004480 active ingredient Substances 0.000 description 6
- 150000001768 cations Chemical class 0.000 description 6
- 238000001914 filtration Methods 0.000 description 6
- 238000009472 formulation Methods 0.000 description 6
- 231100001184 nonphytotoxic Toxicity 0.000 description 6
- 239000008188 pellet Substances 0.000 description 6
- 239000004576 sand Substances 0.000 description 6
- 229910052708 sodium Inorganic materials 0.000 description 6
- 239000011734 sodium Substances 0.000 description 6
- 239000000126 substance Substances 0.000 description 6
- 240000000111 Saccharum officinarum Species 0.000 description 5
- 238000010521 absorption reaction Methods 0.000 description 5
- 125000004429 atom Chemical group 0.000 description 5
- 238000006243 chemical reaction Methods 0.000 description 5
- 239000012141 concentrate Substances 0.000 description 5
- 239000003085 diluting agent Substances 0.000 description 5
- UHOVQNZJYSORNB-UHFFFAOYSA-N monobenzene Natural products C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 5
- 241000209764 Avena fatua Species 0.000 description 4
- 241001632576 Hyacinthus Species 0.000 description 4
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 4
- 241000700159 Rattus Species 0.000 description 4
- 235000007201 Saccharum officinarum Nutrition 0.000 description 4
- 239000002253 acid Substances 0.000 description 4
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 4
- 150000002148 esters Chemical class 0.000 description 4
- 238000001704 evaporation Methods 0.000 description 4
- 230000008020 evaporation Effects 0.000 description 4
- IEKOSPNJXYCZHY-UHFFFAOYSA-N furan-2-sulfonyl chloride Chemical class ClS(=O)(=O)C1=CC=CO1 IEKOSPNJXYCZHY-UHFFFAOYSA-N 0.000 description 4
- 150000002500 ions Chemical class 0.000 description 4
- 229920000609 methyl cellulose Polymers 0.000 description 4
- 239000001923 methylcellulose Substances 0.000 description 4
- 235000010981 methylcellulose Nutrition 0.000 description 4
- 238000002360 preparation method Methods 0.000 description 4
- LJXQPZWIHJMPQQ-UHFFFAOYSA-N pyrimidin-2-amine Chemical compound NC1=NC=CC=N1 LJXQPZWIHJMPQQ-UHFFFAOYSA-N 0.000 description 4
- 239000012265 solid product Substances 0.000 description 4
- 235000000346 sugar Nutrition 0.000 description 4
- 239000004094 surface-active agent Substances 0.000 description 4
- 229910002029 synthetic silica gel Inorganic materials 0.000 description 4
- QQOWHRYOXYEMTL-UHFFFAOYSA-N triazin-4-amine Chemical compound N=C1C=CN=NN1 QQOWHRYOXYEMTL-UHFFFAOYSA-N 0.000 description 4
- 240000006995 Abutilon theophrasti Species 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- 235000004977 Brassica sinapistrum Nutrition 0.000 description 3
- 241000209202 Bromus secalinus Species 0.000 description 3
- 244000201986 Cassia tora Species 0.000 description 3
- 244000037364 Cinnamomum aromaticum Species 0.000 description 3
- 235000014489 Cinnamomum aromaticum Nutrition 0.000 description 3
- 235000001602 Digitaria X umfolozi Nutrition 0.000 description 3
- 240000003176 Digitaria ciliaris Species 0.000 description 3
- 235000017898 Digitaria ciliaris Nutrition 0.000 description 3
- 235000005476 Digitaria cruciata Nutrition 0.000 description 3
- 235000006830 Digitaria didactyla Nutrition 0.000 description 3
- 235000005804 Digitaria eriantha ssp. eriantha Nutrition 0.000 description 3
- 235000010823 Digitaria sanguinalis Nutrition 0.000 description 3
- 235000014716 Eleusine indica Nutrition 0.000 description 3
- 101000604135 Homo sapiens Nucleolar protein 10 Proteins 0.000 description 3
- 240000001549 Ipomoea eriocarpa Species 0.000 description 3
- 235000005146 Ipomoea eriocarpa Nutrition 0.000 description 3
- 229920001732 Lignosulfonate Polymers 0.000 description 3
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 3
- 102100038456 Nucleolar protein 10 Human genes 0.000 description 3
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- 241001355178 Setaria faberi Species 0.000 description 3
- 241000209072 Sorghum Species 0.000 description 3
- YTPLMLYBLZKORZ-UHFFFAOYSA-N Thiophene Chemical class C=1C=CSC=1 YTPLMLYBLZKORZ-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 239000011575 calcium Substances 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Substances ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 3
- YDEXUEFDPVHGHE-GGMCWBHBSA-L disodium;(2r)-3-(2-hydroxy-3-methoxyphenyl)-2-[2-methoxy-4-(3-sulfonatopropyl)phenoxy]propane-1-sulfonate Chemical compound [Na+].[Na+].COC1=CC=CC(C[C@H](CS([O-])(=O)=O)OC=2C(=CC(CCCS([O-])(=O)=O)=CC=2)OC)=C1O YDEXUEFDPVHGHE-GGMCWBHBSA-L 0.000 description 3
- 239000012530 fluid Substances 0.000 description 3
- RHBMVXBGYGIDJN-UHFFFAOYSA-N furan-2-sulfonamide Chemical compound NS(=O)(=O)C1=CC=CO1 RHBMVXBGYGIDJN-UHFFFAOYSA-N 0.000 description 3
- 238000000227 grinding Methods 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 238000002844 melting Methods 0.000 description 3
- 230000008018 melting Effects 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 229920003023 plastic Polymers 0.000 description 3
- 239000004033 plastic Substances 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- 239000001488 sodium phosphate Substances 0.000 description 3
- 150000008163 sugars Chemical class 0.000 description 3
- HFOWWBNMJUVIMH-UHFFFAOYSA-N sulfuryl diisothiocyanate Chemical class S=C=NS(=O)(=O)N=C=S HFOWWBNMJUVIMH-UHFFFAOYSA-N 0.000 description 3
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 3
- KCZIUKYAJJEIQG-UHFFFAOYSA-N 1,3,5-triazin-2-amine Chemical compound NC1=NC=NC=N1 KCZIUKYAJJEIQG-UHFFFAOYSA-N 0.000 description 2
- IDQNBVFPZMCDDN-UHFFFAOYSA-N 2-Amino-4,6-dimethylpyrimidine Chemical compound CC1=CC(C)=NC(N)=N1 IDQNBVFPZMCDDN-UHFFFAOYSA-N 0.000 description 2
- CDOUZKKFHVEKRI-UHFFFAOYSA-N 3-bromo-n-[(prop-2-enoylamino)methyl]propanamide Chemical compound BrCCC(=O)NCNC(=O)C=C CDOUZKKFHVEKRI-UHFFFAOYSA-N 0.000 description 2
- 241001621841 Alopecurus myosuroides Species 0.000 description 2
- 244000078782 Brassica arvensis Species 0.000 description 2
- 235000008427 Brassica arvensis Nutrition 0.000 description 2
- 235000014552 Cassia tora Nutrition 0.000 description 2
- 235000016854 Cyperus rotundus Nutrition 0.000 description 2
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 2
- 240000008853 Datura stramonium Species 0.000 description 2
- SPANOECCGNXGNR-UITAMQMPSA-N Diallat Chemical compound CC(C)N(C(C)C)C(=O)SC\C(Cl)=C\Cl SPANOECCGNXGNR-UITAMQMPSA-N 0.000 description 2
- 235000012827 Digitaria sp Nutrition 0.000 description 2
- 240000003826 Eichhornia crassipes Species 0.000 description 2
- DHMQDGOQFOQNFH-UHFFFAOYSA-N Glycine Chemical compound NCC(O)=O DHMQDGOQFOQNFH-UHFFFAOYSA-N 0.000 description 2
- 241000207783 Ipomoea Species 0.000 description 2
- 235000021506 Ipomoea Nutrition 0.000 description 2
- 239000005909 Kieselgur Substances 0.000 description 2
- 235000003403 Limnocharis flava Nutrition 0.000 description 2
- 244000100545 Lolium multiflorum Species 0.000 description 2
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 2
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical class C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 description 2
- 101100114416 Neurospora crassa (strain ATCC 24698 / 74-OR23-1A / CBS 708.71 / DSM 1257 / FGSC 987) con-10 gene Proteins 0.000 description 2
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 2
- JWOLLWQJKQOEOL-UHFFFAOYSA-N OOOOOOOOOOOOO Chemical compound OOOOOOOOOOOOO JWOLLWQJKQOEOL-UHFFFAOYSA-N 0.000 description 2
- GFRROZIJVHUSKZ-FXGMSQOLSA-N OS I Natural products C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](OC[C@@H](O)[C@@H](O)[C@@H](O)CO)[C@@H]2NC(=O)C)[C@H](O)[C@H](O)[C@H]1O GFRROZIJVHUSKZ-FXGMSQOLSA-N 0.000 description 2
- 241001330451 Paspalum notatum Species 0.000 description 2
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 2
- 241000209504 Poaceae Species 0.000 description 2
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 2
- 239000002202 Polyethylene glycol Substances 0.000 description 2
- 239000004372 Polyvinyl alcohol Substances 0.000 description 2
- 239000004965 Silica aerogel Substances 0.000 description 2
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 239000000440 bentonite Substances 0.000 description 2
- 229910000278 bentonite Inorganic materials 0.000 description 2
- SVPXDRXYRYOSEX-UHFFFAOYSA-N bentoquatam Chemical compound O.O=[Si]=O.O=[Al]O[Al]=O SVPXDRXYRYOSEX-UHFFFAOYSA-N 0.000 description 2
- YDPWVAMKZSUTGO-UHFFFAOYSA-N benzenesulfonamide;sodium Chemical compound [Na].NS(=O)(=O)C1=CC=CC=C1 YDPWVAMKZSUTGO-UHFFFAOYSA-N 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 239000006227 byproduct Substances 0.000 description 2
- 229910052791 calcium Inorganic materials 0.000 description 2
- RYAGRZNBULDMBW-UHFFFAOYSA-L calcium;3-(2-hydroxy-3-methoxyphenyl)-2-[2-methoxy-4-(3-sulfonatopropyl)phenoxy]propane-1-sulfonate Chemical compound [Ca+2].COC1=CC=CC(CC(CS([O-])(=O)=O)OC=2C(=CC(CCCS([O-])(=O)=O)=CC=2)OC)=C1O RYAGRZNBULDMBW-UHFFFAOYSA-L 0.000 description 2
- 239000000969 carrier Substances 0.000 description 2
- 239000004927 clay Substances 0.000 description 2
- 238000011161 development Methods 0.000 description 2
- 230000018109 developmental process Effects 0.000 description 2
- MTHSVFCYNBDYFN-UHFFFAOYSA-N diethylene glycol Chemical compound OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 description 2
- 235000019329 dioctyl sodium sulphosuccinate Nutrition 0.000 description 2
- BNIILDVGGAEEIG-UHFFFAOYSA-L disodium hydrogen phosphate Chemical compound [Na+].[Na+].OP([O-])([O-])=O BNIILDVGGAEEIG-UHFFFAOYSA-L 0.000 description 2
- 229910000397 disodium phosphate Inorganic materials 0.000 description 2
- 235000019800 disodium phosphate Nutrition 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 235000013305 food Nutrition 0.000 description 2
- 230000002218 hypoglycaemic effect Effects 0.000 description 2
- 238000002329 infrared spectrum Methods 0.000 description 2
- 239000000543 intermediate Substances 0.000 description 2
- 150000002540 isothiocyanates Chemical class 0.000 description 2
- 229910052622 kaolinite Inorganic materials 0.000 description 2
- NNGMNPBTIAIDFA-UHFFFAOYSA-M lithium;furan-2-sulfinate Chemical compound [Li+].[O-]S(=O)C1=CC=CO1 NNGMNPBTIAIDFA-UHFFFAOYSA-M 0.000 description 2
- 239000011777 magnesium Substances 0.000 description 2
- 229910052749 magnesium Inorganic materials 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- UJYAZVSPFMJCLW-UHFFFAOYSA-N n-(oxomethylidene)benzenesulfonamide Chemical class O=C=NS(=O)(=O)C1=CC=CC=C1 UJYAZVSPFMJCLW-UHFFFAOYSA-N 0.000 description 2
- JBPHCEHVHVSGEP-UHFFFAOYSA-N n-(oxomethylidene)thiophene-2-sulfonamide Chemical compound O=C=NS(=O)(=O)C1=CC=CS1 JBPHCEHVHVSGEP-UHFFFAOYSA-N 0.000 description 2
- HNHVTXYLRVGMHD-UHFFFAOYSA-N n-butyl isocyanate Chemical compound CCCCN=C=O HNHVTXYLRVGMHD-UHFFFAOYSA-N 0.000 description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 description 2
- 239000012053 oil suspension Substances 0.000 description 2
- CTSLXHKWHWQRSH-UHFFFAOYSA-N oxalyl chloride Chemical compound ClC(=O)C(Cl)=O CTSLXHKWHWQRSH-UHFFFAOYSA-N 0.000 description 2
- 238000004806 packaging method and process Methods 0.000 description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- 229920001223 polyethylene glycol Polymers 0.000 description 2
- 229920002451 polyvinyl alcohol Polymers 0.000 description 2
- 239000012429 reaction media Substances 0.000 description 2
- 239000000377 silicon dioxide Substances 0.000 description 2
- 239000002002 slurry Substances 0.000 description 2
- 239000000600 sorbitol Substances 0.000 description 2
- 150000003871 sulfonates Chemical class 0.000 description 2
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- 229960000278 theophylline Drugs 0.000 description 2
- ZFXYFBGIUFBOJW-UHFFFAOYSA-N theophylline Chemical compound O=C1N(C)C(=O)N(C)C2=C1NC=N2 ZFXYFBGIUFBOJW-UHFFFAOYSA-N 0.000 description 2
- 239000002562 thickening agent Substances 0.000 description 2
- 229930192474 thiophene Chemical class 0.000 description 2
- 238000001665 trituration Methods 0.000 description 2
- 239000008096 xylene Substances 0.000 description 2
- XNRBLQMJVXSCAJ-UHFFFAOYSA-N (2-chlorophenyl) carbamate Chemical compound NC(=O)OC1=CC=CC=C1Cl XNRBLQMJVXSCAJ-UHFFFAOYSA-N 0.000 description 1
- JYEUMXHLPRZUAT-UHFFFAOYSA-N 1,2,3-triazine Chemical compound C1=CN=NN=C1 JYEUMXHLPRZUAT-UHFFFAOYSA-N 0.000 description 1
- NWUYHJFMYQTDRP-UHFFFAOYSA-N 1,2-bis(ethenyl)benzene;1-ethenyl-2-ethylbenzene;styrene Chemical compound C=CC1=CC=CC=C1.CCC1=CC=CC=C1C=C.C=CC1=CC=CC=C1C=C NWUYHJFMYQTDRP-UHFFFAOYSA-N 0.000 description 1
- DHEBKYOPMVVWGT-UHFFFAOYSA-N 1-(4-methylpyrimidin-2-yl)-3-naphthalen-1-ylsulfonylurea Chemical compound CC1=CC=NC(NC(=O)NS(=O)(=O)C=2C3=CC=CC=C3C=CC=2)=N1 DHEBKYOPMVVWGT-UHFFFAOYSA-N 0.000 description 1
- 239000005631 2,4-Dichlorophenoxyacetic acid Substances 0.000 description 1
- HXKWSTRRCHTUEC-UHFFFAOYSA-N 2,4-Dichlorophenoxyaceticacid Chemical compound OC(=O)C(Cl)OC1=CC=C(Cl)C=C1 HXKWSTRRCHTUEC-UHFFFAOYSA-N 0.000 description 1
- UENGBOCGGKLVJJ-UHFFFAOYSA-N 2-chloro-1-(2,4-difluorophenyl)ethanone Chemical compound FC1=CC=C(C(=O)CCl)C(F)=C1 UENGBOCGGKLVJJ-UHFFFAOYSA-N 0.000 description 1
- LALCDSDHLXWTTL-UHFFFAOYSA-N 2-chloro-n-(oxomethylidene)benzenesulfonamide Chemical compound ClC1=CC=CC=C1S(=O)(=O)N=C=O LALCDSDHLXWTTL-UHFFFAOYSA-N 0.000 description 1
- JCCBZCMSYUSCFM-UHFFFAOYSA-N 2-chlorobenzenesulfonamide Chemical compound NS(=O)(=O)C1=CC=CC=C1Cl JCCBZCMSYUSCFM-UHFFFAOYSA-N 0.000 description 1
- CYEJMVLDXAUOPN-UHFFFAOYSA-N 2-dodecylphenol Chemical compound CCCCCCCCCCCCC1=CC=CC=C1O CYEJMVLDXAUOPN-UHFFFAOYSA-N 0.000 description 1
- ZKPVBDCWESAKGC-UHFFFAOYSA-N 2-ethoxybenzenesulfonamide Chemical compound CCOC1=CC=CC=C1S(N)(=O)=O ZKPVBDCWESAKGC-UHFFFAOYSA-N 0.000 description 1
- NXFQWRWXEYTOTK-UHFFFAOYSA-N 2-methyl-4-amino-6-methoxy-s-triazine Chemical compound COC1=NC(C)=NC(N)=N1 NXFQWRWXEYTOTK-UHFFFAOYSA-N 0.000 description 1
- AJVBPNRMKNARPG-UHFFFAOYSA-N 3-sulfamoylbenzamide Chemical compound NC(=O)C1=CC=CC(S(N)(=O)=O)=C1 AJVBPNRMKNARPG-UHFFFAOYSA-N 0.000 description 1
- LVFRCHIUUKWBLR-UHFFFAOYSA-N 4,6-dimethoxypyrimidin-2-amine Chemical compound COC1=CC(OC)=NC(N)=N1 LVFRCHIUUKWBLR-UHFFFAOYSA-N 0.000 description 1
- VQZRXBOTCNWNLM-UHFFFAOYSA-N 4,6-dimethyl-1,3,5-triazin-2-amine Chemical compound CC1=NC(C)=NC(N)=N1 VQZRXBOTCNWNLM-UHFFFAOYSA-N 0.000 description 1
- SNWZXTZIZWBIDQ-UHFFFAOYSA-N 4-methoxy-6-methylpyrimidin-2-amine Chemical compound COC1=CC(C)=NC(N)=N1 SNWZXTZIZWBIDQ-UHFFFAOYSA-N 0.000 description 1
- 241001290610 Abildgaardia Species 0.000 description 1
- 241000219144 Abutilon Species 0.000 description 1
- RZVAJINKPMORJF-UHFFFAOYSA-N Acetaminophen Chemical compound CC(=O)NC1=CC=C(O)C=C1 RZVAJINKPMORJF-UHFFFAOYSA-N 0.000 description 1
- 244000144706 Aeschynomene indica Species 0.000 description 1
- 235000004051 Aeschynomene indica Nutrition 0.000 description 1
- 241000219318 Amaranthus Species 0.000 description 1
- 240000001592 Amaranthus caudatus Species 0.000 description 1
- 235000009328 Amaranthus caudatus Nutrition 0.000 description 1
- 235000013479 Amaranthus retroflexus Nutrition 0.000 description 1
- 235000004135 Amaranthus viridis Nutrition 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- 244000251090 Anthemis cotula Species 0.000 description 1
- 235000007639 Anthemis cotula Nutrition 0.000 description 1
- 235000005781 Avena Nutrition 0.000 description 1
- 235000004535 Avena sterilis Nutrition 0.000 description 1
- 229930194845 Bahia Natural products 0.000 description 1
- 241001645380 Bassia scoparia Species 0.000 description 1
- SLCGUGMPSUYJAY-UHFFFAOYSA-N Benzoylprop-ethyl Chemical compound C=1C=C(Cl)C(Cl)=CC=1N(C(C)C(=O)OCC)C(=O)C1=CC=CC=C1 SLCGUGMPSUYJAY-UHFFFAOYSA-N 0.000 description 1
- 241000219310 Beta vulgaris subsp. vulgaris Species 0.000 description 1
- 241000219198 Brassica Species 0.000 description 1
- 235000003351 Brassica cretica Nutrition 0.000 description 1
- 235000011292 Brassica rapa Nutrition 0.000 description 1
- 235000003343 Brassica rupestris Nutrition 0.000 description 1
- DRSHXJFUUPIBHX-UHFFFAOYSA-N COc1ccc(cc1)N1N=CC2C=NC(Nc3cc(OC)c(OC)c(OCCCN4CCN(C)CC4)c3)=NC12 Chemical compound COc1ccc(cc1)N1N=CC2C=NC(Nc3cc(OC)c(OC)c(OCCCN4CCN(C)CC4)c3)=NC12 DRSHXJFUUPIBHX-UHFFFAOYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- 235000009344 Chenopodium album Nutrition 0.000 description 1
- 240000000005 Chenopodium berlandieri Species 0.000 description 1
- 235000005484 Chenopodium berlandieri Nutrition 0.000 description 1
- 235000009332 Chenopodium rubrum Nutrition 0.000 description 1
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 1
- 241000207892 Convolvulus Species 0.000 description 1
- 229910021591 Copper(I) chloride Inorganic materials 0.000 description 1
- 235000017896 Digitaria Nutrition 0.000 description 1
- 241001303487 Digitaria <clam> Species 0.000 description 1
- HJEINPVZRDJRBY-UHFFFAOYSA-N Disul Chemical compound OS(=O)(=O)OCCOC1=CC=C(Cl)C=C1Cl HJEINPVZRDJRBY-UHFFFAOYSA-N 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- 235000009419 Fagopyrum esculentum Nutrition 0.000 description 1
- 240000008620 Fagopyrum esculentum Species 0.000 description 1
- 102100039401 Gap junction beta-6 protein Human genes 0.000 description 1
- 239000004471 Glycine Substances 0.000 description 1
- 235000009432 Gossypium hirsutum Nutrition 0.000 description 1
- 206010053759 Growth retardation Diseases 0.000 description 1
- 101000657326 Homo sapiens Protein TANC2 Proteins 0.000 description 1
- 240000005979 Hordeum vulgare Species 0.000 description 1
- 235000007340 Hordeum vulgare Nutrition 0.000 description 1
- 241000229754 Iva xanthiifolia Species 0.000 description 1
- 235000017858 Laurus nobilis Nutrition 0.000 description 1
- 244000147568 Laurus nobilis Species 0.000 description 1
- 241001300479 Macroptilium Species 0.000 description 1
- 244000042664 Matricaria chamomilla Species 0.000 description 1
- 235000007232 Matricaria chamomilla Nutrition 0.000 description 1
- 240000004658 Medicago sativa Species 0.000 description 1
- 235000017587 Medicago sativa ssp. sativa Nutrition 0.000 description 1
- 229910017974 NH40H Inorganic materials 0.000 description 1
- 238000005481 NMR spectroscopy Methods 0.000 description 1
- JLNTWVDSQRNWFU-UHFFFAOYSA-N OOOOOOO Chemical compound OOOOOOO JLNTWVDSQRNWFU-UHFFFAOYSA-N 0.000 description 1
- UIQWBVPFHHQZHH-UHFFFAOYSA-N OOOOOOOOOOOOOO Chemical compound OOOOOOOOOOOOOO UIQWBVPFHHQZHH-UHFFFAOYSA-N 0.000 description 1
- CQGRLHBOVUGVEA-UHFFFAOYSA-N OOOOOOOOOOOOOOO Chemical compound OOOOOOOOOOOOOOO CQGRLHBOVUGVEA-UHFFFAOYSA-N 0.000 description 1
- 241000312413 Omoea Species 0.000 description 1
- 235000011999 Panicum crusgalli Nutrition 0.000 description 1
- 241001163743 Perlodes Species 0.000 description 1
- 231100000674 Phytotoxicity Toxicity 0.000 description 1
- 241000209049 Poa pratensis Species 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- 229920001213 Polysorbate 20 Polymers 0.000 description 1
- 102100034784 Protein TANC2 Human genes 0.000 description 1
- CZPWVGJYEJSRLH-UHFFFAOYSA-N Pyrimidine Chemical compound C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 description 1
- 229910005948 SO2Cl Inorganic materials 0.000 description 1
- 241001529553 Scoparia <angiosperm> Species 0.000 description 1
- 241000533293 Sesbania emerus Species 0.000 description 1
- 235000017016 Setaria faberi Nutrition 0.000 description 1
- 235000002834 Sida rhombifolia Nutrition 0.000 description 1
- 240000003194 Sida rhombifolia Species 0.000 description 1
- 240000007807 Sisymbrium officinale Species 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- 229920002125 Sokalan® Polymers 0.000 description 1
- 244000138286 Sorghum saccharatum Species 0.000 description 1
- 241001415395 Spea Species 0.000 description 1
- 235000021536 Sugar beet Nutrition 0.000 description 1
- 229940100389 Sulfonylurea Drugs 0.000 description 1
- 241000623377 Terminalia elliptica Species 0.000 description 1
- 241000404538 Tripleurospermum maritimum subsp. inodorum Species 0.000 description 1
- ISAKRJDGNUQOIC-UHFFFAOYSA-N Uracil Chemical class O=C1C=CNC(=O)N1 ISAKRJDGNUQOIC-UHFFFAOYSA-N 0.000 description 1
- 235000007244 Zea mays Nutrition 0.000 description 1
- OCBFFGCSTGGPSQ-UHFFFAOYSA-N [CH2]CC Chemical compound [CH2]CC OCBFFGCSTGGPSQ-UHFFFAOYSA-N 0.000 description 1
- UKLDJPRMSDWDSL-UHFFFAOYSA-L [dibutyl(dodecanoyloxy)stannyl] dodecanoate Chemical compound CCCCCCCCCCCC(=O)O[Sn](CCCC)(CCCC)OC(=O)CCCCCCCCCCC UKLDJPRMSDWDSL-UHFFFAOYSA-L 0.000 description 1
- 238000000862 absorption spectrum Methods 0.000 description 1
- 239000011149 active material Substances 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 238000005054 agglomeration Methods 0.000 description 1
- 230000002776 aggregation Effects 0.000 description 1
- 239000003905 agrochemical Substances 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 150000004703 alkoxides Chemical class 0.000 description 1
- 229940037003 alum Drugs 0.000 description 1
- 150000005005 aminopyrimidines Chemical class 0.000 description 1
- QXAITBQSYVNQDR-UHFFFAOYSA-N amitraz Chemical compound C=1C=C(C)C=C(C)C=1N=CN(C)C=NC1=CC=C(C)C=C1C QXAITBQSYVNQDR-UHFFFAOYSA-N 0.000 description 1
- 150000003931 anilides Chemical class 0.000 description 1
- 150000001450 anions Chemical class 0.000 description 1
- 239000003472 antidiabetic agent Substances 0.000 description 1
- 229940125708 antidiabetic agent Drugs 0.000 description 1
- 150000001555 benzenes Chemical class 0.000 description 1
- CSKNSYBAZOQPLR-UHFFFAOYSA-N benzenesulfonyl chloride Chemical compound ClS(=O)(=O)C1=CC=CC=C1 CSKNSYBAZOQPLR-UHFFFAOYSA-N 0.000 description 1
- 230000004071 biological effect Effects 0.000 description 1
- QKSKPIVNLNLAAV-UHFFFAOYSA-N bis(2-chloroethyl) sulfide Chemical compound ClCCSCCCl QKSKPIVNLNLAAV-UHFFFAOYSA-N 0.000 description 1
- 239000001273 butane Substances 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 150000001721 carbon Chemical group 0.000 description 1
- 239000003729 cation exchange resin Substances 0.000 description 1
- 125000002091 cationic group Chemical group 0.000 description 1
- 238000003889 chemical engineering Methods 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- OXBLHERUFWYNTN-UHFFFAOYSA-M copper(I) chloride Chemical compound [Cu]Cl OXBLHERUFWYNTN-UHFFFAOYSA-M 0.000 description 1
- 230000007797 corrosion Effects 0.000 description 1
- 238000005260 corrosion Methods 0.000 description 1
- 244000038559 crop plants Species 0.000 description 1
- 229940045803 cuprous chloride Drugs 0.000 description 1
- JJCFRYNCJDLXIK-UHFFFAOYSA-N cyproheptadine Chemical compound C1CN(C)CCC1=C1C2=CC=CC=C2C=CC2=CC=CC=C21 JJCFRYNCJDLXIK-UHFFFAOYSA-N 0.000 description 1
- 230000003111 delayed effect Effects 0.000 description 1
- 239000003599 detergent Substances 0.000 description 1
- 239000012954 diazonium Substances 0.000 description 1
- 150000001989 diazonium salts Chemical class 0.000 description 1
- 239000012975 dibutyltin dilaurate Substances 0.000 description 1
- MCWXGJITAZMZEV-UHFFFAOYSA-N dimethoate Chemical compound CNC(=O)CSP(=S)(OC)OC MCWXGJITAZMZEV-UHFFFAOYSA-N 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 239000000428 dust Substances 0.000 description 1
- 239000004495 emulsifiable concentrate Substances 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 238000004880 explosion Methods 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 239000000835 fiber Substances 0.000 description 1
- RZILCCPWPBTYDO-UHFFFAOYSA-N fluometuron Chemical compound CN(C)C(=O)NC1=CC=CC(C(F)(F)F)=C1 RZILCCPWPBTYDO-UHFFFAOYSA-N 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- 239000001963 growth medium Substances 0.000 description 1
- 231100000001 growth retardation Toxicity 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 150000004678 hydrides Chemical class 0.000 description 1
- 125000001145 hydrido group Chemical group *[H] 0.000 description 1
- VRLIPUYDFBXWCH-UHFFFAOYSA-N hydridocarbon(.) Chemical compound [CH] VRLIPUYDFBXWCH-UHFFFAOYSA-N 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 208000006278 hypochromic anemia Diseases 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 238000010348 incorporation Methods 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 239000002917 insecticide Substances 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- CYPPCCJJKNISFK-UHFFFAOYSA-J kaolinite Chemical compound [OH-].[OH-].[OH-].[OH-].[Al+3].[Al+3].[O-][Si](=O)O[Si]([O-])=O CYPPCCJJKNISFK-UHFFFAOYSA-J 0.000 description 1
- 210000001699 lower leg Anatomy 0.000 description 1
- BACHBFVBHLGWSL-UHFFFAOYSA-N methyl 2-[4-(2,4-dichlorophenoxy)phenoxy]propanoate Chemical compound C1=CC(OC(C)C(=O)OC)=CC=C1OC1=CC=C(Cl)C=C1Cl BACHBFVBHLGWSL-UHFFFAOYSA-N 0.000 description 1
- FOXFZRUHNHCZPX-UHFFFAOYSA-N metribuzin Chemical compound CSC1=NN=C(C(C)(C)C)C(=O)N1N FOXFZRUHNHCZPX-UHFFFAOYSA-N 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 229910000403 monosodium phosphate Inorganic materials 0.000 description 1
- 235000019799 monosodium phosphate Nutrition 0.000 description 1
- 235000010460 mustard Nutrition 0.000 description 1
- XJGMMMDJIMLHJE-UHFFFAOYSA-N n-(oxomethylidene)furan-2-sulfonamide Chemical compound O=C=NS(=O)(=O)C1=CC=CO1 XJGMMMDJIMLHJE-UHFFFAOYSA-N 0.000 description 1
- UWGLXIJZWGXFRV-UHFFFAOYSA-N n-(oxomethylidene)naphthalene-1-sulfonamide Chemical compound C1=CC=C2C(S(=O)(=O)N=C=O)=CC=CC2=C1 UWGLXIJZWGXFRV-UHFFFAOYSA-N 0.000 description 1
- ZACBJJDJJBGIDC-UHFFFAOYSA-N n-(sulfanylidenemethylidene)benzenesulfonamide Chemical compound S=C=NS(=O)(=O)C1=CC=CC=C1 ZACBJJDJJBGIDC-UHFFFAOYSA-N 0.000 description 1
- IJDNQMDRQITEOD-UHFFFAOYSA-N n-butane Chemical compound CCCC IJDNQMDRQITEOD-UHFFFAOYSA-N 0.000 description 1
- OFBQJSOFQDEBGM-UHFFFAOYSA-N n-pentane Natural products CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 1
- ZFIFHAKCBWOSRN-UHFFFAOYSA-N naphthalene-1-sulfonamide Chemical compound C1=CC=C2C(S(=O)(=O)N)=CC=CC2=C1 ZFIFHAKCBWOSRN-UHFFFAOYSA-N 0.000 description 1
- 230000017074 necrotic cell death Effects 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- TVMXDCGIABBOFY-UHFFFAOYSA-N octane Chemical compound CCCCCCCC TVMXDCGIABBOFY-UHFFFAOYSA-N 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- AHLBNYSZXLDEJQ-FWEHEUNISA-N orlistat Chemical compound CCCCCCCCCCC[C@H](OC(=O)[C@H](CC(C)C)NC=O)C[C@@H]1OC(=O)[C@H]1CCCCCC AHLBNYSZXLDEJQ-FWEHEUNISA-N 0.000 description 1
- 230000002688 persistence Effects 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 238000005191 phase separation Methods 0.000 description 1
- NCAIGTHBQTXTLR-UHFFFAOYSA-N phentermine hydrochloride Chemical compound [Cl-].CC(C)([NH3+])CC1=CC=CC=C1 NCAIGTHBQTXTLR-UHFFFAOYSA-N 0.000 description 1
- 125000003170 phenylsulfonyl group Chemical group C1(=CC=CC=C1)S(=O)(=O)* 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 230000019612 pigmentation Effects 0.000 description 1
- 239000004584 polyacrylic acid Substances 0.000 description 1
- 229920000728 polyester Polymers 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 239000000256 polyoxyethylene sorbitan monolaurate Substances 0.000 description 1
- 235000010486 polyoxyethylene sorbitan monolaurate Nutrition 0.000 description 1
- 230000003389 potentiating effect Effects 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 125000004076 pyridyl group Chemical group 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 239000011369 resultant mixture Substances 0.000 description 1
- 230000005070 ripening Effects 0.000 description 1
- 238000005096 rolling process Methods 0.000 description 1
- 230000007226 seed germination Effects 0.000 description 1
- AJPJDKMHJJGVTQ-UHFFFAOYSA-M sodium dihydrogen phosphate Chemical compound [Na+].OP(O)([O-])=O AJPJDKMHJJGVTQ-UHFFFAOYSA-M 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 239000008247 solid mixture Substances 0.000 description 1
- 239000000243 solution Substances 0.000 description 1
- 239000012258 stirred mixture Substances 0.000 description 1
- 150000005846 sugar alcohols Polymers 0.000 description 1
- YROXIXLRRCOBKF-UHFFFAOYSA-N sulfonylurea Chemical compound OC(=N)N=S(=O)=O YROXIXLRRCOBKF-UHFFFAOYSA-N 0.000 description 1
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical class ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 description 1
- 230000001629 suppression Effects 0.000 description 1
- 239000004546 suspension concentrate Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 1
- 238000010998 test method Methods 0.000 description 1
- 150000003577 thiophenes Chemical class 0.000 description 1
- 150000003918 triazines Chemical class 0.000 description 1
- YNJBWRMUSHSURL-UHFFFAOYSA-N trichloroacetic acid Chemical compound OC(=O)C(Cl)(Cl)Cl YNJBWRMUSHSURL-UHFFFAOYSA-N 0.000 description 1
- 230000000007 visual effect Effects 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 238000001238 wet grinding Methods 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
- 239000002023 wood Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/02—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings
- C07D239/24—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members
- C07D239/28—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to ring carbon atoms
- C07D239/46—Two or more oxygen, sulphur or nitrogen atoms
- C07D239/47—One nitrogen atom and one oxygen or sulfur atom, e.g. cytosine
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N47/00—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a carbon atom not being member of a ring and having no bond to a carbon or hydrogen atom, e.g. derivatives of carbonic acid
- A01N47/08—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a carbon atom not being member of a ring and having no bond to a carbon or hydrogen atom, e.g. derivatives of carbonic acid the carbon atom having one or more single bonds to nitrogen atoms
- A01N47/28—Ureas or thioureas containing the groups >N—CO—N< or >N—CS—N<
- A01N47/36—Ureas or thioureas containing the groups >N—CO—N< or >N—CS—N< containing the group >N—CO—N< directly attached to at least one heterocyclic ring; Thio analogues thereof
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/02—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings
- C07D239/24—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/02—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings
- C07D239/24—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members
- C07D239/26—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/02—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings
- C07D239/24—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members
- C07D239/28—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to ring carbon atoms
- C07D239/32—One oxygen, sulfur or nitrogen atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/02—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings
- C07D239/24—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members
- C07D239/28—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to ring carbon atoms
- C07D239/32—One oxygen, sulfur or nitrogen atom
- C07D239/42—One nitrogen atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/02—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings
- C07D239/24—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members
- C07D239/28—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to ring carbon atoms
- C07D239/46—Two or more oxygen, sulphur or nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/02—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings
- C07D239/24—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members
- C07D239/28—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to ring carbon atoms
- C07D239/46—Two or more oxygen, sulphur or nitrogen atoms
- C07D239/52—Two oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/02—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings
- C07D239/24—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members
- C07D239/28—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to ring carbon atoms
- C07D239/46—Two or more oxygen, sulphur or nitrogen atoms
- C07D239/56—One oxygen atom and one sulfur atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D251/00—Heterocyclic compounds containing 1,3,5-triazine rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D251/00—Heterocyclic compounds containing 1,3,5-triazine rings
- C07D251/02—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings
- C07D251/12—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D251/00—Heterocyclic compounds containing 1,3,5-triazine rings
- C07D251/02—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings
- C07D251/12—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members
- C07D251/14—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members with hydrogen or carbon atoms directly attached to at least one ring carbon atom
- C07D251/16—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members with hydrogen or carbon atoms directly attached to at least one ring carbon atom to only one ring carbon atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D251/00—Heterocyclic compounds containing 1,3,5-triazine rings
- C07D251/02—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings
- C07D251/12—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members
- C07D251/14—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members with hydrogen or carbon atoms directly attached to at least one ring carbon atom
- C07D251/22—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members with hydrogen or carbon atoms directly attached to at least one ring carbon atom to two ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D251/00—Heterocyclic compounds containing 1,3,5-triazine rings
- C07D251/02—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings
- C07D251/12—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members
- C07D251/26—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members with only hetero atoms directly attached to ring carbon atoms
- C07D251/40—Nitrogen atoms
- C07D251/42—One nitrogen atom
- C07D251/46—One nitrogen atom with oxygen or sulfur atoms attached to the two other ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D253/00—Heterocyclic compounds containing six-membered rings having three nitrogen atoms as the only ring hetero atoms, not provided for by group C07D251/00
- C07D253/02—Heterocyclic compounds containing six-membered rings having three nitrogen atoms as the only ring hetero atoms, not provided for by group C07D251/00 not condensed with other rings
- C07D253/06—1,2,4-Triazines
- C07D253/065—1,2,4-Triazines having three double bonds between ring members or between ring members and non-ring members
- C07D253/07—1,2,4-Triazines having three double bonds between ring members or between ring members and non-ring members with hetero atoms, or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/02—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings
- C07D307/34—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/02—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings
- C07D307/34—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D307/56—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D307/64—Sulfur atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/02—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings
- C07D333/04—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D405/00—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom
- C07D405/02—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings
- C07D405/12—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D521/00—Heterocyclic compounds containing unspecified hetero rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Life Sciences & Earth Sciences (AREA)
- Agronomy & Crop Science (AREA)
- Pest Control & Pesticides (AREA)
- Plant Pathology (AREA)
- Health & Medical Sciences (AREA)
- Engineering & Computer Science (AREA)
- Dentistry (AREA)
- General Health & Medical Sciences (AREA)
- Wood Science & Technology (AREA)
- Zoology (AREA)
- Environmental Sciences (AREA)
- Plural Heterocyclic Compounds (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
Applications Claiming Priority (7)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US67466876A | 1976-04-07 | 1976-04-07 | |
| US674,668 | 1976-04-07 | ||
| US76991277A | 1977-02-23 | 1977-02-23 | |
| US76991377A | 1977-02-23 | 1977-02-23 | |
| US76991477A | 1977-02-23 | 1977-02-23 | |
| US769,914 | 1977-02-23 | ||
| US769,913 | 1977-02-23 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1082189A true CA1082189A (en) | 1980-07-22 |
Family
ID=27505360
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA275,660A Expired CA1082189A (en) | 1976-04-07 | 1977-04-06 | Herbicidal sulfonamides |
Country Status (13)
| Country | Link |
|---|---|
| US (2) | US4127405A (OSRAM) |
| JP (1) | JPS52122384A (OSRAM) |
| AT (1) | AT357359B (OSRAM) |
| AU (2) | AU510056B2 (OSRAM) |
| BE (1) | BE853374A (OSRAM) |
| CA (1) | CA1082189A (OSRAM) |
| CH (1) | CH632643A5 (OSRAM) |
| DE (1) | DE2715786A1 (OSRAM) |
| FR (1) | FR2403337A1 (OSRAM) |
| GB (2) | GB1561120A (OSRAM) |
| LU (1) | LU77081A1 (OSRAM) |
| NL (1) | NL7703809A (OSRAM) |
| OA (1) | OA05625A (OSRAM) |
Families Citing this family (206)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DK358778A (da) * | 1977-09-19 | 1979-03-20 | Du Pont | Herbicide sulfonamider |
| US4339266A (en) * | 1977-10-06 | 1982-07-13 | E. I. Du Pont De Nemours And Company | Herbicidal sulfonamides |
| DK401978A (da) * | 1977-10-06 | 1979-04-07 | Du Pont | Herbicide sulfonamider |
| US4257802A (en) * | 1977-10-06 | 1981-03-24 | E. I. Du Pont De Nemours And Company | Herbicidal sulfonamides |
| US4191553A (en) * | 1978-03-02 | 1980-03-04 | E. I. Du Pont De Nemours And Company | Herbicidal sulfamates |
| US4564384A (en) * | 1978-05-30 | 1986-01-14 | E. I. Du Pont De Nemours And Company | Agricultural sulfonamides |
| US4755216A (en) * | 1978-05-30 | 1988-07-05 | E. I. Du Pont De Nemours And Company | Agricultural sulfonamides |
| US4394506A (en) | 1978-05-30 | 1983-07-19 | E. I. Du Pont De Nemours And Company | Agricultural sulfonamides |
| DK168779A (da) * | 1978-05-30 | 1979-12-01 | Du Pont | Agrikulturelle carbaminidothioater |
| US4383113A (en) | 1978-05-30 | 1983-05-10 | E. I. Du Pont De Nemours And Company | Agricultural sulfonamides |
| US4592978A (en) * | 1979-11-30 | 1986-06-03 | E. I. Du Pont De Nemours And Company | Agricultural sulfonamides |
| US4684395A (en) * | 1978-09-27 | 1987-08-04 | E. I. Du Pont De Nemours And Company | Agriculture sulfonamides |
| DK349479A (da) * | 1978-09-27 | 1980-03-28 | Du Pont | Sulfonamidderivater og deres anvendelse til regulering af plantevaekst |
| US4501607A (en) * | 1978-09-27 | 1985-02-26 | E. I. Du Pont De Nemours And Company | Herbicidal triazine sulfonamides |
| DE2862234D1 (en) * | 1978-11-01 | 1983-05-19 | Du Pont | Herbicidal sulfonamides, their preparation, compositions containing them and use thereof |
| DK468979A (da) * | 1978-12-04 | 1980-06-05 | Du Pont | Agrikulturelle pyridinsulfonamider |
| DK37880A (da) * | 1979-02-22 | 1980-08-23 | Du Pont | Herbicide sulfonamider |
| US4645529A (en) * | 1979-04-04 | 1987-02-24 | E. I. Du Pont De Nemours And Company | Herbicidal thiophenesulfonamides |
| DK85180A (da) * | 1979-04-04 | 1980-10-05 | Du Pont | Herbicide thiophesulfonamider |
| DK259280A (da) * | 1979-07-20 | 1981-01-21 | Du Pont | Herbicide sulfonamider |
| US4452628A (en) * | 1979-07-26 | 1984-06-05 | E. I. Du Pont De Nemours And Company | Herbicidal sulfonamides |
| US4301286A (en) * | 1979-08-20 | 1981-11-17 | E. I. Du Pont De Nemours And Company | Herbicidal O-alkyl sulfonylisoureas |
| US4293330A (en) * | 1979-10-09 | 1981-10-06 | E. I. Du Pont De Nemours And Company | Herbicidal N-(pyridinylaminocarbonyl)benzenesulfonamides |
| DK469179A (da) * | 1979-10-22 | 1981-04-23 | Du Pont | Agrikulturelle pyridinsulfonylsothiourinstoffer |
| US4892946A (en) * | 1979-11-30 | 1990-01-09 | E. I. Du Pont De Nemours And Company | Agricultural sulfonamides |
| DK465580A (da) * | 1979-11-30 | 1981-05-31 | Du Pont | Sulfonamider og deres anvendelse i prae- og postemergens-herbicider og eller plantevaekstreguleringsmidler |
| US4370479A (en) * | 1979-11-30 | 1983-01-25 | E. I. Du Pont De Nemours And Company | Herbicidal sulfonamides |
| DK172396B1 (da) * | 1979-11-30 | 1998-05-18 | Du Pont | Thiophencarboxylsyrederivater, middel til bekæmpelse af væksten af uønsket vegetation, fremgangsmåde til bekæmpelse af uønsket vegetation samt mellemprodukter til fremstilling af de nævnte derivater |
| ZA806970B (en) * | 1979-11-30 | 1982-06-30 | Du Pont | Agricultural sulfonamides |
| BR8007727A (pt) * | 1979-11-30 | 1981-06-09 | Du Pont | Composto agricola,composicao apropriada e processo para o controle do crescimento de vegetacao indesejada |
| US4339267A (en) | 1980-01-18 | 1982-07-13 | E. I. Du Pont De Nemours And Company | Herbicidal sulfonamides |
| BR8102529A (pt) * | 1980-04-29 | 1982-01-05 | Du Pont | Compostos e composicoes herbicidas ou adequados ao controle do crescimento de vegetacao indesejavel e seus processos de preparacao;processo para o controle do crescimento de vegetacao indesejavel |
| US4443244A (en) * | 1980-05-19 | 1984-04-17 | E. I. Du Pont De Nemours And Company | Herbicidal sulfonamides |
| US4398939A (en) * | 1980-06-03 | 1983-08-16 | E. I. Du Pont De Nemours And Company | Herbicidal thiophenesulfonamides |
| US4348220A (en) * | 1980-07-11 | 1982-09-07 | E. I. Du Pont De Nemours And Company | Herbicidal sulfonamides |
| US4368069A (en) * | 1980-07-11 | 1983-01-11 | E. I. Du Pont De Nemours And Company | Herbicidal sulfonamides |
| US4348219A (en) * | 1980-07-11 | 1982-09-07 | E. I. Du Pont De Nemours And Company | Herbicidal sulfonamides |
| JPS5740472A (en) * | 1980-07-11 | 1982-03-06 | Du Pont | Herbicidal sulfonamides |
| CA1204113A (en) * | 1980-07-11 | 1986-05-06 | William B. Farnham | Herbicidal sulfonamides |
| US4378991A (en) * | 1980-07-11 | 1983-04-05 | E. I. Du Pont De Nemours And Company | Herbicidal o-aryl or alkarylsulfonylureas |
| US4394153A (en) * | 1980-07-11 | 1983-07-19 | E. I. Du Pont De Nemours And Company | Herbicidal aryl esters of N-[(heterocyclic)-aminocarbonyl]sulfamic acid |
| CA1330438C (en) * | 1980-07-17 | 1994-06-28 | Willy Meyer | N-phenylsulfonyl-n'-pyrimidinyl-and-triazinylureas |
| CH657849A5 (en) * | 1980-07-17 | 1986-09-30 | Ciba Geigy Ag | N-Phenylsulfonyl-N'-pyrimidinyl- and -triazinyl ureas |
| US4391627A (en) * | 1980-07-25 | 1983-07-05 | E. I. Du Pont De Nemours And Company | Herbicidal benzothiophene and benzofuran sulfonamides |
| US4460404A (en) * | 1980-09-15 | 1984-07-17 | E. I. Dupont De Nemours And Company | Triazinyl ureas and isoureas |
| US4371391A (en) * | 1980-09-15 | 1983-02-01 | E. I. Du Pont De Nemours And Company | Herbicidal sulfonamides |
| US4369320A (en) * | 1980-11-03 | 1983-01-18 | E. I. Du Pont De Nemours And Company | N-[Heterocyclicaminocarbonyl]-8-quinolinesulfonamides |
| US4343649A (en) * | 1980-11-17 | 1982-08-10 | E. I. Du Pont De Nemours And Company | Herbicide antidotes |
| US4492599A (en) * | 1980-12-04 | 1985-01-08 | E. I. Du Pont De Nemours And Company | Herbicidal s-triazines |
| BR8200353A (pt) * | 1981-01-26 | 1982-11-23 | Du Pont | Composto quimico agricola composicao adequada para controlar o crescimento de vegetacao indesejada |
| TR21378A (tr) * | 1981-01-26 | 1984-04-26 | Nihon Tokushu Noyaku Seizo Kk | Yeni substit*e fenilsulfonil*re t*revleri,bunlarin ihzarina mahsus bir usul ve yeni ara maddeler ve bunlarin herbisidler olarak kullanimi |
| US4441910A (en) * | 1981-03-24 | 1984-04-10 | E. I. Du Pont De Nemours And Company | Thiophene or furan herbicides |
| DE3111451A1 (de) * | 1981-03-24 | 1982-10-07 | Hoechst Ag, 6000 Frankfurt | "heterocyclisch substituierte (halogen)alkyl- und alkoxysulfonylharnstoffe, verfahren zu ihrer herstellung und ihre verwendung in der landwirtschaft" |
| US4523943A (en) * | 1981-05-04 | 1985-06-18 | E. I. Du Pont De Nemours And Company | Herbicidal N-(heterocyclic)-aminocarbonyl thiophenesulfonamides |
| US4534789A (en) * | 1981-05-19 | 1985-08-13 | E. I. Du Pont De Nemours And Company | Herbicidal o-alkylsulfonyloxy- and o-alkylsulfonylaminobenzenesulfonamides |
| AU550945B2 (en) * | 1981-07-10 | 1986-04-10 | E.I. Du Pont De Nemours And Company | Triazolyl-(imidazolyl)-sulphonyl-ureas |
| US4421550A (en) * | 1981-07-10 | 1983-12-20 | E. I. Du Pont De Nemours & Co. | Herbicidal triazole ureas |
| US4443245A (en) * | 1981-07-13 | 1984-04-17 | Ciba-Geigy Corporation | N-Phenylsulfonyl-N'-triazinylureas |
| US4764610A (en) * | 1981-07-16 | 1988-08-16 | E. I. Du Pont De Nemours And Company | Herbicidal indole sulfonamides |
| BR8204028A (pt) * | 1981-07-16 | 1983-07-05 | Du Pont | Composto herbicida composicao adequada e processo para controlar o crescimento de vegetacao indesejada |
| US4443243A (en) * | 1981-07-16 | 1984-04-17 | Ciba-Geigy Corporation | N-Phenylsulfonyl-N-triazinylureas |
| US4836846A (en) * | 1981-07-16 | 1989-06-06 | E. I. Du Pont De Nemours And Company | Herbicidal indole sulfonamides |
| US4494979A (en) * | 1981-07-24 | 1985-01-22 | E. I. Du Pont De Nemours And Company | Benzofuran sulfamates |
| US4545811A (en) * | 1981-08-06 | 1985-10-08 | Ciba-Geigy Corporation | N-Phenylsulfonyl-N'-triazinyl-ureas |
| DE3131489A1 (de) * | 1981-08-08 | 1983-02-24 | Hoechst Ag, 6000 Frankfurt | Heterocyclisch substituierte sulfonylharnstoffe, verfahren zu ihrer herstellung und ihre verwendung in der landwirtschaft |
| US4453970A (en) * | 1981-09-03 | 1984-06-12 | E. I. Du Pont De Nemours And Company | Herbicidal triazinyl sulfonamides |
| US4528024A (en) * | 1981-09-09 | 1985-07-09 | E. I. Du Pont De Nemours And Company | Herbicidal alkyl sulfones |
| JPS5846071A (ja) * | 1981-09-16 | 1983-03-17 | Nippon Tokushu Noyaku Seizo Kk | 置換フエニルスルホニルウレア誘導体、その中間体、それらの製法、及び除草剤 |
| US4420325A (en) * | 1981-09-29 | 1983-12-13 | E. I. Du Pont De Nemours & Company | Herbicidal sulfonamides |
| BR8206012A (pt) * | 1981-10-16 | 1983-09-13 | Du Pont | Composto;composicao e processo adequados para controlar crescimento de vegetacao;processo para sintetizar compostos |
| US4655823A (en) * | 1981-12-07 | 1987-04-07 | E. I. Du Pont De Nemours And Company | Herbicidal sulfonamides |
| US4465506A (en) * | 1981-12-17 | 1984-08-14 | E. I. Dupont De Nemours And Company | Herbicidal N-[heterocyclicaminocarbonyl]-1H-indene and tetrahydronaphthalene sulfonamides |
| US4502882A (en) * | 1982-03-29 | 1985-03-05 | E. I. Du Pont De Nemours And Company | Substituted sulfonamides 1,3-benzodioxole |
| BR8207267A (pt) * | 1981-12-17 | 1983-10-18 | Du Pont | Compostos composicao adequada e processo para controlar crescimento de vegetacao indesejada |
| US4478635A (en) * | 1982-01-11 | 1984-10-23 | Ciba-Geigy Corporation | N-Arylsulfonyl-N'-pyrimidinylureas |
| US4618363A (en) * | 1982-01-25 | 1986-10-21 | Ciba-Geigy Corporation | N-phenylsulfonyl-N'-triazinylureas |
| US4954164A (en) * | 1982-02-27 | 1990-09-04 | Nissan Chemical Industries, Ltd. | Pyrazolesulfonylurea derivatives, preparation thereof, herbicide containing said derivative as active ingredient and herbicidal method by use thereof |
| US4500344A (en) * | 1983-03-21 | 1985-02-19 | E. I. Du Pont De Nemours And Company | Herbicidal ortho-(alkoxy)-benzenesulfonamides |
| BR8302396A (pt) * | 1982-05-12 | 1984-01-10 | Du Pont | Composto;composicao e processo adequados para controlar o crescimento de vegetacao indesejada |
| US4496392A (en) * | 1982-05-12 | 1985-01-29 | E. I. Du Pont De Nemours And Company | Herbicidal heterocyclic alkylaminocarbonylsulfonamides |
| CA1216290A (en) | 1982-05-17 | 1987-01-06 | Alden D. Josey | Process for the nucleophilic substitution of unactivated aromatic and heteroaromatic substrates |
| US4586950A (en) * | 1982-05-31 | 1986-05-06 | E. I. Du Pont De Nemours & Company | Novel phenyl-substituted sulfonamides |
| MA19797A1 (fr) * | 1982-06-14 | 1983-12-31 | Ciba Geigy Ag | N-heterocyclosulfonyl -n- pyrimidinyl et triazinylurees . |
| US4634465A (en) * | 1982-07-16 | 1987-01-06 | Ciba-Geigy Corporation | Fused N-phenylsulfonyl-N'-pyrimidinylureas and N-phenylsulfonyl-N'triazinylureas |
| US4425155A (en) | 1982-07-26 | 1984-01-10 | E. I. Du Pont De Nemours And Company | Herbicidal sulfonamide N-oxides |
| US4555262A (en) * | 1982-09-01 | 1985-11-26 | Ciba-Geigy Corporation | N-Azidophenylsulfonyl-N'-pyrimidinyl ureas |
| US4780125A (en) * | 1982-09-01 | 1988-10-25 | Ciba-Geigy Corporation | N-phenylsulfonyl-N'-triazinylureas |
| US4770690A (en) * | 1982-09-10 | 1988-09-13 | E. I. Du Pont De Nemours And Company | Herbicidal ortho-alkyl- and ortho-alkenyl-substituted benzenesulfonamides |
| DE3237368A1 (de) * | 1982-10-08 | 1984-04-12 | Bayer Ag, 5090 Leverkusen | Selektiv-herbizide mittel enthaltend ein triazinon in kombination mit einem sulfonamid |
| US4521597A (en) * | 1982-10-25 | 1985-06-04 | Ciba Geigy Corporation | Process for producing sulfonylureas having a herbicidal action |
| US4746358A (en) * | 1982-11-01 | 1988-05-24 | E. I. Du Pont De Nemours And Company | Phenyl-substituted sulfonamides |
| US4595407A (en) * | 1982-11-01 | 1986-06-17 | E. I. Du Pont De Nemours And Company | Triazinyl-amino-carbonyl-1,3-benzohetero- or -1,4-benzohetero-sulfonamides |
| EP0112803B1 (de) * | 1982-12-27 | 1987-09-02 | Ciba-Geigy Ag | Phosphorhaltige N-Phenylsulfonyl-N'-pyrimidinyl- und -triazinylharnstoffe |
| US4484939A (en) * | 1983-02-18 | 1984-11-27 | E. I. Du Pont De Nemours And Company | Herbicidal sulfonamide inner salts |
| DE3472557D1 (en) * | 1983-01-04 | 1988-08-11 | Du Pont | Herbicidal n-hydroxy-n'-sulfonylguanidines and sulfonamide inner salts |
| US4531966A (en) * | 1983-03-11 | 1985-07-30 | Stauffer Chemical Company | Herbicide compositions |
| EP0120814B1 (de) * | 1983-03-28 | 1988-07-27 | Ciba-Geigy Ag | N-Phenylsulfonyl-N'-pyrimidinyl- und -triazinylharnstoffe |
| US4604130A (en) * | 1983-03-30 | 1986-08-05 | E. I. Du Pont De Nemours And Company | Herbicidal N-[pyrimidine aminocarbonyl]isothiazole sulfonamides |
| US4917719A (en) * | 1983-03-30 | 1990-04-17 | E. I. Du Pont De Nemours And Company | Herbicidal isothiazole derivatives |
| DE3324802A1 (de) * | 1983-07-09 | 1985-01-17 | Hoechst Ag, 6230 Frankfurt | Neue n-alkoxy- und n- alkylsulfonylaminosulfonylharnstoffe, und neue (pyrimido) triazino-thiadiazinoxide als vorprodukte |
| US4604131A (en) * | 1983-08-05 | 1986-08-05 | E. I. Du Pont De Nemours And Company | Herbicidal sulfonamides |
| US4548638A (en) * | 1983-08-22 | 1985-10-22 | E. I. Du Pont De Nemours And Company | Herbicidal sulfonylureas |
| US4620870A (en) * | 1983-09-20 | 1986-11-04 | E. I. Du Pont De Nemours And Company | Phenyl-substituted sulfonamides |
| US4741761A (en) * | 1983-09-20 | 1988-05-03 | E. I. Du Pont De Nemours And Company | Novel phenyl-substituted sulfonamides |
| US4599412A (en) * | 1983-11-23 | 1986-07-08 | E. I. Du Pont De Nemours And Company | Process for preparation of sulfonylurea solution formulations |
| US4620868A (en) * | 1983-12-27 | 1986-11-04 | Ishihara Sangyo Kaisha, Ltd. | N-[(4,6-dimethoxypyrimidin-2-yl)aminocarbonyl]-3[halo-substituted ethenyl (or propenyl)]-2-thiophenesulfonamides useful as herbicides |
| US4609397A (en) * | 1984-02-21 | 1986-09-02 | E. I. Du Pont De Nemours And Company | Herbicidal 3-[[(4,6-dimethoxypyrimidine-2-yl)aminocarbonyl]aminosulfonylmethyl]-1,5-dimethyl-1H-pyrazole-4-carboxylic acids, ethyl esters |
| US5306825A (en) * | 1984-03-01 | 1994-04-26 | Consiglio Nazionale Delle Ricerche | Physostigmine derivatives with acetylcholinesterase inhibition properties, and the relative production process |
| US4761373A (en) * | 1984-03-06 | 1988-08-02 | Molecular Genetics, Inc. | Herbicide resistance in plants |
| US5304732A (en) * | 1984-03-06 | 1994-04-19 | Mgi Pharma, Inc. | Herbicide resistance in plants |
| US4723991A (en) * | 1984-03-23 | 1988-02-09 | E. I. Du Pont De Nemours And Company | Lower alkyl 2-[[N-(3-cyano-pyridin-2-yl)aminocarbonyl]aminosulphonyl]benzoate derivatives having herbicidal activity |
| DE3413565A1 (de) * | 1984-04-11 | 1985-10-24 | Bayer Ag, 5090 Leverkusen | Substituierte sulfonylharnstoffe |
| EP0158600B1 (de) * | 1984-04-11 | 1991-04-03 | Ciba-Geigy Ag | Verfahren zur selektiven Unkrautbekämpfung in Nutzpflanzenkulturen |
| US4842639A (en) * | 1984-05-07 | 1989-06-27 | E. I. Du Pont De Nemours And Company | Phenyl-substituted sulfonamides |
| US4612035A (en) * | 1984-05-09 | 1986-09-16 | E. I. Du Pont De Nemours And Company | Herbicidal N-[(4-bromo-6-methoxypyrimidin-2-yl)aminocarbonyl]-2,3-dihydro-(2-methyl)benzo[b]thiophene-7-sulfonamides, 1,1-dioxide |
| US4769060A (en) * | 1985-04-29 | 1988-09-06 | E. I. Du Pont De Nemours And Company | Herbicidal sulfonamides |
| US4897108A (en) * | 1984-06-05 | 1990-01-30 | E. I. Du Pont De Nemours And Company | Herbicidal sulfonamides |
| US4892575A (en) * | 1984-06-07 | 1990-01-09 | E. I. Du Pont De Nemours And Company | Herbicidal sulfonamides |
| HU193933B (en) * | 1984-06-08 | 1987-12-28 | Nitrokemia Ipartelepek | Herbicide or plant growth stimulating agent comprising beta-cyclodextrin complex of benzolsulphonylurea derivative and process for preparing the active substances |
| US4705555A (en) * | 1984-08-08 | 1987-11-10 | E. I. Du Pont De Nemours And Company | Herbicidal triazines |
| US4666506A (en) * | 1984-08-08 | 1987-05-19 | E. I. Du Pont De Nemours And Company | Herbicidal pyrimidines |
| US4689069A (en) * | 1984-08-08 | 1987-08-25 | E. I. Du Pont De Nemours And Company | Herbicidal acetylenic pyrimidines and triazines |
| US6211439B1 (en) | 1984-08-10 | 2001-04-03 | Mgi Pharma, Inc | Herbicide resistance in plants |
| US4659369A (en) | 1984-08-27 | 1987-04-21 | E. I. Du Pont De Nemours And Company | Herbicidal acetals and ketals |
| US4753672A (en) * | 1985-07-16 | 1988-06-28 | E. I. Du Pont De Nemours And Company | Herbicidal acetals and ketals |
| US4690705A (en) * | 1984-11-30 | 1987-09-01 | E. I. Du Pont De Nemours And Company | Herbicidal sulfonamides |
| US4666501A (en) * | 1984-12-11 | 1987-05-19 | E. I. Du Pont De Nemours And Company | Herbicidal sulfonamides |
| US4867783A (en) * | 1984-12-11 | 1989-09-19 | E. I. Du Pont De Nemours And Company | Herbicidal sulfonamides |
| NZ216253A (en) * | 1985-05-27 | 1989-07-27 | Mitsui Toatsu Chemicals | N-(3-chloro-4-isopropylphenyl)-carboxamide derivatives and herbicidal compositions |
| US4877440A (en) * | 1985-05-29 | 1989-10-31 | E. I. Du Pont De Nemours And Company | Thiophenesulfonamide herbicides |
| US4743290A (en) * | 1986-04-21 | 1988-05-10 | E. I. Du Pont De Nemours And Company | Thiophenesulfonamide herbicides |
| US5017214A (en) * | 1985-05-30 | 1991-05-21 | George Levitt | Herbicidal sulfonamides |
| EP0209230B1 (en) | 1985-05-30 | 1991-02-27 | E.I. Du Pont De Nemours And Company | Herbicidal sulfonamides |
| US4801327A (en) * | 1985-05-30 | 1989-01-31 | E. I. Du Pont De Nemours And Company | Herbicidal sulfonamides |
| US4913726A (en) * | 1985-05-30 | 1990-04-03 | E. I. Du Pont De Nemours And Company | Herbicidal sulfonamides |
| US4935528A (en) * | 1985-06-07 | 1990-06-19 | Ishihara Sangyo Kaisha Ltd. | Thiophenesulfonamide compounds, herbicidal compositions containing them, and process for their production |
| US4822402A (en) * | 1985-06-07 | 1989-04-18 | Ishihara Sangyo Kaisha Ltd. | Thiophenesulfonamide compounds, and herbicidal compositions containing them |
| US4746357A (en) * | 1985-06-27 | 1988-05-24 | E. I. Du Pont De Nemours And Company | Herbicidal acetylenic triazines |
| JPS63500375A (ja) * | 1985-08-02 | 1988-02-12 | シエブロン リサ−チ カンパニ− | 除草性2−(オクサまたはチアヘテロサイクル)5−アミノ−3−オクソ−4−(置換−フェニル)−2、3−ジヒドロフラン類 |
| US4743292A (en) * | 1985-08-26 | 1988-05-10 | E. I. Du Pont De Nemours And Company | Herbicidal sulfonamides |
| US4759790A (en) * | 1985-10-23 | 1988-07-26 | E. I. Du Pont De Nemours And Company | Herbicidal sulfonamides |
| US4906283A (en) * | 1985-10-23 | 1990-03-06 | E. I. Du Pont De Nemours And Company | Herbicidal sulfonamides |
| JPS61210003A (ja) * | 1986-02-24 | 1986-09-18 | Nissan Chem Ind Ltd | 除草剤 |
| US4902339A (en) * | 1986-03-26 | 1990-02-20 | E. I. Du Pont De Nemours And Company | Herbicidal sulfonamides |
| US4764205A (en) * | 1986-03-27 | 1988-08-16 | E. I. Du Pont De Nemours And Company | Herbicidal sulfonamides |
| JPS62242679A (ja) * | 1986-04-11 | 1987-10-23 | イ−・アイ・デユポン・デ・ニモアス・アンド・カンパニ− | スルホニル尿素化合物 |
| US4906278A (en) * | 1986-06-13 | 1990-03-06 | E. I. Du Pont De Nemours And Company | Herbicidal heterocyclic sulfonamides |
| US5011527A (en) * | 1986-06-13 | 1991-04-30 | E. I. Du Pont De Nemours And Company | Herbicidal heterocyclic sulfonamides |
| US4867781A (en) * | 1986-06-25 | 1989-09-19 | E. I. Du Pont De Nemours And Company | Phenyl-substituted sulfonamides |
| US4802908A (en) * | 1987-01-22 | 1989-02-07 | E. I. Du Pont De Nemours And Company | Herbicidal 2-(1H)-pyrazinones |
| JPS63197526U (OSRAM) * | 1987-06-12 | 1988-12-20 | ||
| FR2617167B1 (fr) * | 1987-06-25 | 1989-11-24 | Rhone Poulenc Agrochimie | Herbicides de type sulfonyluree, leur preparation, les compositions les contenant et leur utilisation |
| BR8907515A (pt) | 1988-06-28 | 1991-05-28 | Du Pont | Formulacoes de pesticidas em comprimidos |
| US5208212A (en) * | 1988-08-31 | 1993-05-04 | Fmc Corporation | Herbicidal compositions containing triazolinones |
| US5084082A (en) * | 1988-09-22 | 1992-01-28 | E. I. Du Pont De Nemours And Company | Soybean plants with dominant selectable trait for herbicide resistance |
| US5215570A (en) * | 1988-10-20 | 1993-06-01 | Ciba-Geigy Corporation | Sulfamoylphenylureas |
| US5369022A (en) * | 1988-12-30 | 1994-11-29 | American Cyanamid Company | Method to improve the protection of crops from herbicidal injury |
| GR1000748B (el) * | 1989-08-07 | 1992-12-30 | Basf Ag | Αποφυλλωτικο μεσο για τη βαμβακια. |
| GR1000753B (el) * | 1989-08-07 | 1992-12-30 | Basf Ag | Αποφυλλωτικο μεσο για τη βαμβακια. |
| DE4018349A1 (de) * | 1989-12-19 | 1991-06-20 | Bayer Ag | Verfahren zur herstellung von sulfonylharnstoff-salzen, neue sulfonylharnstoff-salze und ihre verwendung als herbizide |
| US5328896A (en) * | 1989-12-19 | 1994-07-12 | Bayer Aktiengesellschaft | Preparing herbicidal sulphonylurea salts |
| JPH05501415A (ja) * | 1990-03-07 | 1993-03-18 | フセソユーズヌイ、ナウチノ―イスレドワーチェルスキー、インスチツート、ヒミチェスキフ、スレドストフ、ザスチトイ、ラステヌイ | 置換フェニルスルホニルトリアジニル尿素、その塩並びにそれに基づく植物成長促進及び阻害用薬剤 |
| DE4038430A1 (de) * | 1990-12-01 | 1992-06-04 | Basf Ag | Herbizide n-((1,3,5-triazin-2-yl)-aminocarbonyl) benzolsulfonamide |
| ZA92970B (en) * | 1991-02-12 | 1992-10-28 | Hoechst Ag | Arylsulfonylureas,processes for their preparation,and their use as herbicides and growth regulators |
| DE4105518A1 (de) * | 1991-02-22 | 1992-08-27 | Basf Ag | Sulfonylharnstoffderivate, verfahren zu ihrer herstellung und ihre verwendung |
| US5236887B1 (en) * | 1991-05-03 | 1996-04-16 | Dowelanco | Herbicidal heterocyclic sulfonylurea compositions safened by herbicidal acids such as 2,4-d below a ph of 5 |
| US5498773A (en) * | 1991-05-03 | 1996-03-12 | Dowelanco | Herbicidal compositions with increased crop safety |
| US5262380A (en) * | 1991-05-03 | 1993-11-16 | Dowelanco | Herbicidal compositions with increased crop safety |
| JPH05345780A (ja) * | 1991-12-24 | 1993-12-27 | Kumiai Chem Ind Co Ltd | ピリミジンまたはトリアジン誘導体及び除草剤 |
| US5153324A (en) * | 1991-12-26 | 1992-10-06 | E. I. Du Pont De Nemours And Company | Process for preparing sulfonylureas |
| DE4206146A1 (de) * | 1992-02-28 | 1993-09-02 | Basf Ag | Herbizide n-((1,3,5-triazin-2-yl)aminocarbonyl)benzolsulfonamide |
| DE4206145A1 (de) * | 1992-02-28 | 1993-09-02 | Basf Ag | Herbizide n-((pyrimidin-2-yl)aminocarbonyl)benzolfulfonamide |
| AU644291B1 (en) * | 1992-06-03 | 1993-12-02 | Basf Aktiengesellschaft | Herbicidal N-{(1,3,5-triazin-2-yl)-aminocarbonyl}- benzenesulfonamides |
| DE4303130A1 (de) * | 1993-02-04 | 1994-08-11 | Bayer Ag | Selektive Herbizide auf Basis von N-Azinyl-N'-(2-ethylthiophenylsulfonyl)-harnstoffen |
| US5356789A (en) * | 1993-05-28 | 1994-10-18 | American Cyanamid Company | Methods for detecting acetohydroxyacid synthase inhibitors |
| LT3943B (en) | 1993-12-23 | 1996-05-27 | Ciba Geigy Ag | Remedy for cultured plants protection, use of sulphamoyl-phenyl-carbamides for cultured plant protection, herbicidal preparation, process for preparing sulphamoyl-phenyl-carbamides |
| RU2103263C1 (ru) * | 1995-07-03 | 1998-01-27 | Акционерное общество "Химпром" | Способ получения замещенных n-(1,3,5-триазин-2-ил)аминокарбониларилсульфонамидов |
| DE19608445A1 (de) * | 1996-03-05 | 1997-09-11 | Bayer Ag | Substituierte Arylsulfonyl(thio)harnstoffe |
| DE19651037A1 (de) | 1996-12-09 | 1998-06-10 | Bayer Ag | Substituierte Thienyl(amino)sulfonyl(thio)harnstoffe |
| US6222037B1 (en) | 1997-09-05 | 2001-04-24 | Syngenta Crop Protection, Inc. | Process for preparation of sulfonylurea salts |
| RU2135480C1 (ru) * | 1998-01-27 | 1999-08-27 | Научно-исследовательский институт химических средств защиты растений | Способ получения щелочных солей n- (гетероциклиламинокарбонил)арилсульфонамидов в виде водорастворимых гранул |
| EP1717232A1 (de) * | 2005-04-28 | 2006-11-02 | Bayer CropScience GmbH | Phenylsulfonylharnstoffe mit herbizider Wirkung |
| US8138321B2 (en) * | 2006-09-22 | 2012-03-20 | Danisco Us Inc. | Acetolactate synthase (ALS) selectable marker from Trichoderma reesei |
| EP2052612A1 (de) * | 2007-10-24 | 2009-04-29 | Bayer CropScience AG | Herbizid-Kombination |
| EP2052603A1 (de) * | 2007-10-24 | 2009-04-29 | Bayer CropScience AG | Verwendung des 2-lodo-N-[(4-methoxy-6-methyl-1,3,5-triazin-2-yl)carbamoyl] benzolsulfonamids und/oder dessen Salze zur Bekämpfung von unerwünschtem Pflanzenwuchs in ausgewählten Nutzpflanzenkulten oder Nichtkulturland |
| EP2052608A1 (de) * | 2007-10-24 | 2009-04-29 | Bayer CropScience AG | Herbizid-Kombination |
| EP2052606A1 (de) * | 2007-10-24 | 2009-04-29 | Bayer CropScience AG | Herbizid-Kombination |
| EP2052611A1 (de) * | 2007-10-24 | 2009-04-29 | Bayer CropScience AG | Herbizid-Kombination |
| EP2052610A1 (de) | 2007-10-24 | 2009-04-29 | Bayer CropScience AG | Herbizid-Kombination |
| EP2052613A1 (de) | 2007-10-24 | 2009-04-29 | Bayer CropScience AG | Herbizid-Kombination |
| EP2052605A1 (de) | 2007-10-24 | 2009-04-29 | Bayer CropScience AG | Herbizid-Kombination |
| EP2052607A1 (de) * | 2007-10-24 | 2009-04-29 | Bayer CropScience AG | Herbizid-Kombination |
| EP2052609A1 (de) | 2007-10-24 | 2009-04-29 | Bayer CropScience AG | Herbizid-Kombination |
| EP2052614A1 (de) * | 2007-10-24 | 2009-04-29 | Bayer CropScience AG | Herbizid-Kombination |
| EP2052604A1 (de) | 2007-10-24 | 2009-04-29 | Bayer CropScience AG | Salz des 2-lodo-N-[(4-methoxy-6-methyl-1,3,5-triazin-2-yl)carbamoyl] benzolsulfonamids,Verfahren zu deren Herstellung, sowie deren Verwendung als Herbizide und Pflanzenwachstumregulatoren |
| EP2052615A1 (de) * | 2007-10-24 | 2009-04-29 | Bayer CropScience AG | Herbizid-Kombination |
| EP2052616A1 (de) * | 2007-10-24 | 2009-04-29 | Bayer CropScience AG | Herbizid-Safener-Kombination |
| DE102008037620A1 (de) | 2008-08-14 | 2010-02-18 | Bayer Crop Science Ag | Herbizid-Kombination mit Dimethoxytriazinyl-substituierten Difluormethansulfonylaniliden |
| WO2010046423A2 (en) | 2008-10-22 | 2010-04-29 | Basf Se | Use of sulfonylurea herbicides on cultivated plants |
| RU2402907C1 (ru) * | 2009-02-05 | 2010-11-10 | Юрий Яковлевич Спиридонов | Гербицидная композиция и способ борьбы с сорной растительностью в паровом поле |
| CA2814589C (en) | 2010-10-15 | 2018-07-31 | Bayer Intellectual Property Gmbh | Use of als inhibitor herbicides for control of unwanted vegetation in als inhibitor herbicide tolerant beta vulgaris plants |
| EP2713733B1 (en) | 2011-05-04 | 2018-03-14 | Bayer Intellectual Property GmbH | Use of als inhibitor herbicides for control of unwanted vegetation in als inhibitor herbicide tolerant brassica, such as b. napus, plants |
| RU2466128C1 (ru) * | 2011-07-26 | 2012-11-10 | Владимир Веняминович Андронников | Способ получения гранулированного водорастворимого гербицидного препарата на основе диэтилэтаноламинных и щелочных солей арилсульфонилмочевин |
| DK2931034T4 (da) | 2012-12-13 | 2022-07-18 | Bayer Cropscience Ag | Anvendelse af als-inhibitorherbicider til bekæmpelse af uønsket vegetation i als-inhibitorherbicidtolerante beta vulgaris-planter |
| CN103444728B (zh) * | 2013-08-01 | 2016-05-11 | 广东中迅农科股份有限公司 | 一种含有双氟磺草胺和苯氧羧酸类除草剂的组合物 |
| CN105439970A (zh) * | 2015-10-16 | 2016-03-30 | 南开大学 | 一类可控土壤降解速度的磺酰脲类新结构的发现与应用 |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR1468747A (fr) * | 1965-07-19 | 1967-02-10 | Benzène-sulfonyl-1 (pyrimidyl-2)-3 urées |
-
1977
- 1977-04-06 NL NL7703809A patent/NL7703809A/xx not_active Application Discontinuation
- 1977-04-06 CA CA275,660A patent/CA1082189A/en not_active Expired
- 1977-04-06 OA OA56129A patent/OA05625A/xx unknown
- 1977-04-07 AT AT246377A patent/AT357359B/de not_active IP Right Cessation
- 1977-04-07 BE BE176530A patent/BE853374A/xx not_active IP Right Cessation
- 1977-04-07 JP JP3906277A patent/JPS52122384A/ja active Granted
- 1977-04-07 FR FR7710599A patent/FR2403337A1/fr active Granted
- 1977-04-07 AU AU24066/77A patent/AU510056B2/en not_active Expired
- 1977-04-07 GB GB14900/77A patent/GB1561120A/en not_active Expired
- 1977-04-07 AU AU24065/77A patent/AU511370B2/en not_active Expired
- 1977-04-07 LU LU77081A patent/LU77081A1/xx unknown
- 1977-04-07 DE DE19772715786 patent/DE2715786A1/de active Granted
- 1977-04-07 CH CH447277A patent/CH632643A5/de not_active IP Right Cessation
- 1977-04-07 GB GB14903/77A patent/GB1560918A/en not_active Expired
- 1977-08-15 US US05/824,805 patent/US4127405A/en not_active Expired - Lifetime
- 1977-09-01 US US05/829,823 patent/US4120691A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| AU2406677A (en) | 1978-10-12 |
| FR2403337A1 (fr) | 1979-04-13 |
| AU510056B2 (en) | 1980-06-05 |
| US4120691A (en) | 1978-10-17 |
| ATA246377A (de) | 1979-11-15 |
| LU77081A1 (OSRAM) | 1977-12-01 |
| CH632643A5 (de) | 1982-10-29 |
| OA05625A (fr) | 1981-04-30 |
| JPS6236029B2 (OSRAM) | 1987-08-05 |
| BE853374A (fr) | 1977-10-07 |
| GB1560918A (en) | 1980-02-13 |
| AT357359B (de) | 1980-07-10 |
| JPS52122384A (en) | 1977-10-14 |
| NL7703809A (nl) | 1977-10-11 |
| AU511370B2 (en) | 1980-08-14 |
| FR2403337B1 (OSRAM) | 1983-05-27 |
| GB1561120A (en) | 1980-02-13 |
| DE2715786C2 (OSRAM) | 1987-11-05 |
| US4127405A (en) | 1978-11-28 |
| AU2406577A (en) | 1978-10-12 |
| DE2715786A1 (de) | 1977-10-13 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1082189A (en) | Herbicidal sulfonamides | |
| US4169719A (en) | Herbicidal sulfonamides | |
| US4441910A (en) | Thiophene or furan herbicides | |
| CA1091234A (en) | Herbicidal sulfamates | |
| US4257802A (en) | Herbicidal sulfonamides | |
| US4391627A (en) | Herbicidal benzothiophene and benzofuran sulfonamides | |
| EP0007687B1 (en) | Sulfonamides, processes for their preparation, compositions containing said sulfonamides and a method for controlling the growth of vegetation | |
| CA1188691A (en) | Herbicidal thiophenesulfonamides | |
| US4435206A (en) | Agricultural pyridinesulfonamides | |
| US4214890A (en) | Herbicidal pyrimidine and triazine sulfonamides | |
| US4342587A (en) | Herbicidal pyridinsulfonamides | |
| US4302241A (en) | Agricultural sulfonamides | |
| EP0009419A1 (en) | Agricultural sulfonamides, and preparation and use thereof | |
| US4221585A (en) | N-[(2,6-Dimethoxypyrimidin-4-yl)]aminocarbonyl benzene sulfonamides and their herbicidal compositions and methods of use | |
| US4339266A (en) | Herbicidal sulfonamides | |
| US4522645A (en) | Agricultural pyridinesulfonamides | |
| EP0030139B1 (en) | Herbicidal ureas and isoureas, preparation and use thereof, and compositions containing them | |
| EP0070698A1 (en) | Herbicidal indole sulfonamides | |
| EP0082681A2 (en) | Herbicidal sulfonamides | |
| US4424073A (en) | Herbicidal sulfonamides | |
| EP0010560B1 (en) | Herbicidal sulfonamides, their preparation, compositions containing them and use thereof | |
| US4923995A (en) | Pyridylsulfonamides | |
| US4764610A (en) | Herbicidal indole sulfonamides | |
| US4443244A (en) | Herbicidal sulfonamides | |
| US4836846A (en) | Herbicidal indole sulfonamides |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |