CA1067077A - Process for the manufacture of cyclic-substituted derivatives of 1-amino-2-propanol - Google Patents
Process for the manufacture of cyclic-substituted derivatives of 1-amino-2-propanolInfo
- Publication number
- CA1067077A CA1067077A CA226,694A CA226694A CA1067077A CA 1067077 A CA1067077 A CA 1067077A CA 226694 A CA226694 A CA 226694A CA 1067077 A CA1067077 A CA 1067077A
- Authority
- CA
- Canada
- Prior art keywords
- denotes
- formula
- compound
- lower alkyl
- substituted
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title claims description 107
- 230000008569 process Effects 0.000 title claims description 101
- 238000004519 manufacturing process Methods 0.000 title claims description 8
- HXKKHQJGJAFBHI-UHFFFAOYSA-N 1-aminopropan-2-ol Chemical class CC(O)CN HXKKHQJGJAFBHI-UHFFFAOYSA-N 0.000 title claims 2
- 150000001875 compounds Chemical class 0.000 claims abstract description 101
- 150000003839 salts Chemical class 0.000 claims abstract description 64
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 39
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims abstract description 37
- 125000004076 pyridyl group Chemical group 0.000 claims abstract description 15
- 229910052757 nitrogen Inorganic materials 0.000 claims abstract description 14
- 239000003795 chemical substances by application Substances 0.000 claims abstract description 12
- 125000004433 nitrogen atom Chemical group N* 0.000 claims abstract description 11
- 125000002947 alkylene group Chemical group 0.000 claims abstract description 7
- 125000004430 oxygen atom Chemical group O* 0.000 claims abstract description 7
- 125000000217 alkyl group Chemical group 0.000 claims description 59
- 239000001257 hydrogen Substances 0.000 claims description 56
- 229910052739 hydrogen Inorganic materials 0.000 claims description 56
- 239000000203 mixture Substances 0.000 claims description 56
- 230000002829 reductive effect Effects 0.000 claims description 49
- 239000003054 catalyst Substances 0.000 claims description 48
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 43
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 42
- -1 N-methylcarbamoyl Chemical group 0.000 claims description 42
- 239000002253 acid Substances 0.000 claims description 40
- 239000007858 starting material Substances 0.000 claims description 37
- 229910052736 halogen Inorganic materials 0.000 claims description 30
- 150000002367 halogens Chemical class 0.000 claims description 30
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical group [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 claims description 23
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 claims description 23
- 239000002904 solvent Substances 0.000 claims description 23
- 125000003545 alkoxy group Chemical group 0.000 claims description 22
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 17
- 125000000714 pyrimidinyl group Chemical group 0.000 claims description 15
- 229910052783 alkali metal Inorganic materials 0.000 claims description 14
- 125000005115 alkyl carbamoyl group Chemical group 0.000 claims description 14
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 14
- 125000003373 pyrazinyl group Chemical group 0.000 claims description 14
- 150000002431 hydrogen Chemical class 0.000 claims description 11
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 11
- 125000003302 alkenyloxy group Chemical group 0.000 claims description 10
- 239000003638 chemical reducing agent Substances 0.000 claims description 9
- 229910000510 noble metal Inorganic materials 0.000 claims description 9
- 230000003287 optical effect Effects 0.000 claims description 9
- 150000001340 alkali metals Chemical class 0.000 claims description 8
- 239000012279 sodium borohydride Substances 0.000 claims description 8
- 229910000033 sodium borohydride Inorganic materials 0.000 claims description 8
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical group [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 7
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 7
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 7
- 239000000460 chlorine Chemical group 0.000 claims description 7
- 229910052801 chlorine Chemical group 0.000 claims description 7
- 125000003700 epoxy group Chemical group 0.000 claims description 7
- 229910001385 heavy metal Inorganic materials 0.000 claims description 7
- 239000011877 solvent mixture Substances 0.000 claims description 6
- 125000005336 allyloxy group Chemical group 0.000 claims description 5
- 239000012442 inert solvent Substances 0.000 claims description 5
- 150000007529 inorganic bases Chemical class 0.000 claims description 5
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 5
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 claims description 5
- 125000004043 oxo group Chemical group O=* 0.000 claims description 5
- 125000001118 alkylidene group Chemical group 0.000 claims description 4
- UORVGPXVDQYIDP-UHFFFAOYSA-N borane Chemical compound B UORVGPXVDQYIDP-UHFFFAOYSA-N 0.000 claims description 4
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 4
- QWPPOHNGKGFGJK-UHFFFAOYSA-N hypochlorous acid Chemical compound ClO QWPPOHNGKGFGJK-UHFFFAOYSA-N 0.000 claims description 4
- 125000000464 thioxo group Chemical group S=* 0.000 claims description 4
- 125000004429 atom Chemical group 0.000 claims description 3
- 229910052799 carbon Inorganic materials 0.000 claims description 3
- 239000000126 substance Substances 0.000 claims description 3
- 125000004391 aryl sulfonyl group Chemical group 0.000 claims description 2
- 125000004122 cyclic group Chemical group 0.000 claims description 2
- 101100490437 Mus musculus Acvrl1 gene Proteins 0.000 claims 5
- 229910000091 aluminium hydride Inorganic materials 0.000 claims 4
- 125000005843 halogen group Chemical group 0.000 claims 4
- 229910010277 boron hydride Inorganic materials 0.000 claims 3
- 239000008280 blood Substances 0.000 abstract description 4
- 210000004369 blood Anatomy 0.000 abstract description 4
- 230000000304 vasodilatating effect Effects 0.000 abstract description 3
- 230000000903 blocking effect Effects 0.000 abstract description 2
- 230000004531 blood pressure lowering effect Effects 0.000 abstract description 2
- 206010002383 Angina Pectoris Diseases 0.000 abstract 1
- 206010003119 arrhythmia Diseases 0.000 abstract 1
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 110
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 87
- 239000000243 solution Substances 0.000 description 86
- 229960004592 isopropanol Drugs 0.000 description 85
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 78
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 72
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 60
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 53
- 238000002844 melting Methods 0.000 description 50
- 230000008018 melting Effects 0.000 description 50
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 48
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 43
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 33
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 29
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 27
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 27
- 239000011541 reaction mixture Substances 0.000 description 27
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 24
- 229960004756 ethanol Drugs 0.000 description 23
- 235000019441 ethanol Nutrition 0.000 description 23
- 238000001704 evaporation Methods 0.000 description 21
- 238000006243 chemical reaction Methods 0.000 description 20
- 239000000155 melt Substances 0.000 description 19
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 18
- 235000011167 hydrochloric acid Nutrition 0.000 description 18
- 229960000443 hydrochloric acid Drugs 0.000 description 18
- 230000007935 neutral effect Effects 0.000 description 17
- 238000003756 stirring Methods 0.000 description 17
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 16
- 238000001816 cooling Methods 0.000 description 16
- 238000010992 reflux Methods 0.000 description 16
- 239000001530 fumaric acid Substances 0.000 description 14
- 238000001953 recrystallisation Methods 0.000 description 14
- 239000000725 suspension Substances 0.000 description 14
- 230000008020 evaporation Effects 0.000 description 13
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 12
- 239000012312 sodium hydride Substances 0.000 description 12
- 229910000104 sodium hydride Inorganic materials 0.000 description 12
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 11
- 238000002425 crystallisation Methods 0.000 description 11
- 238000001914 filtration Methods 0.000 description 11
- 239000011570 nicotinamide Substances 0.000 description 11
- 239000000047 product Substances 0.000 description 11
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 10
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 10
- 239000000706 filtrate Substances 0.000 description 10
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 10
- 238000000746 purification Methods 0.000 description 10
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 9
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 9
- KFUSXMDYOPXKKT-UHFFFAOYSA-N 2-[(2-methylphenoxy)methyl]oxirane Chemical compound CC1=CC=CC=C1OCC1OC1 KFUSXMDYOPXKKT-UHFFFAOYSA-N 0.000 description 8
- 239000002585 base Substances 0.000 description 8
- 229910052938 sodium sulfate Inorganic materials 0.000 description 8
- 235000011152 sodium sulphate Nutrition 0.000 description 8
- 229920002261 Corn starch Polymers 0.000 description 7
- 235000019759 Maize starch Nutrition 0.000 description 7
- 238000009835 boiling Methods 0.000 description 7
- 230000000875 corresponding effect Effects 0.000 description 7
- 230000000694 effects Effects 0.000 description 7
- 239000000463 material Substances 0.000 description 7
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 6
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 6
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 6
- 238000006722 reduction reaction Methods 0.000 description 6
- 238000010792 warming Methods 0.000 description 6
- VIHUZJYFQOEUMI-UHFFFAOYSA-N 3-Hydroxypicolinamide Chemical compound NC(=O)C1=NC=CC=C1O VIHUZJYFQOEUMI-UHFFFAOYSA-N 0.000 description 5
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 5
- 241000282326 Felis catus Species 0.000 description 5
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 5
- 239000005662 Paraffin oil Substances 0.000 description 5
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 5
- 239000008346 aqueous phase Substances 0.000 description 5
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 5
- 229910052794 bromium Inorganic materials 0.000 description 5
- 239000000284 extract Substances 0.000 description 5
- 239000012458 free base Substances 0.000 description 5
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 5
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 5
- 239000008101 lactose Substances 0.000 description 5
- 235000019359 magnesium stearate Nutrition 0.000 description 5
- 239000012074 organic phase Substances 0.000 description 5
- 239000003208 petroleum Substances 0.000 description 5
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 5
- 235000017557 sodium bicarbonate Nutrition 0.000 description 5
- 125000001424 substituent group Chemical group 0.000 description 5
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 4
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 4
- 229960000583 acetic acid Drugs 0.000 description 4
- 150000007513 acids Chemical class 0.000 description 4
- 239000007864 aqueous solution Substances 0.000 description 4
- HUMNYLRZRPPJDN-UHFFFAOYSA-N benzaldehyde Chemical compound O=CC1=CC=CC=C1 HUMNYLRZRPPJDN-UHFFFAOYSA-N 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 4
- 238000002360 preparation method Methods 0.000 description 4
- 229910052708 sodium Inorganic materials 0.000 description 4
- 239000011734 sodium Substances 0.000 description 4
- BDHFUVZGWQCTTF-UHFFFAOYSA-N sulfonic acid Chemical compound OS(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-N 0.000 description 4
- 239000000454 talc Substances 0.000 description 4
- 229910052623 talc Inorganic materials 0.000 description 4
- JWZZKOKVBUJMES-UHFFFAOYSA-N (+-)-Isoprenaline Chemical compound CC(C)NCC(O)C1=CC=C(O)C(O)=C1 JWZZKOKVBUJMES-UHFFFAOYSA-N 0.000 description 3
- NKDFARJXOCAEDZ-UHFFFAOYSA-N 2-(3-methylpyrazin-2-yl)oxyethanamine Chemical compound CC1=NC=CN=C1OCCN NKDFARJXOCAEDZ-UHFFFAOYSA-N 0.000 description 3
- FYEKJXSXDASODO-UHFFFAOYSA-N 2-chloro-3-(oxiran-2-ylmethoxy)pyrazine Chemical compound ClC1=NC=CN=C1OCC1OC1 FYEKJXSXDASODO-UHFFFAOYSA-N 0.000 description 3
- TZMQQXLELUHHOU-UHFFFAOYSA-N 2-methyl-3-(oxiran-2-ylmethoxy)pyrazine Chemical compound CC1=NC=CN=C1OCC1OC1 TZMQQXLELUHHOU-UHFFFAOYSA-N 0.000 description 3
- UVEJCSRBCJCNQP-UHFFFAOYSA-N 6-[2-[[2-hydroxy-3-(2-methylphenoxy)propyl]amino]ethoxy]pyridine-3-carboxamide Chemical compound CC1=CC=CC=C1OCC(O)CNCCOC1=CC=C(C(N)=O)C=N1 UVEJCSRBCJCNQP-UHFFFAOYSA-N 0.000 description 3
- 239000007868 Raney catalyst Substances 0.000 description 3
- 229910000564 Raney nickel Inorganic materials 0.000 description 3
- 229920002472 Starch Polymers 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 239000013543 active substance Substances 0.000 description 3
- 125000001931 aliphatic group Chemical group 0.000 description 3
- 125000003118 aryl group Chemical group 0.000 description 3
- 239000007795 chemical reaction product Substances 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 239000008119 colloidal silica Substances 0.000 description 3
- 239000013078 crystal Substances 0.000 description 3
- 239000006185 dispersion Substances 0.000 description 3
- 238000001035 drying Methods 0.000 description 3
- 239000012259 ether extract Substances 0.000 description 3
- 239000013067 intermediate product Substances 0.000 description 3
- 229940039009 isoproterenol Drugs 0.000 description 3
- 150000007522 mineralic acids Chemical class 0.000 description 3
- 150000007524 organic acids Chemical class 0.000 description 3
- MUBZPKHOEPUJKR-UHFFFAOYSA-M oxalate(1-) Chemical compound OC(=O)C([O-])=O MUBZPKHOEPUJKR-UHFFFAOYSA-M 0.000 description 3
- 235000006408 oxalic acid Nutrition 0.000 description 3
- 239000000825 pharmaceutical preparation Substances 0.000 description 3
- 229910000027 potassium carbonate Inorganic materials 0.000 description 3
- 229960005335 propanol Drugs 0.000 description 3
- 239000000741 silica gel Substances 0.000 description 3
- 229910002027 silica gel Inorganic materials 0.000 description 3
- 241000894007 species Species 0.000 description 3
- 235000019698 starch Nutrition 0.000 description 3
- 238000005303 weighing Methods 0.000 description 3
- SFLSHLFXELFNJZ-QMMMGPOBSA-N (-)-norepinephrine Chemical compound NC[C@H](O)C1=CC=C(O)C(O)=C1 SFLSHLFXELFNJZ-QMMMGPOBSA-N 0.000 description 2
- BJEPYKJPYRNKOW-REOHCLBHSA-N (S)-malic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O BJEPYKJPYRNKOW-REOHCLBHSA-N 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- FYVLUTGHOXDQCV-UHFFFAOYSA-N 1-(2-methylphenoxy)-3-[2-(3-methylpyrazin-2-yl)oxyethylamino]propan-2-ol Chemical compound CC1=CC=CC=C1OCC(O)CNCCOC1=NC=CN=C1C FYVLUTGHOXDQCV-UHFFFAOYSA-N 0.000 description 2
- ISIQEWJJVXFCDP-UHFFFAOYSA-N 1-(2-methylphenoxy)propan-2-ol Chemical compound CC(O)COC1=CC=CC=C1C ISIQEWJJVXFCDP-UHFFFAOYSA-N 0.000 description 2
- DCDIHBLJGGSTDX-UHFFFAOYSA-N 1-amino-3-(3-methylpyridin-2-yl)oxypropan-2-ol Chemical compound CC1=CC=CN=C1OCC(O)CN DCDIHBLJGGSTDX-UHFFFAOYSA-N 0.000 description 2
- RRFOGRQKYGRJPN-UHFFFAOYSA-N 1-amino-3-(3-methylpyridin-2-yl)oxypropan-2-ol;hydrochloride Chemical compound Cl.CC1=CC=CN=C1OCC(O)CN RRFOGRQKYGRJPN-UHFFFAOYSA-N 0.000 description 2
- SIJBDWPVNAYVGY-UHFFFAOYSA-N 2,2-dimethyl-1,3-dioxolane Chemical compound CC1(C)OCCO1 SIJBDWPVNAYVGY-UHFFFAOYSA-N 0.000 description 2
- HDOCYUANOWIHAQ-UHFFFAOYSA-N 2-(2-aminoethoxy)benzamide Chemical compound NCCOC1=CC=CC=C1C(N)=O HDOCYUANOWIHAQ-UHFFFAOYSA-N 0.000 description 2
- ZKCNSDNDFKYRTA-UHFFFAOYSA-N 2-(2-bromoethoxy)benzamide Chemical compound NC(=O)C1=CC=CC=C1OCCBr ZKCNSDNDFKYRTA-UHFFFAOYSA-N 0.000 description 2
- JIDHEIXSIHNMCG-UHFFFAOYSA-N 2-(benzylamino)-2-methylpropan-1-ol Chemical compound OCC(C)(C)NCC1=CC=CC=C1 JIDHEIXSIHNMCG-UHFFFAOYSA-N 0.000 description 2
- DQYXPCPADNUWJT-UHFFFAOYSA-N 2-[(2-ethoxy-2-methyl-1,3-dioxolan-4-yl)methoxy]-3-methylpyrazine Chemical compound O1C(OCC)(C)OCC1COC1=NC=CN=C1C DQYXPCPADNUWJT-UHFFFAOYSA-N 0.000 description 2
- SAZKPTPRKMLMSG-UHFFFAOYSA-N 2-[2-[[2-hydroxy-3-(2-methylphenoxy)propyl]amino]ethoxy]pyridine-3-carboxamide Chemical compound CC1=CC=CC=C1OCC(O)CNCCOC1=NC=CC=C1C(N)=O SAZKPTPRKMLMSG-UHFFFAOYSA-N 0.000 description 2
- PZSISEFPCYMBDL-UHFFFAOYSA-N 2-bromo-3-methylpyridine Chemical compound CC1=CC=CN=C1Br PZSISEFPCYMBDL-UHFFFAOYSA-N 0.000 description 2
- MRRMFCNHHZHCMM-UHFFFAOYSA-N 2-chloro-3-[(2-ethoxy-2-methyl-1,3-dioxolan-4-yl)methoxy]pyrazine Chemical compound O1C(OCC)(C)OCC1COC1=NC=CN=C1Cl MRRMFCNHHZHCMM-UHFFFAOYSA-N 0.000 description 2
- WZHWPZQQPWKEAV-UHFFFAOYSA-N 2-chloro-3-methylpyrazine Chemical compound CC1=NC=CN=C1Cl WZHWPZQQPWKEAV-UHFFFAOYSA-N 0.000 description 2
- UNCQVRBWJWWJBF-UHFFFAOYSA-N 2-chloropyrimidine Chemical compound ClC1=NC=CC=N1 UNCQVRBWJWWJBF-UHFFFAOYSA-N 0.000 description 2
- NAENJVWHLUPNHZ-UHFFFAOYSA-N 3-(2-oxopropoxy)pyridine-2-carboxamide Chemical compound CC(=O)COC1=CC=CN=C1C(N)=O NAENJVWHLUPNHZ-UHFFFAOYSA-N 0.000 description 2
- DUBWHKSGOHZFFK-UHFFFAOYSA-N 3-(3-chloropyrazin-2-yl)oxypropane-1,2-diol Chemical compound OCC(O)COC1=NC=CN=C1Cl DUBWHKSGOHZFFK-UHFFFAOYSA-N 0.000 description 2
- MHIAMONBYDFGFO-UHFFFAOYSA-N 4-(2-aminoethoxy)benzamide Chemical compound NCCOC1=CC=C(C(N)=O)C=C1 MHIAMONBYDFGFO-UHFFFAOYSA-N 0.000 description 2
- RQHBSEWZMFOQQJ-UHFFFAOYSA-N 4-(2-bromoethoxy)benzamide Chemical compound NC(=O)C1=CC=C(OCCBr)C=C1 RQHBSEWZMFOQQJ-UHFFFAOYSA-N 0.000 description 2
- QXSAKPUBHTZHKW-UHFFFAOYSA-N 4-hydroxybenzamide Chemical compound NC(=O)C1=CC=C(O)C=C1 QXSAKPUBHTZHKW-UHFFFAOYSA-N 0.000 description 2
- WCESOECGMFLELS-UHFFFAOYSA-N 6-(2-amino-3-phenylpropoxy)pyridine-3-carboxamide Chemical compound C=1C=CC=CC=1CC(N)COC1=CC=C(C(N)=O)C=N1 WCESOECGMFLELS-UHFFFAOYSA-N 0.000 description 2
- GMTNUSPOGDLWEZ-UHFFFAOYSA-N 6-(2-aminoethoxy)-n-methylpyridine-3-carboxamide Chemical compound CNC(=O)C1=CC=C(OCCN)N=C1 GMTNUSPOGDLWEZ-UHFFFAOYSA-N 0.000 description 2
- NBTSDQPNGSCDRT-UHFFFAOYSA-N 6-(2-aminoethoxy)pyridine-3-carboxamide Chemical compound NCCOC1=CC=C(C(N)=O)C=N1 NBTSDQPNGSCDRT-UHFFFAOYSA-N 0.000 description 2
- JKYSAFKAVHBPBR-UHFFFAOYSA-N 6-[2-(benzylamino)-2-methylpropoxy]pyridine-3-carboxamide Chemical compound C=1C=CC=CC=1CNC(C)(C)COC1=CC=C(C(N)=O)C=N1 JKYSAFKAVHBPBR-UHFFFAOYSA-N 0.000 description 2
- DEYOMDZKXMQLCF-UHFFFAOYSA-N 6-chloro-n-methylpyridine-3-carboxamide Chemical compound CNC(=O)C1=CC=C(Cl)N=C1 DEYOMDZKXMQLCF-UHFFFAOYSA-N 0.000 description 2
- ZIJAZUBWHAZHPL-UHFFFAOYSA-N 6-chloropyridine-3-carboxamide Chemical compound NC(=O)C1=CC=C(Cl)N=C1 ZIJAZUBWHAZHPL-UHFFFAOYSA-N 0.000 description 2
- 101150101604 ACVR1B gene Proteins 0.000 description 2
- CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Chemical compound OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 2
- 241000700199 Cavia porcellus Species 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- FBPFZTCFMRRESA-KVTDHHQDSA-N D-Mannitol Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-KVTDHHQDSA-N 0.000 description 2
- 239000001828 Gelatine Substances 0.000 description 2
- DHMQDGOQFOQNFH-UHFFFAOYSA-N Glycine Chemical compound NCC(O)=O DHMQDGOQFOQNFH-UHFFFAOYSA-N 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- 229930195725 Mannitol Natural products 0.000 description 2
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 2
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical compound C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- KYQCOXFCLRTKLS-UHFFFAOYSA-N Pyrazine Chemical compound C1=CN=CC=N1 KYQCOXFCLRTKLS-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 2
- 240000008042 Zea mays Species 0.000 description 2
- 235000016383 Zea mays subsp huehuetenangensis Nutrition 0.000 description 2
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 2
- MHPOYPUPCXDZSK-UHFFFAOYSA-N [1-chloro-3-(3-chloropyrazin-2-yl)oxypropan-2-yl] acetate Chemical compound CC(=O)OC(CCl)COC1=NC=CN=C1Cl MHPOYPUPCXDZSK-UHFFFAOYSA-N 0.000 description 2
- 125000002252 acyl group Chemical group 0.000 description 2
- BJEPYKJPYRNKOW-UHFFFAOYSA-N alpha-hydroxysuccinic acid Natural products OC(=O)C(O)CC(O)=O BJEPYKJPYRNKOW-UHFFFAOYSA-N 0.000 description 2
- 125000003277 amino group Chemical group 0.000 description 2
- RWZYAGGXGHYGMB-UHFFFAOYSA-N anthranilic acid Chemical compound NC1=CC=CC=C1C(O)=O RWZYAGGXGHYGMB-UHFFFAOYSA-N 0.000 description 2
- 239000007900 aqueous suspension Substances 0.000 description 2
- 230000004872 arterial blood pressure Effects 0.000 description 2
- 239000012298 atmosphere Substances 0.000 description 2
- 229940095076 benzaldehyde Drugs 0.000 description 2
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 2
- 230000000747 cardiac effect Effects 0.000 description 2
- BULLHNJGPPOUOX-UHFFFAOYSA-N chloroacetone Chemical compound CC(=O)CCl BULLHNJGPPOUOX-UHFFFAOYSA-N 0.000 description 2
- IJOOHPMOJXWVHK-UHFFFAOYSA-N chlorotrimethylsilane Chemical compound C[Si](C)(C)Cl IJOOHPMOJXWVHK-UHFFFAOYSA-N 0.000 description 2
- 238000004587 chromatography analysis Methods 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- 230000008030 elimination Effects 0.000 description 2
- 238000003379 elimination reaction Methods 0.000 description 2
- 238000010828 elution Methods 0.000 description 2
- 229920000159 gelatin Polymers 0.000 description 2
- 235000019322 gelatine Nutrition 0.000 description 2
- 239000012362 glacial acetic acid Substances 0.000 description 2
- 239000008187 granular material Substances 0.000 description 2
- 238000005984 hydrogenation reaction Methods 0.000 description 2
- 239000005457 ice water Substances 0.000 description 2
- 239000011261 inert gas Substances 0.000 description 2
- 230000000297 inotrophic effect Effects 0.000 description 2
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 2
- 235000009973 maize Nutrition 0.000 description 2
- 239000001630 malic acid Substances 0.000 description 2
- 235000011090 malic acid Nutrition 0.000 description 2
- 239000000594 mannitol Substances 0.000 description 2
- 235000010355 mannitol Nutrition 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- 150000002736 metal compounds Chemical class 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- MGJXBDMLVWIYOQ-UHFFFAOYSA-N methylazanide Chemical compound [NH-]C MGJXBDMLVWIYOQ-UHFFFAOYSA-N 0.000 description 2
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 2
- 238000012986 modification Methods 0.000 description 2
- 230000004048 modification Effects 0.000 description 2
- 239000011664 nicotinic acid Substances 0.000 description 2
- 229960003512 nicotinic acid Drugs 0.000 description 2
- 229960002748 norepinephrine Drugs 0.000 description 2
- SFLSHLFXELFNJZ-UHFFFAOYSA-N norepinephrine Natural products NCC(O)C1=CC=C(O)C(O)=C1 SFLSHLFXELFNJZ-UHFFFAOYSA-N 0.000 description 2
- QNGNSVIICDLXHT-UHFFFAOYSA-N para-ethylbenzaldehyde Natural products CCC1=CC=C(C=O)C=C1 QNGNSVIICDLXHT-UHFFFAOYSA-N 0.000 description 2
- 239000000546 pharmaceutical excipient Substances 0.000 description 2
- 230000000144 pharmacologic effect Effects 0.000 description 2
- 239000004033 plastic Substances 0.000 description 2
- 229920003023 plastic Polymers 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 2
- 239000000376 reactant Substances 0.000 description 2
- YGSDEFSMJLZEOE-UHFFFAOYSA-N salicylic acid Chemical compound OC(=O)C1=CC=CC=C1O YGSDEFSMJLZEOE-UHFFFAOYSA-N 0.000 description 2
- 239000000377 silicon dioxide Substances 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- RNVYQYLELCKWAN-UHFFFAOYSA-N solketal Chemical compound CC1(C)OCC(CO)O1 RNVYQYLELCKWAN-UHFFFAOYSA-N 0.000 description 2
- 229910021653 sulphate ion Inorganic materials 0.000 description 2
- 239000001117 sulphuric acid Substances 0.000 description 2
- 235000011149 sulphuric acid Nutrition 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- 125000002221 trityl group Chemical group [H]C1=C([H])C([H])=C([H])C([H])=C1C([*])(C1=C(C(=C(C(=C1[H])[H])[H])[H])[H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 2
- QBYIENPQHBMVBV-HFEGYEGKSA-N (2R)-2-hydroxy-2-phenylacetic acid Chemical compound O[C@@H](C(O)=O)c1ccccc1.O[C@@H](C(O)=O)c1ccccc1 QBYIENPQHBMVBV-HFEGYEGKSA-N 0.000 description 1
- RMNYHSJQXBBJON-UHFFFAOYSA-N (3-benzyl-2-phenyl-1,3-oxazolidin-5-yl)methanol Chemical compound C=1C=CC=CC=1C1OC(CO)CN1CC1=CC=CC=C1 RMNYHSJQXBBJON-UHFFFAOYSA-N 0.000 description 1
- AAWZDTNXLSGCEK-LNVDRNJUSA-N (3r,5r)-1,3,4,5-tetrahydroxycyclohexane-1-carboxylic acid Chemical compound O[C@@H]1CC(O)(C(O)=O)C[C@@H](O)C1O AAWZDTNXLSGCEK-LNVDRNJUSA-N 0.000 description 1
- UCTWMZQNUQWSLP-VIFPVBQESA-N (R)-adrenaline Chemical compound CNC[C@H](O)C1=CC=C(O)C(O)=C1 UCTWMZQNUQWSLP-VIFPVBQESA-N 0.000 description 1
- NDQXKKFRNOPRDW-UHFFFAOYSA-N 1,1,1-triethoxyethane Chemical compound CCOC(C)(OCC)OCC NDQXKKFRNOPRDW-UHFFFAOYSA-N 0.000 description 1
- PAAZPARNPHGIKF-UHFFFAOYSA-N 1,2-dibromoethane Chemical compound BrCCBr PAAZPARNPHGIKF-UHFFFAOYSA-N 0.000 description 1
- WHMJLHZOOBGEKA-UHFFFAOYSA-N 1-(2-methylphenoxy)-3-[2-(5-methylpyrazin-2-yl)oxyethylamino]propan-2-ol Chemical compound C1=NC(C)=CN=C1OCCNCC(O)COC1=CC=CC=C1C WHMJLHZOOBGEKA-UHFFFAOYSA-N 0.000 description 1
- ZHYSUSNCRBDUGI-UHFFFAOYSA-N 1-(benzylamino)-3-(3-methylpyridin-2-yl)oxypropan-2-ol Chemical compound CC1=CC=CN=C1OCC(O)CNCC1=CC=CC=C1 ZHYSUSNCRBDUGI-UHFFFAOYSA-N 0.000 description 1
- NAPMELXORZMIRR-UHFFFAOYSA-N 1-(benzylamino)-3-[(1-methyl-2h-pyrimidin-2-yl)oxy]propan-2-ol Chemical compound CN1C=CC=NC1OCC(O)CNCC1=CC=CC=C1 NAPMELXORZMIRR-UHFFFAOYSA-N 0.000 description 1
- YNMXNAZSIYDRGA-UHFFFAOYSA-N 1-(benzylamino)-3-pyrimidin-2-yloxypropan-2-ol Chemical compound N=1C=CC=NC=1OCC(O)CNCC1=CC=CC=C1 YNMXNAZSIYDRGA-UHFFFAOYSA-N 0.000 description 1
- NUQZWSGMUAFPRY-UHFFFAOYSA-N 1-[2-(3-ethoxypyridin-2-yl)oxyethylamino]-3-(2-methylphenoxy)propan-2-ol Chemical compound CCOC1=CC=CN=C1OCCNCC(O)COC1=CC=CC=C1C NUQZWSGMUAFPRY-UHFFFAOYSA-N 0.000 description 1
- IXPNQXFRVYWDDI-UHFFFAOYSA-N 1-methyl-2,4-dioxo-1,3-diazinane-5-carboximidamide Chemical compound CN1CC(C(N)=N)C(=O)NC1=O IXPNQXFRVYWDDI-UHFFFAOYSA-N 0.000 description 1
- MLCNOCRGSBCAGH-UHFFFAOYSA-N 2,3-dichloropyrazine Chemical compound ClC1=NC=CN=C1Cl MLCNOCRGSBCAGH-UHFFFAOYSA-N 0.000 description 1
- LNSCNEJNLACZPA-UHFFFAOYSA-N 2,3-dihydroxy-2,3-bis(2-methylphenyl)butanedioic acid Chemical compound CC1=CC=CC=C1C(O)(C(O)=O)C(O)(C(O)=O)C1=CC=CC=C1C LNSCNEJNLACZPA-UHFFFAOYSA-N 0.000 description 1
- XIZHWFXAOMDEAK-UHFFFAOYSA-N 2-(2-oxopropoxy)benzamide Chemical compound CC(=O)COC1=CC=CC=C1C(N)=O XIZHWFXAOMDEAK-UHFFFAOYSA-N 0.000 description 1
- ATLIBKWCBLFLNE-UHFFFAOYSA-N 2-(3-bromopropoxy)benzamide Chemical compound NC(=O)C1=CC=CC=C1OCCCBr ATLIBKWCBLFLNE-UHFFFAOYSA-N 0.000 description 1
- WTTWSMJHJFNCQB-UHFFFAOYSA-N 2-(dibenzylamino)ethanol Chemical compound C=1C=CC=CC=1CN(CCO)CC1=CC=CC=C1 WTTWSMJHJFNCQB-UHFFFAOYSA-N 0.000 description 1
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 1
- LBLYYCQCTBFVLH-UHFFFAOYSA-N 2-Methylbenzenesulfonic acid Chemical compound CC1=CC=CC=C1S(O)(=O)=O LBLYYCQCTBFVLH-UHFFFAOYSA-N 0.000 description 1
- MKPPUNZMLDOCKO-UHFFFAOYSA-N 2-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]-3-methylpyrazine Chemical compound CC1=NC=CN=C1OCC1OC(C)(C)OC1 MKPPUNZMLDOCKO-UHFFFAOYSA-N 0.000 description 1
- IYFFPRFMOMGBGB-UHFFFAOYSA-N 2-[(2-chlorophenoxy)methyl]oxirane Chemical compound ClC1=CC=CC=C1OCC1OC1 IYFFPRFMOMGBGB-UHFFFAOYSA-N 0.000 description 1
- BYDXZYUGDXYSJY-UHFFFAOYSA-N 2-[(4-phenylmethoxyphenoxy)methyl]oxirane Chemical compound C1OC1COC(C=C1)=CC=C1OCC1=CC=CC=C1 BYDXZYUGDXYSJY-UHFFFAOYSA-N 0.000 description 1
- QKFPICHUKVELRR-UHFFFAOYSA-N 2-[2-[(2-hydroxy-3-pyrazin-2-yloxypropyl)amino]ethoxy]benzamide Chemical compound NC(=O)C1=CC=CC=C1OCCNCC(O)COC1=CN=CC=N1 QKFPICHUKVELRR-UHFFFAOYSA-N 0.000 description 1
- CFUXYWSTWQCRPS-UHFFFAOYSA-N 2-[2-[2-hydroxy-3-(3-methylpyridin-2-yl)oxypropyl]iminopropoxy]benzamide Chemical compound N=1C=CC=C(C)C=1OCC(O)CN=C(C)COC1=CC=CC=C1C(N)=O CFUXYWSTWQCRPS-UHFFFAOYSA-N 0.000 description 1
- KTRYFFGWTMSYMZ-UHFFFAOYSA-N 2-[2-[[2-hydroxy-3-(3-methylpyrazin-2-yl)oxypropyl]amino]ethoxy]benzamide Chemical compound CC1=NC=CN=C1OCC(O)CNCCOC1=CC=CC=C1C(N)=O KTRYFFGWTMSYMZ-UHFFFAOYSA-N 0.000 description 1
- FHPXJOCYKPKYKI-UHFFFAOYSA-N 2-[2-[[2-hydroxy-3-(3-methylpyridin-2-yl)oxypropyl]amino]ethoxy]benzamide Chemical compound CC1=CC=CN=C1OCC(O)CNCCOC1=CC=CC=C1C(N)=O FHPXJOCYKPKYKI-UHFFFAOYSA-N 0.000 description 1
- NPIBTOWAFGJACJ-UHFFFAOYSA-N 2-[2-[[2-hydroxy-3-(3-methylpyridin-2-yl)oxypropyl]amino]propoxy]benzamide Chemical compound N=1C=CC=C(C)C=1OCC(O)CNC(C)COC1=CC=CC=C1C(N)=O NPIBTOWAFGJACJ-UHFFFAOYSA-N 0.000 description 1
- 229940058020 2-amino-2-methyl-1-propanol Drugs 0.000 description 1
- IQHSSYROJYPFDV-UHFFFAOYSA-N 2-bromo-1,3-dichloro-5-(trifluoromethyl)benzene Chemical group FC(F)(F)C1=CC(Cl)=C(Br)C(Cl)=C1 IQHSSYROJYPFDV-UHFFFAOYSA-N 0.000 description 1
- QICIAFFGXVLWOO-UHFFFAOYSA-N 2-chloro-3-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]pyrazine Chemical compound O1C(C)(C)OCC1COC1=NC=CN=C1Cl QICIAFFGXVLWOO-UHFFFAOYSA-N 0.000 description 1
- ZQZAHPFFZWEUCL-UHFFFAOYSA-N 2-chloropyridine-3-carboxamide Chemical compound NC(=O)C1=CC=CN=C1Cl ZQZAHPFFZWEUCL-UHFFFAOYSA-N 0.000 description 1
- WLJVXDMOQOGPHL-PPJXEINESA-N 2-phenylacetic acid Chemical compound O[14C](=O)CC1=CC=CC=C1 WLJVXDMOQOGPHL-PPJXEINESA-N 0.000 description 1
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- ADCWCQDKAHGGGY-UHFFFAOYSA-N 3-(3-methylpyrazin-2-yl)oxypropane-1,2-diol Chemical compound CC1=NC=CN=C1OCC(O)CO ADCWCQDKAHGGGY-UHFFFAOYSA-N 0.000 description 1
- ZOCUKSFZJPZMER-UHFFFAOYSA-N 3-[2-(benzylamino)ethoxy]pyridine-2-carboxamide Chemical compound NC(=O)C1=NC=CC=C1OCCNCC1=CC=CC=C1 ZOCUKSFZJPZMER-UHFFFAOYSA-N 0.000 description 1
- SWSKBBKGSGTXSY-UHFFFAOYSA-N 3-[2-[2-hydroxy-3-(3-methylpyridin-2-yl)oxypropyl]iminopropoxy]pyridine-2-carboxamide Chemical compound N=1C=CC=C(C)C=1OCC(O)CN=C(C)COC1=CC=CN=C1C(N)=O SWSKBBKGSGTXSY-UHFFFAOYSA-N 0.000 description 1
- TVLPDFBXURBWCQ-UHFFFAOYSA-N 3-[2-[[2-hydroxy-3-(2-methylphenoxy)propyl]amino]ethoxy]pyridine-2-carboxamide Chemical compound CC1=CC=CC=C1OCC(O)CNCCOC1=CC=CN=C1C(N)=O TVLPDFBXURBWCQ-UHFFFAOYSA-N 0.000 description 1
- OBOVNJRNBSKPGW-UHFFFAOYSA-N 3-[2-[[2-hydroxy-3-(3-methylpyridin-2-yl)oxypropyl]amino]propoxy]pyridine-2-carboxamide Chemical compound N=1C=CC=C(C)C=1OCC(O)CNC(C)COC1=CC=CN=C1C(N)=O OBOVNJRNBSKPGW-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- 125000003349 3-pyridyl group Chemical group N1=C([H])C([*])=C([H])C([H])=C1[H] 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- QVEWRFJBBRCQDQ-UHFFFAOYSA-N 4-[2-[(2-hydroxy-3-pyrazin-2-yloxypropyl)amino]ethoxy]benzamide Chemical compound C1=CC(C(=O)N)=CC=C1OCCNCC(O)COC1=CN=CC=N1 QVEWRFJBBRCQDQ-UHFFFAOYSA-N 0.000 description 1
- DFNFNCOGZUFGDO-UHFFFAOYSA-N 4-[2-[(2-hydroxy-3-pyrimidin-2-yloxypropyl)amino]ethoxy]benzamide Chemical compound C1=CC(C(=O)N)=CC=C1OCCNCC(O)COC1=NC=CC=N1 DFNFNCOGZUFGDO-UHFFFAOYSA-N 0.000 description 1
- KUMORWMNLYZMKJ-UHFFFAOYSA-N 4-[2-[[2-hydroxy-3-(3-methylpyrazin-2-yl)oxypropyl]amino]ethoxy]benzamide Chemical compound CC1=NC=CN=C1OCC(O)CNCCOC1=CC=C(C(N)=O)C=C1 KUMORWMNLYZMKJ-UHFFFAOYSA-N 0.000 description 1
- PAGPVPWCKAIVRF-UHFFFAOYSA-N 4-[2-[[2-hydroxy-3-(3-methylpyridin-2-yl)oxypropyl]amino]ethoxy]benzamide Chemical compound CC1=CC=CN=C1OCC(O)CNCCOC1=CC=C(C(N)=O)C=C1 PAGPVPWCKAIVRF-UHFFFAOYSA-N 0.000 description 1
- WCTHNIXQOBZVAV-UHFFFAOYSA-N 4-[2-[[2-hydroxy-3-(4-methylpyridin-2-yl)oxypropyl]amino]ethoxy]benzamide Chemical compound CC1=CC=NC(OCC(O)CNCCOC=2C=CC(=CC=2)C(N)=O)=C1 WCTHNIXQOBZVAV-UHFFFAOYSA-N 0.000 description 1
- 125000000339 4-pyridyl group Chemical group N1=C([H])C([H])=C([*])C([H])=C1[H] 0.000 description 1
- YYROPELSRYBVMQ-UHFFFAOYSA-N 4-toluenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 description 1
- UAWMVMPAYRWUFX-UHFFFAOYSA-N 6-Chloronicotinic acid Chemical compound OC(=O)C1=CC=C(Cl)N=C1 UAWMVMPAYRWUFX-UHFFFAOYSA-N 0.000 description 1
- LHSDDDNWNOTMEE-UHFFFAOYSA-N 6-[2-(benzylamino)ethoxy]pyridine-3-carboxamide Chemical compound N1=CC(C(=O)N)=CC=C1OCCNCC1=CC=CC=C1 LHSDDDNWNOTMEE-UHFFFAOYSA-N 0.000 description 1
- INXXCNYPHPDMQD-UHFFFAOYSA-N 6-[2-[(2-hydroxy-3-phenoxypropyl)amino]ethoxy]pyridine-3-carboxamide Chemical compound N1=CC(C(=O)N)=CC=C1OCCNCC(O)COC1=CC=CC=C1 INXXCNYPHPDMQD-UHFFFAOYSA-N 0.000 description 1
- QHXDVTYSGOWKRL-UHFFFAOYSA-N 6-[2-[[2-hydroxy-3-(4-hydroxyphenoxy)propyl]amino]ethoxy]pyridine-3-carboxamide Chemical compound N1=CC(C(=O)N)=CC=C1OCCNCC(O)COC1=CC=C(O)C=C1 QHXDVTYSGOWKRL-UHFFFAOYSA-N 0.000 description 1
- XLTSRYUFJABOPI-UHFFFAOYSA-N 6-[2-[[3-(2-chlorophenoxy)-2-hydroxypropyl]amino]ethoxy]pyridine-3-carboxamide Chemical compound N1=CC(C(=O)N)=CC=C1OCCNCC(O)COC1=CC=CC=C1Cl XLTSRYUFJABOPI-UHFFFAOYSA-N 0.000 description 1
- IZZBUHRYXJPZLP-UHFFFAOYSA-N 6-[2-[benzyl-[2-hydroxy-3-(2-methoxyphenoxy)propyl]amino]ethoxy]pyridine-3-carboxamide Chemical compound COC1=CC=CC=C1OCC(O)CN(CC=1C=CC=CC=1)CCOC1=CC=C(C(N)=O)C=N1 IZZBUHRYXJPZLP-UHFFFAOYSA-N 0.000 description 1
- JYPRLODUFMPFOE-UHFFFAOYSA-N 6-[3-[[2-hydroxy-3-(2-methylphenoxy)propyl]amino]propoxy]pyridine-3-carboxamide Chemical compound CC1=CC=CC=C1OCC(O)CNCCCOC1=CC=C(C(N)=O)C=N1 JYPRLODUFMPFOE-UHFFFAOYSA-N 0.000 description 1
- FMEBIWNKYZUWFV-UHFFFAOYSA-N 6-chloropyridine-3-carbonyl chloride Chemical compound ClC(=O)C1=CC=C(Cl)N=C1 FMEBIWNKYZUWFV-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- 229920001817 Agar Polymers 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- 241000416162 Astragalus gummifer Species 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 241000555825 Clupeidae Species 0.000 description 1
- AAWZDTNXLSGCEK-UHFFFAOYSA-N Cordycepinsaeure Natural products OC1CC(O)(C(O)=O)CC(O)C1O AAWZDTNXLSGCEK-UHFFFAOYSA-N 0.000 description 1
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 1
- FBPFZTCFMRRESA-JGWLITMVSA-N D-glucitol Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-JGWLITMVSA-N 0.000 description 1
- VVNCNSJFMMFHPL-VKHMYHEASA-N D-penicillamine Chemical compound CC(C)(S)[C@@H](N)C(O)=O VVNCNSJFMMFHPL-VKHMYHEASA-N 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- CTKINSOISVBQLD-UHFFFAOYSA-N Glycidol Chemical compound OCC1CO1 CTKINSOISVBQLD-UHFFFAOYSA-N 0.000 description 1
- 239000004471 Glycine Substances 0.000 description 1
- AEMRFAOFKBGASW-UHFFFAOYSA-N Glycolic acid Chemical compound OCC(O)=O AEMRFAOFKBGASW-UHFFFAOYSA-N 0.000 description 1
- CKLJMWTZIZZHCS-REOHCLBHSA-N L-aspartic acid Chemical compound OC(=O)[C@@H](N)CC(O)=O CKLJMWTZIZZHCS-REOHCLBHSA-N 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 244000151018 Maranta arundinacea Species 0.000 description 1
- 235000010804 Maranta arundinacea Nutrition 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 1
- 241001072332 Monia Species 0.000 description 1
- PCNDJXKNXGMECE-UHFFFAOYSA-N Phenazine Natural products C1=CC=CC2=NC3=CC=CC=C3N=C21 PCNDJXKNXGMECE-UHFFFAOYSA-N 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- FQYUMYWMJTYZTK-UHFFFAOYSA-N Phenyl glycidyl ether Chemical compound C1OC1COC1=CC=CC=C1 FQYUMYWMJTYZTK-UHFFFAOYSA-N 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- YZCKVEUIGOORGS-IGMARMGPSA-N Protium Chemical compound [1H] YZCKVEUIGOORGS-IGMARMGPSA-N 0.000 description 1
- AAWZDTNXLSGCEK-ZHQZDSKASA-N Quinic acid Natural products O[C@H]1CC(O)(C(O)=O)C[C@H](O)C1O AAWZDTNXLSGCEK-ZHQZDSKASA-N 0.000 description 1
- IWYDHOAUDWTVEP-UHFFFAOYSA-N R-2-phenyl-2-hydroxyacetic acid Natural products OC(=O)C(O)C1=CC=CC=C1 IWYDHOAUDWTVEP-UHFFFAOYSA-N 0.000 description 1
- 241000700159 Rattus Species 0.000 description 1
- 208000036366 Sensation of pressure Diseases 0.000 description 1
- 235000021355 Stearic acid Nutrition 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- 208000001871 Tachycardia Diseases 0.000 description 1
- 241001385887 Tachys Species 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- 235000012419 Thalia geniculata Nutrition 0.000 description 1
- 229920001615 Tragacanth Polymers 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- JGSXYJBGFSEKDO-UHFFFAOYSA-N [1-chloro-3-(3-methylpyrazin-2-yl)oxypropan-2-yl] acetate Chemical compound CC(=O)OC(CCl)COC1=NC=CN=C1C JGSXYJBGFSEKDO-UHFFFAOYSA-N 0.000 description 1
- DPXJVFZANSGRMM-UHFFFAOYSA-N acetic acid;2,3,4,5,6-pentahydroxyhexanal;sodium Chemical compound [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O DPXJVFZANSGRMM-UHFFFAOYSA-N 0.000 description 1
- 230000001800 adrenalinergic effect Effects 0.000 description 1
- 239000003463 adsorbent Substances 0.000 description 1
- 239000008272 agar Substances 0.000 description 1
- 235000010419 agar Nutrition 0.000 description 1
- 235000010443 alginic acid Nutrition 0.000 description 1
- 239000000783 alginic acid Substances 0.000 description 1
- 229920000615 alginic acid Polymers 0.000 description 1
- 229960001126 alginic acid Drugs 0.000 description 1
- 150000004781 alginic acids Chemical class 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 125000004390 alkyl sulfonyl group Chemical group 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- PZZYQPZGQPZBDN-UHFFFAOYSA-N aluminium silicate Chemical compound O=[Al]O[Si](=O)O[Al]=O PZZYQPZGQPZBDN-UHFFFAOYSA-N 0.000 description 1
- 229910000323 aluminium silicate Inorganic materials 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- CBTVGIZVANVGBH-UHFFFAOYSA-N aminomethyl propanol Chemical compound CC(C)(N)CO CBTVGIZVANVGBH-UHFFFAOYSA-N 0.000 description 1
- 235000010323 ascorbic acid Nutrition 0.000 description 1
- 239000011668 ascorbic acid Substances 0.000 description 1
- 229960005070 ascorbic acid Drugs 0.000 description 1
- 235000003704 aspartic acid Nutrition 0.000 description 1
- 238000010533 azeotropic distillation Methods 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 1
- 125000000649 benzylidene group Chemical group [H]C(=[*])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- WQZGKKKJIJFFOK-VFUOTHLCSA-N beta-D-glucose Chemical compound OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-VFUOTHLCSA-N 0.000 description 1
- OQFSQFPPLPISGP-UHFFFAOYSA-N beta-carboxyaspartic acid Natural products OC(=O)C(N)C(C(O)=O)C(O)=O OQFSQFPPLPISGP-UHFFFAOYSA-N 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 210000004204 blood vessel Anatomy 0.000 description 1
- 239000000872 buffer Substances 0.000 description 1
- CJZGTCYPCWQAJB-UHFFFAOYSA-L calcium stearate Chemical compound [Ca+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O CJZGTCYPCWQAJB-UHFFFAOYSA-L 0.000 description 1
- 239000008116 calcium stearate Substances 0.000 description 1
- 235000013539 calcium stearate Nutrition 0.000 description 1
- MIOPJNTWMNEORI-UHFFFAOYSA-N camphorsulfonic acid Chemical compound C1CC2(CS(O)(=O)=O)C(=O)CC1C2(C)C MIOPJNTWMNEORI-UHFFFAOYSA-N 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 150000001721 carbon Chemical group 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 1
- XBWRJSSJWDOUSJ-UHFFFAOYSA-L chromium(ii) chloride Chemical compound Cl[Cr]Cl XBWRJSSJWDOUSJ-UHFFFAOYSA-L 0.000 description 1
- 230000002057 chronotropic effect Effects 0.000 description 1
- 230000002301 combined effect Effects 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 239000002178 crystalline material Substances 0.000 description 1
- HCAJEUSONLESMK-UHFFFAOYSA-N cyclohexylsulfamic acid Chemical compound OS(=O)(=O)NC1CCCCC1 HCAJEUSONLESMK-UHFFFAOYSA-N 0.000 description 1
- 238000006264 debenzylation reaction Methods 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 229940075911 depen Drugs 0.000 description 1
- 239000008121 dextrose Substances 0.000 description 1
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 229940035564 duration Drugs 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 229960005139 epinephrine Drugs 0.000 description 1
- CCIVGXIOQKPBKL-UHFFFAOYSA-N ethanesulfonic acid Chemical compound CCS(O)(=O)=O CCIVGXIOQKPBKL-UHFFFAOYSA-N 0.000 description 1
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 125000000031 ethylamino group Chemical group [H]C([H])([H])C([H])([H])N([H])[*] 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 210000001105 femoral artery Anatomy 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- 235000003599 food sweetener Nutrition 0.000 description 1
- 238000005755 formation reaction Methods 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 238000001640 fractional crystallisation Methods 0.000 description 1
- VZCYOOQTPOCHFL-OWOJBTEDSA-M fumarate(1-) Chemical compound OC(=O)\C=C\C([O-])=O VZCYOOQTPOCHFL-OWOJBTEDSA-M 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 230000014509 gene expression Effects 0.000 description 1
- 229940093915 gynecological organic acid Drugs 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 229910000039 hydrogen halide Inorganic materials 0.000 description 1
- 239000012433 hydrogen halide Substances 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- SHFJWMWCIHQNCP-UHFFFAOYSA-M hydron;tetrabutylazanium;sulfate Chemical compound OS([O-])(=O)=O.CCCC[N+](CCCC)(CCCC)CCCC SHFJWMWCIHQNCP-UHFFFAOYSA-M 0.000 description 1
- 239000003978 infusion fluid Substances 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 230000005764 inhibitory process Effects 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- JMMWKPVZQRWMSS-UHFFFAOYSA-N isopropanol acetate Natural products CC(C)OC(C)=O JMMWKPVZQRWMSS-UHFFFAOYSA-N 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000004310 lactic acid Substances 0.000 description 1
- 235000014655 lactic acid Nutrition 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 239000012280 lithium aluminium hydride Substances 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 229960002510 mandelic acid Drugs 0.000 description 1
- 210000003975 mesenteric artery Anatomy 0.000 description 1
- 229910052987 metal hydride Inorganic materials 0.000 description 1
- 150000004681 metal hydrides Chemical class 0.000 description 1
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 1
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- ODVQDBWFBZXDMQ-UHFFFAOYSA-N methyl n-[[4-[3-[2-(5-carbamoylpyridin-2-yl)oxyethylamino]-2-hydroxypropoxy]phenyl]methyl]carbamate Chemical compound C1=CC(CNC(=O)OC)=CC=C1OCC(O)CNCCOC1=CC=C(C(N)=O)C=N1 ODVQDBWFBZXDMQ-UHFFFAOYSA-N 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 235000010981 methylcellulose Nutrition 0.000 description 1
- 244000005700 microbiome Species 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 150000004682 monohydrates Chemical class 0.000 description 1
- 239000012452 mother liquor Substances 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000003136 n-heptyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 1
- DYLRHPMZZYMYLU-UHFFFAOYSA-N n-methyl-4-(oxiran-2-ylmethoxy)benzamide Chemical compound C1=CC(C(=O)NC)=CC=C1OCC1OC1 DYLRHPMZZYMYLU-UHFFFAOYSA-N 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001971 neopentyl group Chemical group [H]C([*])([H])C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 1
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 1
- 229940099990 ogen Drugs 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 230000003204 osmotic effect Effects 0.000 description 1
- MUMZUERVLWJKNR-UHFFFAOYSA-N oxoplatinum Chemical compound [Pt]=O MUMZUERVLWJKNR-UHFFFAOYSA-N 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- FJKROLUGYXJWQN-UHFFFAOYSA-N papa-hydroxy-benzoic acid Natural products OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 1
- 239000012188 paraffin wax Substances 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 229940036562 perchlorate antithyroid preparations Drugs 0.000 description 1
- 230000010412 perfusion Effects 0.000 description 1
- IBBMAWULFFBRKK-UHFFFAOYSA-N picolinamide Chemical compound NC(=O)C1=CC=CC=N1 IBBMAWULFFBRKK-UHFFFAOYSA-N 0.000 description 1
- SIOXPEMLGUPBBT-UHFFFAOYSA-N picolinic acid Chemical compound OC(=O)C1=CC=CC=N1 SIOXPEMLGUPBBT-UHFFFAOYSA-N 0.000 description 1
- OXNIZHLAWKMVMX-UHFFFAOYSA-N picric acid Chemical class OC1=C([N+]([O-])=O)C=C([N+]([O-])=O)C=C1[N+]([O-])=O OXNIZHLAWKMVMX-UHFFFAOYSA-N 0.000 description 1
- 229910003446 platinum oxide Inorganic materials 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 1
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 1
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 150000003112 potassium compounds Chemical class 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- 125000004307 pyrazin-2-yl group Chemical group [H]C1=C([H])N=C(*)C([H])=N1 0.000 description 1
- 125000005554 pyridyloxy group Chemical group 0.000 description 1
- 125000000246 pyrimidin-2-yl group Chemical group [H]C1=NC(*)=NC([H])=C1[H] 0.000 description 1
- 125000004527 pyrimidin-4-yl group Chemical group N1=CN=C(C=C1)* 0.000 description 1
- 125000004528 pyrimidin-5-yl group Chemical group N1=CN=CC(=C1)* 0.000 description 1
- 239000003087 receptor blocking agent Substances 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 229940100486 rice starch Drugs 0.000 description 1
- 229960004889 salicylic acid Drugs 0.000 description 1
- 239000011833 salt mixture Substances 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 235000010413 sodium alginate Nutrition 0.000 description 1
- 239000000661 sodium alginate Substances 0.000 description 1
- 229940005550 sodium alginate Drugs 0.000 description 1
- 235000019812 sodium carboxymethyl cellulose Nutrition 0.000 description 1
- 229920001027 sodium carboxymethylcellulose Polymers 0.000 description 1
- BEOOHQFXGBMRKU-UHFFFAOYSA-N sodium cyanoborohydride Chemical compound [Na+].[B-]C#N BEOOHQFXGBMRKU-UHFFFAOYSA-N 0.000 description 1
- RBWSWDPRDBEWCR-RKJRWTFHSA-N sodium;(2r)-2-[(2r)-3,4-dihydroxy-5-oxo-2h-furan-2-yl]-2-hydroxyethanolate Chemical compound [Na+].[O-]C[C@@H](O)[C@H]1OC(=O)C(O)=C1O RBWSWDPRDBEWCR-RKJRWTFHSA-N 0.000 description 1
- CMXPERZAMAQXSF-UHFFFAOYSA-M sodium;1,4-bis(2-ethylhexoxy)-1,4-dioxobutane-2-sulfonate;1,8-dihydroxyanthracene-9,10-dione Chemical compound [Na+].O=C1C2=CC=CC(O)=C2C(=O)C2=C1C=CC=C2O.CCCCC(CC)COC(=O)CC(S([O-])(=O)=O)C(=O)OCC(CC)CCCC CMXPERZAMAQXSF-UHFFFAOYSA-M 0.000 description 1
- 239000008279 sol Substances 0.000 description 1
- 239000000600 sorbitol Substances 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 239000008117 stearic acid Substances 0.000 description 1
- 239000005720 sucrose Substances 0.000 description 1
- 239000003765 sweetening agent Substances 0.000 description 1
- 230000006794 tachycardia Effects 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 1
- 239000000196 tragacanth Substances 0.000 description 1
- 235000010487 tragacanth Nutrition 0.000 description 1
- 229940116362 tragacanth Drugs 0.000 description 1
- 239000005051 trimethylchlorosilane Substances 0.000 description 1
- NLVXSWCKKBEXTG-UHFFFAOYSA-N vinylsulfonic acid Chemical compound OS(=O)(=O)C=C NLVXSWCKKBEXTG-UHFFFAOYSA-N 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/62—Oxygen or sulfur atoms
- C07D213/63—One oxygen atom
- C07D213/64—One oxygen atom attached in position 2 or 6
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/13—Amines
- A61K31/135—Amines having aromatic rings, e.g. ketamine, nortriptyline
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/62—Oxygen or sulfur atoms
- C07D213/63—One oxygen atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/78—Carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D213/81—Amides; Imides
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/02—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings
- C07D239/24—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members
- C07D239/28—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to ring carbon atoms
- C07D239/32—One oxygen, sulfur or nitrogen atom
- C07D239/34—One oxygen atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D241/00—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings
- C07D241/02—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings not condensed with other rings
- C07D241/10—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members
- C07D241/14—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D241/18—Oxygen or sulfur atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- General Health & Medical Sciences (AREA)
- Pharmacology & Pharmacy (AREA)
- Epidemiology (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- Medicinal Chemistry (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Pyridine Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Heterocyclic Compounds That Contain Two Or More Ring Oxygen Atoms (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH156177A CH592625A5 (https=) | 1974-05-14 | 1974-05-14 | |
| CH661874A CH594626A5 (https=) | 1974-05-14 | 1974-05-14 | |
| CH658274A CH591448A5 (https=) | 1974-05-14 | 1974-05-14 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1067077A true CA1067077A (en) | 1979-11-27 |
Family
ID=27173079
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA226,694A Expired CA1067077A (en) | 1974-05-14 | 1975-05-12 | Process for the manufacture of cyclic-substituted derivatives of 1-amino-2-propanol |
Country Status (12)
| Country | Link |
|---|---|
| US (1) | US4027027A (https=) |
| JP (1) | JPS50154213A (https=) |
| AT (1) | AT345288B (https=) |
| AU (1) | AU8104575A (https=) |
| BE (1) | BE828989A (https=) |
| CA (1) | CA1067077A (https=) |
| CH (3) | CH591448A5 (https=) |
| DE (1) | DE2520910A1 (https=) |
| FR (1) | FR2270863B1 (https=) |
| GB (1) | GB1493006A (https=) |
| NL (1) | NL7504864A (https=) |
| SE (1) | SE7504375L (https=) |
Families Citing this family (22)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4193995A (en) * | 1972-05-05 | 1980-03-18 | Merck Sharp & Dohme (I.A.) Corp. | 2-(3-Substituted amino-2-hydroxypropoxy)-3-substituted pyrazine compounds and compositions |
| US4195090A (en) * | 1973-02-20 | 1980-03-25 | Ciba-Geigy Corporation | 2-(3-Amino-2-hydroxy-propoxy)pyridine derivatives and pharmaceutical compositions therewith |
| US4853383A (en) * | 1975-03-03 | 1989-08-01 | Merck & Co., Inc. | β-blocking substituted imidazoles |
| US4440774A (en) * | 1975-03-03 | 1984-04-03 | Merck & Co., Inc. | 3-Amino-2-hydroxypropoxyaryl imidazole derivatives |
| US4263323A (en) * | 1976-10-07 | 1981-04-21 | Aktiebolaget Hassle | β-Receptor blocking compounds and treatment of cardiovascular disorders therewith |
| DE2711655A1 (de) * | 1977-03-17 | 1978-09-21 | Basf Ag | Pyridinyl-aminoalkylaether |
| FI782133A7 (fi) * | 1977-07-08 | 1979-01-09 | Ciba Geigy Ag | Piperidino-propanoler och foerfarande foer deras framstaellning |
| US4235919A (en) | 1977-07-21 | 1980-11-25 | Sandoz Ltd. | 1-(Indol-4-yloxy)-3-(2-substituted amino)-2-propanols and pharmaceutical use thereof |
| US4263325A (en) * | 1977-10-05 | 1981-04-21 | Aktiebolaget Hassle | β-Receptor blocking compounds and treatment of cardiovascular disorders therewith |
| DK267779A (da) * | 1978-06-27 | 1979-12-28 | Merck & Co Inc | Fr&mgangsmaade til fremstilling af n-aralkylamino-propoxycyanopyridiner |
| US4210653A (en) * | 1978-06-27 | 1980-07-01 | Merck & Co., Inc. | Pyridyloxypropanolamines |
| US4208416A (en) * | 1978-06-27 | 1980-06-17 | Merck & Co., Inc. | N-Aralkyl containing cyanopyridines |
| JPS55124742A (en) * | 1979-03-20 | 1980-09-26 | Kyowa Hakko Kogyo Co Ltd | Novel aminoalcohol derivative |
| IT1165040B (it) * | 1979-04-23 | 1987-04-22 | Isf Spa | Alcossialchilidenidrazinopiridazione e procedimento per la loro preparazione |
| DE3048487A1 (de) * | 1980-12-22 | 1982-07-29 | Cassella Ag, 6000 Frankfurt | Basisch substituierte pyridazine, ihre herstellung und ihre verwendung |
| US4599333A (en) * | 1982-06-14 | 1986-07-08 | Teikoku Hormone Mfg. Co., Ltd. | Hydrazinopyridazine compound, process for production thereof, and use thereof as medicament |
| US4598149A (en) * | 1984-03-02 | 1986-07-01 | Merck & Co., Inc. | 3-amino-2-hydroxypropyl of pyrimidin-4-one useful as antihypertensive, cardioprotective, antiarrythmic, and antianginal agents |
| US4920134A (en) * | 1987-08-07 | 1990-04-24 | Takeda Chemical Industries, Ltd. | 2-O-pyrimidinyl glycerol derivatives |
| NZ234087A (en) * | 1989-06-19 | 1991-08-27 | Teikoku Hormone Mfg Co Ltd | 2-(3-aryloxy(2-hydroxy-propylamino))-2-methylpropyl- aminophenyl pyridazine derivatives |
| US5221674A (en) * | 1989-06-19 | 1993-06-22 | Teikoku Hormone Mfg. Co., Ltd. | Pyridazinone derivatives |
| US5998404A (en) * | 1994-10-24 | 1999-12-07 | Eli Lilly And Company | Heterocyclic compounds and their use |
| CA2314458A1 (en) | 1999-08-02 | 2001-02-02 | Kazumi Okuro | Process for production of 3-(3-pyridyl)-1-propanol derivatives |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| LU65414A1 (https=) * | 1972-05-24 | 1973-12-04 |
-
1974
- 1974-05-14 CH CH658274A patent/CH591448A5/xx not_active IP Right Cessation
- 1974-05-14 CH CH661874A patent/CH594626A5/xx not_active IP Right Cessation
- 1974-05-14 CH CH156177A patent/CH592625A5/xx not_active IP Right Cessation
-
1975
- 1975-04-16 SE SE7504375A patent/SE7504375L/xx unknown
- 1975-04-24 NL NL7504864A patent/NL7504864A/xx not_active Application Discontinuation
- 1975-05-02 GB GB18491/75A patent/GB1493006A/en not_active Expired
- 1975-05-05 US US05/574,785 patent/US4027027A/en not_active Expired - Lifetime
- 1975-05-10 DE DE19752520910 patent/DE2520910A1/de active Pending
- 1975-05-12 CA CA226,694A patent/CA1067077A/en not_active Expired
- 1975-05-12 FR FR7514655A patent/FR2270863B1/fr not_active Expired
- 1975-05-12 AU AU81045/75A patent/AU8104575A/en not_active Expired
- 1975-05-13 BE BE156276A patent/BE828989A/xx unknown
- 1975-05-13 AT AT364675A patent/AT345288B/de not_active IP Right Cessation
- 1975-05-14 JP JP50056214A patent/JPS50154213A/ja active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| CH592625A5 (https=) | 1977-10-31 |
| GB1493006A (en) | 1977-11-23 |
| BE828989A (fr) | 1975-11-13 |
| NL7504864A (nl) | 1975-11-18 |
| US4027027A (en) | 1977-05-31 |
| JPS50154213A (https=) | 1975-12-12 |
| CH591448A5 (https=) | 1977-09-15 |
| ATA364675A (de) | 1978-01-15 |
| CH594626A5 (https=) | 1978-01-13 |
| FR2270863A1 (https=) | 1975-12-12 |
| SE7504375L (sv) | 1975-11-17 |
| AU8104575A (en) | 1976-11-18 |
| DE2520910A1 (de) | 1975-12-04 |
| FR2270863B1 (https=) | 1979-05-18 |
| AT345288B (de) | 1978-09-11 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1067077A (en) | Process for the manufacture of cyclic-substituted derivatives of 1-amino-2-propanol | |
| FI78479C (fi) | Foerfarande foer framstaellning av terapeutiskt anvaendbara aryloxi-hydroxipropylenpiperazinylacetanilider. | |
| CA1134843A (en) | Process for the preparation of derivatives of 3-aminopropane-1,2-diol | |
| CA1124241A (en) | N-alkylated aminoalcohols and their salts, processes for their preparation and pharmaceutical preparations containing these compounds | |
| CA1273929A (en) | N-(piperidinyl-alkyl)-carboxamides | |
| US4559354A (en) | Certain antihypertensive 1-[2-[3-carbamoyl-4-hydroxy phenoxy]alkylene amino]-heterocyclic phenoxy-propanol derivatives | |
| US4140793A (en) | Guanidine derivatives | |
| IE46278B1 (en) | Piperazine derivatives | |
| IE46895B1 (en) | Alkylenediamine derivatives | |
| GB2046259A (en) | Amino-alcohol derivatives and pharmaceutical compositions containing them | |
| US4139623A (en) | Cyclic-substituted derivatives of 1-amino-2-propanol | |
| US4278796A (en) | Piperazines | |
| US4699918A (en) | 2-imino-pyrrolidines, process for their preparation, and therapeutic compositions containing same | |
| CA1158649A (en) | Substituted amino triazoles | |
| CA1187878A (en) | Phenylpiperazine derivatives of hetarylphenols and hetarylanilines, their preparation, and therapeutic agents containing these compounds | |
| CA1131641A (en) | Piperazinyl-tetrahydronaphthalene derivatives | |
| US4490533A (en) | Aminoalkyl pyridine derivatives | |
| CA1108633A (en) | 1-aryloxy-2-hydroxy-3-aminopropanes and process for preparing same | |
| CA1105021A (en) | Process for the manufacture of new 1-amino-2-hydroxy- 3-heterocyclyloxy-propanes | |
| US4656180A (en) | Diamine derivatives and pharmaceutical preparations containing these compounds | |
| US4659721A (en) | Alkanol derivatives, and pharmaceutical preparation containing these compounds | |
| CA1292739C (en) | Heteroaromatic acetylenes useful as antihypertensive agents | |
| EP0009362A1 (en) | Heterocyclic derivatives of guanidine, their preparation and pharmaceutical formulations comprising them | |
| US4914126A (en) | Aromatic amines | |
| CS249503B2 (en) | Method of new 1-(3-/3,4,5-trimethoxyphenoxy/-2-hydroxypropyl-4-aryl-piperazine derivatives production |