CA1050682A - Flame retardant polycarbonate composition - Google Patents
Flame retardant polycarbonate compositionInfo
- Publication number
- CA1050682A CA1050682A CA211,444A CA211444A CA1050682A CA 1050682 A CA1050682 A CA 1050682A CA 211444 A CA211444 A CA 211444A CA 1050682 A CA1050682 A CA 1050682A
- Authority
- CA
- Canada
- Prior art keywords
- additive
- composition
- aromatic
- group
- metal
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000000203 mixture Substances 0.000 title claims abstract description 29
- RNFJDJUURJAICM-UHFFFAOYSA-N 2,2,4,4,6,6-hexaphenoxy-1,3,5-triaza-2$l^{5},4$l^{5},6$l^{5}-triphosphacyclohexa-1,3,5-triene Chemical compound N=1P(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP=1(OC=1C=CC=CC=1)OC1=CC=CC=C1 RNFJDJUURJAICM-UHFFFAOYSA-N 0.000 title claims abstract description 15
- 239000003063 flame retardant Substances 0.000 title claims abstract description 15
- 229920000515 polycarbonate Polymers 0.000 title abstract description 17
- 239000004417 polycarbonate Substances 0.000 title abstract description 17
- 239000000654 additive Substances 0.000 claims abstract description 40
- 230000000996 additive effect Effects 0.000 claims abstract description 34
- 125000003118 aryl group Chemical group 0.000 claims abstract description 29
- 229910052751 metal Inorganic materials 0.000 claims abstract description 21
- 239000002184 metal Substances 0.000 claims abstract description 21
- -1 aromatic carboxylic acids Chemical class 0.000 claims abstract description 19
- 150000003839 salts Chemical class 0.000 claims abstract description 16
- 150000002148 esters Chemical class 0.000 claims abstract description 13
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 claims abstract description 12
- 150000003460 sulfonic acids Chemical class 0.000 claims abstract description 11
- 229920000642 polymer Polymers 0.000 claims abstract description 9
- 150000003254 radicals Chemical class 0.000 claims description 17
- 229910052784 alkaline earth metal Inorganic materials 0.000 claims description 8
- 229910052783 alkali metal Inorganic materials 0.000 claims description 6
- 150000001340 alkali metals Chemical class 0.000 claims description 5
- 125000004432 carbon atom Chemical group C* 0.000 claims description 5
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 4
- 125000003342 alkenyl group Chemical group 0.000 claims description 4
- 125000000217 alkyl group Chemical group 0.000 claims description 4
- 229910052801 chlorine Inorganic materials 0.000 claims description 4
- 239000000460 chlorine Substances 0.000 claims description 4
- 239000003513 alkali Substances 0.000 claims description 3
- 150000005840 aryl radicals Chemical group 0.000 claims description 3
- 230000000737 periodic effect Effects 0.000 claims description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 2
- 125000001931 aliphatic group Chemical group 0.000 claims description 2
- 125000004450 alkenylene group Chemical group 0.000 claims description 2
- 125000001118 alkylidene group Chemical group 0.000 claims description 2
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 2
- 229910052794 bromium Inorganic materials 0.000 claims description 2
- 125000000392 cycloalkenyl group Chemical group 0.000 claims description 2
- 229910052731 fluorine Inorganic materials 0.000 claims description 2
- 239000011737 fluorine Substances 0.000 claims description 2
- 229910052736 halogen Inorganic materials 0.000 claims description 2
- 150000002367 halogens Chemical class 0.000 claims description 2
- 229920001707 polybutylene terephthalate Polymers 0.000 claims description 2
- 150000001342 alkaline earth metals Chemical class 0.000 claims 3
- 125000002947 alkylene group Chemical group 0.000 claims 1
- 125000000753 cycloalkyl group Chemical group 0.000 claims 1
- IAYYYSOVVFWEII-UHFFFAOYSA-L disodium 2,5-dichloro-4-sulfobenzoate Chemical group ClC1=C(C(=O)[O-])C=C(C(=C1)S(=O)(=O)O)Cl.[Na+].[Na+].ClC1=C(C(=O)[O-])C=C(C(=C1)S(=O)(=O)O)Cl IAYYYSOVVFWEII-UHFFFAOYSA-L 0.000 claims 1
- 229920000139 polyethylene terephthalate Polymers 0.000 claims 1
- 239000005020 polyethylene terephthalate Substances 0.000 claims 1
- XWFVPKXJJRNIKZ-UHFFFAOYSA-N sodium;2,4,6-trichloro-3,5-bis(methoxycarbonyl)benzenesulfonic acid Chemical group [Na].COC(=O)C1=C(Cl)C(C(=O)OC)=C(Cl)C(S(O)(=O)=O)=C1Cl XWFVPKXJJRNIKZ-UHFFFAOYSA-N 0.000 claims 1
- UJUUKGCHZOAEAU-UHFFFAOYSA-K trisodium 2,4,6-trichloro-3,5-disulfobenzoate Chemical group ClC1=C(C(=O)[O-])C(=C(C(=C1S(=O)(=O)O)Cl)S(=O)(=O)O)Cl.[Na+].[Na+].[Na+].ClC1=C(C(=O)[O-])C(=C(C(=C1S(=O)(=O)O)Cl)S(=O)(=O)O)Cl.ClC1=C(C(=O)[O-])C(=C(C(=C1S(=O)(=O)O)Cl)S(=O)(=O)O)Cl UJUUKGCHZOAEAU-UHFFFAOYSA-K 0.000 claims 1
- 229920001169 thermoplastic Polymers 0.000 abstract 1
- 239000004416 thermosoftening plastic Substances 0.000 abstract 1
- 239000002253 acid Substances 0.000 description 12
- ATUOYWHBWRKTHZ-UHFFFAOYSA-N Propane Chemical compound CCC ATUOYWHBWRKTHZ-UHFFFAOYSA-N 0.000 description 8
- 150000007513 acids Chemical class 0.000 description 6
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 5
- 238000000034 method Methods 0.000 description 5
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 4
- 239000001294 propane Substances 0.000 description 4
- 229920000742 Cotton Polymers 0.000 description 3
- IISBACLAFKSPIT-UHFFFAOYSA-N bisphenol A Chemical compound C=1C=C(O)C=CC=1C(C)(C)C1=CC=C(O)C=C1 IISBACLAFKSPIT-UHFFFAOYSA-N 0.000 description 3
- 239000011575 calcium Substances 0.000 description 3
- 230000015556 catabolic process Effects 0.000 description 3
- 238000006731 degradation reaction Methods 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 239000002243 precursor Substances 0.000 description 3
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 2
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 2
- 229920001634 Copolyester Polymers 0.000 description 2
- 101100536354 Drosophila melanogaster tant gene Proteins 0.000 description 2
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 2
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 229910052791 calcium Inorganic materials 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 230000000593 degrading effect Effects 0.000 description 2
- SNRUBQQJIBEYMU-UHFFFAOYSA-N dodecane Chemical compound CCCCCCCCCCCC SNRUBQQJIBEYMU-UHFFFAOYSA-N 0.000 description 2
- 229910052744 lithium Inorganic materials 0.000 description 2
- 229910052749 magnesium Inorganic materials 0.000 description 2
- 239000011777 magnesium Substances 0.000 description 2
- 235000001055 magnesium Nutrition 0.000 description 2
- 229940091250 magnesium supplement Drugs 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 239000002245 particle Substances 0.000 description 2
- 230000000704 physical effect Effects 0.000 description 2
- 229910052701 rubidium Inorganic materials 0.000 description 2
- IGLNJRXAVVLDKE-UHFFFAOYSA-N rubidium atom Chemical compound [Rb] IGLNJRXAVVLDKE-UHFFFAOYSA-N 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 229910052712 strontium Inorganic materials 0.000 description 2
- CIOAGBVUUVVLOB-UHFFFAOYSA-N strontium atom Chemical compound [Sr] CIOAGBVUUVVLOB-UHFFFAOYSA-N 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- 238000010998 test method Methods 0.000 description 2
- DJHWAIPYZDRNMH-UHFFFAOYSA-N 1,2,3,4,5-pentabromo-6-(2-bromophenyl)benzene Chemical group BrC1=CC=CC=C1C1=C(Br)C(Br)=C(Br)C(Br)=C1Br DJHWAIPYZDRNMH-UHFFFAOYSA-N 0.000 description 1
- DEIGXXQKDWULML-UHFFFAOYSA-N 1,2,5,6,9,10-hexabromocyclododecane Chemical compound BrC1CCC(Br)C(Br)CCC(Br)C(Br)CCC1Br DEIGXXQKDWULML-UHFFFAOYSA-N 0.000 description 1
- KEQGZUUPPQEDPF-UHFFFAOYSA-N 1,3-dichloro-5,5-dimethylimidazolidine-2,4-dione Chemical compound CC1(C)N(Cl)C(=O)N(Cl)C1=O KEQGZUUPPQEDPF-UHFFFAOYSA-N 0.000 description 1
- YMTYZTXUZLQUSF-UHFFFAOYSA-N 3,3'-Dimethylbisphenol A Chemical compound C1=C(O)C(C)=CC(C(C)(C)C=2C=C(C)C(O)=CC=2)=C1 YMTYZTXUZLQUSF-UHFFFAOYSA-N 0.000 description 1
- PQXDWLVQNPRVNU-UHFFFAOYSA-N 3,7-bis(ethoxycarbonyl)naphthalene-1-sulfonic acid Chemical compound C1=C(C(=O)OCC)C=C(S(O)(=O)=O)C2=CC(C(=O)OCC)=CC=C21 PQXDWLVQNPRVNU-UHFFFAOYSA-N 0.000 description 1
- MLDIQALUMKMHCC-UHFFFAOYSA-N 4,4-Bis(4-hydroxyphenyl)heptane Chemical compound C=1C=C(O)C=CC=1C(CCC)(CCC)C1=CC=C(O)C=C1 MLDIQALUMKMHCC-UHFFFAOYSA-N 0.000 description 1
- 125000004203 4-hydroxyphenyl group Chemical group [H]OC1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 229930185605 Bisphenol Natural products 0.000 description 1
- 101100087530 Caenorhabditis elegans rom-1 gene Proteins 0.000 description 1
- 101100042371 Caenorhabditis elegans set-3 gene Proteins 0.000 description 1
- 241000784713 Cupido Species 0.000 description 1
- 244000228957 Ferula foetida Species 0.000 description 1
- 239000009180 Flamin Substances 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 101150007144 Intu gene Proteins 0.000 description 1
- 101100536883 Legionella pneumophila subsp. pneumophila (strain Philadelphia 1 / ATCC 33152 / DSM 7513) thi5 gene Proteins 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 101100305983 Mus musculus Rom1 gene Proteins 0.000 description 1
- BFYWEEYSTUUOFQ-UHFFFAOYSA-N OC1=CC=C(C=C1)C(C)(C)C1=CC=C(C=C1)O.C(CCC(=O)O)(=O)O Chemical compound OC1=CC=C(C=C1)C(C)(C)C1=CC=C(C=C1)O.C(CCC(=O)O)(=O)O BFYWEEYSTUUOFQ-UHFFFAOYSA-N 0.000 description 1
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 101100240664 Schizosaccharomyces pombe (strain 972 / ATCC 24843) nmt1 gene Proteins 0.000 description 1
- 125000002070 alkenylidene group Chemical group 0.000 description 1
- 229910052787 antimony Inorganic materials 0.000 description 1
- WATWJIUSRGPENY-UHFFFAOYSA-N antimony atom Chemical compound [Sb] WATWJIUSRGPENY-UHFFFAOYSA-N 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 229910052788 barium Inorganic materials 0.000 description 1
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 229940106691 bisphenol a Drugs 0.000 description 1
- LBQQZNWFBQNKCL-UHFFFAOYSA-N butane-1,1-diol;ethane-1,2-diol;terephthalic acid Chemical compound OCCO.CCCC(O)O.OC(=O)C1=CC=C(C(O)=O)C=C1 LBQQZNWFBQNKCL-UHFFFAOYSA-N 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- GPUADMRJQVPIAS-QCVDVZFFSA-M cerivastatin sodium Chemical compound [Na+].COCC1=C(C(C)C)N=C(C(C)C)C(\C=C\[C@@H](O)C[C@@H](O)CC([O-])=O)=C1C1=CC=C(F)C=C1 GPUADMRJQVPIAS-QCVDVZFFSA-M 0.000 description 1
- 159000000006 cesium salts Chemical class 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- XTHPWXDJESJLNJ-UHFFFAOYSA-N chlorosulfonic acid Substances OS(Cl)(=O)=O XTHPWXDJESJLNJ-UHFFFAOYSA-N 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 239000003431 cross linking reagent Substances 0.000 description 1
- 125000004093 cyano group Chemical group *C#N 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 125000004970 halomethyl group Chemical group 0.000 description 1
- 125000004464 hydroxyphenyl group Chemical group 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 239000008188 pellet Substances 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- XNGIFLGASWRNHJ-UHFFFAOYSA-L phthalate(2-) Chemical compound [O-]C(=O)C1=CC=CC=C1C([O-])=O XNGIFLGASWRNHJ-UHFFFAOYSA-L 0.000 description 1
- 150000003071 polychlorinated biphenyls Chemical group 0.000 description 1
- 229920000728 polyester Polymers 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 1
- 238000006277 sulfonation reaction Methods 0.000 description 1
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 1
- 125000004953 trihalomethyl group Chemical group 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K5/00—Use of organic ingredients
- C08K5/36—Sulfur-, selenium-, or tellurium-containing compounds
- C08K5/41—Compounds containing sulfur bound to oxygen
- C08K5/42—Sulfonic acids; Derivatives thereof
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08L—COMPOSITIONS OF MACROMOLECULAR COMPOUNDS
- C08L67/00—Compositions of polyesters obtained by reactions forming a carboxylic ester link in the main chain; Compositions of derivatives of such polymers
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08L—COMPOSITIONS OF MACROMOLECULAR COMPOUNDS
- C08L69/00—Compositions of polycarbonates; Compositions of derivatives of polycarbonates
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Compositions Of Macromolecular Compounds (AREA)
- Polyesters Or Polycarbonates (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/429,127 US3953399A (en) | 1973-12-28 | 1973-12-28 | Flame retardant polycarbonate composition |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1050682A true CA1050682A (en) | 1979-03-13 |
Family
ID=23701923
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA211,444A Expired CA1050682A (en) | 1973-12-28 | 1974-10-15 | Flame retardant polycarbonate composition |
Country Status (9)
| Country | Link |
|---|---|
| US (2) | US3953399A (OSRAM) |
| JP (1) | JPS5733302B2 (OSRAM) |
| BR (1) | BR7410865D0 (OSRAM) |
| CA (1) | CA1050682A (OSRAM) |
| DE (1) | DE2458527C2 (OSRAM) |
| FR (1) | FR2256212B1 (OSRAM) |
| GB (1) | GB1495738A (OSRAM) |
| IT (1) | IT1027806B (OSRAM) |
| NL (1) | NL174655C (OSRAM) |
Families Citing this family (25)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4535108A (en) * | 1981-02-25 | 1985-08-13 | General Electric Company | Flame retardant polycarbonate |
| US4371650A (en) * | 1981-03-26 | 1983-02-01 | General Electric Company | Flame retardant polycarbonates |
| US4600742A (en) * | 1984-08-17 | 1986-07-15 | The Lubrizol Corporation | Polycarbonate compositions |
| US5037889A (en) * | 1986-12-23 | 1991-08-06 | General Electric Company | Resin blends exhibiting improved impact properties |
| US4902737A (en) * | 1986-12-23 | 1990-02-20 | General Electric Company | Resin blends exhibiting improved impact properties |
| US5162405A (en) * | 1987-12-24 | 1992-11-10 | Elf Atochem North America, Inc. | Single-functional and mixtures of multi-functional oligomeric performance additive compositions and their uses |
| US5013777A (en) * | 1987-12-24 | 1991-05-07 | Atochem North America, Inc. | Novel single-functional and mixtures of multi-functional oligomeric performance additive compositions and their uses |
| US4994510A (en) * | 1990-04-05 | 1991-02-19 | General Electric Company | Poly(carbonate-siloxane) with reduced tendency to burn |
| JPH0479982U (OSRAM) * | 1990-11-26 | 1992-07-13 | ||
| DE4130331A1 (de) * | 1991-09-12 | 1993-03-18 | Bayer Ag | Flammwidrige polycarbonatformmassen |
| DE4221581A1 (de) * | 1992-03-18 | 1993-09-23 | Bayer Ag | Verwendung von salzen in kombination mit halogenierten phthalimiden zur flammfestausruestung von glasfaserhaltigen polycarbonatformkoerpern |
| JPH07502068A (ja) * | 1992-10-07 | 1995-03-02 | ゼネラル エレクトリック カンパニイ | 滴下が減少した耐燃性熱可塑性樹脂ブレンド |
| US5364895A (en) * | 1993-01-20 | 1994-11-15 | Dover Chemical Corp. | Hydrolytically stable pentaerythritol diphosphites |
| US5438086A (en) * | 1993-08-30 | 1995-08-01 | Stevenson; Donald R. | Hydrolytically stable pentaerythritol diphosphites |
| US6066694A (en) * | 1998-03-04 | 2000-05-23 | General Electric Company | Polyester molding composition |
| DE19907831A1 (de) | 1999-02-24 | 2000-08-31 | Bayer Ag | Flammwidrige thermoplastische Formmasse |
| US6518340B1 (en) | 2001-08-07 | 2003-02-11 | General Electric Company | Polycarbonate resin compositions and articles therefrom |
| DE10247777A1 (de) * | 2002-10-14 | 2004-04-22 | Bayer Ag | Flammgeschützte Polycarbonate und Polyestercarbonate |
| US6995212B2 (en) | 2003-08-08 | 2006-02-07 | Bayer Materialscience Llc | Flame retardant, thermoplastic polycarbonate molding compositions |
| EP1791908B1 (en) * | 2004-09-14 | 2008-12-31 | Bayer MaterialScience LLC | Flame retardant, thermoplastic polycarbonate molding compositions |
| US20080167440A1 (en) * | 2007-01-10 | 2008-07-10 | Pickel Deanna L | Use of copolymerizable sulfonate salts to promote char formation in polyesters and copolyesters |
| DE102007040925A1 (de) | 2007-08-30 | 2009-03-05 | Bayer Materialscience Ag | Thermoplastische Zusammensetzungen mit geringer Trübung |
| WO2011049228A1 (ja) | 2009-10-19 | 2011-04-28 | 帝人化成株式会社 | 芳香族ポリカーボネート樹脂組成物 |
| WO2011055854A1 (ja) | 2009-11-05 | 2011-05-12 | 帝人化成株式会社 | 芳香族ポリカーボネート樹脂組成物からなる押し出し成形品 |
| KR101838994B1 (ko) | 2010-11-05 | 2018-03-15 | 코베스트로 도이칠란드 아게 | 분자량 분해가 낮은 내염성 uv-보호 폴리카보네이트 성형 조성물 |
Family Cites Families (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2283236A (en) * | 1939-06-23 | 1942-05-19 | United Gas Improvement Co | Sulphonated derivatives of polymerized methylstyrene |
| US3018272A (en) * | 1955-06-30 | 1962-01-23 | Du Pont | Sulfonate containing polyesters dyeable with basic dyes |
| US3151153A (en) * | 1958-09-30 | 1964-09-29 | Sinclair Research Inc | Preparation of sulfobenzene carboxylic acid |
| US3398212A (en) * | 1963-07-01 | 1968-08-20 | Eastman Kodak Co | Bisphenol polycarbonates and polyesters containing units derived from a thiodiphenol |
| GB1127925A (en) * | 1964-12-07 | 1968-09-18 | Ici Ltd | Modified polyesters |
| US3374210A (en) * | 1965-09-20 | 1968-03-19 | Grefco | Sulfonated aromatic resins |
| US3475372A (en) * | 1966-08-18 | 1969-10-28 | Mobay Chemical Corp | Flame resistant polycarbonates |
| US3535300A (en) * | 1967-10-12 | 1970-10-20 | Mobay Chemical Corp | Flame resistant polycarbonates |
| AT297333B (de) * | 1969-06-13 | 1972-03-27 | Bayer Ag | Verfahren zur Herstellung von Polycarbonaten mit verminderter Brennbarkeit |
| BE755832A (fr) * | 1969-09-05 | 1971-03-08 | Hoechst Ag | Matieres a mouler thermoplastiques a base de polyesters satures |
| DE2112987C3 (de) * | 1971-03-17 | 1980-04-17 | Bayer Ag, 5090 Leverkusen | Flammwidriges Polycarbonat |
| DE2049358C3 (de) * | 1970-10-08 | 1979-12-06 | Bayer Ag, 5090 Leverkusen | Flammwidriges Polycarbonat |
| DE2149311A1 (de) * | 1971-10-02 | 1973-04-05 | Bayer Ag | Flammwidrige polycarbonate |
| BE790919R (fr) * | 1971-11-03 | 1973-05-03 | Bayer Ag | Polycarbonates thermoplastiques a poids moleculaire eleve de phenols |
-
1973
- 1973-12-28 US US05/429,127 patent/US3953399A/en not_active Expired - Lifetime
-
1974
- 1974-10-15 CA CA211,444A patent/CA1050682A/en not_active Expired
- 1974-12-11 DE DE2458527A patent/DE2458527C2/de not_active Expired
- 1974-12-16 GB GB54250/74A patent/GB1495738A/en not_active Expired
- 1974-12-16 JP JP14491674A patent/JPS5733302B2/ja not_active Expired
- 1974-12-19 IT IT30728/74A patent/IT1027806B/it active
- 1974-12-20 NL NLAANVRAGE7416729,A patent/NL174655C/xx not_active IP Right Cessation
- 1974-12-26 BR BR10865/74A patent/BR7410865D0/pt unknown
- 1974-12-27 FR FR7443090A patent/FR2256212B1/fr not_active Expired
-
1976
- 1976-03-26 US US05/670,680 patent/US4064101A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| DE2458527C2 (de) | 1986-12-04 |
| BR7410865D0 (pt) | 1975-09-02 |
| AU7586574A (en) | 1976-06-03 |
| NL174655B (nl) | 1984-02-16 |
| FR2256212A1 (OSRAM) | 1975-07-25 |
| NL174655C (nl) | 1984-07-16 |
| NL7416729A (nl) | 1975-07-01 |
| GB1495738A (en) | 1977-12-21 |
| DE2458527A1 (de) | 1975-07-10 |
| US4064101A (en) | 1977-12-20 |
| FR2256212B1 (OSRAM) | 1980-05-23 |
| US3953399A (en) | 1976-04-27 |
| JPS5098540A (OSRAM) | 1975-08-05 |
| JPS5733302B2 (OSRAM) | 1982-07-16 |
| IT1027806B (it) | 1978-12-20 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1050682A (en) | Flame retardant polycarbonate composition | |
| US3978024A (en) | Flame retardant polycarbonate composition | |
| US3948851A (en) | Flame retardant polycarbonate composition | |
| US3940366A (en) | Flame retardant polycarbonate composition | |
| US4115354A (en) | Flame retardant polycarbonate composition | |
| CA1048677A (en) | Flame retardant polycarbonate composition | |
| US3951910A (en) | Flame retardant polycarbonate composition | |
| CA1048678A (en) | Flame retardant polycarbonate composition | |
| US3909490A (en) | Flame retardant polycarbonate composition | |
| US4093589A (en) | Non-opaque flame retardant polycarbonate composition | |
| US3931100A (en) | Flame retardant polycarbonate composition | |
| CA1049681A (en) | Flame retardant polycarbonate composition | |
| DE2535262A1 (de) | Flammhemmende polycarbonatzusammensetzung | |
| CA1048190A (en) | Flame retardant polycarbonate composition | |
| US4735978A (en) | Flame retardant polycarbonate composition | |
| US4104246A (en) | Non-opaque flame-retardant polycarbonate composition | |
| CA1063282A (en) | Flame retardant polycarbonate composition | |
| US4067846A (en) | Non-opaque flame retardant polycarbonate composition | |
| CA1062836A (en) | Flame retardant polycarbonate composition | |
| GB1564469A (en) | On-opaque-flame-retardant polycarbonate composition | |
| CA1062837A (en) | Flame retardant polycarbonate composition | |
| US4001175A (en) | Flame retardant polycarbonate composition | |
| US4039509A (en) | Non-opaque flame retardant polycarbonate composition | |
| US4032506A (en) | Flame retardant polycarbonate composition | |
| US4033930A (en) | Flame retardant polycarbonate composition |