CA1080625A - Conditioning non-irritating shampoo compositions - Google Patents
Conditioning non-irritating shampoo compositionsInfo
- Publication number
- CA1080625A CA1080625A CA266,626A CA266626A CA1080625A CA 1080625 A CA1080625 A CA 1080625A CA 266626 A CA266626 A CA 266626A CA 1080625 A CA1080625 A CA 1080625A
- Authority
- CA
- Canada
- Prior art keywords
- per cent
- integer
- weight
- shampoo
- shampoo composition
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000002453 shampoo Substances 0.000 title claims abstract description 91
- 239000000203 mixture Substances 0.000 title claims abstract description 47
- 230000003750 conditioning effect Effects 0.000 title claims abstract description 28
- 231100000344 non-irritating Toxicity 0.000 title claims abstract description 7
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims abstract description 20
- 239000004480 active ingredient Substances 0.000 claims abstract description 20
- 239000002280 amphoteric surfactant Substances 0.000 claims abstract description 19
- 239000003945 anionic surfactant Substances 0.000 claims abstract description 16
- 239000002736 nonionic surfactant Substances 0.000 claims abstract description 16
- 229920000642 polymer Polymers 0.000 claims abstract description 16
- 229910052757 nitrogen Inorganic materials 0.000 claims abstract description 11
- 125000002091 cationic group Chemical group 0.000 claims abstract description 10
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Substances N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims abstract description 5
- -1 carbon atom fatty acid Chemical class 0.000 claims description 25
- 229920006317 cationic polymer Polymers 0.000 claims description 20
- 239000004094 surface-active agent Substances 0.000 claims description 12
- 125000004432 carbon atom Chemical group C* 0.000 claims description 10
- SJRJJKPEHAURKC-UHFFFAOYSA-N N-Methylmorpholine Chemical group CN1CCOCC1 SJRJJKPEHAURKC-UHFFFAOYSA-N 0.000 claims description 9
- 229920003171 Poly (ethylene oxide) Polymers 0.000 claims description 9
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 claims description 9
- TWNIBLMWSKIRAT-VFUOTHLCSA-N levoglucosan Chemical group O[C@@H]1[C@@H](O)[C@H](O)[C@H]2CO[C@@H]1O2 TWNIBLMWSKIRAT-VFUOTHLCSA-N 0.000 claims description 9
- 125000000217 alkyl group Chemical group 0.000 claims description 8
- 239000007864 aqueous solution Substances 0.000 claims description 8
- 229920003086 cellulose ether Polymers 0.000 claims description 8
- XFRVVPUIAFSTFO-UHFFFAOYSA-N 1-Tridecanol Chemical group CCCCCCCCCCCCCO XFRVVPUIAFSTFO-UHFFFAOYSA-N 0.000 claims description 6
- BWZVCCNYKMEVEX-UHFFFAOYSA-N 2,4,6-Trimethylpyridine Chemical group CC1=CC(C)=NC(C)=C1 BWZVCCNYKMEVEX-UHFFFAOYSA-N 0.000 claims description 6
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical group C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 claims description 6
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 6
- 150000005846 sugar alcohols Polymers 0.000 claims description 6
- 229940087291 tridecyl alcohol Drugs 0.000 claims description 6
- PAMIQIKDUOTOBW-UHFFFAOYSA-N 1-methylpiperidine Chemical group CN1CCCCC1 PAMIQIKDUOTOBW-UHFFFAOYSA-N 0.000 claims description 4
- XWKFPIODWVPXLX-UHFFFAOYSA-N 2,5-dimethylpyridine Chemical group CC1=CC=C(C)N=C1 XWKFPIODWVPXLX-UHFFFAOYSA-N 0.000 claims description 4
- XZIIFPSPUDAGJM-UHFFFAOYSA-N 6-chloro-2-n,2-n-diethylpyrimidine-2,4-diamine Chemical compound CCN(CC)C1=NC(N)=CC(Cl)=N1 XZIIFPSPUDAGJM-UHFFFAOYSA-N 0.000 claims description 4
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 claims description 4
- 235000019864 coconut oil Nutrition 0.000 claims description 4
- 239000003240 coconut oil Substances 0.000 claims description 4
- 235000014113 dietary fatty acids Nutrition 0.000 claims description 4
- 239000000194 fatty acid Substances 0.000 claims description 4
- 229930195729 fatty acid Natural products 0.000 claims description 4
- 239000007788 liquid Substances 0.000 claims description 4
- 229940035044 sorbitan monolaurate Drugs 0.000 claims description 4
- 125000001931 aliphatic group Chemical group 0.000 claims description 3
- 125000004183 alkoxy alkyl group Chemical group 0.000 claims description 3
- 125000002877 alkyl aryl group Chemical group 0.000 claims description 3
- 150000001450 anions Chemical group 0.000 claims description 3
- 125000003118 aryl group Chemical group 0.000 claims description 3
- 229910052799 carbon Inorganic materials 0.000 claims description 3
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 3
- 125000000623 heterocyclic group Chemical group 0.000 claims description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 3
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 3
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 claims description 3
- 150000003254 radicals Chemical class 0.000 claims description 3
- 125000001424 substituent group Chemical group 0.000 claims description 3
- HVCNXQOWACZAFN-UHFFFAOYSA-N 4-ethylmorpholine Chemical group CCN1CCOCC1 HVCNXQOWACZAFN-UHFFFAOYSA-N 0.000 claims description 2
- HTLZVHNRZJPSMI-UHFFFAOYSA-N N-ethylpiperidine Chemical group CCN1CCCCC1 HTLZVHNRZJPSMI-UHFFFAOYSA-N 0.000 claims description 2
- 229910001413 alkali metal ion Inorganic materials 0.000 claims description 2
- 229910001420 alkaline earth metal ion Inorganic materials 0.000 claims description 2
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 2
- 239000007795 chemical reaction product Substances 0.000 claims description 2
- BSKHPKMHTQYZBB-UHFFFAOYSA-N 2-methylpyridine Chemical group CC1=CC=CC=N1 BSKHPKMHTQYZBB-UHFFFAOYSA-N 0.000 claims 1
- 150000005215 alkyl ethers Chemical group 0.000 claims 1
- 125000006353 oxyethylene group Chemical group 0.000 claims 1
- 239000004615 ingredient Substances 0.000 abstract description 11
- 210000004209 hair Anatomy 0.000 description 25
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 15
- 239000006260 foam Substances 0.000 description 12
- 230000003749 cleanliness Effects 0.000 description 9
- 239000000243 solution Substances 0.000 description 9
- 239000000463 material Substances 0.000 description 7
- 238000012360 testing method Methods 0.000 description 7
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 6
- 239000004166 Lanolin Substances 0.000 description 6
- 239000008367 deionised water Substances 0.000 description 6
- 229910021641 deionized water Inorganic materials 0.000 description 6
- 230000007794 irritation Effects 0.000 description 6
- 229940039717 lanolin Drugs 0.000 description 6
- 235000019388 lanolin Nutrition 0.000 description 6
- 230000009467 reduction Effects 0.000 description 6
- 238000000034 method Methods 0.000 description 5
- 238000002156 mixing Methods 0.000 description 5
- 239000002304 perfume Substances 0.000 description 5
- 239000003755 preservative agent Substances 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- 238000004140 cleaning Methods 0.000 description 4
- 230000001143 conditioned effect Effects 0.000 description 4
- 102000004169 proteins and genes Human genes 0.000 description 4
- 108090000623 proteins and genes Proteins 0.000 description 4
- 230000003068 static effect Effects 0.000 description 4
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 229960003237 betaine Drugs 0.000 description 3
- 239000000975 dye Substances 0.000 description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 3
- 229920001223 polyethylene glycol Polymers 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- KWIUHFFTVRNATP-UHFFFAOYSA-N Betaine Natural products C[N+](C)(C)CC([O-])=O KWIUHFFTVRNATP-UHFFFAOYSA-N 0.000 description 2
- 229910014033 C-OH Inorganic materials 0.000 description 2
- 229910014570 C—OH Inorganic materials 0.000 description 2
- 231100000635 Draize test Toxicity 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- KWIUHFFTVRNATP-UHFFFAOYSA-O N,N,N-trimethylglycinium Chemical compound C[N+](C)(C)CC(O)=O KWIUHFFTVRNATP-UHFFFAOYSA-O 0.000 description 2
- 241000283973 Oryctolagus cuniculus Species 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- 230000008859 change Effects 0.000 description 2
- 239000011248 coating agent Substances 0.000 description 2
- 238000000576 coating method Methods 0.000 description 2
- 239000000084 colloidal system Substances 0.000 description 2
- 239000002537 cosmetic Substances 0.000 description 2
- 125000005456 glyceride group Chemical group 0.000 description 2
- 210000004919 hair shaft Anatomy 0.000 description 2
- 230000002209 hydrophobic effect Effects 0.000 description 2
- 239000002861 polymer material Substances 0.000 description 2
- 238000001556 precipitation Methods 0.000 description 2
- 230000002335 preservative effect Effects 0.000 description 2
- 239000000344 soap Substances 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 2
- 239000008399 tap water Substances 0.000 description 2
- 235000020679 tap water Nutrition 0.000 description 2
- 239000002562 thickening agent Substances 0.000 description 2
- RZXLPPRPEOUENN-UHFFFAOYSA-N Chlorfenson Chemical compound C1=CC(Cl)=CC=C1OS(=O)(=O)C1=CC=C(Cl)C=C1 RZXLPPRPEOUENN-UHFFFAOYSA-N 0.000 description 1
- 102000008186 Collagen Human genes 0.000 description 1
- 108010035532 Collagen Proteins 0.000 description 1
- 208000006069 Corneal Opacity Diseases 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- 206010019049 Hair texture abnormal Diseases 0.000 description 1
- 241000976416 Isatis tinctoria subsp. canescens Species 0.000 description 1
- 241000047703 Nonion Species 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- 229920001213 Polysorbate 20 Polymers 0.000 description 1
- 229910006127 SO3X Inorganic materials 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 150000008055 alkyl aryl sulfonates Chemical class 0.000 description 1
- 150000008051 alkyl sulfates Chemical class 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 239000000022 bacteriostatic agent Substances 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 238000004061 bleaching Methods 0.000 description 1
- 239000007844 bleaching agent Substances 0.000 description 1
- 150000007942 carboxylates Chemical class 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 229920001436 collagen Polymers 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 231100000269 corneal opacity Toxicity 0.000 description 1
- 230000003745 detangling effect Effects 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 239000012153 distilled water Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 230000005611 electricity Effects 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 210000003128 head Anatomy 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 239000008240 homogeneous mixture Substances 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 125000004435 hydrogen atom Chemical class [H]* 0.000 description 1
- 230000006872 improvement Effects 0.000 description 1
- 238000010348 incorporation Methods 0.000 description 1
- 231100000021 irritant Toxicity 0.000 description 1
- 239000002085 irritant Substances 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 235000019198 oils Nutrition 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 150000002978 peroxides Chemical class 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 239000000256 polyoxyethylene sorbitan monolaurate Substances 0.000 description 1
- 235000010486 polyoxyethylene sorbitan monolaurate Nutrition 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 230000008569 process Effects 0.000 description 1
- 229940071089 sarcosinate Drugs 0.000 description 1
- 230000035945 sensitivity Effects 0.000 description 1
- 231100000323 severe irritant Toxicity 0.000 description 1
- 239000001488 sodium phosphate Substances 0.000 description 1
- IREHMHHIIDCYGZ-UHFFFAOYSA-N sodium;tridecan-1-ol Chemical compound [Na].CCCCCCCCCCCCCO IREHMHHIIDCYGZ-UHFFFAOYSA-N 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 229940117986 sulfobetaine Drugs 0.000 description 1
- RYFMWSXOAZQYPI-UHFFFAOYSA-K trisodium phosphate Chemical compound [Na+].[Na+].[Na+].[O-]P([O-])([O-])=O RYFMWSXOAZQYPI-UHFFFAOYSA-K 0.000 description 1
- 229910000406 trisodium phosphate Inorganic materials 0.000 description 1
- 235000019801 trisodium phosphate Nutrition 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Landscapes
- Cosmetics (AREA)
- Detergent Compositions (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US63627075A | 1975-11-28 | 1975-11-28 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1080625A true CA1080625A (en) | 1980-07-01 |
Family
ID=24551182
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA266,626A Expired CA1080625A (en) | 1975-11-28 | 1976-11-26 | Conditioning non-irritating shampoo compositions |
Country Status (12)
| Country | Link |
|---|---|
| JP (1) | JPS5933639B2 (cg-RX-API-DMAC7.html) |
| AU (1) | AU509287B2 (cg-RX-API-DMAC7.html) |
| BR (1) | BR7607893A (cg-RX-API-DMAC7.html) |
| CA (1) | CA1080625A (cg-RX-API-DMAC7.html) |
| ES (1) | ES453015A1 (cg-RX-API-DMAC7.html) |
| GR (1) | GR60357B (cg-RX-API-DMAC7.html) |
| IN (1) | IN143258B (cg-RX-API-DMAC7.html) |
| MX (1) | MX144082A (cg-RX-API-DMAC7.html) |
| NZ (1) | NZ182303A (cg-RX-API-DMAC7.html) |
| PT (1) | PT65896B (cg-RX-API-DMAC7.html) |
| ZA (1) | ZA766344B (cg-RX-API-DMAC7.html) |
| ZM (1) | ZM12976A1 (cg-RX-API-DMAC7.html) |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO2011015858A2 (en) | 2009-08-03 | 2011-02-10 | Innospec Limited | Composition |
| WO2011015857A2 (en) | 2009-08-03 | 2011-02-10 | Innospec Limited | Composition |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA1137415A (en) * | 1979-07-02 | 1982-12-14 | Leszek J. Wolfram | Aqueous acidic hair conditioning composition containing cationic polymer and amphoteric detergent |
| US4490355A (en) * | 1983-03-14 | 1984-12-25 | Miranol Chemical Company, Inc. | Betaine based cosmetic formulations |
| EP0127580A3 (de) * | 1983-05-31 | 1986-06-25 | Ciba-Geigy Ag | Gemische aus quaternären, polymeren Ammoniumsalzen und einem ternären Tensidsystem aus nicht-ionogenen, anionischen und amphoteren Tensiden, deren Herstellung und Verwendung in kosmetischen Mitteln |
| JP2012246270A (ja) * | 2011-05-30 | 2012-12-13 | Hoyu Co Ltd | 毛髪洗浄剤組成物 |
-
1976
- 1976-10-12 IN IN1866/CAL/1976A patent/IN143258B/en unknown
- 1976-10-12 NZ NZ18230376A patent/NZ182303A/xx unknown
- 1976-10-25 ZA ZA00766344A patent/ZA766344B/xx unknown
- 1976-11-01 AU AU19199/76A patent/AU509287B2/en not_active Expired
- 1976-11-02 ZM ZM12976A patent/ZM12976A1/xx unknown
- 1976-11-04 ES ES453015A patent/ES453015A1/es not_active Expired
- 1976-11-16 GR GR52196A patent/GR60357B/el unknown
- 1976-11-25 BR BR7607893A patent/BR7607893A/pt unknown
- 1976-11-26 CA CA266,626A patent/CA1080625A/en not_active Expired
- 1976-11-26 PT PT6589676A patent/PT65896B/pt unknown
- 1976-11-26 MX MX16718176A patent/MX144082A/es unknown
- 1976-11-29 JP JP14238476A patent/JPS5933639B2/ja not_active Expired
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO2011015858A2 (en) | 2009-08-03 | 2011-02-10 | Innospec Limited | Composition |
| WO2011015857A2 (en) | 2009-08-03 | 2011-02-10 | Innospec Limited | Composition |
Also Published As
| Publication number | Publication date |
|---|---|
| JPS5266506A (en) | 1977-06-02 |
| AU509287B2 (en) | 1980-05-01 |
| MX144082A (es) | 1981-08-26 |
| ZM12976A1 (en) | 1977-07-21 |
| NZ182303A (en) | 1978-09-20 |
| PT65896A (en) | 1976-12-01 |
| GR60357B (en) | 1978-05-18 |
| PT65896B (en) | 1978-10-12 |
| JPS5933639B2 (ja) | 1984-08-16 |
| IN143258B (cg-RX-API-DMAC7.html) | 1977-10-22 |
| AU1919976A (en) | 1978-05-11 |
| BR7607893A (pt) | 1977-11-08 |
| ES453015A1 (es) | 1978-01-16 |
| ZA766344B (en) | 1978-06-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA2066885C (en) | Hair shampoo composition to impart improved hair conditioning properties | |
| US5358667A (en) | Conditioning shampoo composition and method of preparing and using the same | |
| AU614750B2 (en) | Shine hair conditioner | |
| US5275761A (en) | Conditioning shampoo composition and method of preparing and using the same | |
| US3769398A (en) | Polyethylenimine shampoo compositions | |
| AU598816B2 (en) | Hair rinse conditioner | |
| US6017860A (en) | Cleaning, conditioning and styling hair care compositions | |
| DE69121976T2 (de) | Haarreinigungsmittel | |
| US5145607A (en) | Optically clear conditioning shampoo comprising anionic and cationic surfactants | |
| CA2092284C (en) | Conditioning shampoo composition and method of preparing and using the same | |
| US3816616A (en) | Unitary shampoo and cream rinse compositions | |
| US20030228272A1 (en) | Novel antidandruff conditioning shampoo | |
| US5679357A (en) | Cationic dispersions based on ceramides and/or glycoceramides | |
| AU609140B2 (en) | Hair rinse conditioner | |
| US4247538A (en) | Conditioning shampoo | |
| JPH0460966B2 (cg-RX-API-DMAC7.html) | ||
| EP0175485A2 (en) | Shampoo compositions | |
| US4205063A (en) | Low irritant conditioning shampoo composition | |
| EP0562638A2 (en) | Stable conditioning shampoo containing cationic and suspended water-insoluble conditioning agents | |
| CA1080625A (en) | Conditioning non-irritating shampoo compositions | |
| EP1013257A2 (de) | Haarbehandlungsmittel enthaltend Oligoester | |
| US3697655A (en) | Germicidal detergent compositions in controlling dandruff | |
| JPS5914518B2 (ja) | 液状のシヤンプ−組成物 | |
| WO1990006105A2 (de) | Oberflächenaktive mischungen | |
| US4155994A (en) | Hair conditioning agents |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |