CA1047610A - High density logic array - Google Patents
High density logic arrayInfo
- Publication number
- CA1047610A CA1047610A CA238,824A CA238824A CA1047610A CA 1047610 A CA1047610 A CA 1047610A CA 238824 A CA238824 A CA 238824A CA 1047610 A CA1047610 A CA 1047610A
- Authority
- CA
- Canada
- Prior art keywords
- array
- input
- lines
- product term
- logic
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000003491 array Methods 0.000 claims abstract description 58
- 230000006870 function Effects 0.000 claims abstract description 52
- 230000006872 improvement Effects 0.000 claims description 7
- 239000002184 metal Substances 0.000 description 19
- 238000009792 diffusion process Methods 0.000 description 14
- 238000005516 engineering process Methods 0.000 description 4
- 238000004519 manufacturing process Methods 0.000 description 3
- 238000001465 metallisation Methods 0.000 description 3
- 238000000034 method Methods 0.000 description 3
- 230000003647 oxidation Effects 0.000 description 3
- 238000007254 oxidation reaction Methods 0.000 description 3
- 244000187656 Eucalyptus cornuta Species 0.000 description 2
- 239000000758 substrate Substances 0.000 description 2
- BHMLFPOTZYRDKA-IRXDYDNUSA-N (2s)-2-[(s)-(2-iodophenoxy)-phenylmethyl]morpholine Chemical compound IC1=CC=CC=C1O[C@@H](C=1C=CC=CC=1)[C@H]1OCCNC1 BHMLFPOTZYRDKA-IRXDYDNUSA-N 0.000 description 1
- 235000014676 Phragmites communis Nutrition 0.000 description 1
- 230000001133 acceleration Effects 0.000 description 1
- 230000003466 anti-cipated effect Effects 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- 229910044991 metal oxide Inorganic materials 0.000 description 1
- 150000004706 metal oxides Chemical class 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 239000002674 ointment Substances 0.000 description 1
- 229920000136 polysorbate Polymers 0.000 description 1
- 230000008569 process Effects 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 238000005549 size reduction Methods 0.000 description 1
- 101150065190 term gene Proteins 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H03—ELECTRONIC CIRCUITRY
- H03K—PULSE TECHNIQUE
- H03K19/00—Logic circuits, i.e. having at least two inputs acting on one output; Inverting circuits
- H03K19/02—Logic circuits, i.e. having at least two inputs acting on one output; Inverting circuits using specified components
- H03K19/173—Logic circuits, i.e. having at least two inputs acting on one output; Inverting circuits using specified components using elementary logic circuits as components
- H03K19/177—Logic circuits, i.e. having at least two inputs acting on one output; Inverting circuits using specified components using elementary logic circuits as components arranged in matrix form
- H03K19/17704—Logic circuits, i.e. having at least two inputs acting on one output; Inverting circuits using specified components using elementary logic circuits as components arranged in matrix form the logic functions being realised by the interconnection of rows and columns
- H03K19/17708—Logic circuits, i.e. having at least two inputs acting on one output; Inverting circuits using specified components using elementary logic circuits as components arranged in matrix form the logic functions being realised by the interconnection of rows and columns using an AND matrix followed by an OR matrix, i.e. programmable logic arrays
- H03K19/17716—Logic circuits, i.e. having at least two inputs acting on one output; Inverting circuits using specified components using elementary logic circuits as components arranged in matrix form the logic functions being realised by the interconnection of rows and columns using an AND matrix followed by an OR matrix, i.e. programmable logic arrays with synchronous operation, i.e. using clock signals, e.g. of I/O or coupling register
-
- H—ELECTRICITY
- H10—SEMICONDUCTOR DEVICES; ELECTRIC SOLID-STATE DEVICES NOT OTHERWISE PROVIDED FOR
- H10B—ELECTRONIC MEMORY DEVICES
- H10B20/00—Read-only memory [ROM] devices
-
- H—ELECTRICITY
- H10—SEMICONDUCTOR DEVICES; ELECTRIC SOLID-STATE DEVICES NOT OTHERWISE PROVIDED FOR
- H10D—INORGANIC ELECTRIC SEMICONDUCTOR DEVICES
- H10D99/00—Subject matter not provided for in other groups of this subclass
Landscapes
- Physics & Mathematics (AREA)
- Mathematical Physics (AREA)
- Engineering & Computer Science (AREA)
- Computer Hardware Design (AREA)
- Computing Systems (AREA)
- General Engineering & Computer Science (AREA)
- Logic Circuits (AREA)
- Design And Manufacture Of Integrated Circuits (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/537,219 US3987287A (en) | 1974-12-30 | 1974-12-30 | High density logic array |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1047610A true CA1047610A (en) | 1979-01-30 |
Family
ID=24141731
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA238,824A Expired CA1047610A (en) | 1974-12-30 | 1975-10-30 | High density logic array |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US3987287A (OSRAM) |
| JP (2) | JPS5851451B2 (OSRAM) |
| CA (1) | CA1047610A (OSRAM) |
| DE (1) | DE2556275C2 (OSRAM) |
| GB (1) | GB1473029A (OSRAM) |
| IT (1) | IT1050023B (OSRAM) |
Families Citing this family (48)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5396781A (en) * | 1977-02-04 | 1978-08-24 | Nec Corp | Integrated circuit device |
| FR2396468A1 (fr) * | 1977-06-30 | 1979-01-26 | Ibm France | Perfectionnement aux reseaux logiques programmables |
| US4195352A (en) * | 1977-07-08 | 1980-03-25 | Xerox Corporation | Split programmable logic array |
| US4139907A (en) * | 1977-08-31 | 1979-02-13 | Bell Telephone Laboratories, Incorporated | Integrated read only memory |
| US4157590A (en) * | 1978-01-03 | 1979-06-05 | International Business Machines Corporation | Programmable logic array adder |
| JPS54148360A (en) * | 1978-05-12 | 1979-11-20 | Nec Corp | Logic array circuit |
| JPS558135A (en) * | 1978-07-04 | 1980-01-21 | Mamoru Tanaka | Rewritable programable logic array |
| US4348736A (en) * | 1978-10-05 | 1982-09-07 | International Business Machines Corp. | Programmable logic array adder |
| JPS562739A (en) * | 1979-06-20 | 1981-01-13 | Nec Corp | Pla logical operation circuit |
| US4495590A (en) * | 1980-12-31 | 1985-01-22 | International Business Machines Corporation | PLA With time division multiplex feature for improved density |
| US4431928A (en) * | 1981-06-22 | 1984-02-14 | Hewlett-Packard Company | Symmetrical programmable logic array |
| US4467439A (en) * | 1981-06-30 | 1984-08-21 | Ibm Corporation | OR Product term function in the search array of a PLA |
| US4458163A (en) * | 1981-07-20 | 1984-07-03 | Texas Instruments Incorporated | Programmable architecture logic |
| US4433331A (en) * | 1981-12-14 | 1984-02-21 | Bell Telephone Laboratories, Incorporated | Programmable logic array interconnection matrix |
| US4461000A (en) * | 1982-03-01 | 1984-07-17 | Harris Corporation | ROM/PLA Structure and method of testing |
| US4506341A (en) * | 1982-06-10 | 1985-03-19 | International Business Machines Corporation | Interlaced programmable logic array having shared elements |
| US4504904A (en) * | 1982-06-15 | 1985-03-12 | International Business Machines Corporation | Binary logic structure employing programmable logic arrays and useful in microword generation apparatus |
| US4516123A (en) * | 1982-12-27 | 1985-05-07 | At&T Bell Laboratories | Integrated circuit including logic array with distributed ground connections |
| US4791602A (en) * | 1983-04-14 | 1988-12-13 | Control Data Corporation | Soft programmable logic array |
| USRE34363E (en) * | 1984-03-12 | 1993-08-31 | Xilinx, Inc. | Configurable electrical circuit having configurable logic elements and configurable interconnects |
| US4617479B1 (en) * | 1984-05-03 | 1993-09-21 | Altera Semiconductor Corp. | Programmable logic array device using eprom technology |
| JPS61107814A (ja) * | 1984-10-31 | 1986-05-26 | Agency Of Ind Science & Technol | プログラマブル・ロジツク・アレイの構成方法 |
| US5365165A (en) * | 1986-09-19 | 1994-11-15 | Actel Corporation | Testability architecture and techniques for programmable interconnect architecture |
| US5367208A (en) * | 1986-09-19 | 1994-11-22 | Actel Corporation | Reconfigurable programmable interconnect architecture |
| US5451887A (en) * | 1986-09-19 | 1995-09-19 | Actel Corporation | Programmable logic module and architecture for field programmable gate array device |
| US5341092A (en) * | 1986-09-19 | 1994-08-23 | Actel Corporation | Testability architecture and techniques for programmable interconnect architecture |
| US5172014A (en) * | 1986-09-19 | 1992-12-15 | Actel Corporation | Programmable interconnect architecture |
| US4758745B1 (en) * | 1986-09-19 | 1994-11-15 | Actel Corp | User programmable integrated circuit interconnect architecture and test method |
| US5477165A (en) * | 1986-09-19 | 1995-12-19 | Actel Corporation | Programmable logic module and architecture for field programmable gate array device |
| US5187393A (en) * | 1986-09-19 | 1993-02-16 | Actel Corporation | Reconfigurable programmable interconnect architecture |
| US4870598A (en) * | 1987-08-04 | 1989-09-26 | Texas Instruments Incorporated | Comprehensive logic circuit layout system |
| US5150309A (en) * | 1987-08-04 | 1992-09-22 | Texas Instruments Incorporated | Comprehensive logic circuit layout system |
| US5119313A (en) * | 1987-08-04 | 1992-06-02 | Texas Instruments Incorporated | Comprehensive logic circuit layout system |
| JPH02104600U (OSRAM) * | 1989-02-06 | 1990-08-20 | ||
| JP2544027B2 (ja) * | 1990-05-24 | 1996-10-16 | 株式会社東芝 | 低消費電力型プログラマブルロジックアレイおよびそれを用いた情報処理装置 |
| US5322812A (en) * | 1991-03-20 | 1994-06-21 | Crosspoint Solutions, Inc. | Improved method of fabricating antifuses in an integrated circuit device and resulting structure |
| US5189320A (en) * | 1991-09-23 | 1993-02-23 | Atmel Corporation | Programmable logic device with multiple shared logic arrays |
| IL103190A (en) * | 1991-09-25 | 1995-06-29 | Messier Bugatti | A security locking device that includes a movable hook |
| WO1993012582A1 (en) * | 1991-12-13 | 1993-06-24 | Knights Technology, Inc. | Programmable logic device cell and method |
| US5294846A (en) * | 1992-08-17 | 1994-03-15 | Paivinen John O | Method and apparatus for programming anti-fuse devices |
| US5384497A (en) * | 1992-11-04 | 1995-01-24 | At&T Corp. | Low-skew signal routing in a programmable array |
| US5424655A (en) * | 1994-05-20 | 1995-06-13 | Quicklogic Corporation | Programmable application specific integrated circuit employing antifuses and methods therefor |
| US5552720A (en) * | 1994-12-01 | 1996-09-03 | Quicklogic Corporation | Method for simultaneous programming of multiple antifuses |
| US5495181A (en) * | 1994-12-01 | 1996-02-27 | Quicklogic Corporation | Integrated circuit facilitating simultaneous programming of multiple antifuses |
| US5744980A (en) * | 1996-02-16 | 1998-04-28 | Actel Corporation | Flexible, high-performance static RAM architecture for field-programmable gate arrays |
| US20050102476A1 (en) * | 2003-11-12 | 2005-05-12 | Infineon Technologies North America Corp. | Random access memory with optional column address strobe latency of one |
| US8438522B1 (en) | 2008-09-24 | 2013-05-07 | Iowa State University Research Foundation, Inc. | Logic element architecture for generic logic chains in programmable devices |
| US8661394B1 (en) | 2008-09-24 | 2014-02-25 | Iowa State University Research Foundation, Inc. | Depth-optimal mapping of logic chains in reconfigurable fabrics |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1101851A (en) * | 1965-01-20 | 1968-01-31 | Ncr Co | Generalized logic circuitry |
| US3699534A (en) * | 1970-12-15 | 1972-10-17 | Us Navy | Cellular arithmetic array |
| US3818252A (en) * | 1971-12-20 | 1974-06-18 | Hitachi Ltd | Universal logical integrated circuit |
| US3761902A (en) * | 1971-12-30 | 1973-09-25 | Ibm | Functional memory using multi-state associative cells |
| US3731073A (en) * | 1972-04-05 | 1973-05-01 | Bell Telephone Labor Inc | Programmable switching array |
| US3816725A (en) * | 1972-04-28 | 1974-06-11 | Gen Electric | Multiple level associative logic circuits |
| US3849638A (en) * | 1973-07-18 | 1974-11-19 | Gen Electric | Segmented associative logic circuits |
-
1974
- 1974-12-30 US US05/537,219 patent/US3987287A/en not_active Expired - Lifetime
-
1975
- 1975-09-16 GB GB3791875A patent/GB1473029A/en not_active Expired
- 1975-10-30 CA CA238,824A patent/CA1047610A/en not_active Expired
- 1975-12-09 IT IT30096/75A patent/IT1050023B/it active
- 1975-12-12 JP JP50147531A patent/JPS5851451B2/ja not_active Expired
- 1975-12-13 DE DE2556275A patent/DE2556275C2/de not_active Expired
-
1980
- 1980-06-20 JP JP55082980A patent/JPS6053965B2/ja not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| JPS5851451B2 (ja) | 1983-11-16 |
| DE2556275A1 (de) | 1976-07-08 |
| JPS6053965B2 (ja) | 1985-11-28 |
| DE2556275C2 (de) | 1982-04-01 |
| US3987287A (en) | 1976-10-19 |
| JPS5184538A (OSRAM) | 1976-07-23 |
| IT1050023B (it) | 1981-03-10 |
| GB1473029A (en) | 1977-05-11 |
| JPS5623032A (en) | 1981-03-04 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1047610A (en) | High density logic array | |
| CA1045214A (en) | Segmented parallel rail paths for input/output signals | |
| US3975623A (en) | Logic array with multiple readout tables | |
| US4034356A (en) | Reconfigurable logic array | |
| EP0068374B1 (en) | Programmable logic array | |
| US4786904A (en) | Electronically programmable gate array having programmable interconnect lines | |
| US4433331A (en) | Programmable logic array interconnection matrix | |
| EP0096225B1 (en) | Interlaced programmable logic array having shared elements | |
| US4084152A (en) | Time shared programmable logic array | |
| US5781030A (en) | Programmable uniform symmetrical distribution logic allocator for a high-density complex PLD | |
| US5557217A (en) | High-density erasable programmable logic device architecture using multiplexer interconnections | |
| US5023606A (en) | Programmable logic device with ganged output pins | |
| US3566153A (en) | Programmable sequential logic | |
| US4177452A (en) | Electrically programmable logic array | |
| CA1260560A (en) | Programmable logic array with single clock dynamic logic | |
| DE2627546A1 (de) | Integrierte schaltung hoher packungsdichte | |
| EP0069225B1 (en) | Improved search array of a programmable logic array | |
| US2901736A (en) | Printed circuit for array of toroidal cores | |
| JPS61198761A (ja) | 半導体集積回路 | |
| US3993919A (en) | Programmable latch and other circuits for logic arrays | |
| US4564773A (en) | Semiconductor gate array device having an improved interconnection structure | |
| CA1204171A (en) | Programmable logic array | |
| EP0126322B1 (en) | Testable array logic device | |
| EP0051157B1 (en) | A logic performing cell for use in array structures | |
| US5465055A (en) | RAM-logic tile for field programmable gate arrays |