CA1074774A - Catalyst component comprising brown titanium trichloride - Google Patents
Catalyst component comprising brown titanium trichlorideInfo
- Publication number
- CA1074774A CA1074774A CA225,266A CA225266A CA1074774A CA 1074774 A CA1074774 A CA 1074774A CA 225266 A CA225266 A CA 225266A CA 1074774 A CA1074774 A CA 1074774A
- Authority
- CA
- Canada
- Prior art keywords
- catalyst component
- ether
- brown
- solid
- per gram
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000003054 catalyst Substances 0.000 title claims abstract description 49
- YONPGGFAJWQGJC-UHFFFAOYSA-K titanium(iii) chloride Chemical compound Cl[Ti](Cl)Cl YONPGGFAJWQGJC-UHFFFAOYSA-K 0.000 title claims abstract description 17
- 239000007787 solid Substances 0.000 claims abstract description 74
- 150000001875 compounds Chemical class 0.000 claims abstract description 46
- 238000006116 polymerization reaction Methods 0.000 claims abstract description 31
- 239000004711 α-olefin Substances 0.000 claims abstract description 13
- 239000011148 porous material Substances 0.000 claims abstract description 12
- 229910001040 Beta-titanium Inorganic materials 0.000 claims abstract description 7
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims description 26
- 229910052719 titanium Inorganic materials 0.000 claims description 26
- 239000010936 titanium Substances 0.000 claims description 26
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 claims description 24
- AQZGPSLYZOOYQP-UHFFFAOYSA-N Diisoamyl ether Chemical compound CC(C)CCOCCC(C)C AQZGPSLYZOOYQP-UHFFFAOYSA-N 0.000 claims description 17
- YNLAOSYQHBDIKW-UHFFFAOYSA-M diethylaluminium chloride Chemical compound CC[Al](Cl)CC YNLAOSYQHBDIKW-UHFFFAOYSA-M 0.000 claims description 15
- 150000001412 amines Chemical class 0.000 claims description 9
- 239000000203 mixture Substances 0.000 claims description 8
- 239000002685 polymerization catalyst Substances 0.000 claims description 6
- 150000002170 ethers Chemical class 0.000 claims description 5
- 150000002576 ketones Chemical class 0.000 claims description 5
- 150000003568 thioethers Chemical class 0.000 claims description 5
- 150000003573 thiols Chemical class 0.000 claims description 5
- 150000005215 alkyl ethers Chemical class 0.000 claims description 4
- 150000001408 amides Chemical class 0.000 claims description 4
- 150000002148 esters Chemical class 0.000 claims description 4
- DURPTKYDGMDSBL-UHFFFAOYSA-N 1-butoxybutane Chemical compound CCCCOCCCC DURPTKYDGMDSBL-UHFFFAOYSA-N 0.000 claims description 3
- 150000003003 phosphines Chemical class 0.000 claims description 3
- 239000011949 solid catalyst Substances 0.000 claims description 2
- 239000002002 slurry Substances 0.000 abstract description 31
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 abstract description 18
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 abstract description 18
- 229920000642 polymer Polymers 0.000 abstract description 7
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 abstract description 5
- 239000001257 hydrogen Substances 0.000 abstract description 5
- 229910052739 hydrogen Inorganic materials 0.000 abstract description 5
- 229920006125 amorphous polymer Polymers 0.000 abstract description 4
- 239000003607 modifier Substances 0.000 abstract description 3
- 239000012808 vapor phase Substances 0.000 abstract description 3
- 230000001965 increasing effect Effects 0.000 abstract description 2
- 230000003197 catalytic effect Effects 0.000 abstract 1
- 239000003795 chemical substances by application Substances 0.000 abstract 1
- 230000035945 sensitivity Effects 0.000 abstract 1
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 144
- 239000000243 solution Substances 0.000 description 22
- 229910052782 aluminium Inorganic materials 0.000 description 14
- XJDNKRIXUMDJCW-UHFFFAOYSA-J titanium tetrachloride Chemical compound Cl[Ti](Cl)(Cl)Cl XJDNKRIXUMDJCW-UHFFFAOYSA-J 0.000 description 13
- 238000000034 method Methods 0.000 description 12
- KPZGRMZPZLOPBS-UHFFFAOYSA-N 1,3-dichloro-2,2-bis(chloromethyl)propane Chemical compound ClCC(CCl)(CCl)CCl KPZGRMZPZLOPBS-UHFFFAOYSA-N 0.000 description 9
- -1 aminés Chemical class 0.000 description 9
- 125000000217 alkyl group Chemical group 0.000 description 8
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 8
- 239000007788 liquid Substances 0.000 description 7
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 6
- 229910010061 TiC13 Inorganic materials 0.000 description 6
- 238000004458 analytical method Methods 0.000 description 6
- 239000000463 material Substances 0.000 description 6
- 239000000460 chlorine Substances 0.000 description 5
- 238000010908 decantation Methods 0.000 description 5
- 238000005259 measurement Methods 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- 239000011550 stock solution Substances 0.000 description 5
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- 150000001336 alkenes Chemical class 0.000 description 4
- 229910052801 chlorine Inorganic materials 0.000 description 4
- 238000010438 heat treatment Methods 0.000 description 4
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 4
- 238000012986 modification Methods 0.000 description 4
- 230000004048 modification Effects 0.000 description 4
- 229920001155 polypropylene Polymers 0.000 description 4
- 239000000843 powder Substances 0.000 description 4
- 238000000634 powder X-ray diffraction Methods 0.000 description 4
- VXEGSRKPIUDPQT-UHFFFAOYSA-N 4-[4-(4-methoxyphenyl)piperazin-1-yl]aniline Chemical compound C1=CC(OC)=CC=C1N1CCN(C=2C=CC(N)=CC=2)CC1 VXEGSRKPIUDPQT-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- 239000004743 Polypropylene Substances 0.000 description 3
- 229910010066 TiC14 Inorganic materials 0.000 description 3
- 238000007792 addition Methods 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 239000012632 extractable Substances 0.000 description 3
- 239000007789 gas Substances 0.000 description 3
- 150000004820 halides Chemical group 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- OJMIONKXNSYLSR-UHFFFAOYSA-N phosphorous acid Chemical compound OP(O)O OJMIONKXNSYLSR-UHFFFAOYSA-N 0.000 description 3
- 230000000379 polymerizing effect Effects 0.000 description 3
- 239000005049 silicon tetrachloride Substances 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- IEXRMSFAVATTJX-UHFFFAOYSA-N tetrachlorogermane Chemical compound Cl[Ge](Cl)(Cl)Cl IEXRMSFAVATTJX-UHFFFAOYSA-N 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- NKJOXAZJBOMXID-UHFFFAOYSA-N 1,1'-Oxybisoctane Chemical compound CCCCCCCCOCCCCCCCC NKJOXAZJBOMXID-UHFFFAOYSA-N 0.000 description 2
- BWZVCCNYKMEVEX-UHFFFAOYSA-N 2,4,6-Trimethylpyridine Chemical compound CC1=CC(C)=NC(C)=C1 BWZVCCNYKMEVEX-UHFFFAOYSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 2
- 239000005977 Ethylene Substances 0.000 description 2
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 2
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 description 2
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminum chloride Substances Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- 238000004090 dissolution Methods 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 239000011521 glass Substances 0.000 description 2
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 description 2
- 239000002245 particle Substances 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 239000012265 solid product Substances 0.000 description 2
- OUULRIDHGPHMNQ-UHFFFAOYSA-N stibane Chemical class [SbH3] OUULRIDHGPHMNQ-UHFFFAOYSA-N 0.000 description 2
- AUHZEENZYGFFBQ-UHFFFAOYSA-N 1,3,5-Me3C6H3 Natural products CC1=CC(C)=CC(C)=C1 AUHZEENZYGFFBQ-UHFFFAOYSA-N 0.000 description 1
- OZCMOJQQLBXBKI-UHFFFAOYSA-N 1-ethenoxy-2-methylpropane Chemical compound CC(C)COC=C OZCMOJQQLBXBKI-UHFFFAOYSA-N 0.000 description 1
- KMJWLOCIFITPTO-UHFFFAOYSA-N 3-methyl-1-(2-methylpropoxy)butane Chemical compound CC(C)CCOCC(C)C KMJWLOCIFITPTO-UHFFFAOYSA-N 0.000 description 1
- ZSBTVXBAENDZBH-UHFFFAOYSA-N 3-methylbutoxybenzene Chemical compound CC(C)CCOC1=CC=CC=C1 ZSBTVXBAENDZBH-UHFFFAOYSA-N 0.000 description 1
- RXXCIBALSKQCAE-UHFFFAOYSA-N 3-methylbutoxymethylbenzene Chemical compound CC(C)CCOCC1=CC=CC=C1 RXXCIBALSKQCAE-UHFFFAOYSA-N 0.000 description 1
- 241000428352 Amma Species 0.000 description 1
- 238000004438 BET method Methods 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical class S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 description 1
- 101100536354 Drosophila melanogaster tant gene Proteins 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 239000002841 Lewis acid Substances 0.000 description 1
- 239000004721 Polyphenylene oxide Substances 0.000 description 1
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 description 1
- 229910010062 TiCl3 Inorganic materials 0.000 description 1
- 229910021552 Vanadium(IV) chloride Inorganic materials 0.000 description 1
- 238000002441 X-ray diffraction Methods 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 230000032683 aging Effects 0.000 description 1
- 238000013019 agitation Methods 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 150000001335 aliphatic alkanes Chemical class 0.000 description 1
- 125000005234 alkyl aluminium group Chemical group 0.000 description 1
- 150000001348 alkyl chlorides Chemical class 0.000 description 1
- PQLAYKMGZDUDLQ-UHFFFAOYSA-K aluminium bromide Chemical compound Br[Al](Br)Br PQLAYKMGZDUDLQ-UHFFFAOYSA-K 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 239000012986 chain transfer agent Substances 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 229920001577 copolymer Polymers 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 238000006006 cyclotrimerization reaction Methods 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- SBZXBUIDTXKZTM-UHFFFAOYSA-N diglyme Chemical compound COCCOCCOC SBZXBUIDTXKZTM-UHFFFAOYSA-N 0.000 description 1
- 238000001493 electron microscopy Methods 0.000 description 1
- LDLDYFCCDKENPD-UHFFFAOYSA-N ethenylcyclohexane Chemical compound C=CC1CCCCC1 LDLDYFCCDKENPD-UHFFFAOYSA-N 0.000 description 1
- UAIZDWNSWGTKFZ-UHFFFAOYSA-L ethylaluminum(2+);dichloride Chemical compound CC[Al](Cl)Cl UAIZDWNSWGTKFZ-UHFFFAOYSA-L 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000001307 helium Substances 0.000 description 1
- 229910052734 helium Inorganic materials 0.000 description 1
- SWQJXJOGLNCZEY-UHFFFAOYSA-N helium atom Chemical compound [He] SWQJXJOGLNCZEY-UHFFFAOYSA-N 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- ATADHKWKHYVBTJ-UHFFFAOYSA-N hydron;4-[1-hydroxy-2-(methylamino)ethyl]benzene-1,2-diol;chloride Chemical compound Cl.CNCC(O)C1=CC=C(O)C(O)=C1 ATADHKWKHYVBTJ-UHFFFAOYSA-N 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 150000007517 lewis acids Chemical class 0.000 description 1
- 239000006193 liquid solution Substances 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 1
- 229910052753 mercury Inorganic materials 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 239000000178 monomer Substances 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 230000003472 neutralizing effect Effects 0.000 description 1
- VIKNJXKGJWUCNN-XGXHKTLJSA-N norethisterone Chemical compound O=C1CC[C@@H]2[C@H]3CC[C@](C)([C@](CC4)(O)C#C)[C@@H]4[C@@H]3CCC2=C1 VIKNJXKGJWUCNN-XGXHKTLJSA-N 0.000 description 1
- 239000002674 ointment Substances 0.000 description 1
- 229920005787 opaque polymer Polymers 0.000 description 1
- 125000000962 organic group Chemical group 0.000 description 1
- 230000000737 periodic effect Effects 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- 229920000570 polyether Polymers 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- IOVGROKTTNBUGK-SJCJKPOMSA-N ritodrine Chemical compound N([C@@H](C)[C@H](O)C=1C=CC(O)=CC=1)CCC1=CC=C(O)C=C1 IOVGROKTTNBUGK-SJCJKPOMSA-N 0.000 description 1
- 229910052709 silver Inorganic materials 0.000 description 1
- 239000004332 silver Substances 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011343 solid material Substances 0.000 description 1
- 238000001179 sorption measurement Methods 0.000 description 1
- 239000012086 standard solution Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- GFYHSKONPJXCDE-UHFFFAOYSA-N sym-collidine Natural products CC1=CN=C(C)C(C)=C1 GFYHSKONPJXCDE-UHFFFAOYSA-N 0.000 description 1
- 238000004448 titration Methods 0.000 description 1
- JTJFQBNJBPPZRI-UHFFFAOYSA-J vanadium tetrachloride Chemical compound Cl[V](Cl)(Cl)Cl JTJFQBNJBPPZRI-UHFFFAOYSA-J 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F10/00—Homopolymers and copolymers of unsaturated aliphatic hydrocarbons having only one carbon-to-carbon double bond
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Transition And Organic Metals Composition Catalysts For Addition Polymerization (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US46846374A | 1974-05-09 | 1974-05-09 | |
| US05/563,679 US3984350A (en) | 1974-05-09 | 1975-03-31 | Catalyst component comprising brown titanium trichloride |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1074774A true CA1074774A (en) | 1980-04-01 |
Family
ID=27042403
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA225,266A Expired CA1074774A (en) | 1974-05-09 | 1975-04-23 | Catalyst component comprising brown titanium trichloride |
Country Status (14)
| Country | Link |
|---|---|
| US (1) | US3984350A (member.php) |
| JP (1) | JPS50152992A (member.php) |
| AR (1) | AR221466A1 (member.php) |
| BR (1) | BR7502821A (member.php) |
| CA (1) | CA1074774A (member.php) |
| DD (1) | DD119795A5 (member.php) |
| DE (1) | DE2518530A1 (member.php) |
| EG (1) | EG12351A (member.php) |
| FR (1) | FR2284369A1 (member.php) |
| GB (1) | GB1507932A (member.php) |
| NL (1) | NL7504795A (member.php) |
| PH (1) | PH11941A (member.php) |
| RO (1) | RO82095A (member.php) |
| SU (1) | SU917683A3 (member.php) |
Families Citing this family (40)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| IE40215B1 (en) * | 1973-12-04 | 1979-04-11 | Ici Ltd | Olefine polymer, olefine polymerisation process and catalyst |
| US4115533A (en) * | 1974-07-31 | 1978-09-19 | Mitsubishi Chemical Industries, Ltd. | Preparation of solid titanium trichloride |
| US4115532A (en) * | 1974-07-31 | 1978-09-19 | Mitsubishi Chemical Industries, Ltd. | Preparation of solid titanium trichloride |
| GB1485791A (en) * | 1974-10-30 | 1977-09-14 | Ici Ltd | Treatment of transition metal compound |
| JPS527891A (en) * | 1975-07-09 | 1977-01-21 | Toa Nenryo Kogyo Kk | Process for producing catalyst components for polymerization of olefi n |
| JPS527892A (en) * | 1975-07-09 | 1977-01-21 | Toa Nenryo Kogyo Kk | Process for producing catalyst components for polymerization of alpha-olefin |
| IT1040379B (it) * | 1975-08-08 | 1979-12-20 | Montedison Spa | Componenti catalitici e catalizzatori per la polimerizzazione delle olefine |
| US4177160A (en) * | 1975-08-08 | 1979-12-04 | Montedison S.P.A. | Catalytic components and catalysts for the polymerization of olefins |
| US4127504A (en) * | 1975-11-25 | 1978-11-28 | Toa Nenryo Kogyo Kabushiki Kaisha | Process for the production of a catalyst component for use in the polymerization of alphaolefins |
| JPS5263981A (en) * | 1975-11-25 | 1977-05-26 | Toa Nenryo Kogyo Kk | Preparation of polymerization catalyst for alpha-olefin |
| JPS5273195A (en) * | 1975-12-16 | 1977-06-18 | Toyo Sutoufuaa Kemikaru Yuugen | Manufacture of catalyst composite for alphaaolefine polymerization |
| JPS591286B2 (ja) * | 1976-02-05 | 1984-01-11 | 三井東圧化学株式会社 | α−オレフインの重合方法 |
| JPS52110793A (en) * | 1976-03-15 | 1977-09-17 | Sumitomo Chem Co Ltd | Preparation of highly crystalline olefin polymers |
| GR63148B (en) * | 1976-05-17 | 1979-09-25 | Mitsui Toatsu Chemicals | Process for the polymerization of ethylene of a-olefins and catalyst therefor |
| US4256866A (en) * | 1976-06-16 | 1981-03-17 | Standard Oil Company (Indiana) | Polymerization process |
| US4189556A (en) * | 1976-06-16 | 1980-02-19 | Standard Oil Company (Indiana) | Polymerization process |
| US4258168A (en) * | 1976-06-16 | 1981-03-24 | Standard Oil Company (Indiana) | Polymerization process |
| JPS52155199A (en) * | 1976-06-18 | 1977-12-23 | Mitsubishi Petrochem Co Ltd | Production of titanium trichloride composition |
| US4334047A (en) * | 1976-06-28 | 1982-06-08 | Standard Oil Company (Indiana) | Polymerization catalysts |
| JPS537786A (en) * | 1976-07-09 | 1978-01-24 | Sumitomo Chem Co Ltd | Preparation of propylene polymer or copolymer |
| NL185455C (nl) * | 1976-09-08 | 1990-04-17 | Sumitomo Chemical Co | Werkwijze ter bereiding van een vaste titaantrichloridekatalysator en werkwijze ter bereiding van alkeenpolymeren. |
| US4111836A (en) * | 1976-11-03 | 1978-09-05 | Standard Oil Company (Indiana) | Process for forming high performance titanium trichloride olefin polymerization catalyst components |
| US4189553A (en) * | 1976-12-01 | 1980-02-19 | The Dow Chemical Company | High efficiency catalyst for polymerizing olefins |
| US4120820A (en) * | 1976-12-01 | 1978-10-17 | The Dow Chemical Company | High efficiency catalyst for polymerizing olefins |
| DE2861357D1 (en) * | 1977-08-31 | 1982-01-28 | Ici Plc | Titanium trichloride compositions, preparation thereof, catalyst system containing them and polymerisation of olefins using this system |
| DE2861689D1 (en) * | 1977-08-31 | 1982-04-29 | Ici Plc | Titanium trichloride compositions, preparation thereof, catalyst system containing them and polymerisation of olefins using this system |
| DE2860737D1 (en) * | 1977-08-31 | 1981-09-03 | Ici Plc | Titanium trichloride compositions, preparation thereof, catalyst system containing them, and polymerisation of olefins using this system |
| US4370457A (en) * | 1978-02-27 | 1983-01-25 | Standard Oil Company (Indiana) | Catalyst system |
| US4222893A (en) * | 1978-04-03 | 1980-09-16 | Standard Oil Company (Indiana) | Process for forming high performance titanium trichloride olefin polymerization catalyst components |
| US4543400A (en) * | 1978-09-26 | 1985-09-24 | Exxon Research & Engineering Co. | Titanium trichloride catalyst component and the process for the production thereof |
| US4235983A (en) * | 1978-10-04 | 1980-11-25 | Standard Oil Company (Indiana) | Purification of olefin recycle to polymerization |
| US4200714A (en) * | 1978-10-04 | 1980-04-29 | Standard Oil Company (Indiana) | Olefin purification process for hydrogen contaminated streams |
| US4235747A (en) * | 1979-04-19 | 1980-11-25 | Standard Oil Company (Indiana) | Process for improving polymerization performance of brown solid titanium trichloride catalyst component |
| US4255281A (en) * | 1979-07-03 | 1981-03-10 | Standard Oil Company (Indiana) | Alpha-olefin polymerization catalyst and process |
| US4251389A (en) * | 1980-01-14 | 1981-02-17 | Gulf Oil Corporation | Titanium chloride propylene polymerization catalyst and process for polymerizing propylene therewith |
| JPS5928573B2 (ja) * | 1980-02-05 | 1984-07-13 | チッソ株式会社 | α−オレフイン重合体の製造方法 |
| JPS56112912A (en) | 1980-02-13 | 1981-09-05 | Toyo Sutoufuaa Chem:Kk | Titanium trichloride catalytic component and polymerization or copolymerization method of alpha-olefin |
| US4376061A (en) * | 1981-01-23 | 1983-03-08 | Gulf Research & Development Company | Polymerizing olefins with a novel catalyst |
| WO1989000584A1 (en) * | 1987-07-10 | 1989-01-26 | Quantum Chemical Corporation | Propylene polymerization catalyst and method |
| US6180011B1 (en) * | 1993-04-07 | 2001-01-30 | Enichem Synthesis S.P.A | Method for removing hydrocarbon products from water surfaces |
-
1975
- 1975-03-31 US US05/563,679 patent/US3984350A/en not_active Expired - Lifetime
- 1975-04-17 PH PH17067A patent/PH11941A/en unknown
- 1975-04-23 NL NL7504795A patent/NL7504795A/xx not_active Application Discontinuation
- 1975-04-23 CA CA225,266A patent/CA1074774A/en not_active Expired
- 1975-04-25 DE DE19752518530 patent/DE2518530A1/de not_active Withdrawn
- 1975-04-30 GB GB18015/75A patent/GB1507932A/en not_active Expired
- 1975-04-30 DD DD185805A patent/DD119795A5/xx unknown
- 1975-05-06 JP JP50054162A patent/JPS50152992A/ja active Pending
- 1975-05-07 FR FR7514340A patent/FR2284369A1/fr active Granted
- 1975-05-07 EG EG75272A patent/EG12351A/xx active
- 1975-05-08 BR BR3599/75D patent/BR7502821A/pt unknown
- 1975-05-08 AR AR258690A patent/AR221466A1/es active
- 1975-05-08 SU SU752133352A patent/SU917683A3/ru active
- 1975-05-09 RO RO7582176A patent/RO82095A/ro unknown
Also Published As
| Publication number | Publication date |
|---|---|
| DE2518530A1 (de) | 1975-11-20 |
| FR2284369B1 (member.php) | 1981-04-10 |
| RO82095B (ro) | 1983-06-30 |
| JPS50152992A (member.php) | 1975-12-09 |
| NL7504795A (nl) | 1975-11-11 |
| RO82095A (ro) | 1983-07-07 |
| FR2284369A1 (fr) | 1976-04-09 |
| DD119795A5 (member.php) | 1976-05-12 |
| PH11941A (en) | 1978-09-15 |
| EG12351A (en) | 1978-12-31 |
| US3984350A (en) | 1976-10-05 |
| GB1507932A (en) | 1978-04-19 |
| AR221466A1 (es) | 1981-02-13 |
| BR7502821A (pt) | 1976-03-16 |
| SU917683A3 (ru) | 1982-03-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1074774A (en) | Catalyst component comprising brown titanium trichloride | |
| CA1177050A (en) | Polymerization catalyst and method | |
| US3644318A (en) | Process for the polymerization of olefins | |
| EP0202859B1 (en) | Exhaustively prepolymerized supported alpha-olefin polymerization catalyst | |
| CA1169998A (en) | METHOD FOR POLYMERIZING .alpha.-OLEFIN | |
| US4154701A (en) | Olefin polymerization catalyst | |
| US4121030A (en) | Transition metal composition | |
| EP0250229B1 (en) | Alpha-olefin polymerization catalyst system including an advantageous modifier component | |
| CA1145318A (en) | Olefin polymerisation catalyst, process and polyolefin product | |
| CA1172621A (en) | Polymerization catalyst and method | |
| CA1281023C (en) | CATALYST COMPOSITION FOR POLYMERIZING .alpha.-OLEFIN POLYMERS OF RELATIVELY NARROW MOLECULAR WEIGHT DISTRIBUTION | |
| CA1282771C (en) | CATALYST COMPOSITION FOR POLYMERIZING .alpha.-OLEFIN POLYMERS OF RELATIVELY NARROW MOLECULAR WEIGHT DISTRIBUTION | |
| EP0324587A2 (en) | Catalyst composition for the preparation of alpha-olefin polymers with a narrow molecular weight distribution | |
| US4478988A (en) | Polymerization method | |
| US4210559A (en) | Catalyst for the preparation of polyalpha-olefins having broad molecular weight distributions | |
| US4738942A (en) | Catalyst composition for polymerizing alpha-olefin polymers of relatively narrow molecular weight distribution and high melt index | |
| CA1207739A (en) | Catalyst composition | |
| US4876321A (en) | Preparation of alpha-olefin polymers of relatively narrow molecular weight distribution | |
| RU2066240C1 (ru) | Сокаталитическая композиция для полимеризации альфа-олефинов, каталитическая система на ее основе и способ полимеризации альфа-олефинов | |
| US4467044A (en) | Supported catalyst for polymerization of olefins | |
| US3773735A (en) | Process for the manufacture of polyolefins | |
| CA1216398A (en) | Method of polymerizing ethylene | |
| US4208304A (en) | Catalyst system for producing ethylene polymers | |
| GB2184448A (en) | Catalyst composition for preparing alpha-olefin polymers of relatively narrow molecular weight distribution and high melt index | |
| US4387201A (en) | Process for the homo- and copolymerization of α-olefins |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |