CA1048521A - Process for producing low and high molecular weight diorganopolysiloxanes for use in heat vulcanizable silicone rubber compositions - Google Patents
Process for producing low and high molecular weight diorganopolysiloxanes for use in heat vulcanizable silicone rubber compositionsInfo
- Publication number
- CA1048521A CA1048521A CA75222206A CA222206A CA1048521A CA 1048521 A CA1048521 A CA 1048521A CA 75222206 A CA75222206 A CA 75222206A CA 222206 A CA222206 A CA 222206A CA 1048521 A CA1048521 A CA 1048521A
- Authority
- CA
- Canada
- Prior art keywords
- cyclic
- carbon atoms
- formula
- class consisting
- radicals
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title claims abstract description 71
- 239000000203 mixture Substances 0.000 title claims description 50
- 229920005645 diorganopolysiloxane polymer Polymers 0.000 title claims description 43
- 229920002379 silicone rubber Polymers 0.000 title description 8
- 239000004945 silicone rubber Substances 0.000 title description 5
- 125000004122 cyclic group Chemical group 0.000 claims abstract description 131
- 239000003054 catalyst Substances 0.000 claims abstract description 49
- 125000000962 organic group Chemical group 0.000 claims abstract description 20
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 12
- -1 siloxane chains Chemical group 0.000 claims description 159
- 125000004432 carbon atom Chemical group C* 0.000 claims description 57
- 229920001296 polysiloxane Polymers 0.000 claims description 57
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 28
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 25
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 24
- 229920001577 copolymer Polymers 0.000 claims description 23
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 23
- 229920002554 vinyl polymer Polymers 0.000 claims description 21
- HUCVOHYBFXVBRW-UHFFFAOYSA-M caesium hydroxide Chemical compound [OH-].[Cs+] HUCVOHYBFXVBRW-UHFFFAOYSA-M 0.000 claims description 20
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 claims description 17
- 239000004215 Carbon black (E152) Substances 0.000 claims description 16
- 229930195733 hydrocarbon Natural products 0.000 claims description 16
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 15
- 125000001931 aliphatic group Chemical group 0.000 claims description 14
- 229910052757 nitrogen Inorganic materials 0.000 claims description 13
- 239000003039 volatile agent Substances 0.000 claims description 12
- 239000011541 reaction mixture Substances 0.000 claims description 11
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 claims description 8
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 7
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 6
- 229910052801 chlorine Inorganic materials 0.000 claims description 6
- 239000000460 chlorine Substances 0.000 claims description 6
- 150000001875 compounds Chemical class 0.000 claims description 6
- 230000003472 neutralizing effect Effects 0.000 claims description 6
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 5
- 229910052794 bromium Inorganic materials 0.000 claims description 5
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 4
- 229910000147 aluminium phosphate Inorganic materials 0.000 claims description 4
- 239000004615 ingredient Substances 0.000 claims description 4
- 238000010438 heat treatment Methods 0.000 claims description 3
- BHEPBYXIRTUNPN-UHFFFAOYSA-N hydridophosphorus(.) (triplet) Chemical compound [PH] BHEPBYXIRTUNPN-UHFFFAOYSA-N 0.000 claims description 3
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 claims 1
- 125000005010 perfluoroalkyl group Chemical group 0.000 claims 1
- 229910052698 phosphorus Inorganic materials 0.000 claims 1
- 239000011574 phosphorus Substances 0.000 claims 1
- 239000003921 oil Substances 0.000 abstract description 65
- 238000011067 equilibration Methods 0.000 abstract description 26
- RSNQKPMXXVDJFG-UHFFFAOYSA-N tetrasiloxane Chemical compound [SiH3]O[SiH2]O[SiH2]O[SiH3] RSNQKPMXXVDJFG-UHFFFAOYSA-N 0.000 abstract description 12
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 abstract 1
- MMRXGMFYRAWUAC-UHFFFAOYSA-N O[SiH3].P Chemical compound O[SiH3].P MMRXGMFYRAWUAC-UHFFFAOYSA-N 0.000 abstract 1
- 125000005376 alkyl siloxane group Chemical group 0.000 abstract 1
- KIZFHUJKFSNWKO-UHFFFAOYSA-M calcium monohydroxide Chemical compound [Ca]O KIZFHUJKFSNWKO-UHFFFAOYSA-M 0.000 abstract 1
- 125000001188 haloalkyl group Chemical group 0.000 abstract 1
- 150000003254 radicals Chemical class 0.000 description 31
- 238000006243 chemical reaction Methods 0.000 description 21
- 239000002904 solvent Substances 0.000 description 19
- 229920000642 polymer Polymers 0.000 description 17
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical group [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 description 16
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 15
- 125000001424 substituent group Chemical group 0.000 description 13
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 12
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 12
- 238000005336 cracking Methods 0.000 description 12
- KPUWHANPEXNPJT-UHFFFAOYSA-N disiloxane Chemical compound [SiH3]O[SiH3] KPUWHANPEXNPJT-UHFFFAOYSA-N 0.000 description 11
- MFGOFGRYDNHJTA-UHFFFAOYSA-N 2-amino-1-(2-fluorophenyl)ethanol Chemical compound NCC(O)C1=CC=CC=C1F MFGOFGRYDNHJTA-UHFFFAOYSA-N 0.000 description 10
- 239000000047 product Substances 0.000 description 9
- 229910052710 silicon Inorganic materials 0.000 description 9
- UQSXHKLRYXJYBZ-UHFFFAOYSA-N Iron oxide Chemical compound [Fe]=O UQSXHKLRYXJYBZ-UHFFFAOYSA-N 0.000 description 8
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 8
- 238000006116 polymerization reaction Methods 0.000 description 8
- 239000000654 additive Substances 0.000 description 7
- 239000000178 monomer Substances 0.000 description 7
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 6
- 239000003795 chemical substances by application Substances 0.000 description 6
- 239000000463 material Substances 0.000 description 6
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 6
- 229910052753 mercury Inorganic materials 0.000 description 6
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 5
- 229910052799 carbon Inorganic materials 0.000 description 5
- 238000007334 copolymerization reaction Methods 0.000 description 5
- 238000004519 manufacturing process Methods 0.000 description 5
- 239000003960 organic solvent Substances 0.000 description 5
- 238000002360 preparation method Methods 0.000 description 5
- 125000004469 siloxy group Chemical group [SiH3]O* 0.000 description 5
- 239000013638 trimer Substances 0.000 description 5
- XLOMVQKBTHCTTD-UHFFFAOYSA-N Zinc monoxide Chemical compound [Zn]=O XLOMVQKBTHCTTD-UHFFFAOYSA-N 0.000 description 4
- 230000015572 biosynthetic process Effects 0.000 description 4
- 238000004821 distillation Methods 0.000 description 4
- 229920001971 elastomer Polymers 0.000 description 4
- 238000005755 formation reaction Methods 0.000 description 4
- 230000007062 hydrolysis Effects 0.000 description 4
- 238000006460 hydrolysis reaction Methods 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 4
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 4
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 4
- 239000011347 resin Substances 0.000 description 4
- 229920005989 resin Polymers 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 125000004429 atom Chemical group 0.000 description 3
- 239000002585 base Substances 0.000 description 3
- 229910052792 caesium Inorganic materials 0.000 description 3
- TVFDJXOCXUVLDH-UHFFFAOYSA-N caesium atom Chemical compound [Cs] TVFDJXOCXUVLDH-UHFFFAOYSA-N 0.000 description 3
- 235000011089 carbon dioxide Nutrition 0.000 description 3
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 3
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 3
- DDJSWKLBKSLAAZ-UHFFFAOYSA-N cyclotetrasiloxane Chemical compound O1[SiH2]O[SiH2]O[SiH2]O[SiH2]1 DDJSWKLBKSLAAZ-UHFFFAOYSA-N 0.000 description 3
- 239000012530 fluid Substances 0.000 description 3
- 229910052909 inorganic silicate Inorganic materials 0.000 description 3
- 238000010926 purge Methods 0.000 description 3
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 3
- KOMNUTZXSVSERR-UHFFFAOYSA-N 1,3,5-tris(prop-2-enyl)-1,3,5-triazinane-2,4,6-trione Chemical compound C=CCN1C(=O)N(CC=C)C(=O)N(CC=C)C1=O KOMNUTZXSVSERR-UHFFFAOYSA-N 0.000 description 2
- XMNIXWIUMCBBBL-UHFFFAOYSA-N 2-(2-phenylpropan-2-ylperoxy)propan-2-ylbenzene Chemical compound C=1C=CC=CC=1C(C)(C)OOC(C)(C)C1=CC=CC=C1 XMNIXWIUMCBBBL-UHFFFAOYSA-N 0.000 description 2
- 238000012935 Averaging Methods 0.000 description 2
- 239000004342 Benzoyl peroxide Substances 0.000 description 2
- OMPJBNCRMGITSC-UHFFFAOYSA-N Benzoylperoxide Chemical compound C=1C=CC=CC=1C(=O)OOC(=O)C1=CC=CC=C1 OMPJBNCRMGITSC-UHFFFAOYSA-N 0.000 description 2
- 239000005046 Chlorosilane Substances 0.000 description 2
- 239000005909 Kieselgur Substances 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 2
- 230000032683 aging Effects 0.000 description 2
- 238000004458 analytical method Methods 0.000 description 2
- 235000019400 benzoyl peroxide Nutrition 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 230000015556 catabolic process Effects 0.000 description 2
- KOPOQZFJUQMUML-UHFFFAOYSA-N chlorosilane Chemical class Cl[SiH3] KOPOQZFJUQMUML-UHFFFAOYSA-N 0.000 description 2
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 2
- 238000006731 degradation reaction Methods 0.000 description 2
- LIKFHECYJZWXFJ-UHFFFAOYSA-N dimethyldichlorosilane Chemical compound C[Si](C)(Cl)Cl LIKFHECYJZWXFJ-UHFFFAOYSA-N 0.000 description 2
- 239000000806 elastomer Substances 0.000 description 2
- 239000000945 filler Substances 0.000 description 2
- 239000003063 flame retardant Substances 0.000 description 2
- 229910021485 fumed silica Inorganic materials 0.000 description 2
- 150000002430 hydrocarbons Chemical class 0.000 description 2
- 239000012535 impurity Substances 0.000 description 2
- 150000007522 mineralic acids Chemical class 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- 238000006386 neutralization reaction Methods 0.000 description 2
- 150000001282 organosilanes Chemical class 0.000 description 2
- IGHYQPLIRUHBKO-UHFFFAOYSA-N oxidosilane tetramethylazanium Chemical compound [SiH3][O-].C[N+](C)(C)C IGHYQPLIRUHBKO-UHFFFAOYSA-N 0.000 description 2
- 150000002978 peroxides Chemical class 0.000 description 2
- 239000000049 pigment Substances 0.000 description 2
- 229910052697 platinum Inorganic materials 0.000 description 2
- 230000000379 polymerizing effect Effects 0.000 description 2
- 230000005855 radiation Effects 0.000 description 2
- 239000005060 rubber Substances 0.000 description 2
- 238000000926 separation method Methods 0.000 description 2
- 150000004756 silanes Chemical class 0.000 description 2
- 239000010703 silicon Substances 0.000 description 2
- 239000000377 silicon dioxide Substances 0.000 description 2
- OGIDPMRJRNCKJF-UHFFFAOYSA-N titanium oxide Inorganic materials [Ti]=O OGIDPMRJRNCKJF-UHFFFAOYSA-N 0.000 description 2
- ZQTYRTSKQFQYPQ-UHFFFAOYSA-N trisiloxane Chemical compound [SiH3]O[SiH2]O[SiH3] ZQTYRTSKQFQYPQ-UHFFFAOYSA-N 0.000 description 2
- 239000011787 zinc oxide Substances 0.000 description 2
- IMAYJYGCQCZYID-UHFFFAOYSA-N 1,3,5,7,9,11-hexaoxa-2,4,6,8,10,12-hexasilacyclododecane Chemical class O1[SiH2]O[SiH2]O[SiH2]O[SiH2]O[SiH2]O[SiH2]1 IMAYJYGCQCZYID-UHFFFAOYSA-N 0.000 description 1
- CCPYCNSBZPTUMJ-UHFFFAOYSA-N 1,3,5,7,9,2,4,6,8,10-pentaoxapentasilecane Chemical class O1[SiH2]O[SiH2]O[SiH2]O[SiH2]O[SiH2]1 CCPYCNSBZPTUMJ-UHFFFAOYSA-N 0.000 description 1
- HNEGJTWNOOWEMH-UHFFFAOYSA-N 1-fluoropropane Chemical group [CH2]CCF HNEGJTWNOOWEMH-UHFFFAOYSA-N 0.000 description 1
- RNFJDJUURJAICM-UHFFFAOYSA-N 2,2,4,4,6,6-hexaphenoxy-1,3,5-triaza-2$l^{5},4$l^{5},6$l^{5}-triphosphacyclohexa-1,3,5-triene Chemical compound N=1P(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP=1(OC=1C=CC=CC=1)OC1=CC=CC=C1 RNFJDJUURJAICM-UHFFFAOYSA-N 0.000 description 1
- FBEHFRAORPEGFH-UHFFFAOYSA-N Allyxycarb Chemical compound CNC(=O)OC1=CC(C)=C(N(CC=C)CC=C)C(C)=C1 FBEHFRAORPEGFH-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 241000282320 Panthera leo Species 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 229910052770 Uranium Inorganic materials 0.000 description 1
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 description 1
- NRTJGTSOTDBPDE-UHFFFAOYSA-N [dimethyl(methylsilyloxy)silyl]oxy-dimethyl-trimethylsilyloxysilane Chemical class C[SiH2]O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)C NRTJGTSOTDBPDE-UHFFFAOYSA-N 0.000 description 1
- 238000013019 agitation Methods 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 239000011260 aqueous acid Substances 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- OUKMJYHQZXBWNQ-UHFFFAOYSA-N cesium oxidosilane Chemical compound [Cs+].[SiH3][O-] OUKMJYHQZXBWNQ-UHFFFAOYSA-N 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 230000001276 controlling effect Effects 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- BITPLIXHRASDQB-UHFFFAOYSA-N ethenyl-[ethenyl(dimethyl)silyl]oxy-dimethylsilane Chemical compound C=C[Si](C)(C)O[Si](C)(C)C=C BITPLIXHRASDQB-UHFFFAOYSA-N 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 150000002367 halogens Chemical group 0.000 description 1
- 229920006158 high molecular weight polymer Polymers 0.000 description 1
- 229920001519 homopolymer Polymers 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 238000002386 leaching Methods 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- HMMGMWAXVFQUOA-UHFFFAOYSA-N octamethylcyclotetrasiloxane Chemical compound C[Si]1(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O1 HMMGMWAXVFQUOA-UHFFFAOYSA-N 0.000 description 1
- 125000005004 perfluoroethyl group Chemical group FC(F)(F)C(F)(F)* 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 239000010734 process oil Substances 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 238000002407 reforming Methods 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 239000012763 reinforcing filler Substances 0.000 description 1
- SCPYDCQAZCOKTP-UHFFFAOYSA-N silanol Chemical compound [SiH3]O SCPYDCQAZCOKTP-UHFFFAOYSA-N 0.000 description 1
- 229920005573 silicon-containing polymer Polymers 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 1
- 125000000725 trifluoropropyl group Chemical group [H]C([H])(*)C([H])([H])C(F)(F)F 0.000 description 1
- ORGHESHFQPYLAO-UHFFFAOYSA-N vinyl radical Chemical compound C=[CH] ORGHESHFQPYLAO-UHFFFAOYSA-N 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G77/00—Macromolecular compounds obtained by reactions forming a linkage containing silicon with or without sulfur, nitrogen, oxygen or carbon in the main chain of the macromolecule
- C08G77/04—Polysiloxanes
- C08G77/06—Preparatory processes
- C08G77/08—Preparatory processes characterised by the catalysts used
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G77/00—Macromolecular compounds obtained by reactions forming a linkage containing silicon with or without sulfur, nitrogen, oxygen or carbon in the main chain of the macromolecule
- C08G77/04—Polysiloxanes
- C08G77/22—Polysiloxanes containing silicon bound to organic groups containing atoms other than carbon, hydrogen and oxygen
- C08G77/24—Polysiloxanes containing silicon bound to organic groups containing atoms other than carbon, hydrogen and oxygen halogen-containing groups
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Silicon Polymers (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/463,435 US3937684A (en) | 1974-04-24 | 1974-04-24 | Process for producing high molecular weight diorganopolysiloxanes for use in heat vulcanizable silicone rubber compositions |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1048521A true CA1048521A (en) | 1979-02-13 |
Family
ID=23840068
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA75222206A Expired CA1048521A (en) | 1974-04-24 | 1975-03-17 | Process for producing low and high molecular weight diorganopolysiloxanes for use in heat vulcanizable silicone rubber compositions |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US3937684A (enExample) |
| JP (1) | JPS5639777B2 (enExample) |
| CA (1) | CA1048521A (enExample) |
| DE (1) | DE2517475A1 (enExample) |
| FR (1) | FR2308649A1 (enExample) |
| GB (1) | GB1505747A (enExample) |
Families Citing this family (18)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4341888A (en) * | 1974-04-24 | 1982-07-27 | General Electric Company | Diorganopolysiloxane copolymers and process for the preparation thereof |
| US4272624A (en) * | 1974-04-24 | 1981-06-09 | General Electric Company | Process for producing high molecular weight diorganopolysiloxanes for use in heat vulcanizable silicone rubber compositions |
| GB1543596A (en) * | 1975-05-05 | 1979-04-04 | Gen Electric | Diorganopolysiloxane copolymers and process for the preparation thereof |
| GB1551775A (en) * | 1975-05-05 | 1979-08-30 | Gen Electric | Process for producting diorganopolysioxane oils |
| GB1549344A (en) * | 1975-05-19 | 1979-08-08 | Gen Electric | Process for producing silanol end-stopped diorganopolysiloxane oils |
| US4138349A (en) * | 1977-01-10 | 1979-02-06 | General Electric Company | Silicone lubricant compositions containing trischloroethyl-phosphite and/or bis-chloroethyl chloroethyl phosphonate |
| US4089833A (en) * | 1977-05-02 | 1978-05-16 | General Electric Company | Process aids for fluorosilicone polymers |
| US4177200A (en) * | 1977-11-25 | 1979-12-04 | General Electric Company | Silyl phosphates as neutralizing agents for alkali metal hydroxides |
| US4317899A (en) * | 1978-11-13 | 1982-03-02 | General Electric Company | Process for producing fluorosilicone polymers |
| US4348531A (en) * | 1979-08-30 | 1982-09-07 | General Electric Company | Fluorosilicone polydimethylsiloxane equilibration chainstopper and process for manufacture |
| US4436846A (en) | 1979-11-07 | 1984-03-13 | General Electric Company | Composition and method for improving the properties of liquid media |
| US4267298A (en) * | 1979-11-09 | 1981-05-12 | General Electric Company | Process for preparing M-stopped silicone fluids from silanol fluids |
| US4529774A (en) * | 1982-08-20 | 1985-07-16 | General Electric Company | Treated silica fillers and process for making same |
| US4433096A (en) * | 1983-03-14 | 1984-02-21 | Dow Corning Corporation | Polymerization of polydiorganosiloxane in the presence of filler |
| US4599437A (en) * | 1984-10-29 | 1986-07-08 | Wacker-Chemie Gmbh | Continuous process for varying molecular weight of organopolysiloxanes |
| US5283308A (en) * | 1992-10-05 | 1994-02-01 | Dow Corning Corporation | Neutralization of polyorganosiloxanes using triorganosilanes and curable compositions containing said polyorganosiloxanes |
| JP3546727B2 (ja) * | 1998-12-02 | 2004-07-28 | 信越化学工業株式会社 | オルガノポリシロキサンガムの製造方法 |
| CN103154095A (zh) | 2010-08-05 | 2013-06-12 | 生物膜Ip有限责任公司 | 环硅氧烷取代的聚硅氧烷化合物、包含所述化合物的组合物及其使用方法 |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3132167A (en) * | 1960-02-26 | 1964-05-05 | Gen Electric | Process for preparing linear silanol chain-stopped diorganopolysiloxanes |
| US3598851A (en) * | 1963-12-16 | 1971-08-10 | Gen Electric | Cyclic organosilicon materials |
| GB1217335A (en) * | 1967-04-10 | 1970-12-31 | Midland Silicones Ltd | Polymerisation of siloxanes |
| US3661962A (en) * | 1969-05-09 | 1972-05-09 | Stauffer Wacker Silicone Corp | Molecular weight control and polysiloxanes |
| US3779987A (en) * | 1972-10-12 | 1973-12-18 | Gen Electric | Process for producing diorganopolysiloxane polymers |
| US3842110A (en) * | 1973-10-11 | 1974-10-15 | Gen Electric | Process for producing octaphenyltetracyclosiloxane |
-
1974
- 1974-04-24 US US05/463,435 patent/US3937684A/en not_active Expired - Lifetime
-
1975
- 1975-03-17 CA CA75222206A patent/CA1048521A/en not_active Expired
- 1975-04-16 GB GB15706/75A patent/GB1505747A/en not_active Expired
- 1975-04-19 DE DE2517475A patent/DE2517475A1/de not_active Withdrawn
- 1975-04-21 JP JP4760475A patent/JPS5639777B2/ja not_active Expired
- 1975-04-24 FR FR7512758A patent/FR2308649A1/fr active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| JPS50143900A (enExample) | 1975-11-19 |
| FR2308649A1 (fr) | 1976-11-19 |
| US3937684A (en) | 1976-02-10 |
| GB1505747A (en) | 1978-03-30 |
| DE2517475A1 (de) | 1975-11-13 |
| JPS5639777B2 (enExample) | 1981-09-16 |
| FR2308649B1 (enExample) | 1980-02-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1048521A (en) | Process for producing low and high molecular weight diorganopolysiloxanes for use in heat vulcanizable silicone rubber compositions | |
| US4157337A (en) | Process for the polymerization of cyclic diorganopolysiloxanes with cation-complex catalysts | |
| EP0119093B1 (en) | Polymerization of polydiorganosiloxane in the presence of filler | |
| US4122247A (en) | Process for the polymerization of cyclic diorganopolysiloxanes with cation-complex catalysts | |
| US3978104A (en) | Process for producing diorganopolysiloxane oils | |
| US4341888A (en) | Diorganopolysiloxane copolymers and process for the preparation thereof | |
| US5457220A (en) | Process for the production of crosslinked siloxanes by disproportionation | |
| US5420221A (en) | Process for the production of linear organosiloxane polymers by disproportionation | |
| KR960005068B1 (ko) | 비닐 말단 불소-함유 폴리디오르가노실옥산의 제조방법 | |
| EP0120645A2 (en) | Method of polymerizing oligomers of polydiorganosiloxane in the presence of filler | |
| CA2061004A1 (en) | Method of making organopolysiloxanes | |
| EP0119092A2 (en) | Method of polymerizing hydroxyl endblocked polydiorganosiloxanes | |
| US3498945A (en) | Linear organopolysiloxanes their preparation and their use | |
| US4267298A (en) | Process for preparing M-stopped silicone fluids from silanol fluids | |
| JPS6249891B2 (enExample) | ||
| US4317899A (en) | Process for producing fluorosilicone polymers | |
| US4089833A (en) | Process aids for fluorosilicone polymers | |
| US4835237A (en) | Process for preparing diorganopolysiloxanes containing triorganosiloxy terminal groups | |
| GB2118959A (en) | Process for producing fluorosilicone polymers | |
| US2883366A (en) | Quaternary phosphonium compounds as polymerization catalysts for siloxanes | |
| US4272624A (en) | Process for producing high molecular weight diorganopolysiloxanes for use in heat vulcanizable silicone rubber compositions | |
| US3706775A (en) | Method of preparing high molecular weight linear organopolysiloxanes | |
| KR970006899B1 (ko) | 플루오로실리콘 중합체 제조용 촉매 | |
| US3175995A (en) | Preparation of organopolysiloxanes by siloxane rearrangement | |
| CA1096875A (en) | Alkenyloxy silicon compositions |