CA1070311A - N-(1-((1,3-dihydro-1,3-dioxo-2h-benz(de) isoquinolin-2-yl)-alkyl)-4-piperidinyl)-n-phenylalkylamides - Google Patents
N-(1-((1,3-dihydro-1,3-dioxo-2h-benz(de) isoquinolin-2-yl)-alkyl)-4-piperidinyl)-n-phenylalkylamidesInfo
- Publication number
- CA1070311A CA1070311A CA241,199A CA241199A CA1070311A CA 1070311 A CA1070311 A CA 1070311A CA 241199 A CA241199 A CA 241199A CA 1070311 A CA1070311 A CA 1070311A
- Authority
- CA
- Canada
- Prior art keywords
- benz
- formula
- compounds
- dioxo
- piperidinyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- -1 1,3-dihydro-1,3-dioxo-2h-benz(de) isoquinolin-2-yl Chemical group 0.000 title claims abstract description 17
- 150000001875 compounds Chemical class 0.000 claims abstract description 34
- 150000003839 salts Chemical class 0.000 claims abstract description 12
- 239000002253 acid Substances 0.000 claims abstract description 11
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 11
- 229910052736 halogen Inorganic materials 0.000 claims abstract description 6
- 150000002367 halogens Chemical group 0.000 claims abstract description 6
- 238000000034 method Methods 0.000 claims description 21
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 8
- PMCBDBWCQQBSRJ-UHFFFAOYSA-N norfentanyl Chemical compound C=1C=CC=CC=1N(C(=O)CC)C1CCNCC1 PMCBDBWCQQBSRJ-UHFFFAOYSA-N 0.000 claims description 5
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 claims description 3
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 claims description 3
- 125000004432 carbon atom Chemical group C* 0.000 claims 2
- 238000004519 manufacturing process Methods 0.000 claims 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 abstract description 9
- 125000002947 alkylene group Chemical group 0.000 abstract description 7
- 229910052739 hydrogen Inorganic materials 0.000 abstract description 6
- 239000001257 hydrogen Substances 0.000 abstract description 6
- 125000003545 alkoxy group Chemical group 0.000 abstract description 4
- 125000004414 alkyl thio group Chemical group 0.000 abstract description 4
- 230000001430 anti-depressive effect Effects 0.000 abstract description 4
- 239000000935 antidepressant agent Substances 0.000 abstract description 4
- 229940005513 antidepressants Drugs 0.000 abstract description 4
- 230000000694 effects Effects 0.000 abstract description 4
- 150000002431 hydrogen Chemical group 0.000 abstract description 3
- 125000000753 cycloalkyl group Chemical group 0.000 abstract description 2
- 229940121363 anti-inflammatory agent Drugs 0.000 abstract 1
- 239000002260 anti-inflammatory agent Substances 0.000 abstract 1
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 abstract 1
- 239000000203 mixture Substances 0.000 description 13
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 12
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 12
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 12
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 11
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 11
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 9
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 9
- 238000006243 chemical reaction Methods 0.000 description 7
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 6
- XJHABGPPCLHLLV-UHFFFAOYSA-N benzo[de]isoquinoline-1,3-dione Chemical class C1=CC(C(=O)NC2=O)=C3C2=CC=CC3=C1 XJHABGPPCLHLLV-UHFFFAOYSA-N 0.000 description 6
- 239000002244 precipitate Substances 0.000 description 6
- 239000000047 product Substances 0.000 description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 6
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 4
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- GRSMWKLPSNHDHA-UHFFFAOYSA-N Naphthalic anhydride Chemical class C1=CC(C(=O)OC2=O)=C3C2=CC=CC3=C1 GRSMWKLPSNHDHA-UHFFFAOYSA-N 0.000 description 4
- 239000003795 chemical substances by application Substances 0.000 description 4
- 229910052801 chlorine Inorganic materials 0.000 description 4
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 4
- 125000001424 substituent group Chemical group 0.000 description 4
- ULTHEAFYOOPTTB-UHFFFAOYSA-N 1,4-dibromobutane Chemical compound BrCCCCBr ULTHEAFYOOPTTB-UHFFFAOYSA-N 0.000 description 3
- BVEQCSSYYLIIHY-UHFFFAOYSA-N 2-(4-bromobutyl)benzo[de]isoquinoline-1,3-dione Chemical compound C1=CC(C(N(CCCCBr)C2=O)=O)=C3C2=CC=CC3=C1 BVEQCSSYYLIIHY-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- 230000037396 body weight Effects 0.000 description 3
- 229910052794 bromium Inorganic materials 0.000 description 3
- 150000002148 esters Chemical class 0.000 description 3
- 229910052731 fluorine Inorganic materials 0.000 description 3
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 3
- 239000000543 intermediate Substances 0.000 description 3
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 3
- 241000894007 species Species 0.000 description 3
- MLYDUNKGAQLZAO-UHFFFAOYSA-N 2-(6-bromohexyl)benzo[de]isoquinoline-1,3-dione Chemical compound C1=CC(C(N(CCCCCCBr)C2=O)=O)=C3C2=CC=CC3=C1 MLYDUNKGAQLZAO-UHFFFAOYSA-N 0.000 description 2
- PBIUDEUWYGBHDW-UHFFFAOYSA-N 2-chloro-1-pyridin-3-ylethanone;hydrochloride Chemical compound Cl.ClCC(=O)C1=CC=CN=C1 PBIUDEUWYGBHDW-UHFFFAOYSA-N 0.000 description 2
- 208000006820 Arthralgia Diseases 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 2
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 150000008064 anhydrides Chemical class 0.000 description 2
- 238000005282 brightening Methods 0.000 description 2
- 239000003638 chemical reducing agent Substances 0.000 description 2
- CGIGDMFJXJATDK-UHFFFAOYSA-N indomethacin Chemical compound CC1=C(CC(O)=O)C2=CC(OC)=CC=C2N1C(=O)C1=CC=C(Cl)C=C1 CGIGDMFJXJATDK-UHFFFAOYSA-N 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 2
- 230000003287 optical effect Effects 0.000 description 2
- 150000003053 piperidines Chemical class 0.000 description 2
- 239000003495 polar organic solvent Substances 0.000 description 2
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- MKJIEFSOBYUXJB-HOCLYGCPSA-N (3S,11bS)-9,10-dimethoxy-3-isobutyl-1,3,4,6,7,11b-hexahydro-2H-pyrido[2,1-a]isoquinolin-2-one Chemical compound C1CN2C[C@H](CC(C)C)C(=O)C[C@H]2C2=C1C=C(OC)C(OC)=C2 MKJIEFSOBYUXJB-HOCLYGCPSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- IBODDUNKEPPBKW-UHFFFAOYSA-N 1,5-dibromopentane Chemical group BrCCCCCBr IBODDUNKEPPBKW-UHFFFAOYSA-N 0.000 description 1
- SGRHVVLXEBNBDV-UHFFFAOYSA-N 1,6-dibromohexane Chemical group BrCCCCCCBr SGRHVVLXEBNBDV-UHFFFAOYSA-N 0.000 description 1
- XLNYKKLAKBFEIP-UHFFFAOYSA-N 2-(5-bromopentyl)benzo[de]isoquinoline-1,3-dione Chemical compound C1=CC(C(N(CCCCCBr)C2=O)=O)=C3C2=CC=CC3=C1 XLNYKKLAKBFEIP-UHFFFAOYSA-N 0.000 description 1
- 125000005273 2-acetoxybenzoic acid group Chemical group 0.000 description 1
- 125000004182 2-chlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(*)C([H])=C1[H] 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- 125000004179 3-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(Cl)=C1[H] 0.000 description 1
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 1
- LIEGIQPEUGHGAI-UHFFFAOYSA-N 4-phenylpiperidine-2,6-dione Chemical class C1C(=O)NC(=O)CC1C1=CC=CC=C1 LIEGIQPEUGHGAI-UHFFFAOYSA-N 0.000 description 1
- 125000000339 4-pyridyl group Chemical group N1=C([H])C([H])=C([*])C([H])=C1[H] 0.000 description 1
- COVZYZSDYWQREU-UHFFFAOYSA-N Busulfan Chemical compound CS(=O)(=O)OCCCCOS(C)(=O)=O COVZYZSDYWQREU-UHFFFAOYSA-N 0.000 description 1
- 241000282472 Canis lupus familiaris Species 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 206010015995 Eyelid ptosis Diseases 0.000 description 1
- 241000282326 Felis catus Species 0.000 description 1
- 206010023230 Joint stiffness Diseases 0.000 description 1
- 206010023232 Joint swelling Diseases 0.000 description 1
- 239000012359 Methanesulfonyl chloride Substances 0.000 description 1
- 241000699670 Mus sp. Species 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- 229930040373 Paraformaldehyde Natural products 0.000 description 1
- WUGQZFFCHPXWKQ-UHFFFAOYSA-N Propanolamine Chemical compound NCCCO WUGQZFFCHPXWKQ-UHFFFAOYSA-N 0.000 description 1
- 241000700159 Rattus Species 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 229960000836 amitriptyline Drugs 0.000 description 1
- KRMDCWKBEZIMAB-UHFFFAOYSA-N amitriptyline Chemical compound C1CC2=CC=CC=C2C(=CCCN(C)C)C2=CC=CC=C21 KRMDCWKBEZIMAB-UHFFFAOYSA-N 0.000 description 1
- 230000003444 anaesthetic effect Effects 0.000 description 1
- 230000000202 analgesic effect Effects 0.000 description 1
- 150000001450 anions Chemical class 0.000 description 1
- 230000000844 anti-bacterial effect Effects 0.000 description 1
- 230000000842 anti-protozoal effect Effects 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid group Chemical group C(C1=CC=CC=C1)(=O)O WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 210000003169 central nervous system Anatomy 0.000 description 1
- 238000013329 compounding Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 125000004093 cyano group Chemical group *C#N 0.000 description 1
- HCAJEUSONLESMK-UHFFFAOYSA-N cyclohexylsulfamic acid Chemical compound OS(=O)(=O)NC1CCCCC1 HCAJEUSONLESMK-UHFFFAOYSA-N 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 239000002552 dosage form Substances 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 125000004705 ethylthio group Chemical group C(C)S* 0.000 description 1
- 239000000796 flavoring agent Substances 0.000 description 1
- 235000019634 flavors Nutrition 0.000 description 1
- 239000006081 fluorescent whitening agent Substances 0.000 description 1
- 239000013505 freshwater Substances 0.000 description 1
- 150000002430 hydrocarbons Chemical group 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 229910000043 hydrogen iodide Inorganic materials 0.000 description 1
- 150000003949 imides Chemical class 0.000 description 1
- 238000000338 in vitro Methods 0.000 description 1
- 229960000905 indomethacin Drugs 0.000 description 1
- 239000002198 insoluble material Substances 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 239000010410 layer Substances 0.000 description 1
- 125000000040 m-tolyl group Chemical group [H]C1=C([H])C(*)=C([H])C(=C1[H])C([H])([H])[H] 0.000 description 1
- UKWHYYKOEPRTIC-UHFFFAOYSA-N mercury(ii) oxide Chemical compound [Hg]=O UKWHYYKOEPRTIC-UHFFFAOYSA-N 0.000 description 1
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 1
- WSFSSNUMVMOOMR-NJFSPNSNSA-N methanone Chemical compound O=[14CH2] WSFSSNUMVMOOMR-NJFSPNSNSA-N 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- MRGZFRXUOCSAPS-UHFFFAOYSA-N n-[1-[2-(1,3-dioxobenzo[de]isoquinolin-2-yl)ethyl]piperidin-4-yl]-n-phenylpropanamide Chemical compound C1CN(CCN2C(C=3C=CC=C4C=CC=C(C=34)C2=O)=O)CCC1N(C(=O)CC)C1=CC=CC=C1 MRGZFRXUOCSAPS-UHFFFAOYSA-N 0.000 description 1
- 230000000701 neuroleptic effect Effects 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 125000003261 o-tolyl group Chemical group [H]C1=C([H])C(*)=C(C([H])=C1[H])C([H])([H])[H] 0.000 description 1
- 239000006186 oral dosage form Substances 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- 125000001037 p-tolyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- 229920002866 paraformaldehyde Polymers 0.000 description 1
- 239000006201 parenteral dosage form Substances 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- 230000003285 pharmacodynamic effect Effects 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 229960002895 phenylbutazone Drugs 0.000 description 1
- VYMDGNCVAMGZFE-UHFFFAOYSA-N phenylbutazonum Chemical compound O=C1C(CCCC)C(=O)N(C=2C=CC=CC=2)N1C1=CC=CC=C1 VYMDGNCVAMGZFE-UHFFFAOYSA-N 0.000 description 1
- 125000004482 piperidin-4-yl group Chemical group N1CCC(CC1)* 0.000 description 1
- 230000001376 precipitating effect Effects 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- 230000002335 preservative effect Effects 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 201000003004 ptosis Diseases 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
- 206010039073 rheumatoid arthritis Diseases 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 229960005333 tetrabenazine Drugs 0.000 description 1
- HFRXJVQOXRXOPP-UHFFFAOYSA-N thionyl bromide Chemical compound BrS(Br)=O HFRXJVQOXRXOPP-UHFFFAOYSA-N 0.000 description 1
- 239000003981 vehicle Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D221/00—Heterocyclic compounds containing six-membered rings having one nitrogen atom as the only ring hetero atom, not provided for by groups C07D211/00 - C07D219/00
- C07D221/02—Heterocyclic compounds containing six-membered rings having one nitrogen atom as the only ring hetero atom, not provided for by groups C07D211/00 - C07D219/00 condensed with carbocyclic rings or ring systems
- C07D221/04—Ortho- or peri-condensed ring systems
- C07D221/06—Ring systems of three rings
- C07D221/14—Aza-phenalenes, e.g. 1,8-naphthalimide
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/06—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings linked by a carbon chain containing only aliphatic carbon atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Plural Heterocyclic Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Hydrogenated Pyridines (AREA)
- Other In-Based Heterocyclic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/538,977 US3959286A (en) | 1975-01-06 | 1975-01-06 | N-(1-(1,3-Dihydro-1,3-dioxo-2H-benz(de)-isoquinolin-2-yl)alkyl)-4-N-piperidinyl)-n-phenylalkylamides |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1070311A true CA1070311A (en) | 1980-01-22 |
Family
ID=24149234
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA241,199A Expired CA1070311A (en) | 1975-01-06 | 1975-12-08 | N-(1-((1,3-dihydro-1,3-dioxo-2h-benz(de) isoquinolin-2-yl)-alkyl)-4-piperidinyl)-n-phenylalkylamides |
Country Status (16)
| Country | Link |
|---|---|
| US (1) | US3959286A (enExample) |
| JP (1) | JPS5191271A (enExample) |
| BE (1) | BE837333A (enExample) |
| CA (1) | CA1070311A (enExample) |
| CH (1) | CH620210A5 (enExample) |
| DE (1) | DE2558023A1 (enExample) |
| DK (1) | DK2176A (enExample) |
| FR (1) | FR2296417A1 (enExample) |
| GB (1) | GB1528790A (enExample) |
| HU (1) | HU172542B (enExample) |
| IE (1) | IE43651B1 (enExample) |
| NL (1) | NL7514918A (enExample) |
| NO (1) | NO143744C (enExample) |
| PH (1) | PH11443A (enExample) |
| SE (1) | SE7600046L (enExample) |
| ZA (1) | ZA757671B (enExample) |
Families Citing this family (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4070465A (en) * | 1976-06-24 | 1978-01-24 | E. R. Squibb & Sons, Inc. | Various 2-(substituted piperazinyl)-1H-benz [de]isoquinoline-1,3 (2H) -diones |
| US4062953A (en) * | 1976-06-24 | 1977-12-13 | E. R. Squibb & Sons, Inc. | Various 2-substituted-1H-benz[de]isoquinoline-1,3(2H)-diones |
| US4051246A (en) * | 1976-09-29 | 1977-09-27 | E. R. Squibb & Sons, Inc. | 2-substituted-1h-benz(de)-isoquinoline-1,3-(2h)-diones |
| US4180579A (en) * | 1976-09-29 | 1979-12-25 | E. R. Squibb & Sons, Inc. | 2-Substituted-1H-benz[de]-isoquinoline-1,3(2H)-diones |
| US4115555A (en) * | 1976-09-29 | 1978-09-19 | E. R. Squibb & Sons, Inc. | 2-Substituted-1H-benz[de]-isoquinoline-1,3(2H)-diones |
| US4170651A (en) * | 1976-09-29 | 1979-10-09 | E. R. Squibb & Sons, Inc. | 2-Substituted-1H-benz-[de]-isoquinoline-1,3(2H)-diones |
| FR2673944B1 (fr) * | 1991-03-13 | 1995-03-10 | Sanofi Elf | Derives de l'1,8-naphtalimide, leur procede de preparation et les compositions pharmaceutiques les contenant. |
| US5235045A (en) * | 1992-03-19 | 1993-08-10 | Microbiomed Corporation | Non-azo naphthalimide dyes |
| US5766600A (en) * | 1993-08-09 | 1998-06-16 | Microbiomed Corporation | Non-azo naphtalimide dyes and uses for same |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3625947A (en) * | 1957-01-30 | 1971-12-07 | Nippon Kayaku Kk | N heterocyclic ethyl naphthalimides |
| CH439286A (de) * | 1962-04-10 | 1967-07-15 | Ciba Geigy | Verfahren zur Herstellung neuer Piperidin-Verbindungen |
-
1975
- 1975-01-06 US US05/538,977 patent/US3959286A/en not_active Expired - Lifetime
- 1975-12-08 ZA ZA757671A patent/ZA757671B/xx unknown
- 1975-12-08 CA CA241,199A patent/CA1070311A/en not_active Expired
- 1975-12-16 PH PH17879A patent/PH11443A/en unknown
- 1975-12-22 IE IE2800/75A patent/IE43651B1/en unknown
- 1975-12-22 DE DE19752558023 patent/DE2558023A1/de not_active Withdrawn
- 1975-12-22 NL NL7514918A patent/NL7514918A/xx not_active Application Discontinuation
- 1975-12-22 GB GB52420/75A patent/GB1528790A/en not_active Expired
- 1975-12-23 CH CH1673875A patent/CH620210A5/de not_active IP Right Cessation
-
1976
- 1976-01-05 SE SE7600046A patent/SE7600046L/xx unknown
- 1976-01-05 DK DK2176*#A patent/DK2176A/da unknown
- 1976-01-05 NO NO760025A patent/NO143744C/no unknown
- 1976-01-05 HU HU76SU00000909A patent/HU172542B/hu unknown
- 1976-01-06 FR FR7600191A patent/FR2296417A1/fr active Granted
- 1976-01-06 JP JP51001372A patent/JPS5191271A/ja active Pending
- 1976-01-06 BE BE163331A patent/BE837333A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| FR2296417A1 (fr) | 1976-07-30 |
| IE43651B1 (en) | 1981-04-22 |
| US3959286A (en) | 1976-05-25 |
| HU172542B (hu) | 1978-09-28 |
| FR2296417B1 (enExample) | 1978-08-18 |
| NO143744B (no) | 1980-12-29 |
| PH11443A (en) | 1978-02-01 |
| GB1528790A (en) | 1978-10-18 |
| IE43651L (en) | 1976-07-06 |
| DK2176A (da) | 1976-07-07 |
| NO143744C (no) | 1981-04-08 |
| NO760025L (enExample) | 1976-07-07 |
| SE7600046L (sv) | 1976-07-07 |
| NL7514918A (nl) | 1976-07-08 |
| AU8753575A (en) | 1977-06-23 |
| JPS5191271A (en) | 1976-08-10 |
| ZA757671B (en) | 1976-11-24 |
| BE837333A (fr) | 1976-07-06 |
| DE2558023A1 (de) | 1976-07-15 |
| CH620210A5 (enExample) | 1980-11-14 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3940398A (en) | 2-[[4-(Azine or diazine or triazine)-1-piperazinyl]alkyl]-1H-benz[de]isoquinoline-1,3(2H)-diones | |
| US3299078A (en) | Pyrido [3', 4': 4, 5] pyrrolo [3, 2, 1-hi] indoles and-[3, 2, 1-ij] quinolines | |
| FI96768C (fi) | Menetelmä valmistaa farmakologisesti arvokasta bentso/5,6/sykloheptapyridiiniä | |
| US4556653A (en) | Pyrido[1,5]benzodiazepinone derivatives and pharmacological activities thereof | |
| BG60270B2 (bg) | Метод за получаване на 5н-2,3-бензодиазепинови производни | |
| US3935227A (en) | 2-[(Substituted-piperidinyl or tetrahydropyridinyl)alkyl]-1H-benz[de]isoquinoline-1,3(2H)-diones | |
| CA1070311A (en) | N-(1-((1,3-dihydro-1,3-dioxo-2h-benz(de) isoquinolin-2-yl)-alkyl)-4-piperidinyl)-n-phenylalkylamides | |
| US3996363A (en) | 2-[(4-Oxo-1-phenyl-1,3,8-triazaspiro[4.5]decan-8-yl)alkyl]-1H-benz[de]isoquinolin-1,3(2H)-diones | |
| US3947452A (en) | 2-[(Dihydroisoquinolinyl or dihydroisoindol-2-yl)alkyl]-1H-benz[de]isoquinoline-1,3(2H)-diones | |
| US4434171A (en) | Dibenzazepine derivatives, pharmaceutical compositions containing them, and pharmaceutical methods using them | |
| US3940397A (en) | 2-[(Substituted-piperazinyl)alkyl]-1H-benz[de]isoquinoline-1,3(2H)-diones | |
| US3996362A (en) | 2-[[4-(2,3-Dihydro-2-oxo-1H-benzimidazol-1-yl)-1-(piperidinyl or 1,2,3,6-tetrahydro-1-pyridinyl)]alkyl]-1H-benz[de]isoquinoline-1,3(2H)-diones | |
| US5441956A (en) | Hydroisoquinoline derivatives | |
| US5502051A (en) | 3-aminopyrroles, methods for their synthesis and for their pharmaceutical use | |
| US4007191A (en) | 2-(Piperidinyl or tetrahydropyridinyl)-alkyl)-2,3-dihydro-3-hydroxy-1H-benz(DE)isoquinolin-1-ones | |
| US4062953A (en) | Various 2-substituted-1H-benz[de]isoquinoline-1,3(2H)-diones | |
| US4291042A (en) | Antidepressant piperidine derivatives | |
| US4057560A (en) | 1,2,2A,3,4,5 Hexahydrobenz[c,d]indol-1-yl-2-guanidines | |
| GB2044254A (en) | Novel piperidine derivatives | |
| US4070465A (en) | Various 2-(substituted piperazinyl)-1H-benz [de]isoquinoline-1,3 (2H) -diones | |
| US6057340A (en) | Oxazole derivatives as serotonin-1A receptor agonists | |
| US4125538A (en) | Substituted 5-phenyl-2,3,4,5-tetrahydro-1,4-benzoxazepines | |
| JPH05247052A (ja) | N−アルキルグルタールイミドの4−(4−ピペリジニル)−チエノ〔3,2−c〕ピリジン誘導体 | |
| EP0743946A1 (en) | 5ht2b receptor antagonists condensed indoles | |
| US3575984A (en) | 1-r-3,4-dihydro-4-methyl-4-phenyl-6-chloro-carbostyrils |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |