CA1075697A - 3-phenyl-5-substituted-4(1h)-pyridones(thiones) - Google Patents
3-phenyl-5-substituted-4(1h)-pyridones(thiones)Info
- Publication number
- CA1075697A CA1075697A CA305,980A CA305980A CA1075697A CA 1075697 A CA1075697 A CA 1075697A CA 305980 A CA305980 A CA 305980A CA 1075697 A CA1075697 A CA 1075697A
- Authority
- CA
- Canada
- Prior art keywords
- methyl
- pyridone
- phenyl
- trifluoromethylphenyl
- methylphenyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 241001061127 Thione Species 0.000 title description 2
- 150000001875 compounds Chemical class 0.000 claims abstract description 197
- -1 propylthio-4(1H)-pyridone Chemical compound 0.000 claims description 20
- ADQXBMXRWFHZAZ-UHFFFAOYSA-N 1-methyl-3,5-bis(3-methylphenyl)pyridin-4-one Chemical compound CC1=CC=CC(C=2C(C(C=3C=C(C)C=CC=3)=CN(C)C=2)=O)=C1 ADQXBMXRWFHZAZ-UHFFFAOYSA-N 0.000 claims description 3
- CPSYCRJDDNLMEE-UHFFFAOYSA-N 3-(2-bromo-5-fluorophenyl)-1-methyl-5-phenylpyridin-4-one Chemical compound O=C1C(C=2C(=CC=C(F)C=2)Br)=CN(C)C=C1C1=CC=CC=C1 CPSYCRJDDNLMEE-UHFFFAOYSA-N 0.000 claims description 3
- VUSUUQPVZIWVPB-UHFFFAOYSA-N 3-(2-bromophenyl)-1-methyl-5-[3-(trifluoromethyl)phenyl]pyridin-4-one Chemical compound O=C1C(C=2C(=CC=CC=2)Br)=CN(C)C=C1C1=CC=CC(C(F)(F)F)=C1 VUSUUQPVZIWVPB-UHFFFAOYSA-N 0.000 claims description 3
- YDFNQQYEEUNQSN-UHFFFAOYSA-N 3-(2-chloro-4-fluorophenyl)-1-methyl-5-[3-(trifluoromethyl)phenyl]pyridin-4-one Chemical compound O=C1C(C=2C(=CC(F)=CC=2)Cl)=CN(C)C=C1C1=CC=CC(C(F)(F)F)=C1 YDFNQQYEEUNQSN-UHFFFAOYSA-N 0.000 claims description 3
- RQLIJAVEEKLTKO-UHFFFAOYSA-N 3-(2-chloro-4-fluorophenyl)-1-methyl-5-phenylpyridin-4-one Chemical compound O=C1C(C=2C(=CC(F)=CC=2)Cl)=CN(C)C=C1C1=CC=CC=C1 RQLIJAVEEKLTKO-UHFFFAOYSA-N 0.000 claims description 3
- ZEPZQEHOYXDHQJ-UHFFFAOYSA-N 3-(2-methoxyphenyl)-1-methyl-5-[3-(trifluoromethyl)phenyl]pyridin-4-one Chemical compound COC1=CC=CC=C1C(C1=O)=CN(C)C=C1C1=CC=CC(C(F)(F)F)=C1 ZEPZQEHOYXDHQJ-UHFFFAOYSA-N 0.000 claims description 3
- UDECNRBAPYJGCP-UHFFFAOYSA-N 3-(3,4-dichlorophenyl)-1-methyl-5-(3-methylphenyl)pyridin-4-one Chemical compound CC1=CC=CC(C=2C(C(C=3C=C(Cl)C(Cl)=CC=3)=CN(C)C=2)=O)=C1 UDECNRBAPYJGCP-UHFFFAOYSA-N 0.000 claims description 3
- WJDOZPRFBWROLK-UHFFFAOYSA-N 3-(3,4-dichlorophenyl)-5-(3,4-dimethylphenyl)-1-methylpyridin-4-one Chemical compound C1=C(C)C(C)=CC=C1C(C1=O)=CN(C)C=C1C1=CC=C(Cl)C(Cl)=C1 WJDOZPRFBWROLK-UHFFFAOYSA-N 0.000 claims description 3
- ANBYKRIWQYPJEJ-UHFFFAOYSA-N 3-(3,4-dimethylphenyl)-1-methyl-5-phenylpyridin-4-one Chemical compound C1=C(C)C(C)=CC=C1C(C1=O)=CN(C)C=C1C1=CC=CC=C1 ANBYKRIWQYPJEJ-UHFFFAOYSA-N 0.000 claims description 3
- JXVCBCIFPRUGJZ-UHFFFAOYSA-N 3-(3-bromo-4-methylphenyl)-1-methyl-5-phenylpyridin-4-one Chemical compound C1=C(Br)C(C)=CC=C1C(C1=O)=CN(C)C=C1C1=CC=CC=C1 JXVCBCIFPRUGJZ-UHFFFAOYSA-N 0.000 claims description 3
- HHGMXGKKJIKKRL-UHFFFAOYSA-N 3-(3-bromophenyl)-1-methyl-5-(2-methylphenyl)pyridin-4-one Chemical compound CC1=CC=CC=C1C(C1=O)=CN(C)C=C1C1=CC=CC(Br)=C1 HHGMXGKKJIKKRL-UHFFFAOYSA-N 0.000 claims description 3
- LZQDBIYYJBQXBS-UHFFFAOYSA-N 3-(3-chlorophenyl)-1-methyl-5-(2-methylphenyl)pyridin-4-one Chemical compound CC1=CC=CC=C1C(C1=O)=CN(C)C=C1C1=CC=CC(Cl)=C1 LZQDBIYYJBQXBS-UHFFFAOYSA-N 0.000 claims description 3
- UJPQYTSIRKOARI-UHFFFAOYSA-N 3-(4-bromophenyl)-1-methyl-5-[3-(trifluoromethyl)phenyl]pyridin-4-one Chemical compound O=C1C(C=2C=C(C=CC=2)C(F)(F)F)=CN(C)C=C1C1=CC=C(Br)C=C1 UJPQYTSIRKOARI-UHFFFAOYSA-N 0.000 claims description 3
- MQHBHPDZECZJOQ-UHFFFAOYSA-N 3-[2-chloro-5-(trifluoromethyl)phenyl]-1-methyl-5-[3-(trifluoromethyl)phenyl]pyridin-4-one Chemical compound O=C1C(C=2C(=CC=C(C=2)C(F)(F)F)Cl)=CN(C)C=C1C1=CC=CC(C(F)(F)F)=C1 MQHBHPDZECZJOQ-UHFFFAOYSA-N 0.000 claims description 3
- OSPYOQPKGLKIEB-UHFFFAOYSA-N 3-[4-chloro-3-(trifluoromethyl)phenyl]-1-methyl-5-phenylpyridin-4-one Chemical compound O=C1C(C=2C=C(C(Cl)=CC=2)C(F)(F)F)=CN(C)C=C1C1=CC=CC=C1 OSPYOQPKGLKIEB-UHFFFAOYSA-N 0.000 claims description 3
- ZBLXIJIVIVBIEG-UHFFFAOYSA-N 3-[4-chloro-3-(trifluoromethyl)phenyl]-5-ethoxy-1-methylpyridin-4-one Chemical compound O=C1C(OCC)=CN(C)C=C1C1=CC=C(Cl)C(C(F)(F)F)=C1 ZBLXIJIVIVBIEG-UHFFFAOYSA-N 0.000 claims description 3
- VYODLZOOLCDJRT-UHFFFAOYSA-N 3-[4-chloro-3-(trifluoromethyl)phenyl]-5-ethyl-1-methylpyridin-4-one Chemical compound O=C1C(CC)=CN(C)C=C1C1=CC=C(Cl)C(C(F)(F)F)=C1 VYODLZOOLCDJRT-UHFFFAOYSA-N 0.000 claims description 3
- WWIJSZOWDRDBFG-UHFFFAOYSA-N 3-ethoxy-1-methyl-5-[3-(trifluoromethyl)phenyl]pyridine-4-thione Chemical compound S=C1C(OCC)=CN(C)C=C1C1=CC=CC(C(F)(F)F)=C1 WWIJSZOWDRDBFG-UHFFFAOYSA-N 0.000 claims description 3
- WUHDZMNDUKCIRF-UHFFFAOYSA-N 3-ethylsulfanyl-1-methyl-5-phenylpyridin-4-one Chemical compound O=C1C(SCC)=CN(C)C=C1C1=CC=CC=C1 WUHDZMNDUKCIRF-UHFFFAOYSA-N 0.000 claims description 3
- RXGJTLBOHFPKIJ-UHFFFAOYSA-N 3-ethylsulfinyl-1-methyl-5-[3-(trifluoromethyl)phenyl]pyridin-4-one Chemical compound O=C1C(S(=O)CC)=CN(C)C=C1C1=CC=CC(C(F)(F)F)=C1 RXGJTLBOHFPKIJ-UHFFFAOYSA-N 0.000 claims description 3
- FJXXEHJYKAQACI-UHFFFAOYSA-N 3-methoxy-1-methyl-5-[3-(trifluoromethyl)phenyl]pyridin-4-one Chemical compound O=C1C(OC)=CN(C)C=C1C1=CC=CC(C(F)(F)F)=C1 FJXXEHJYKAQACI-UHFFFAOYSA-N 0.000 claims description 3
- KTXPHXSEKIXRHS-UHFFFAOYSA-N 3-tert-butylsulfanyl-1-methyl-5-[3-(trifluoromethyl)phenyl]pyridin-4-one Chemical compound CN1C=C(SC(C)(C)C)C(=O)C(C=2C=C(C=CC=2)C(F)(F)F)=C1 KTXPHXSEKIXRHS-UHFFFAOYSA-N 0.000 claims description 3
- LSCADUVZHBDNDQ-UHFFFAOYSA-N 1-methyl-3-(2-methyl-5-nitrophenyl)-5-phenylpyridin-4-one Chemical compound CC1=CC=C([N+]([O-])=O)C=C1C(C1=O)=CN(C)C=C1C1=CC=CC=C1 LSCADUVZHBDNDQ-UHFFFAOYSA-N 0.000 claims description 2
- PVHYDAMTVRNMLN-UHFFFAOYSA-N 1-methyl-3-(2-methylprop-2-enylsulfanyl)-5-[3-(trifluoromethyl)phenyl]pyridin-4-one Chemical compound CN1C=C(C(C(=C1)C1=CC(=CC=C1)C(F)(F)F)=O)SCC(=C)C PVHYDAMTVRNMLN-UHFFFAOYSA-N 0.000 claims description 2
- BVTWGIRMMJIIDA-UHFFFAOYSA-N 1-methyl-3-(2-methylpropylsulfanyl)-5-[3-(trifluoromethyl)phenyl]pyridin-4-one Chemical compound O=C1C(SCC(C)C)=CN(C)C=C1C1=CC=CC(C(F)(F)F)=C1 BVTWGIRMMJIIDA-UHFFFAOYSA-N 0.000 claims description 2
- YGXHMSGOWXBHJP-UHFFFAOYSA-N 1-methyl-3-methylsulfanyl-5-[3-(trifluoromethyl)phenyl]pyridin-4-one Chemical compound O=C1C(SC)=CN(C)C=C1C1=CC=CC(C(F)(F)F)=C1 YGXHMSGOWXBHJP-UHFFFAOYSA-N 0.000 claims description 2
- YFRWLIMGZKMSLL-UHFFFAOYSA-N 1-methyl-3-propan-2-yloxy-5-[3-(trifluoromethyl)phenyl]pyridin-4-one Chemical compound O=C1C(OC(C)C)=CN(C)C=C1C1=CC=CC(C(F)(F)F)=C1 YFRWLIMGZKMSLL-UHFFFAOYSA-N 0.000 claims description 2
- LVWMUEHLPPAIRJ-UHFFFAOYSA-N 3,5-bis(3,5-dichlorophenyl)-1-methylpyridin-4-one Chemical compound O=C1C(C=2C=C(Cl)C=C(Cl)C=2)=CN(C)C=C1C1=CC(Cl)=CC(Cl)=C1 LVWMUEHLPPAIRJ-UHFFFAOYSA-N 0.000 claims description 2
- XWDHZBMZZGGMKI-UHFFFAOYSA-N 3-(1-methyl-4-oxo-5-phenylpyridin-3-yl)benzoic acid Chemical compound O=C1C(C=2C=C(C=CC=2)C(O)=O)=CN(C)C=C1C1=CC=CC=C1 XWDHZBMZZGGMKI-UHFFFAOYSA-N 0.000 claims description 2
- QIYCFIVWINMHEB-UHFFFAOYSA-N 3-(2,6-dichlorophenyl)-1-methyl-5-phenylpyridin-4-one Chemical compound O=C1C(C=2C(=CC=CC=2Cl)Cl)=CN(C)C=C1C1=CC=CC=C1 QIYCFIVWINMHEB-UHFFFAOYSA-N 0.000 claims description 2
- KFGRUVDEMASZSL-UHFFFAOYSA-N 3-(2-hydroxypropyl)-1-methyl-5-[3-(trifluoromethyl)phenyl]pyridin-4-one Chemical compound OC(CC1=CN(C=C(C1=O)C1=CC(=CC=C1)C(F)(F)F)C)C KFGRUVDEMASZSL-UHFFFAOYSA-N 0.000 claims description 2
- UXMVRFNURBAMQM-UHFFFAOYSA-N 3-(3,5-dimethylphenyl)-1-methyl-5-phenylpyridin-4-one Chemical compound CC1=CC(C)=CC(C=2C(C(C=3C=CC=CC=3)=CN(C)C=2)=O)=C1 UXMVRFNURBAMQM-UHFFFAOYSA-N 0.000 claims description 2
- DLLHXQIRBHMLRZ-UHFFFAOYSA-N 3-(3-bromo-4-methylphenyl)-1-methyl-5-[3-(trifluoromethyl)phenyl]pyridin-4-one Chemical compound C1=C(Br)C(C)=CC=C1C(C1=O)=CN(C)C=C1C1=CC=CC(C(F)(F)F)=C1 DLLHXQIRBHMLRZ-UHFFFAOYSA-N 0.000 claims description 2
- YIKCZGOLVIJOSE-UHFFFAOYSA-N 3-(3-butylphenyl)-1-methyl-5-phenylpyridin-4-one Chemical compound CCCCC1=CC=CC(C=2C(C(C=3C=CC=CC=3)=CN(C)C=2)=O)=C1 YIKCZGOLVIJOSE-UHFFFAOYSA-N 0.000 claims description 2
- FCFDJFGLLZGCJU-UHFFFAOYSA-N 3-(3-iodophenyl)-1-methyl-5-[3-(trifluoromethyl)phenyl]pyridin-4-one Chemical compound O=C1C(C=2C=C(C=CC=2)C(F)(F)F)=CN(C)C=C1C1=CC=CC(I)=C1 FCFDJFGLLZGCJU-UHFFFAOYSA-N 0.000 claims description 2
- DKXGXYDYISDUJN-UHFFFAOYSA-N 3-(4-bromophenyl)-1-methyl-5-(3-methylphenyl)pyridin-4-one Chemical compound CC1=CC=CC(C=2C(C(C=3C=CC(Br)=CC=3)=CN(C)C=2)=O)=C1 DKXGXYDYISDUJN-UHFFFAOYSA-N 0.000 claims description 2
- PFHOINPYJMFSHA-UHFFFAOYSA-N 3-(4-hydroxyphenyl)-1-methyl-5-[3-(trifluoromethyl)phenyl]pyridin-4-one Chemical compound O=C1C(C=2C=C(C=CC=2)C(F)(F)F)=CN(C)C=C1C1=CC=C(O)C=C1 PFHOINPYJMFSHA-UHFFFAOYSA-N 0.000 claims description 2
- WKWTWJRJHAXOKS-UHFFFAOYSA-N 3-(5-bromo-2-fluorophenyl)-1-methyl-5-phenylpyridin-4-one Chemical compound O=C1C(C=2C(=CC=C(Br)C=2)F)=CN(C)C=C1C1=CC=CC=C1 WKWTWJRJHAXOKS-UHFFFAOYSA-N 0.000 claims description 2
- PSESGFASJZSNPK-UHFFFAOYSA-N 3-(5-fluoro-2-iodophenyl)-1-methyl-5-phenylpyridin-4-one Chemical compound O=C1C(C=2C(=CC=C(F)C=2)I)=CN(C)C=C1C1=CC=CC=C1 PSESGFASJZSNPK-UHFFFAOYSA-N 0.000 claims description 2
- OKPZCDJLJVZSGD-UHFFFAOYSA-N 3-[4-chloro-3-(trifluoromethyl)phenyl]-1-methyl-5-thiophen-2-ylpyridin-4-one Chemical compound O=C1C(C=2C=C(C(Cl)=CC=2)C(F)(F)F)=CN(C)C=C1C1=CC=CS1 OKPZCDJLJVZSGD-UHFFFAOYSA-N 0.000 claims description 2
- MEJIZPJXNFVKRN-UHFFFAOYSA-N 3-[5-(4-bromophenyl)-1-methyl-4-oxopyridin-3-yl]benzoic acid Chemical compound O=C1C(C=2C=C(C=CC=2)C(O)=O)=CN(C)C=C1C1=CC=C(Br)C=C1 MEJIZPJXNFVKRN-UHFFFAOYSA-N 0.000 claims description 2
- BHUVIGDARDZYBX-UHFFFAOYSA-N 3-butan-2-ylsulfanyl-1-methyl-5-[3-(trifluoromethyl)phenyl]pyridin-4-one Chemical compound O=C1C(SC(C)CC)=CN(C)C=C1C1=CC=CC(C(F)(F)F)=C1 BHUVIGDARDZYBX-UHFFFAOYSA-N 0.000 claims description 2
- UTGZMOBPWKRIRD-UHFFFAOYSA-N 3-ethyl-1-hydroxy-5-[3-(trifluoromethyl)phenyl]pyridin-4-one Chemical compound C(C)C1=CN(C=C(C1=O)C1=CC(=CC=C1)C(F)(F)F)O UTGZMOBPWKRIRD-UHFFFAOYSA-N 0.000 claims description 2
- FJSVUDOFDZQJLK-UHFFFAOYSA-N 3-ethyl-5-(3-methoxyphenyl)-1-methylpyridin-4-one Chemical compound O=C1C(CC)=CN(C)C=C1C1=CC=CC(OC)=C1 FJSVUDOFDZQJLK-UHFFFAOYSA-N 0.000 claims description 2
- QYPIXOUNZMGSPN-UHFFFAOYSA-N 3-ethylsulfanyl-1-methyl-5-[3-(trifluoromethyl)phenyl]pyridine-4-thione Chemical compound S=C1C(SCC)=CN(C)C=C1C1=CC=CC(C(F)(F)F)=C1 QYPIXOUNZMGSPN-UHFFFAOYSA-N 0.000 claims description 2
- JFACACRTOHUIJN-UHFFFAOYSA-N 5-(2,5-dimethoxyphenyl)-1-methyl-4-oxopyridine-3-carbonitrile Chemical compound COC1=CC=C(OC)C(C=2C(C(C#N)=CN(C)C=2)=O)=C1 JFACACRTOHUIJN-UHFFFAOYSA-N 0.000 claims description 2
- LREAIMREKYLQHA-UHFFFAOYSA-N ethyl 1-methyl-4-oxo-5-[3-(trifluoromethyl)phenyl]pyridine-3-carboxylate Chemical compound O=C1C(C(=O)OCC)=CN(C)C=C1C1=CC=CC(C(F)(F)F)=C1 LREAIMREKYLQHA-UHFFFAOYSA-N 0.000 claims description 2
- JYRCAWKOBDYVHA-UHFFFAOYSA-N ethyl 1-methyl-4-oxo-5-phenylpyridine-3-carboxylate Chemical compound O=C1C(C(=O)OCC)=CN(C)C=C1C1=CC=CC=C1 JYRCAWKOBDYVHA-UHFFFAOYSA-N 0.000 claims description 2
- IILVJUUUQGCNHC-UHFFFAOYSA-N methyl 3-[1-methyl-5-(4-methylphenyl)-4-oxopyridin-3-yl]benzoate Chemical compound COC(=O)C1=CC=CC(C=2C(C(C=3C=CC(C)=CC=3)=CN(C)C=2)=O)=C1 IILVJUUUQGCNHC-UHFFFAOYSA-N 0.000 claims description 2
- HBHMIWZJYDCYAX-UHFFFAOYSA-N 1,3-diethyl-5-[3-(trifluoromethyl)phenyl]pyridin-4-one Chemical compound O=C1C(CC)=CN(CC)C=C1C1=CC=CC(C(F)(F)F)=C1 HBHMIWZJYDCYAX-UHFFFAOYSA-N 0.000 claims 2
- GUTSDNKJOBEZPP-UHFFFAOYSA-N 1-ethyl-3,5-bis[3-(trifluoromethyl)phenyl]pyridin-4-one Chemical compound O=C1C(C=2C=C(C=CC=2)C(F)(F)F)=CN(CC)C=C1C1=CC=CC(C(F)(F)F)=C1 GUTSDNKJOBEZPP-UHFFFAOYSA-N 0.000 claims 2
- QOYMDVZODDSWDA-UHFFFAOYSA-N 1-methyl-3-(2-methylphenyl)-5-[3-(trifluoromethyl)phenyl]pyridin-4-one Chemical compound CC1=CC=CC=C1C(C1=O)=CN(C)C=C1C1=CC=CC(C(F)(F)F)=C1 QOYMDVZODDSWDA-UHFFFAOYSA-N 0.000 claims 2
- HNASGVMMKOVJEJ-UHFFFAOYSA-N 1-methyl-3-(3-methylphenyl)-5-[3-(trifluoromethyl)phenyl]pyridin-4-one Chemical compound CC1=CC=CC(C=2C(C(C=3C=C(C=CC=3)C(F)(F)F)=CN(C)C=2)=O)=C1 HNASGVMMKOVJEJ-UHFFFAOYSA-N 0.000 claims 2
- SBDOCCCTNKSHTC-UHFFFAOYSA-N 1-methyl-3-[2-(trifluoromethyl)phenyl]-5-[3-(trifluoromethyl)phenyl]pyridin-4-one Chemical compound O=C1C(C=2C(=CC=CC=2)C(F)(F)F)=CN(C)C=C1C1=CC=CC(C(F)(F)F)=C1 SBDOCCCTNKSHTC-UHFFFAOYSA-N 0.000 claims 2
- VJRIXDIYCWJUSG-UHFFFAOYSA-N 1-methyl-3-[3-(trifluoromethyl)phenyl]-5-(trifluoromethylsulfanyl)pyridin-4-one Chemical compound CN1C=C(SC(F)(F)F)C(=O)C(C=2C=C(C=CC=2)C(F)(F)F)=C1 VJRIXDIYCWJUSG-UHFFFAOYSA-N 0.000 claims 2
- DJZUELVYQFBCQV-UHFFFAOYSA-N 1-methyl-3-[3-(trifluoromethyl)phenyl]-5-[3-(trifluoromethylsulfanyl)phenyl]pyridin-4-one Chemical compound O=C1C(C=2C=C(C=CC=2)C(F)(F)F)=CN(C)C=C1C1=CC=CC(SC(F)(F)F)=C1 DJZUELVYQFBCQV-UHFFFAOYSA-N 0.000 claims 2
- IFKAIWRSFKDBLQ-UHFFFAOYSA-N 1-methyl-3-phenoxy-5-[3-(trifluoromethyl)phenyl]pyridin-4-one Chemical compound O=C1C(C=2C=C(C=CC=2)C(F)(F)F)=CN(C)C=C1OC1=CC=CC=C1 IFKAIWRSFKDBLQ-UHFFFAOYSA-N 0.000 claims 2
- UJGIVLUARJLMDC-UHFFFAOYSA-N 1-methyl-3-propan-2-ylsulfanyl-5-[3-(trifluoromethyl)phenyl]pyridin-4-one Chemical compound O=C1C(SC(C)C)=CN(C)C=C1C1=CC=CC(C(F)(F)F)=C1 UJGIVLUARJLMDC-UHFFFAOYSA-N 0.000 claims 2
- QXIPCVZWIYWEEP-UHFFFAOYSA-N 1-methyl-3-propylsulfanyl-5-[3-(trifluoromethyl)phenyl]pyridin-4-one Chemical compound O=C1C(SCCC)=CN(C)C=C1C1=CC=CC(C(F)(F)F)=C1 QXIPCVZWIYWEEP-UHFFFAOYSA-N 0.000 claims 2
- PIGVXHSMBYPWHH-UHFFFAOYSA-N 3-(1-hydroxyethyl)-1-methyl-5-[3-(trifluoromethyl)phenyl]pyridin-4-one Chemical compound OC(C)C1=CN(C=C(C1=O)C1=CC(=CC=C1)C(F)(F)F)C PIGVXHSMBYPWHH-UHFFFAOYSA-N 0.000 claims 2
- JRWOQCCEZSXGEL-UHFFFAOYSA-N 3-(2-ethylphenyl)-1-methyl-5-[3-(trifluoromethyl)phenyl]pyridin-4-one Chemical compound CCC1=CC=CC=C1C(C1=O)=CN(C)C=C1C1=CC=CC(C(F)(F)F)=C1 JRWOQCCEZSXGEL-UHFFFAOYSA-N 0.000 claims 2
- WDVRXTMUHHKVKF-UHFFFAOYSA-N 3-[4-chloro-3-(trifluoromethyl)phenyl]-1-methyl-5-propan-2-ylpyridin-4-one Chemical compound O=C1C(C(C)C)=CN(C)C=C1C1=CC=C(Cl)C(C(F)(F)F)=C1 WDVRXTMUHHKVKF-UHFFFAOYSA-N 0.000 claims 2
- RSUUQCLUXRFJPU-UHFFFAOYSA-N 3-[4-chloro-3-(trifluoromethyl)phenyl]-1-methyl-5-propylpyridin-4-one Chemical compound O=C1C(CCC)=CN(C)C=C1C1=CC=C(Cl)C(C(F)(F)F)=C1 RSUUQCLUXRFJPU-UHFFFAOYSA-N 0.000 claims 2
- ZUOBJEZINDUQCJ-UHFFFAOYSA-N 3-ethoxy-1-methyl-5-[3-(trifluoromethyl)phenyl]pyridin-4-one Chemical compound O=C1C(OCC)=CN(C)C=C1C1=CC=CC(C(F)(F)F)=C1 ZUOBJEZINDUQCJ-UHFFFAOYSA-N 0.000 claims 2
- NPPHIEHTKJAYSL-UHFFFAOYSA-N 1-hydroxy-3-phenyl-5-[3-(trifluoromethyl)phenyl]pyridin-4-one Chemical compound ON1C=C(C(C(=C1)C1=CC(=CC=C1)C(F)(F)F)=O)C1=CC=CC=C1 NPPHIEHTKJAYSL-UHFFFAOYSA-N 0.000 claims 1
- LKKJQHHZMHXZQZ-UHFFFAOYSA-N 1-methyl-3,5-bis(4-methylphenyl)pyridin-4-one Chemical compound C1=CC(C)=CC=C1C(C1=O)=CN(C)C=C1C1=CC=C(C)C=C1 LKKJQHHZMHXZQZ-UHFFFAOYSA-N 0.000 claims 1
- DOWJIZDWBUSYHL-UHFFFAOYSA-N 1-methyl-3-(2,2,2-trifluoroethoxy)-5-[3-(trifluoromethyl)phenyl]pyridin-4-one Chemical compound CN1C=C(OCC(F)(F)F)C(=O)C(C=2C=C(C=CC=2)C(F)(F)F)=C1 DOWJIZDWBUSYHL-UHFFFAOYSA-N 0.000 claims 1
- KFJJVZWHNWJYLJ-UHFFFAOYSA-N 1-methyl-3-(2-methylphenyl)-5-(4-methylphenyl)pyridin-4-one Chemical compound C1=CC(C)=CC=C1C(C1=O)=CN(C)C=C1C1=CC=CC=C1C KFJJVZWHNWJYLJ-UHFFFAOYSA-N 0.000 claims 1
- DLJVPHFTTVREKE-UHFFFAOYSA-N 1-methyl-3-(2-methylphenyl)-5-[3-(trifluoromethyl)phenyl]pyridine-4-thione Chemical compound CC1=CC=CC=C1C(C1=S)=CN(C)C=C1C1=CC=CC(C(F)(F)F)=C1 DLJVPHFTTVREKE-UHFFFAOYSA-N 0.000 claims 1
- FZCFUDJDBFANJW-UHFFFAOYSA-N 1-methyl-3-(2-nitrophenyl)-5-[3-(trifluoromethyl)phenyl]pyridin-4-one Chemical compound CN1C=C(C(C(=C1)C1=CC(=CC=C1)C(F)(F)F)=O)C1=C(C=CC=C1)[N+](=O)[O-] FZCFUDJDBFANJW-UHFFFAOYSA-N 0.000 claims 1
- RHVMTQLQQPMHCO-UHFFFAOYSA-N 1-methyl-3-(3-methylphenyl)-5-[3-(trifluoromethyl)phenyl]pyridine-4-thione Chemical compound CC1=CC=CC(C=2C(C(C=3C=C(C=CC=3)C(F)(F)F)=CN(C)C=2)=S)=C1 RHVMTQLQQPMHCO-UHFFFAOYSA-N 0.000 claims 1
- WFADELHOIGJNEN-UHFFFAOYSA-N 1-methyl-3-(3-methylsulfanylphenyl)-5-[3-(trifluoromethyl)phenyl]pyridin-4-one Chemical compound CSC1=CC=CC(C=2C(C(C=3C=C(C=CC=3)C(F)(F)F)=CN(C)C=2)=O)=C1 WFADELHOIGJNEN-UHFFFAOYSA-N 0.000 claims 1
- DICIFTSQDRTGOQ-UHFFFAOYSA-N 1-methyl-3-(3-methylsulfonylphenyl)-5-[3-(trifluoromethyl)phenyl]pyridin-4-one Chemical compound O=C1C(C=2C=C(C=CC=2)S(C)(=O)=O)=CN(C)C=C1C1=CC=CC(C(F)(F)F)=C1 DICIFTSQDRTGOQ-UHFFFAOYSA-N 0.000 claims 1
- WKDRQTCGLUYFPA-UHFFFAOYSA-N 1-methyl-3-(3-nitrophenoxy)-5-[3-(trifluoromethyl)phenyl]pyridin-4-one Chemical compound CN1C=C(C(C(=C1)C1=CC(=CC=C1)C(F)(F)F)=O)OC1=CC(=CC=C1)[N+](=O)[O-] WKDRQTCGLUYFPA-UHFFFAOYSA-N 0.000 claims 1
- YGHRCYGVUMJJJW-UHFFFAOYSA-N 1-methyl-3-(3-nitrophenyl)-5-[3-(trifluoromethyl)phenyl]pyridin-4-one Chemical compound O=C1C(C=2C=C(C=CC=2)C(F)(F)F)=CN(C)C=C1C1=CC=CC([N+]([O-])=O)=C1 YGHRCYGVUMJJJW-UHFFFAOYSA-N 0.000 claims 1
- HLNMEKSHNFUWJU-UHFFFAOYSA-N 1-methyl-3-(4-methylphenyl)-5-[3-(trifluoromethyl)phenyl]pyridin-4-one Chemical compound C1=CC(C)=CC=C1C(C1=O)=CN(C)C=C1C1=CC=CC(C(F)(F)F)=C1 HLNMEKSHNFUWJU-UHFFFAOYSA-N 0.000 claims 1
- GUYIPUYQVSTREL-UHFFFAOYSA-N 1-methyl-3-(4-nitrophenoxy)-5-[3-(trifluoromethyl)phenyl]pyridin-4-one Chemical compound CN1C=C(C(C(=C1)C1=CC(=CC=C1)C(F)(F)F)=O)OC1=CC=C(C=C1)[N+](=O)[O-] GUYIPUYQVSTREL-UHFFFAOYSA-N 0.000 claims 1
- OVGQFCHBUBEYHU-UHFFFAOYSA-N 1-methyl-3-[3-(trifluoromethyl)phenoxy]-5-[3-(trifluoromethyl)phenyl]pyridin-4-one Chemical compound O=C1C(C=2C=C(C=CC=2)C(F)(F)F)=CN(C)C=C1OC1=CC=CC(C(F)(F)F)=C1 OVGQFCHBUBEYHU-UHFFFAOYSA-N 0.000 claims 1
- IASIQNJYUQGOLO-UHFFFAOYSA-N 1-methyl-3-[3-(trifluoromethyl)phenyl]-5-[3-(trifluoromethylsulfonyl)phenyl]pyridin-4-one Chemical compound CN1C=C(C(C(=C1)C1=CC(=CC=C1)S(=O)(=O)C(F)(F)F)=O)C1=CC(=CC=C1)C(F)(F)F IASIQNJYUQGOLO-UHFFFAOYSA-N 0.000 claims 1
- AEENHMHYRZRZOZ-UHFFFAOYSA-N 1-methyl-3-[3-(trifluoromethyl)phenyl]-5-[4-(trifluoromethyl)phenyl]pyridin-4-one Chemical compound O=C1C(C=2C=C(C=CC=2)C(F)(F)F)=CN(C)C=C1C1=CC=C(C(F)(F)F)C=C1 AEENHMHYRZRZOZ-UHFFFAOYSA-N 0.000 claims 1
- QHHXGHBAYXTTMO-UHFFFAOYSA-N 1-methyl-3-phenoxy-5-[3-(trifluoromethyl)phenyl]pyridine-4-thione Chemical compound S=C1C(C=2C=C(C=CC=2)C(F)(F)F)=CN(C)C=C1OC1=CC=CC=C1 QHHXGHBAYXTTMO-UHFFFAOYSA-N 0.000 claims 1
- ZXHBGILCPUXDED-UHFFFAOYSA-N 1-methyl-3-phenyl-5-(3-phenylsulfanylphenyl)pyridin-4-one Chemical compound O=C1C(C=2C=C(SC=3C=CC=CC=3)C=CC=2)=CN(C)C=C1C1=CC=CC=C1 ZXHBGILCPUXDED-UHFFFAOYSA-N 0.000 claims 1
- KGSHDRQNZDJRNQ-UHFFFAOYSA-N 1-methyl-3-phenyl-5-[2-(trifluoromethyl)phenyl]pyridin-4-one Chemical compound O=C1C(C=2C(=CC=CC=2)C(F)(F)F)=CN(C)C=C1C1=CC=CC=C1 KGSHDRQNZDJRNQ-UHFFFAOYSA-N 0.000 claims 1
- QDBRDBMHBBGAJI-UHFFFAOYSA-N 1-methyl-3-propyl-5-[3-(trifluoromethyl)phenyl]pyridin-4-one Chemical compound O=C1C(CCC)=CN(C)C=C1C1=CC=CC(C(F)(F)F)=C1 QDBRDBMHBBGAJI-UHFFFAOYSA-N 0.000 claims 1
- BYNOXGANNLIADN-UHFFFAOYSA-N 1-methyl-3-propyl-5-[3-(trifluoromethyl)phenyl]pyridine-4-thione Chemical compound S=C1C(CCC)=CN(C)C=C1C1=CC=CC(C(F)(F)F)=C1 BYNOXGANNLIADN-UHFFFAOYSA-N 0.000 claims 1
- XCTAWVRRTZVVAL-UHFFFAOYSA-N 1-methyl-3-thiophen-2-yl-5-[3-(trifluoromethyl)phenyl]pyridin-4-one Chemical compound O=C1C(C=2C=C(C=CC=2)C(F)(F)F)=CN(C)C=C1C1=CC=CS1 XCTAWVRRTZVVAL-UHFFFAOYSA-N 0.000 claims 1
- MSOGMQRDKULBCA-UHFFFAOYSA-N 3-(1-methoxyethyl)-1-methyl-5-[3-(trifluoromethyl)phenyl]pyridin-4-one Chemical compound COC(C)C1=CN(C=C(C1=O)C1=CC(=CC=C1)C(F)(F)F)C MSOGMQRDKULBCA-UHFFFAOYSA-N 0.000 claims 1
- ZWAUCPHSIQTYLG-UHFFFAOYSA-N 3-(2,4-dimethylphenyl)-1-methyl-5-phenylpyridin-4-one Chemical compound CC1=CC(C)=CC=C1C(C1=O)=CN(C)C=C1C1=CC=CC=C1 ZWAUCPHSIQTYLG-UHFFFAOYSA-N 0.000 claims 1
- ZGTDAXKAJGNOSZ-UHFFFAOYSA-N 3-(2,5-dimethylphenyl)-1-methyl-5-[3-(trifluoromethyl)phenyl]pyridin-4-one Chemical compound CC1=CC=C(C)C(C=2C(C(C=3C=C(C=CC=3)C(F)(F)F)=CN(C)C=2)=O)=C1 ZGTDAXKAJGNOSZ-UHFFFAOYSA-N 0.000 claims 1
- FOJXTTOFFRYKAV-UHFFFAOYSA-N 3-(2,5-dimethylphenyl)-1-methyl-5-phenylpyridin-4-one Chemical compound CC1=CC=C(C)C(C=2C(C(C=3C=CC=CC=3)=CN(C)C=2)=O)=C1 FOJXTTOFFRYKAV-UHFFFAOYSA-N 0.000 claims 1
- AEJMCABCUCESFJ-UHFFFAOYSA-N 3-(2,5-dimethylphenyl)-5-(3-fluorophenyl)-1-methylpyridin-4-one Chemical compound CC1=CC=C(C)C(C=2C(C(C=3C=C(F)C=CC=3)=CN(C)C=2)=O)=C1 AEJMCABCUCESFJ-UHFFFAOYSA-N 0.000 claims 1
- USYWTCPAJKGMOK-UHFFFAOYSA-N 3-(2-chlorophenyl)-1-methyl-5-(2-methylphenyl)pyridin-4-one Chemical compound CC1=CC=CC=C1C(C1=O)=CN(C)C=C1C1=CC=CC=C1Cl USYWTCPAJKGMOK-UHFFFAOYSA-N 0.000 claims 1
- LGROCYPKTWLEMB-UHFFFAOYSA-N 3-(2-chlorophenyl)-5-(3,4-dichlorophenyl)-1-methylpyridin-4-one Chemical compound O=C1C(C=2C(=CC=CC=2)Cl)=CN(C)C=C1C1=CC=C(Cl)C(Cl)=C1 LGROCYPKTWLEMB-UHFFFAOYSA-N 0.000 claims 1
- FWYVBUIEQQCRFW-UHFFFAOYSA-N 3-(2-chlorophenyl)-5-(3-chlorophenyl)-1-methylpyridin-4-one Chemical compound O=C1C(C=2C(=CC=CC=2)Cl)=CN(C)C=C1C1=CC=CC(Cl)=C1 FWYVBUIEQQCRFW-UHFFFAOYSA-N 0.000 claims 1
- PYRBLBODZHIUNZ-UHFFFAOYSA-N 3-(3,4-dichlorophenyl)-1-methyl-5-(2-methylphenyl)pyridin-4-one Chemical compound CC1=CC=CC=C1C(C1=O)=CN(C)C=C1C1=CC=C(Cl)C(Cl)=C1 PYRBLBODZHIUNZ-UHFFFAOYSA-N 0.000 claims 1
- KQZJTTJVNZENGS-UHFFFAOYSA-N 3-(3,4-dimethylphenyl)-1-methyl-5-[3-(trifluoromethyl)phenyl]pyridin-4-one Chemical compound C1=C(C)C(C)=CC=C1C(C1=O)=CN(C)C=C1C1=CC=CC(C(F)(F)F)=C1 KQZJTTJVNZENGS-UHFFFAOYSA-N 0.000 claims 1
- MMZLUWKAZJZBLB-UHFFFAOYSA-N 3-(3-bromophenyl)-1-methyl-5-(3-methylphenyl)pyridin-4-one Chemical compound CC1=CC=CC(C=2C(C(C=3C=C(Br)C=CC=3)=CN(C)C=2)=O)=C1 MMZLUWKAZJZBLB-UHFFFAOYSA-N 0.000 claims 1
- ZTCLHLYWMOFAMN-UHFFFAOYSA-N 3-(3-bromophenyl)-1-methyl-5-[3-(trifluoromethyl)phenyl]pyridin-4-one Chemical compound O=C1C(C=2C=C(C=CC=2)C(F)(F)F)=CN(C)C=C1C1=CC=CC(Br)=C1 ZTCLHLYWMOFAMN-UHFFFAOYSA-N 0.000 claims 1
- IODWFHZHTBNQBX-UHFFFAOYSA-N 3-(3-bromophenyl)-1-methyl-5-phenylpyridine-4-thione Chemical compound S=C1C(C=2C=C(Br)C=CC=2)=CN(C)C=C1C1=CC=CC=C1 IODWFHZHTBNQBX-UHFFFAOYSA-N 0.000 claims 1
- AVRUBKYLIYQTCZ-UHFFFAOYSA-N 3-(3-bromophenyl)-5-(2-chlorophenyl)-1-methylpyridin-4-one Chemical compound O=C1C(C=2C(=CC=CC=2)Cl)=CN(C)C=C1C1=CC=CC(Br)=C1 AVRUBKYLIYQTCZ-UHFFFAOYSA-N 0.000 claims 1
- GTFTUOCKPHPOMJ-UHFFFAOYSA-N 3-(3-bromophenyl)-5-(3,4-dichlorophenyl)-1-methylpyridin-4-one Chemical compound O=C1C(C=2C=C(Cl)C(Cl)=CC=2)=CN(C)C=C1C1=CC=CC(Br)=C1 GTFTUOCKPHPOMJ-UHFFFAOYSA-N 0.000 claims 1
- VZEWENBDQGFSOL-UHFFFAOYSA-N 3-(3-bromophenyl)-5-(3-chlorophenyl)-1-methylpyridin-4-one Chemical compound O=C1C(C=2C=C(Br)C=CC=2)=CN(C)C=C1C1=CC=CC(Cl)=C1 VZEWENBDQGFSOL-UHFFFAOYSA-N 0.000 claims 1
- BROKQSKIPUWDNJ-UHFFFAOYSA-N 3-(3-chlorophenyl)-1-methyl-5-[4-(trifluoromethyl)phenyl]pyridin-4-one Chemical compound O=C1C(C=2C=C(Cl)C=CC=2)=CN(C)C=C1C1=CC=C(C(F)(F)F)C=C1 BROKQSKIPUWDNJ-UHFFFAOYSA-N 0.000 claims 1
- AGSMFDSNVKMHMJ-UHFFFAOYSA-N 3-(3-chlorophenyl)-5-(3,4-dichlorophenyl)-1-methylpyridin-4-one Chemical compound O=C1C(C=2C=C(Cl)C(Cl)=CC=2)=CN(C)C=C1C1=CC=CC(Cl)=C1 AGSMFDSNVKMHMJ-UHFFFAOYSA-N 0.000 claims 1
- XVNFAOYHJNNODO-UHFFFAOYSA-N 3-(3-ethoxy-4-methoxyphenyl)-1-methyl-5-[3-(trifluoromethyl)phenyl]pyridin-4-one Chemical compound C1=C(OC)C(OCC)=CC(C=2C(C(C=3C=C(C=CC=3)C(F)(F)F)=CN(C)C=2)=O)=C1 XVNFAOYHJNNODO-UHFFFAOYSA-N 0.000 claims 1
- WXNOPOJSWZHJOP-UHFFFAOYSA-N 3-(3-iodophenyl)-1-methyl-5-phenylpyridin-4-one Chemical compound O=C1C(C=2C=C(I)C=CC=2)=CN(C)C=C1C1=CC=CC=C1 WXNOPOJSWZHJOP-UHFFFAOYSA-N 0.000 claims 1
- DEKHZEREPNMPLR-UHFFFAOYSA-N 3-(4-chlorophenoxy)-1-methyl-5-[3-(trifluoromethyl)phenyl]pyridin-4-one Chemical compound O=C1C(C=2C=C(C=CC=2)C(F)(F)F)=CN(C)C=C1OC1=CC=C(Cl)C=C1 DEKHZEREPNMPLR-UHFFFAOYSA-N 0.000 claims 1
- BDSYDSMHSRDZJN-UHFFFAOYSA-N 3-(4-methoxy-3-methylphenyl)-1-methyl-5-phenylpyridin-4-one Chemical compound C1=C(C)C(OC)=CC=C1C(C1=O)=CN(C)C=C1C1=CC=CC=C1 BDSYDSMHSRDZJN-UHFFFAOYSA-N 0.000 claims 1
- WVQHJTMQSOGRMR-UHFFFAOYSA-N 3-(4-methoxyphenyl)-1-methyl-5-[3-(trifluoromethyl)phenyl]pyridin-4-one Chemical compound C1=CC(OC)=CC=C1C(C1=O)=CN(C)C=C1C1=CC=CC(C(F)(F)F)=C1 WVQHJTMQSOGRMR-UHFFFAOYSA-N 0.000 claims 1
- FHLDYCAOLUBSFV-UHFFFAOYSA-N 3-[2-chloro-5-(trifluoromethyl)phenyl]-1-methyl-5-phenylpyridin-4-one Chemical compound O=C1C(C=2C(=CC=C(C=2)C(F)(F)F)Cl)=CN(C)C=C1C1=CC=CC=C1 FHLDYCAOLUBSFV-UHFFFAOYSA-N 0.000 claims 1
- AKXCSXPKLFYIGS-UHFFFAOYSA-N 3-[2-chloro-5-(trifluoromethyl)phenyl]-5-ethylsulfanyl-1-methylpyridin-4-one Chemical compound O=C1C(SCC)=CN(C)C=C1C1=CC(C(F)(F)F)=CC=C1Cl AKXCSXPKLFYIGS-UHFFFAOYSA-N 0.000 claims 1
- YRYAAALFYIMNGZ-UHFFFAOYSA-N 3-[3-(benzenesulfonyl)phenyl]-1-methyl-5-phenylpyridin-4-one Chemical compound O=C1C(C=2C=C(C=CC=2)S(=O)(=O)C=2C=CC=CC=2)=CN(C)C=C1C1=CC=CC=C1 YRYAAALFYIMNGZ-UHFFFAOYSA-N 0.000 claims 1
- GVLRDLFVGZMEOM-UHFFFAOYSA-N 3-[4-chloro-3-(trifluoromethyl)phenyl]-1-methyl-5-(trifluoromethyl)pyridin-4-one Chemical compound O=C1C(C(F)(F)F)=CN(C)C=C1C1=CC=C(Cl)C(C(F)(F)F)=C1 GVLRDLFVGZMEOM-UHFFFAOYSA-N 0.000 claims 1
- XPJHGLKTMDGHGF-UHFFFAOYSA-N 3-[4-chloro-3-(trifluoromethyl)phenyl]-1-methyl-5-phenoxypyridin-4-one Chemical compound O=C1C(C=2C=C(C(Cl)=CC=2)C(F)(F)F)=CN(C)C=C1OC1=CC=CC=C1 XPJHGLKTMDGHGF-UHFFFAOYSA-N 0.000 claims 1
- IKIYNTKDRPVELS-UHFFFAOYSA-N 3-[4-chloro-3-(trifluoromethyl)phenyl]-5-ethylsulfanyl-1-methylpyridin-4-one Chemical compound O=C1C(SCC)=CN(C)C=C1C1=CC=C(Cl)C(C(F)(F)F)=C1 IKIYNTKDRPVELS-UHFFFAOYSA-N 0.000 claims 1
- AEDAJCBBHLCLET-UHFFFAOYSA-N 3-benzylsulfanyl-1-methyl-5-[3-(trifluoromethyl)phenyl]pyridin-4-one Chemical compound O=C1C(C=2C=C(C=CC=2)C(F)(F)F)=CN(C)C=C1SCC1=CC=CC=C1 AEDAJCBBHLCLET-UHFFFAOYSA-N 0.000 claims 1
- APPWFEBNRMRWFO-UHFFFAOYSA-N 3-butylsulfanyl-1-methyl-5-[3-(trifluoromethyl)phenyl]pyridin-4-one Chemical compound O=C1C(SCCCC)=CN(C)C=C1C1=CC=CC(C(F)(F)F)=C1 APPWFEBNRMRWFO-UHFFFAOYSA-N 0.000 claims 1
- BYDRRHYWLSSFEA-UHFFFAOYSA-N 3-ethylsulfanyl-1-methyl-5-[3-(trifluoromethyl)phenyl]pyridin-4-one Chemical compound O=C1C(SCC)=CN(C)C=C1C1=CC=CC(C(F)(F)F)=C1 BYDRRHYWLSSFEA-UHFFFAOYSA-N 0.000 claims 1
- VBUKBPYRJKIOCT-UHFFFAOYSA-N 3-ethylsulfonyl-1-methyl-5-[3-(trifluoromethyl)phenyl]pyridin-4-one Chemical compound O=C1C(S(=O)(=O)CC)=CN(C)C=C1C1=CC=CC(C(F)(F)F)=C1 VBUKBPYRJKIOCT-UHFFFAOYSA-N 0.000 claims 1
- CWSFNHNDGDHJSH-UHFFFAOYSA-N 3-methoxy-1-methyl-5-phenylpyridin-4-one Chemical compound O=C1C(OC)=CN(C)C=C1C1=CC=CC=C1 CWSFNHNDGDHJSH-UHFFFAOYSA-N 0.000 claims 1
- DMQMYEXVKFVCAX-UHFFFAOYSA-N [4-oxo-3-phenyl-5-[3-(trifluoromethyl)phenyl]pyridin-1-yl] acetate Chemical compound O=C1C(C=2C=C(C=CC=2)C(F)(F)F)=CN(OC(=O)C)C=C1C1=CC=CC=C1 DMQMYEXVKFVCAX-UHFFFAOYSA-N 0.000 claims 1
- CXAUXZWEJXENHE-UHFFFAOYSA-N methyl 3-[1-methyl-5-(3-methylphenyl)-4-oxopyridin-3-yl]benzoate Chemical compound COC(=O)C1=CC=CC(C=2C(C(C=3C=C(C)C=CC=3)=CN(C)C=2)=O)=C1 CXAUXZWEJXENHE-UHFFFAOYSA-N 0.000 claims 1
- 241000196324 Embryophyta Species 0.000 abstract description 75
- 240000007594 Oryza sativa Species 0.000 abstract description 13
- 235000007164 Oryza sativa Nutrition 0.000 abstract description 12
- 235000009566 rice Nutrition 0.000 abstract description 12
- 239000004009 herbicide Substances 0.000 abstract description 10
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 abstract description 9
- 229920000742 Cotton Polymers 0.000 abstract description 5
- 125000001424 substituent group Chemical group 0.000 abstract description 5
- LFXDDUCUKGFLFJ-UHFFFAOYSA-N 3-phenyl-1h-pyridin-4-one Chemical class O=C1C=CNC=C1C1=CC=CC=C1 LFXDDUCUKGFLFJ-UHFFFAOYSA-N 0.000 abstract description 3
- 229910052757 nitrogen Inorganic materials 0.000 abstract description 2
- WHMDPDGBKYUEMW-UHFFFAOYSA-N pyridine-2-thiol Chemical class SC1=CC=CC=N1 WHMDPDGBKYUEMW-UHFFFAOYSA-N 0.000 abstract description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 abstract 2
- 238000000034 method Methods 0.000 description 46
- 239000000203 mixture Substances 0.000 description 36
- 230000008569 process Effects 0.000 description 29
- 238000002360 preparation method Methods 0.000 description 25
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 24
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 23
- 239000000047 product Substances 0.000 description 22
- 239000002689 soil Substances 0.000 description 21
- 239000003795 chemical substances by application Substances 0.000 description 19
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 18
- LVWZTYCIRDMTEY-UHFFFAOYSA-N metamizole Chemical compound O=C1C(N(CS(O)(=O)=O)C)=C(C)N(C)N1C1=CC=CC=C1 LVWZTYCIRDMTEY-UHFFFAOYSA-N 0.000 description 18
- 238000012360 testing method Methods 0.000 description 17
- 125000000217 alkyl group Chemical group 0.000 description 16
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 15
- 238000006243 chemical reaction Methods 0.000 description 14
- 239000000543 intermediate Substances 0.000 description 14
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 13
- 230000002363 herbicidal effect Effects 0.000 description 13
- 239000011541 reaction mixture Substances 0.000 description 13
- 239000002904 solvent Substances 0.000 description 13
- 150000001412 amines Chemical class 0.000 description 12
- 238000004949 mass spectrometry Methods 0.000 description 12
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 12
- 150000003839 salts Chemical class 0.000 description 12
- 238000003786 synthesis reaction Methods 0.000 description 12
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 11
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 11
- 239000000243 solution Substances 0.000 description 11
- 230000015572 biosynthetic process Effects 0.000 description 9
- 125000005843 halogen group Chemical group 0.000 description 9
- 238000010992 reflux Methods 0.000 description 9
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 8
- UBQKCCHYAOITMY-UHFFFAOYSA-N pyridin-2-ol Chemical compound OC1=CC=CC=N1 UBQKCCHYAOITMY-UHFFFAOYSA-N 0.000 description 8
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical group C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 7
- 238000006170 formylation reaction Methods 0.000 description 7
- 125000004356 hydroxy functional group Chemical group O* 0.000 description 7
- GCNTZFIIOFTKIY-UHFFFAOYSA-N 4-hydroxypyridine Chemical compound OC1=CC=NC=C1 GCNTZFIIOFTKIY-UHFFFAOYSA-N 0.000 description 6
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 6
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 6
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- 239000002253 acid Substances 0.000 description 6
- 239000000839 emulsion Substances 0.000 description 6
- 238000009472 formulation Methods 0.000 description 6
- 150000002576 ketones Chemical class 0.000 description 6
- 229910052760 oxygen Inorganic materials 0.000 description 6
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 5
- 239000002585 base Substances 0.000 description 5
- 150000002081 enamines Chemical class 0.000 description 5
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 5
- 230000022244 formylation Effects 0.000 description 5
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 5
- 239000001301 oxygen Substances 0.000 description 5
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 4
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 4
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 4
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- 150000004820 halides Chemical class 0.000 description 4
- 229910052739 hydrogen Inorganic materials 0.000 description 4
- 239000001257 hydrogen Substances 0.000 description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 4
- 239000000843 powder Substances 0.000 description 4
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 4
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 4
- 244000058871 Echinochloa crus-galli Species 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 3
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical class [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 3
- 239000003905 agrochemical Substances 0.000 description 3
- 229910052783 alkali metal Inorganic materials 0.000 description 3
- 125000003545 alkoxy group Chemical group 0.000 description 3
- 239000000010 aprotic solvent Substances 0.000 description 3
- 230000000875 corresponding effect Effects 0.000 description 3
- WBJINCZRORDGAQ-UHFFFAOYSA-N formic acid ethyl ester Natural products CCOC=O WBJINCZRORDGAQ-UHFFFAOYSA-N 0.000 description 3
- 125000002485 formyl group Chemical class [H]C(*)=O 0.000 description 3
- 239000008187 granular material Substances 0.000 description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 3
- 235000019341 magnesium sulphate Nutrition 0.000 description 3
- NQMRYBIKMRVZLB-UHFFFAOYSA-N methylamine hydrochloride Chemical compound [Cl-].[NH3+]C NQMRYBIKMRVZLB-UHFFFAOYSA-N 0.000 description 3
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 3
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- 241000894007 species Species 0.000 description 3
- 229910052717 sulfur Chemical group 0.000 description 3
- 239000011593 sulfur Chemical group 0.000 description 3
- 239000008096 xylene Substances 0.000 description 3
- 125000004455 (C1-C3) alkylthio group Chemical group 0.000 description 2
- 244000036975 Ambrosia artemisiifolia Species 0.000 description 2
- 235000003129 Ambrosia artemisiifolia var elatior Nutrition 0.000 description 2
- 244000025254 Cannabis sativa Species 0.000 description 2
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 2
- QXNVGIXVLWOKEQ-UHFFFAOYSA-N Disodium Chemical compound [Na][Na] QXNVGIXVLWOKEQ-UHFFFAOYSA-N 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical class Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 2
- ZSXGLVDWWRXATF-UHFFFAOYSA-N N,N-dimethylformamide dimethyl acetal Chemical compound COC(OC)N(C)C ZSXGLVDWWRXATF-UHFFFAOYSA-N 0.000 description 2
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 2
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 2
- 240000002439 Sorghum halepense Species 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 208000027418 Wounds and injury Diseases 0.000 description 2
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 2
- 235000003484 annual ragweed Nutrition 0.000 description 2
- 230000009286 beneficial effect Effects 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 235000006263 bur ragweed Nutrition 0.000 description 2
- FUSUHKVFWTUUBE-UHFFFAOYSA-N buten-2-one Chemical compound CC(=O)C=C FUSUHKVFWTUUBE-UHFFFAOYSA-N 0.000 description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 2
- 238000004587 chromatography analysis Methods 0.000 description 2
- 239000004927 clay Substances 0.000 description 2
- 235000003488 common ragweed Nutrition 0.000 description 2
- 230000006378 damage Effects 0.000 description 2
- 239000004495 emulsifiable concentrate Substances 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- XWBDWHCCBGMXKG-UHFFFAOYSA-N ethanamine;hydron;chloride Chemical compound Cl.CCN XWBDWHCCBGMXKG-UHFFFAOYSA-N 0.000 description 2
- 150000003840 hydrochlorides Chemical class 0.000 description 2
- 230000002209 hydrophobic effect Effects 0.000 description 2
- 208000014674 injury Diseases 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- TZIHFWKZFHZASV-UHFFFAOYSA-N methyl formate Chemical compound COC=O TZIHFWKZFHZASV-UHFFFAOYSA-N 0.000 description 2
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 description 2
- 125000002816 methylsulfanyl group Chemical group [H]C([H])([H])S[*] 0.000 description 2
- 239000002736 nonionic surfactant Substances 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 230000003647 oxidation Effects 0.000 description 2
- 238000007254 oxidation reaction Methods 0.000 description 2
- 230000001590 oxidative effect Effects 0.000 description 2
- 125000003356 phenylsulfanyl group Chemical group [*]SC1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 2
- 235000009736 ragweed Nutrition 0.000 description 2
- 239000000741 silica gel Substances 0.000 description 2
- 229910002027 silica gel Inorganic materials 0.000 description 2
- JQWHASGSAFIOCM-UHFFFAOYSA-M sodium periodate Chemical compound [Na+].[O-]I(=O)(=O)=O JQWHASGSAFIOCM-UHFFFAOYSA-M 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 239000004094 surface-active agent Substances 0.000 description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 2
- VCGRFBXVSFAGGA-UHFFFAOYSA-N (1,1-dioxo-1,4-thiazinan-4-yl)-[6-[[3-(4-fluorophenyl)-5-methyl-1,2-oxazol-4-yl]methoxy]pyridin-3-yl]methanone Chemical compound CC=1ON=C(C=2C=CC(F)=CC=2)C=1COC(N=C1)=CC=C1C(=O)N1CCS(=O)(=O)CC1 VCGRFBXVSFAGGA-UHFFFAOYSA-N 0.000 description 1
- 125000006273 (C1-C3) alkyl group Chemical group 0.000 description 1
- 125000006274 (C1-C3)alkoxy group Chemical group 0.000 description 1
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 description 1
- 125000006656 (C2-C4) alkenyl group Chemical group 0.000 description 1
- BWKAYBPLDRWMCJ-UHFFFAOYSA-N 1,1-diethoxy-n,n-dimethylmethanamine Chemical compound CCOC(N(C)C)OCC BWKAYBPLDRWMCJ-UHFFFAOYSA-N 0.000 description 1
- QIMSIBBZWOVMOH-UHFFFAOYSA-N 1,5-bis(dimethylamino)-2-(3-methylphenyl)-4-[3-(trifluoromethyl)phenyl]penta-1,4-dien-3-one Chemical compound CN(C=C(C(C(=CN(C)C)C1=CC(=CC=C1)C(F)(F)F)=O)C1=CC(=CC=C1)C)C QIMSIBBZWOVMOH-UHFFFAOYSA-N 0.000 description 1
- BOMBCJWXEMTPFR-UHFFFAOYSA-N 1,5-dihydroxy-2,4-diphenylpenta-1,4-dien-3-one Chemical compound C=1C=CC=CC=1C(=CO)C(=O)C(=CO)C1=CC=CC=C1 BOMBCJWXEMTPFR-UHFFFAOYSA-N 0.000 description 1
- ARCJHQVJRAPMHW-UHFFFAOYSA-N 1-(3-methylphenyl)-3-[3-(trifluoromethyl)phenyl]propan-2-one Chemical compound CC1=CC=CC(CC(=O)CC=2C=C(C=CC=2)C(F)(F)F)=C1 ARCJHQVJRAPMHW-UHFFFAOYSA-N 0.000 description 1
- VZAWCLCJGSBATP-UHFFFAOYSA-N 1-cycloundecyl-1,2-diazacycloundecane Chemical compound C1CCCCCCCCCC1N1NCCCCCCCCC1 VZAWCLCJGSBATP-UHFFFAOYSA-N 0.000 description 1
- PZHIWRCQKBBTOW-UHFFFAOYSA-N 1-ethoxybutane Chemical compound CCCCOCC PZHIWRCQKBBTOW-UHFFFAOYSA-N 0.000 description 1
- NVJUHMXYKCUMQA-UHFFFAOYSA-N 1-ethoxypropane Chemical compound CCCOCC NVJUHMXYKCUMQA-UHFFFAOYSA-N 0.000 description 1
- ISJSKZRWDSBCOL-UHFFFAOYSA-N 1-methyl-2,6-diphenylpyridin-4-one Chemical compound CN1C(C=2C=CC=CC=2)=CC(=O)C=C1C1=CC=CC=C1 ISJSKZRWDSBCOL-UHFFFAOYSA-N 0.000 description 1
- LZQWXHXEBCOWNT-UHFFFAOYSA-N 1-methyl-3,5-diphenylpyridin-4-one Chemical compound O=C1C(C=2C=CC=CC=2)=CN(C)C=C1C1=CC=CC=C1 LZQWXHXEBCOWNT-UHFFFAOYSA-N 0.000 description 1
- HEJNJWZNGRGUOX-UHFFFAOYSA-N 1-methyl-3-(2-methylphenyl)pyridin-4-one Chemical compound CN1C=CC(C(=C1)C1=C(C=CC=C1)C)=O HEJNJWZNGRGUOX-UHFFFAOYSA-N 0.000 description 1
- MRASGAKBIOABQQ-UHFFFAOYSA-N 1-methyl-3-(3-methylphenyl)-5-(4-methylphenyl)pyridin-4-one Chemical compound C1=CC(C)=CC=C1C(C1=O)=CN(C)C=C1C1=CC=CC(C)=C1 MRASGAKBIOABQQ-UHFFFAOYSA-N 0.000 description 1
- DGYQMWOGVUXAFM-UHFFFAOYSA-N 1-phenylpyridin-4-one Chemical compound C1=CC(=O)C=CN1C1=CC=CC=C1 DGYQMWOGVUXAFM-UHFFFAOYSA-N 0.000 description 1
- LQRGDMUHZHPARU-UHFFFAOYSA-N 1-propan-2-ylpyridin-4-one Chemical compound CC(C)N1C=CC(=O)C=C1 LQRGDMUHZHPARU-UHFFFAOYSA-N 0.000 description 1
- FHTDDANQIMVWKZ-UHFFFAOYSA-N 1h-pyridine-4-thione Chemical compound SC1=CC=NC=C1 FHTDDANQIMVWKZ-UHFFFAOYSA-N 0.000 description 1
- OVSKIKFHRZPJSS-UHFFFAOYSA-N 2,4-D Chemical compound OC(=O)COC1=CC=C(Cl)C=C1Cl OVSKIKFHRZPJSS-UHFFFAOYSA-N 0.000 description 1
- MQMKJILTEHLNTP-UHFFFAOYSA-N 2-(3-nitrophenoxy)acetyl chloride Chemical compound [O-][N+](=O)C1=CC=CC(OCC(Cl)=O)=C1 MQMKJILTEHLNTP-UHFFFAOYSA-N 0.000 description 1
- TXIPVVLKTCCGPA-UHFFFAOYSA-N 2-[3-[2-[[1-(cyclopropanecarbonyl)piperidin-3-yl]amino]pyrimidin-4-yl]-2-quinolin-2-ylimidazol-4-yl]acetonitrile Chemical compound C1(CC1)C(=O)N1CC(CCC1)NC1=NC=CC(=N1)N1C(=NC=C1CC#N)C1=NC2=CC=CC=C2C=C1 TXIPVVLKTCCGPA-UHFFFAOYSA-N 0.000 description 1
- ZPMWWAIBJJFPPQ-UHFFFAOYSA-N 2-ethoxyacetyl chloride Chemical compound CCOCC(Cl)=O ZPMWWAIBJJFPPQ-UHFFFAOYSA-N 0.000 description 1
- ZNQVEEAIQZEUHB-UHFFFAOYSA-N 2-ethoxyethanol Chemical compound CCOCCO ZNQVEEAIQZEUHB-UHFFFAOYSA-N 0.000 description 1
- 229940093475 2-ethoxyethanol Drugs 0.000 description 1
- PKUPAJQAJXVUEK-UHFFFAOYSA-N 2-phenoxyacetyl chloride Chemical compound ClC(=O)COC1=CC=CC=C1 PKUPAJQAJXVUEK-UHFFFAOYSA-N 0.000 description 1
- DKMXZAGSGCAVPX-UHFFFAOYSA-N 3,5-dibenzyl-1-methylpyridin-4-one Chemical class O=C1C(CC=2C=CC=CC=2)=CN(C)C=C1CC1=CC=CC=C1 DKMXZAGSGCAVPX-UHFFFAOYSA-N 0.000 description 1
- WNEODWDFDXWOLU-QHCPKHFHSA-N 3-[3-(hydroxymethyl)-4-[1-methyl-5-[[5-[(2s)-2-methyl-4-(oxetan-3-yl)piperazin-1-yl]pyridin-2-yl]amino]-6-oxopyridin-3-yl]pyridin-2-yl]-7,7-dimethyl-1,2,6,8-tetrahydrocyclopenta[3,4]pyrrolo[3,5-b]pyrazin-4-one Chemical compound C([C@@H](N(CC1)C=2C=NC(NC=3C(N(C)C=C(C=3)C=3C(=C(N4C(C5=CC=6CC(C)(C)CC=6N5CC4)=O)N=CC=3)CO)=O)=CC=2)C)N1C1COC1 WNEODWDFDXWOLU-QHCPKHFHSA-N 0.000 description 1
- 125000004179 3-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(Cl)=C1[H] 0.000 description 1
- MPOYBFYHRQBZPM-UHFFFAOYSA-N 3h-pyridin-4-one Chemical class O=C1CC=NC=C1 MPOYBFYHRQBZPM-UHFFFAOYSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- WIFIQCQDQCBMCM-UHFFFAOYSA-N 4-[3-(trifluoromethyl)phenyl]but-3-en-2-one Chemical compound CC(=O)C=CC1=CC=CC(C(F)(F)F)=C1 WIFIQCQDQCBMCM-UHFFFAOYSA-N 0.000 description 1
- GECGEYVQNQQTQY-UHFFFAOYSA-N 4-hydroxy-1-phenyl-3-[3-(trifluoromethyl)phenyl]but-3-en-2-one Chemical compound C=1C=CC(C(F)(F)F)=CC=1C(=CO)C(=O)CC1=CC=CC=C1 GECGEYVQNQQTQY-UHFFFAOYSA-N 0.000 description 1
- XVMSFILGAMDHEY-UHFFFAOYSA-N 6-(4-aminophenyl)sulfonylpyridin-3-amine Chemical compound C1=CC(N)=CC=C1S(=O)(=O)C1=CC=C(N)C=N1 XVMSFILGAMDHEY-UHFFFAOYSA-N 0.000 description 1
- RHXHGRAEPCAFML-UHFFFAOYSA-N 7-cyclopentyl-n,n-dimethyl-2-[(5-piperazin-1-ylpyridin-2-yl)amino]pyrrolo[2,3-d]pyrimidine-6-carboxamide Chemical compound N1=C2N(C3CCCC3)C(C(=O)N(C)C)=CC2=CN=C1NC(N=C1)=CC=C1N1CCNCC1 RHXHGRAEPCAFML-UHFFFAOYSA-N 0.000 description 1
- CYJRNFFLTBEQSQ-UHFFFAOYSA-N 8-(3-methyl-1-benzothiophen-5-yl)-N-(4-methylsulfonylpyridin-3-yl)quinoxalin-6-amine Chemical compound CS(=O)(=O)C1=C(C=NC=C1)NC=1C=C2N=CC=NC2=C(C=1)C=1C=CC2=C(C(=CS2)C)C=1 CYJRNFFLTBEQSQ-UHFFFAOYSA-N 0.000 description 1
- BSFODEXXVBBYOC-UHFFFAOYSA-N 8-[4-(dimethylamino)butan-2-ylamino]quinolin-6-ol Chemical compound C1=CN=C2C(NC(CCN(C)C)C)=CC(O)=CC2=C1 BSFODEXXVBBYOC-UHFFFAOYSA-N 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- 235000013479 Amaranthus retroflexus Nutrition 0.000 description 1
- 244000055702 Amaranthus viridis Species 0.000 description 1
- 235000004135 Amaranthus viridis Nutrition 0.000 description 1
- 244000105624 Arachis hypogaea Species 0.000 description 1
- 241000217446 Calystegia sepium Species 0.000 description 1
- 244000277285 Cassia obtusifolia Species 0.000 description 1
- 235000006719 Cassia obtusifolia Nutrition 0.000 description 1
- 235000014552 Cassia tora Nutrition 0.000 description 1
- 235000009344 Chenopodium album Nutrition 0.000 description 1
- 235000005484 Chenopodium berlandieri Nutrition 0.000 description 1
- 235000009332 Chenopodium rubrum Nutrition 0.000 description 1
- 241000195493 Cryptophyta Species 0.000 description 1
- 244000052363 Cynodon dactylon Species 0.000 description 1
- 235000005853 Cyperus esculentus Nutrition 0.000 description 1
- 244000075634 Cyperus rotundus Species 0.000 description 1
- 241000508725 Elymus repens Species 0.000 description 1
- OTMSDBZUPAUEDD-UHFFFAOYSA-N Ethane Chemical compound CC OTMSDBZUPAUEDD-UHFFFAOYSA-N 0.000 description 1
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical class C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 1
- 101100002119 Gallus gallus ARF5 gene Proteins 0.000 description 1
- 244000068988 Glycine max Species 0.000 description 1
- 235000010469 Glycine max Nutrition 0.000 description 1
- 244000052355 Hydrilla verticillata Species 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 102100022260 Killin Human genes 0.000 description 1
- 101710193777 Killin Proteins 0.000 description 1
- 229920001732 Lignosulfonate Polymers 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical class CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 1
- AYCPARAPKDAOEN-LJQANCHMSA-N N-[(1S)-2-(dimethylamino)-1-phenylethyl]-6,6-dimethyl-3-[(2-methyl-4-thieno[3,2-d]pyrimidinyl)amino]-1,4-dihydropyrrolo[3,4-c]pyrazole-5-carboxamide Chemical compound C1([C@H](NC(=O)N2C(C=3NN=C(NC=4C=5SC=CC=5N=C(C)N=4)C=3C2)(C)C)CN(C)C)=CC=CC=C1 AYCPARAPKDAOEN-LJQANCHMSA-N 0.000 description 1
- 240000004928 Paspalum scrobiculatum Species 0.000 description 1
- 241000209504 Poaceae Species 0.000 description 1
- 235000008406 SarachaNachtschatten Nutrition 0.000 description 1
- 241000208292 Solanaceae Species 0.000 description 1
- 235000004790 Solanum aculeatissimum Nutrition 0.000 description 1
- 235000008424 Solanum demissum Nutrition 0.000 description 1
- 235000018253 Solanum ferox Nutrition 0.000 description 1
- 235000000208 Solanum incanum Nutrition 0.000 description 1
- 235000013131 Solanum macrocarpon Nutrition 0.000 description 1
- 235000009869 Solanum phureja Nutrition 0.000 description 1
- 235000000341 Solanum ptychanthum Nutrition 0.000 description 1
- 235000017622 Solanum xanthocarpum Nutrition 0.000 description 1
- 240000006394 Sorghum bicolor Species 0.000 description 1
- 235000011684 Sorghum saccharatum Nutrition 0.000 description 1
- 235000021307 Triticum Nutrition 0.000 description 1
- 244000098338 Triticum aestivum Species 0.000 description 1
- 241000607479 Yersinia pestis Species 0.000 description 1
- LXRZVMYMQHNYJB-UNXOBOICSA-N [(1R,2S,4R)-4-[[5-[4-[(1R)-7-chloro-1,2,3,4-tetrahydroisoquinolin-1-yl]-5-methylthiophene-2-carbonyl]pyrimidin-4-yl]amino]-2-hydroxycyclopentyl]methyl sulfamate Chemical compound CC1=C(C=C(S1)C(=O)C1=C(N[C@H]2C[C@H](O)[C@@H](COS(N)(=O)=O)C2)N=CN=C1)[C@@H]1NCCC2=C1C=C(Cl)C=C2 LXRZVMYMQHNYJB-UNXOBOICSA-N 0.000 description 1
- DHKHKXVYLBGOIT-UHFFFAOYSA-N acetaldehyde Diethyl Acetal Natural products CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 description 1
- 150000001241 acetals Chemical class 0.000 description 1
- 229940022682 acetone Drugs 0.000 description 1
- 125000003668 acetyloxy group Chemical group [H]C([H])([H])C(=O)O[*] 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 150000001335 aliphatic alkanes Chemical class 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910001854 alkali hydroxide Inorganic materials 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 229910000102 alkali metal hydride Inorganic materials 0.000 description 1
- 150000008046 alkali metal hydrides Chemical class 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 150000008051 alkyl sulfates Chemical class 0.000 description 1
- 230000002152 alkylating effect Effects 0.000 description 1
- 230000004075 alteration Effects 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 150000001793 charged compounds Chemical class 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- HHTOWVWIVBSOKC-UHFFFAOYSA-N cis,trans-5'-hydroxythalidomide Chemical compound O=C1NC(=O)C(O)CC1N1C(=O)C2=CC=CC=C2C1=O HHTOWVWIVBSOKC-UHFFFAOYSA-N 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 101150075361 cps3 gene Proteins 0.000 description 1
- 244000038559 crop plants Species 0.000 description 1
- 125000004093 cyano group Chemical group *C#N 0.000 description 1
- 239000008367 deionised water Substances 0.000 description 1
- 229910021641 deionized water Inorganic materials 0.000 description 1
- GUJOJGAPFQRJSV-UHFFFAOYSA-N dialuminum;dioxosilane;oxygen(2-);hydrate Chemical compound O.[O-2].[O-2].[O-2].[Al+3].[Al+3].O=[Si]=O.O=[Si]=O.O=[Si]=O.O=[Si]=O GUJOJGAPFQRJSV-UHFFFAOYSA-N 0.000 description 1
- CRPOUZQWHJYTMS-UHFFFAOYSA-N dialuminum;magnesium;disilicate Chemical compound [Mg+2].[Al+3].[Al+3].[O-][Si]([O-])([O-])[O-].[O-][Si]([O-])([O-])[O-] CRPOUZQWHJYTMS-UHFFFAOYSA-N 0.000 description 1
- 125000003963 dichloro group Chemical group Cl* 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 238000011156 evaluation Methods 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 125000001153 fluoro group Chemical group F* 0.000 description 1
- ZHNUHDYFZUAESO-UHFFFAOYSA-N formamide Substances NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 230000008570 general process Effects 0.000 description 1
- 230000035784 germination Effects 0.000 description 1
- 125000001475 halogen functional group Chemical group 0.000 description 1
- 125000005842 heteroatom Chemical group 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical class I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- 230000003301 hydrolyzing effect Effects 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 238000010348 incorporation Methods 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- 239000002917 insecticide Substances 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 235000019357 lignosulphonate Nutrition 0.000 description 1
- MXIRPJHGXWFUAE-UHFFFAOYSA-N lithium;propan-1-olate Chemical compound [Li+].CCC[O-] MXIRPJHGXWFUAE-UHFFFAOYSA-N 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 239000000395 magnesium oxide Substances 0.000 description 1
- CPLXHLVBOLITMK-UHFFFAOYSA-N magnesium oxide Inorganic materials [Mg]=O CPLXHLVBOLITMK-UHFFFAOYSA-N 0.000 description 1
- AXZKOIWUVFPNLO-UHFFFAOYSA-N magnesium;oxygen(2-) Chemical compound [O-2].[Mg+2] AXZKOIWUVFPNLO-UHFFFAOYSA-N 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- 229910052901 montmorillonite Inorganic materials 0.000 description 1
- HNPCDFJZADHNHD-UHFFFAOYSA-N n-(diformamidomethyl)formamide Chemical class O=CNC(NC=O)NC=O HNPCDFJZADHNHD-UHFFFAOYSA-N 0.000 description 1
- PSZYNBSKGUBXEH-UHFFFAOYSA-N naphthalene-1-sulfonic acid Chemical class C1=CC=C2C(S(=O)(=O)O)=CC=CC2=C1 PSZYNBSKGUBXEH-UHFFFAOYSA-N 0.000 description 1
- 239000005645 nematicide Substances 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- TVMXDCGIABBOFY-UHFFFAOYSA-N octane Chemical compound CCCCCCCC TVMXDCGIABBOFY-UHFFFAOYSA-N 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 235000020232 peanut Nutrition 0.000 description 1
- 150000002978 peroxides Chemical class 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- CYQAYERJWZKYML-UHFFFAOYSA-N phosphorus pentasulfide Chemical compound S1P(S2)(=S)SP3(=S)SP1(=S)SP2(=S)S3 CYQAYERJWZKYML-UHFFFAOYSA-N 0.000 description 1
- RPDAUEIUDPHABB-UHFFFAOYSA-N potassium ethoxide Chemical compound [K+].CC[O-] RPDAUEIUDPHABB-UHFFFAOYSA-N 0.000 description 1
- 239000012264 purified product Substances 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 238000011160 research Methods 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- XGVXKJKTISMIOW-ZDUSSCGKSA-N simurosertib Chemical compound N1N=CC(C=2SC=3C(=O)NC(=NC=3C=2)[C@H]2N3CCC(CC3)C2)=C1C XGVXKJKTISMIOW-ZDUSSCGKSA-N 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 125000001273 sulfonato group Chemical class [O-]S(*)(=O)=O 0.000 description 1
- 150000003460 sulfonic acids Chemical class 0.000 description 1
- 238000010998 test method Methods 0.000 description 1
- CZDYPVPMEAXLPK-UHFFFAOYSA-N tetramethylsilane Chemical compound C[Si](C)(C)C CZDYPVPMEAXLPK-UHFFFAOYSA-N 0.000 description 1
- 125000001544 thienyl group Chemical group 0.000 description 1
- LBLYYCQCTBFVLH-UHFFFAOYSA-M toluenesulfonate group Chemical group C=1(C(=CC=CC1)S(=O)(=O)[O-])C LBLYYCQCTBFVLH-UHFFFAOYSA-M 0.000 description 1
- KMIOJWCYOHBUJS-HAKPAVFJSA-N vorolanib Chemical compound C1N(C(=O)N(C)C)CC[C@@H]1NC(=O)C1=C(C)NC(\C=C/2C3=CC(F)=CC=C3NC\2=O)=C1C KMIOJWCYOHBUJS-HAKPAVFJSA-N 0.000 description 1
- 239000004563 wettable powder Substances 0.000 description 1
- 150000003738 xylenes Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/62—Oxygen or sulfur atoms
- C07D213/69—Two or more oxygen atoms
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N43/00—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds
- A01N43/34—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with one nitrogen atom as the only ring hetero atom
- A01N43/40—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with one nitrogen atom as the only ring hetero atom six-membered rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/62—Oxygen or sulfur atoms
- C07D213/63—One oxygen atom
- C07D213/68—One oxygen atom attached in position 4
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/62—Oxygen or sulfur atoms
- C07D213/70—Sulfur atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/62—Oxygen or sulfur atoms
- C07D213/70—Sulfur atoms
- C07D213/71—Sulfur atoms to which a second hetero atom is attached
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/78—Carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D213/79—Acids; Esters
- C07D213/80—Acids; Esters in position 3
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/78—Carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D213/84—Nitriles
- C07D213/85—Nitriles in position 3
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/89—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members with hetero atoms directly attached to the ring nitrogen atom
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Life Sciences & Earth Sciences (AREA)
- Dentistry (AREA)
- Wood Science & Technology (AREA)
- Plant Pathology (AREA)
- Health & Medical Sciences (AREA)
- Engineering & Computer Science (AREA)
- Agronomy & Crop Science (AREA)
- General Health & Medical Sciences (AREA)
- Pest Control & Pesticides (AREA)
- Zoology (AREA)
- Environmental Sciences (AREA)
- Pyridine Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/810,219 US4152136A (en) | 1974-08-28 | 1977-06-27 | 3-Phenyl-5-substituted-4(1H)-pyridones(thiones) |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1075697A true CA1075697A (en) | 1980-04-15 |
Family
ID=25203294
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA305,980A Expired CA1075697A (en) | 1977-06-27 | 1978-06-22 | 3-phenyl-5-substituted-4(1h)-pyridones(thiones) |
Country Status (16)
Families Citing this family (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4714492A (en) * | 1980-05-12 | 1987-12-22 | Rohm And Haas Company | Certain 2-phenyl-4-oxo-nicotinates and their use for inducing male sterility in a cereal grain plant |
| US4936904A (en) * | 1980-05-12 | 1990-06-26 | Carlson Glenn R | Aryl-4-oxonicotinates useful for inducing male sterility in cereal grain plants |
| AU539399B2 (en) * | 1980-05-12 | 1984-09-27 | Zeneca Limited | Substituted oxonicotinates |
| EP0067511A3 (en) * | 1981-05-19 | 1983-04-06 | Imperial Chemical Industries Plc | Method of inducing tillering using pyridine derivatives, and some of the pyridines themselves, process for preparing them and agricultural compositions containing them |
| DE3531773A1 (de) * | 1985-09-06 | 1987-03-19 | Bayer Ag | 3,5 disubstituierte 4-pyridone |
| GB9005518D0 (en) * | 1990-03-12 | 1990-05-09 | Wellcome Found | Heterocyclic compounds |
| US5403934A (en) * | 1990-03-12 | 1995-04-04 | Burroughs Wellcome Co. | Heterocyclic compounds |
| US5567698A (en) * | 1995-02-15 | 1996-10-22 | Bristol-Myers Squibb Company | Pyridinium thiomethyl substituted chepholosporin derivatives |
| WO2023232673A1 (en) * | 2022-06-01 | 2023-12-07 | Syngenta Crop Protection Ag | Herbicidal derivatives |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NZ178426A (en) * | 1974-08-28 | 1978-06-20 | Lilly Co Eli | 3-phenyl-1-substituted-4(1h)-pyridones or-pyridine-thionesand herbicidal compositions |
-
1975
- 1975-08-27 AT AT563277A patent/AT362613B/de not_active IP Right Cessation
-
1978
- 1978-03-31 MW MW17/78A patent/MW1778A1/xx unknown
- 1978-05-25 IN IN567/CAL/78A patent/IN149651B/en unknown
- 1978-06-21 RO RO7894426A patent/RO75145A/ro unknown
- 1978-06-21 RO RO78102053A patent/RO80037A/ro unknown
- 1978-06-21 RO RO78102054A patent/RO80699A/ro unknown
- 1978-06-22 CA CA305,980A patent/CA1075697A/en not_active Expired
- 1978-06-22 FR FR7818746A patent/FR2395996A2/fr active Granted
- 1978-06-22 ZM ZM58/78A patent/ZM5878A1/xx unknown
- 1978-06-23 BE BE1008944A patent/BE868393A/xx not_active IP Right Cessation
- 1978-06-24 GR GR56592A patent/GR70237B/el unknown
- 1978-06-26 IT IT24972/78A patent/IT1113145B/it active
- 1978-06-26 LU LU79873A patent/LU79873A1/xx unknown
- 1978-06-26 IE IE1265/78A patent/IE47202B1/en unknown
- 1978-06-26 GT GT197852905A patent/GT197852905A/es unknown
- 1978-06-26 ZA ZA783650A patent/ZA783650B/xx unknown
- 1978-06-27 BG BG041632A patent/BG30176A4/xx unknown
- 1978-06-27 BG BG041633A patent/BG30168A4/xx unknown
- 1978-06-27 BG BG041631A patent/BG30175A4/xx unknown
- 1978-06-27 BG BG040220A patent/BG29870A3/xx unknown
- 1978-09-01 GB GB7835305A patent/GB2029403B/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| BG30176A4 (en) | 1981-04-15 |
| BG29870A3 (en) | 1981-02-16 |
| IE47202B1 (en) | 1984-01-11 |
| IE781265L (en) | 1978-12-27 |
| BG30175A4 (en) | 1981-04-15 |
| IT1113145B (it) | 1986-01-20 |
| RO75145A (ro) | 1981-01-30 |
| LU79873A1 (enrdf_load_stackoverflow) | 1978-12-07 |
| RO80699A (ro) | 1982-12-06 |
| FR2395996B2 (enrdf_load_stackoverflow) | 1983-08-05 |
| BG30168A4 (en) | 1981-04-15 |
| MW1778A1 (en) | 1979-05-09 |
| GR70237B (enrdf_load_stackoverflow) | 1982-09-01 |
| ATA563277A (de) | 1980-10-15 |
| IN149651B (enrdf_load_stackoverflow) | 1982-03-06 |
| BE868393A (fr) | 1978-12-27 |
| AT362613B (de) | 1981-06-10 |
| ZA783650B (en) | 1980-02-27 |
| GT197852905A (es) | 1979-12-18 |
| RO80037A (ro) | 1982-10-26 |
| GB2029403B (en) | 1982-10-27 |
| ZM5878A1 (en) | 1979-04-23 |
| GB2029403A (en) | 1980-03-19 |
| FR2395996A2 (fr) | 1979-01-26 |
| IT7824972A0 (it) | 1978-06-26 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JPH08508277A (ja) | 除草性のヘテロ環式置換ピリジン | |
| CA1075697A (en) | 3-phenyl-5-substituted-4(1h)-pyridones(thiones) | |
| JPS6341906B2 (enrdf_load_stackoverflow) | ||
| CA1109878A (en) | Imidazolinyl benzoic acids esters and salts | |
| CA2161440A1 (en) | Herbicidal substituted 1-phenyl or 1-pyridinyl-benzotriazoles | |
| EP0332133B1 (en) | Novel triazole compounds, process for producing the same, and herbicidal compositions containing the same | |
| HU206953B (en) | Insecticidal agent comprising tetrahdyropyrimidine derivatives and process for producing such compounds | |
| HK1005028B (en) | Novel triazole compounds, process for producing the same, and herbicidal compositions containing the same | |
| IL104977A (en) | Arylindazoles and herbicidal compositions containing them | |
| EP0468924A2 (de) | Neue Herbizide | |
| FI97616C (fi) | 2-fenyyli-imidatsolijohdannainen, sen valmistusmenetelmä ja käyttö niveljalkaistuholaisten torjuntaan | |
| US4345936A (en) | Imidazoles, compositions and herbicidal method | |
| JPS6049628B2 (ja) | 3−(2−アリ−ル−2−プロピル)尿素化合物およびこの化合物を有効成分とする除草剤 | |
| US4218238A (en) | Herbicidal 1-alkyl-3-phenylpyridinium salts | |
| US4908357A (en) | Photoactive azole pesticides | |
| US4743603A (en) | Derivatives of 2-(3-pyridyl)-2-phenylaminoacetic acid and their use as antifungals in the field of argriculture | |
| JPH07509253A (ja) | キノリニルオキサジアゾール除草剤 | |
| EP0006359B1 (en) | Use of 1-alkyl-3-phenylpyridinium salts as herbicides and herbicidal formulations containing the salts | |
| JPS62230782A (ja) | イミダゾリン誘導体、その製法および除草剤 | |
| WO1991001978A1 (en) | Triazine derivatives | |
| CN111655677A (zh) | 作为农用化学品的苯并咪唑化合物 | |
| JP3090995B2 (ja) | 3,4−トランス−4−エチル−3−(置換フェニル)−1−(3−イソプロピルフェニル)−2−ピロリジノン誘導体、 | |
| EP0122130B1 (en) | Herbicidal tetrahydrobenzothiazole derivatives | |
| JPH04230253A (ja) | 除草性化合物、その製造法及びそれを含有する除草剤組成物 | |
| JPH01121290A (ja) | テトラヒドロトリアゾピリダジン−3−チオキソ−1(2h)−オン誘導体及び除草剤 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |