CA1061215A - Extensible paper fastening device - Google Patents
Extensible paper fastening deviceInfo
- Publication number
- CA1061215A CA1061215A CA261,840A CA261840A CA1061215A CA 1061215 A CA1061215 A CA 1061215A CA 261840 A CA261840 A CA 261840A CA 1061215 A CA1061215 A CA 1061215A
- Authority
- CA
- Canada
- Prior art keywords
- compressor
- tongue
- tongues
- fastener
- hooks
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 210000002105 tongue Anatomy 0.000 claims description 61
- 239000004033 plastic Substances 0.000 claims description 9
- 229920003023 plastic Polymers 0.000 claims description 9
- 239000000463 material Substances 0.000 claims description 7
- 238000006073 displacement reaction Methods 0.000 claims description 5
- 238000005728 strengthening Methods 0.000 claims description 4
- 230000002093 peripheral effect Effects 0.000 claims description 3
- 230000004048 modification Effects 0.000 claims description 2
- 238000012986 modification Methods 0.000 claims description 2
- 230000003578 releasing effect Effects 0.000 claims description 2
- 239000004743 Polypropylene Substances 0.000 claims 2
- 239000004698 Polyethylene Substances 0.000 claims 1
- 229920000573 polyethylene Polymers 0.000 claims 1
- -1 polypropylene Polymers 0.000 claims 1
- 229920001155 polypropylene Polymers 0.000 claims 1
- 229920005653 propylene-ethylene copolymer Polymers 0.000 abstract 1
- 230000000295 complement effect Effects 0.000 description 2
- 238000001746 injection moulding Methods 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- NLZUEZXRPGMBCV-UHFFFAOYSA-N Butylhydroxytoluene Chemical compound CC1=CC(C(C)(C)C)=C(O)C(C(C)(C)C)=C1 NLZUEZXRPGMBCV-UHFFFAOYSA-N 0.000 description 1
- 101100334009 Caenorhabditis elegans rib-2 gene Proteins 0.000 description 1
- 239000004677 Nylon Substances 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 238000010276 construction Methods 0.000 description 1
- 229920001577 copolymer Polymers 0.000 description 1
- 239000000789 fastener Substances 0.000 description 1
- 210000004124 hock Anatomy 0.000 description 1
- JEIPFZHSYJVQDO-UHFFFAOYSA-N iron(III) oxide Inorganic materials O=[Fe]O[Fe]=O JEIPFZHSYJVQDO-UHFFFAOYSA-N 0.000 description 1
- 229920001778 nylon Polymers 0.000 description 1
Classifications
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B42—BOOKBINDING; ALBUMS; FILES; SPECIAL PRINTED MATTER
- B42F—SHEETS TEMPORARILY ATTACHED TOGETHER; FILING APPLIANCES; FILE CARDS; INDEXING
- B42F13/00—Filing appliances with means for engaging perforations or slots
- B42F13/02—Filing appliances with means for engaging perforations or slots with flexible or resilient means
- B42F13/06—Filing appliances with means for engaging perforations or slots with flexible or resilient means with strips or bands
- B42F13/10—Filing appliances with means for engaging perforations or slots with flexible or resilient means with strips or bands of plastics
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| AUPC332475 | 1975-09-25 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1061215A true CA1061215A (en) | 1979-08-28 |
Family
ID=3766376
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA261,840A Expired CA1061215A (en) | 1975-09-25 | 1976-09-22 | Extensible paper fastening device |
Country Status (17)
| Country | Link |
|---|---|
| US (1) | US4070736A (enExample) |
| JP (1) | JPS5850879B2 (enExample) |
| BR (1) | BR7606384A (enExample) |
| CA (1) | CA1061215A (enExample) |
| CH (1) | CH610548A5 (enExample) |
| DE (1) | DE2643006C3 (enExample) |
| DK (1) | DK143258C (enExample) |
| FR (1) | FR2325571A1 (enExample) |
| GB (1) | GB1525997A (enExample) |
| HK (1) | HK22780A (enExample) |
| IT (1) | IT1068167B (enExample) |
| MY (1) | MY8100052A (enExample) |
| NL (1) | NL179354C (enExample) |
| NO (1) | NO146768C (enExample) |
| NZ (1) | NZ182162A (enExample) |
| SE (1) | SE423511B (enExample) |
| ZA (1) | ZA765496B (enExample) |
Families Citing this family (19)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4174910A (en) * | 1978-02-28 | 1979-11-20 | Mechanical Plastics Corp. | Paper clip and binder device |
| US4453851A (en) * | 1979-04-19 | 1984-06-12 | Purcocks Dale M | Securing device, the formation thereof, and a binder system |
| US4382708A (en) * | 1979-11-13 | 1983-05-10 | Permclip Products Corporation | Paper compressor |
| US4483637A (en) * | 1982-06-29 | 1984-11-20 | Moore Business Forms, Inc. | Binder for business forms |
| GB8317498D0 (en) * | 1983-06-28 | 1983-08-03 | Savory & Sons Sales Ltd | Paper fastener |
| JPS6255478U (enExample) * | 1985-09-27 | 1987-04-06 | ||
| JPS6287874U (enExample) * | 1985-11-25 | 1987-06-04 | ||
| US4979841A (en) * | 1989-12-04 | 1990-12-25 | Lauder John A | Member for sheet binding staple |
| US5096323A (en) * | 1991-07-05 | 1992-03-17 | Walker Frank J | Prong type stacked paper fastener |
| SE503832C2 (sv) * | 1995-01-11 | 1996-09-16 | Anders Benson | Tillhållare för mappar avsedda för dokumentförvaring |
| US6217246B1 (en) * | 2000-04-04 | 2001-04-17 | Chung Cheng Yu | Two-piece paper fastener having rounded sides |
| WO2003020533A1 (en) * | 2001-08-29 | 2003-03-13 | General Binding Corporation | Binding elements for binding a wide range of thicknesses of stacks of sheets |
| US7207740B1 (en) * | 2004-06-01 | 2007-04-24 | Baggett R Sherman | Stacked paper fastener |
| JP4486683B2 (ja) * | 2004-07-12 | 2010-06-23 | ゼネラル バインディング コーポレーション | 自動化工程に特に適した単数及び複数の綴じ具 |
| US8123448B2 (en) * | 2005-08-16 | 2012-02-28 | General Binding Corporation | Apparatus and methods for automatically binding a stack of sheets with a nonspiral binding element |
| US7527449B2 (en) * | 2005-12-12 | 2009-05-05 | Staples The Office Superstore, Llc | Ring binder mechanism |
| US7524127B2 (en) | 2005-12-12 | 2009-04-28 | Staples The Office Superstore, Llc | Ring binder mechanism |
| US7399136B2 (en) | 2006-01-06 | 2008-07-15 | Staples The Office Superstore Llc | Molded binder |
| USD620977S1 (en) | 2006-08-04 | 2010-08-03 | General Binding Corporation | Binding element |
Family Cites Families (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2888055A (en) * | 1959-05-26 | Wallet card holding and display book and clamp therefor | ||
| CA713853A (en) * | 1965-07-20 | Howard C. Smith | Sheet fastening device | |
| NL258793A (enExample) * | ||||
| US1927623A (en) * | 1932-12-12 | 1933-09-19 | Eastern Tool & Mfg Co | Paper fastener |
| US2160564A (en) * | 1934-01-22 | 1939-05-30 | Yawman & Erbe Mfg Co | Paper fastener |
| US2192701A (en) * | 1937-09-08 | 1940-03-05 | Vogel Max | Prong fastener for binders, folders, and the like |
| US2328416A (en) * | 1942-07-28 | 1943-08-31 | Nat Fiberstok Envelope Co | Loose-leaf binder |
| US2328268A (en) * | 1943-03-05 | 1943-08-31 | Peerless Key Imp Mfg Co | Paper fastener |
| US2386723A (en) * | 1943-12-09 | 1945-10-09 | William L Sparks | Fastener |
| US2498901A (en) * | 1944-09-18 | 1950-02-28 | Wilson Jones Co | Paper fastener |
| GB862775A (en) * | 1958-09-16 | 1961-03-15 | Georg Alfred Zippel | Improvements in binders for documents |
| US3176363A (en) * | 1963-02-18 | 1965-04-06 | Natser Corp | Paper fastener |
| US3362411A (en) * | 1965-12-13 | 1968-01-09 | Carl G. Moller | Loose leaf binder |
| JPS4826587U (enExample) * | 1971-07-30 | 1973-03-30 | ||
| JPS5228591Y2 (enExample) * | 1973-08-08 | 1977-06-29 |
-
1976
- 1976-09-14 ZA ZA765496A patent/ZA765496B/xx unknown
- 1976-09-15 GB GB38204/76A patent/GB1525997A/en not_active Expired
- 1976-09-21 US US05/725,413 patent/US4070736A/en not_active Expired - Lifetime
- 1976-09-21 SE SE7610439A patent/SE423511B/xx unknown
- 1976-09-22 CA CA261,840A patent/CA1061215A/en not_active Expired
- 1976-09-23 CH CH1205676A patent/CH610548A5/xx not_active IP Right Cessation
- 1976-09-23 DK DK429376A patent/DK143258C/da not_active Application Discontinuation
- 1976-09-23 NL NLAANVRAGE7610554,A patent/NL179354C/xx not_active IP Right Cessation
- 1976-09-24 NO NO76763289A patent/NO146768C/no unknown
- 1976-09-24 DE DE2643006A patent/DE2643006C3/de not_active Expired
- 1976-09-24 IT IT12809/76A patent/IT1068167B/it active
- 1976-09-24 NZ NZ182162A patent/NZ182162A/xx unknown
- 1976-09-24 BR BR7606384A patent/BR7606384A/pt unknown
- 1976-09-24 FR FR7628737A patent/FR2325571A1/fr active Granted
- 1976-09-24 JP JP51115358A patent/JPS5850879B2/ja not_active Expired
-
1980
- 1980-05-01 HK HK227/80A patent/HK22780A/xx unknown
-
1981
- 1981-12-30 MY MY52/81A patent/MY8100052A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| ZA765496B (en) | 1977-08-31 |
| US4070736A (en) | 1978-01-31 |
| JPS5256628A (en) | 1977-05-10 |
| SE7610439L (sv) | 1977-03-26 |
| BR7606384A (pt) | 1977-06-21 |
| DK143258C (da) | 1981-12-07 |
| JPS5850879B2 (ja) | 1983-11-12 |
| MY8100052A (en) | 1981-12-31 |
| DE2643006A1 (de) | 1977-04-07 |
| NO763289L (no) | 1977-03-28 |
| FR2325571B1 (enExample) | 1981-05-29 |
| NZ182162A (en) | 1978-11-13 |
| FR2325571A1 (fr) | 1977-04-22 |
| NL7610554A (nl) | 1977-03-29 |
| DK429376A (da) | 1977-03-26 |
| SE423511B (sv) | 1982-05-10 |
| DK143258B (da) | 1981-08-03 |
| GB1525997A (en) | 1978-09-27 |
| IT1068167B (it) | 1985-03-21 |
| HK22780A (en) | 1980-05-09 |
| NL179354C (nl) | 1986-09-01 |
| CH610548A5 (enExample) | 1979-04-30 |
| DE2643006B2 (de) | 1980-06-12 |
| DE2643006C3 (de) | 1981-02-19 |
| NO146768B (no) | 1982-08-30 |
| NO146768C (no) | 1982-12-08 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1061215A (en) | Extensible paper fastening device | |
| US5142733A (en) | Mat holders | |
| US4588628A (en) | Floor mat | |
| US20020162564A1 (en) | Hair clip | |
| US4693624A (en) | Binding mechanism for perforated papers | |
| US4577985A (en) | Ring binder | |
| US3313304A (en) | Binder | |
| US5018896A (en) | Snap ring assembly | |
| JPH0588679B2 (enExample) | ||
| US3944033A (en) | Bag handle | |
| US5405209A (en) | Paper binder for folders | |
| US4200404A (en) | Loose leaf binders | |
| US20020015613A1 (en) | Fastener for a folder | |
| WO1994015798A2 (en) | Hinged loose-leaf retainer system | |
| US4000951A (en) | Loose leaf binders | |
| US5716153A (en) | Safety ring binder | |
| US3276450A (en) | Binding means | |
| US4180340A (en) | Binder post connection | |
| US4564983A (en) | Device for fastening a belt or the like | |
| US4185934A (en) | Filler cradle for looseleaf ringbinders | |
| US4979841A (en) | Member for sheet binding staple | |
| US5440829A (en) | Hook holder | |
| JPH0551996U (ja) | 可撓性長尺物の係止構造 | |
| US891490A (en) | Temporary binder for shoe-uppers. | |
| US4486111A (en) | Data binder slide |