CA1043736A - Electrolytic process for manufacturing chlorine dioxide, hydrogen peroxide, chlorine, alkali metal hydroxide and hydrogen - Google Patents
Electrolytic process for manufacturing chlorine dioxide, hydrogen peroxide, chlorine, alkali metal hydroxide and hydrogenInfo
- Publication number
- CA1043736A CA1043736A CA216,840A CA216840A CA1043736A CA 1043736 A CA1043736 A CA 1043736A CA 216840 A CA216840 A CA 216840A CA 1043736 A CA1043736 A CA 1043736A
- Authority
- CA
- Canada
- Prior art keywords
- alkali metal
- compartment
- anode
- active
- cation
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- OSVXSBDYLRYLIG-UHFFFAOYSA-N dioxidochlorine(.) Chemical compound O=Cl=O OSVXSBDYLRYLIG-UHFFFAOYSA-N 0.000 title claims abstract description 67
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 title claims abstract description 43
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 title claims abstract description 33
- 239000004155 Chlorine dioxide Substances 0.000 title claims abstract description 33
- 235000019398 chlorine dioxide Nutrition 0.000 title claims abstract description 33
- 239000000460 chlorine Substances 0.000 title claims abstract description 31
- 239000001257 hydrogen Substances 0.000 title claims abstract description 27
- 229910052739 hydrogen Inorganic materials 0.000 title claims abstract description 27
- 229910052801 chlorine Inorganic materials 0.000 title claims abstract description 24
- 150000008044 alkali metal hydroxides Chemical class 0.000 title claims abstract description 21
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 title claims abstract description 19
- 238000000034 method Methods 0.000 title claims description 46
- 238000004519 manufacturing process Methods 0.000 title claims description 13
- 230000008569 process Effects 0.000 title description 24
- 239000012528 membrane Substances 0.000 claims abstract description 129
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims abstract description 101
- XTEGARKTQYYJKE-UHFFFAOYSA-M Chlorate Chemical compound [O-]Cl(=O)=O XTEGARKTQYYJKE-UHFFFAOYSA-M 0.000 claims abstract description 42
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims abstract description 37
- 229910001868 water Inorganic materials 0.000 claims abstract description 37
- 150000004968 peroxymonosulfuric acids Chemical class 0.000 claims abstract description 31
- 229910001514 alkali metal chloride Inorganic materials 0.000 claims abstract description 17
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 claims abstract description 11
- 229910001902 chlorine oxide Inorganic materials 0.000 claims abstract description 7
- -1 alkali metal chlorate Chemical class 0.000 claims description 59
- 229920001577 copolymer Polymers 0.000 claims description 34
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 claims description 33
- 239000000243 solution Substances 0.000 claims description 32
- 229910052783 alkali metal Inorganic materials 0.000 claims description 28
- 229920000642 polymer Polymers 0.000 claims description 28
- 239000000463 material Substances 0.000 claims description 20
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 claims description 20
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 claims description 18
- 150000001768 cations Chemical class 0.000 claims description 12
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 claims description 10
- 229910052697 platinum Inorganic materials 0.000 claims description 10
- 229920000915 polyvinyl chloride Polymers 0.000 claims description 10
- 239000004800 polyvinyl chloride Substances 0.000 claims description 10
- 150000001340 alkali metals Chemical class 0.000 claims description 9
- 229920001343 polytetrafluoroethylene Polymers 0.000 claims description 9
- 239000004810 polytetrafluoroethylene Substances 0.000 claims description 9
- 229940058401 polytetrafluoroethylene Drugs 0.000 claims description 9
- 239000011780 sodium chloride Substances 0.000 claims description 9
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 claims description 9
- RRZIJNVZMJUGTK-UHFFFAOYSA-N 1,1,2-trifluoro-2-(1,2,2-trifluoroethenoxy)ethene Chemical class FC(F)=C(F)OC(F)=C(F)F RRZIJNVZMJUGTK-UHFFFAOYSA-N 0.000 claims description 8
- BZSXEZOLBIJVQK-UHFFFAOYSA-N 2-methylsulfonylbenzoic acid Chemical compound CS(=O)(=O)C1=CC=CC=C1C(O)=O BZSXEZOLBIJVQK-UHFFFAOYSA-N 0.000 claims description 8
- 239000007864 aqueous solution Substances 0.000 claims description 8
- 125000004432 carbon atom Chemical group C* 0.000 claims description 8
- 229920002313 fluoropolymer Polymers 0.000 claims description 8
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 8
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 7
- 229910002804 graphite Inorganic materials 0.000 claims description 7
- 239000010439 graphite Substances 0.000 claims description 7
- 229920001155 polypropylene Polymers 0.000 claims description 7
- BFKJFAAPBSQJPD-UHFFFAOYSA-N tetrafluoroethene Chemical group FC(F)=C(F)F BFKJFAAPBSQJPD-UHFFFAOYSA-N 0.000 claims description 7
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 claims description 6
- 239000004743 Polypropylene Substances 0.000 claims description 6
- 150000001336 alkenes Chemical class 0.000 claims description 6
- 229910000510 noble metal Inorganic materials 0.000 claims description 6
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 claims description 6
- 125000001453 quaternary ammonium group Chemical group 0.000 claims description 6
- 229910052715 tantalum Inorganic materials 0.000 claims description 6
- GUVRBAGPIYLISA-UHFFFAOYSA-N tantalum atom Chemical compound [Ta] GUVRBAGPIYLISA-UHFFFAOYSA-N 0.000 claims description 6
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 5
- 229910000831 Steel Inorganic materials 0.000 claims description 5
- 239000010425 asbestos Substances 0.000 claims description 5
- 229910052731 fluorine Inorganic materials 0.000 claims description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 claims description 5
- 229910052742 iron Inorganic materials 0.000 claims description 5
- 229910052895 riebeckite Inorganic materials 0.000 claims description 5
- 229910052708 sodium Inorganic materials 0.000 claims description 5
- 239000011734 sodium Substances 0.000 claims description 5
- 239000010959 steel Substances 0.000 claims description 5
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 claims description 4
- 239000003792 electrolyte Substances 0.000 claims description 4
- 239000010936 titanium Substances 0.000 claims description 4
- 229910052719 titanium Inorganic materials 0.000 claims description 4
- 229910001209 Low-carbon steel Inorganic materials 0.000 claims description 3
- 239000012527 feed solution Substances 0.000 claims description 3
- 125000001153 fluoro group Chemical group F* 0.000 claims description 3
- 150000003839 salts Chemical class 0.000 claims description 3
- KJTLSVCANCCWHF-UHFFFAOYSA-N Ruthenium Chemical compound [Ru] KJTLSVCANCCWHF-UHFFFAOYSA-N 0.000 claims description 2
- 229910052741 iridium Inorganic materials 0.000 claims description 2
- GKOZUEZYRPOHIO-UHFFFAOYSA-N iridium atom Chemical compound [Ir] GKOZUEZYRPOHIO-UHFFFAOYSA-N 0.000 claims description 2
- 229910052758 niobium Inorganic materials 0.000 claims description 2
- 239000010955 niobium Substances 0.000 claims description 2
- GUCVJGMIXFAOAE-UHFFFAOYSA-N niobium atom Chemical compound [Nb] GUCVJGMIXFAOAE-UHFFFAOYSA-N 0.000 claims description 2
- 229910052703 rhodium Inorganic materials 0.000 claims description 2
- 239000010948 rhodium Substances 0.000 claims description 2
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 claims description 2
- 229910052707 ruthenium Inorganic materials 0.000 claims description 2
- 229910003202 NH4 Inorganic materials 0.000 claims 2
- 229910006095 SO2F Inorganic materials 0.000 claims 2
- QYKIQEUNHZKYBP-UHFFFAOYSA-N Vinyl ether Chemical class C=COC=C QYKIQEUNHZKYBP-UHFFFAOYSA-N 0.000 claims 2
- 229910052784 alkaline earth metal Inorganic materials 0.000 claims 2
- 150000001342 alkaline earth metals Chemical class 0.000 claims 2
- 238000005341 cation exchange Methods 0.000 claims 1
- 238000005868 electrolysis reaction Methods 0.000 abstract description 12
- 239000000126 substance Substances 0.000 abstract description 8
- 238000004537 pulping Methods 0.000 abstract description 6
- 229920001131 Pulp (paper) Polymers 0.000 abstract description 5
- 238000004061 bleaching Methods 0.000 abstract description 4
- 239000002023 wood Substances 0.000 abstract description 4
- 239000003513 alkali Substances 0.000 abstract description 3
- 229910052751 metal Inorganic materials 0.000 abstract description 3
- 239000002184 metal Substances 0.000 abstract description 3
- 210000004379 membrane Anatomy 0.000 description 102
- 210000004027 cell Anatomy 0.000 description 51
- 239000003518 caustics Substances 0.000 description 15
- 238000006243 chemical reaction Methods 0.000 description 13
- 230000007062 hydrolysis Effects 0.000 description 10
- 238000006460 hydrolysis reaction Methods 0.000 description 10
- 238000001256 steam distillation Methods 0.000 description 10
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 9
- 239000002585 base Substances 0.000 description 8
- 238000009792 diffusion process Methods 0.000 description 7
- 150000002500 ions Chemical class 0.000 description 7
- 229920000557 Nafion® Polymers 0.000 description 6
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 6
- 239000004744 fabric Substances 0.000 description 6
- 239000000203 mixture Substances 0.000 description 6
- 229920009441 perflouroethylene propylene Polymers 0.000 description 6
- 125000001424 substituent group Chemical group 0.000 description 6
- 239000010408 film Substances 0.000 description 5
- 150000002431 hydrogen Chemical class 0.000 description 5
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- 239000004698 Polyethylene Substances 0.000 description 4
- 239000002253 acid Substances 0.000 description 4
- 150000001450 anions Chemical class 0.000 description 4
- 229910052802 copper Inorganic materials 0.000 description 4
- 239000010949 copper Substances 0.000 description 4
- YADSGOSSYOOKMP-UHFFFAOYSA-N dioxolead Chemical compound O=[Pb]=O YADSGOSSYOOKMP-UHFFFAOYSA-N 0.000 description 4
- SLGWESQGEUXWJQ-UHFFFAOYSA-N formaldehyde;phenol Chemical compound O=C.OC1=CC=CC=C1 SLGWESQGEUXWJQ-UHFFFAOYSA-N 0.000 description 4
- 230000003301 hydrolyzing effect Effects 0.000 description 4
- 238000012986 modification Methods 0.000 description 4
- 230000004048 modification Effects 0.000 description 4
- 150000002978 peroxides Chemical class 0.000 description 4
- 229920001568 phenolic resin Polymers 0.000 description 4
- 238000011160 research Methods 0.000 description 4
- 239000010409 thin film Substances 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- 238000010521 absorption reaction Methods 0.000 description 3
- 230000006835 compression Effects 0.000 description 3
- 238000007906 compression Methods 0.000 description 3
- 239000004020 conductor Substances 0.000 description 3
- 230000006866 deterioration Effects 0.000 description 3
- 238000002474 experimental method Methods 0.000 description 3
- 239000000835 fiber Substances 0.000 description 3
- 229930195733 hydrocarbon Natural products 0.000 description 3
- 150000002430 hydrocarbons Chemical class 0.000 description 3
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 3
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 239000002609 medium Substances 0.000 description 3
- 229920000573 polyethylene Polymers 0.000 description 3
- 230000005855 radiation Effects 0.000 description 3
- 239000000376 reactant Substances 0.000 description 3
- 229920005989 resin Polymers 0.000 description 3
- 239000011347 resin Substances 0.000 description 3
- AKEJUJNQAAGONA-UHFFFAOYSA-N sulfur trioxide Chemical compound O=S(=O)=O AKEJUJNQAAGONA-UHFFFAOYSA-N 0.000 description 3
- PEVRKKOYEFPFMN-UHFFFAOYSA-N 1,1,2,3,3,3-hexafluoroprop-1-ene;1,1,2,2-tetrafluoroethene Chemical class FC(F)=C(F)F.FC(F)=C(F)C(F)(F)F PEVRKKOYEFPFMN-UHFFFAOYSA-N 0.000 description 2
- MYRTYDVEIRVNKP-UHFFFAOYSA-N 1,2-Divinylbenzene Chemical compound C=CC1=CC=CC=C1C=C MYRTYDVEIRVNKP-UHFFFAOYSA-N 0.000 description 2
- KEQGZUUPPQEDPF-UHFFFAOYSA-N 1,3-dichloro-5,5-dimethylimidazolidine-2,4-dione Chemical compound CC1(C)N(Cl)C(=O)N(Cl)C1=O KEQGZUUPPQEDPF-UHFFFAOYSA-N 0.000 description 2
- 102100033680 Bombesin receptor-activated protein C6orf89 Human genes 0.000 description 2
- 101710086147 Bombesin receptor-activated protein C6orf89 Proteins 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 2
- 239000004793 Polystyrene Substances 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 description 2
- 239000004809 Teflon Substances 0.000 description 2
- 229920006362 Teflon® Polymers 0.000 description 2
- 125000000217 alkyl group Chemical group 0.000 description 2
- 229910052782 aluminium Inorganic materials 0.000 description 2
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 2
- 229910021529 ammonia Inorganic materials 0.000 description 2
- 150000007942 carboxylates Chemical class 0.000 description 2
- 229920001429 chelating resin Polymers 0.000 description 2
- 238000003889 chemical engineering Methods 0.000 description 2
- 239000003153 chemical reaction reagent Substances 0.000 description 2
- XTHPWXDJESJLNJ-UHFFFAOYSA-N chlorosulfonic acid Substances OS(Cl)(=O)=O XTHPWXDJESJLNJ-UHFFFAOYSA-N 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 238000010276 construction Methods 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- 229920001971 elastomer Polymers 0.000 description 2
- 239000011737 fluorine Substances 0.000 description 2
- 239000000446 fuel Substances 0.000 description 2
- 239000008246 gaseous mixture Substances 0.000 description 2
- 238000005342 ion exchange Methods 0.000 description 2
- 229920003303 ion-exchange polymer Polymers 0.000 description 2
- 239000000178 monomer Substances 0.000 description 2
- 229920002223 polystyrene Polymers 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 238000012545 processing Methods 0.000 description 2
- 150000003254 radicals Chemical class 0.000 description 2
- 239000005060 rubber Substances 0.000 description 2
- 238000012216 screening Methods 0.000 description 2
- 238000000926 separation method Methods 0.000 description 2
- 229910052709 silver Inorganic materials 0.000 description 2
- 239000004332 silver Substances 0.000 description 2
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 2
- 238000006277 sulfonation reaction Methods 0.000 description 2
- 229920001169 thermoplastic Polymers 0.000 description 2
- 239000004416 thermosoftening plastic Substances 0.000 description 2
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 2
- DJKGDNKYTKCJKD-BPOCMEKLSA-N (1s,4r,5s,6r)-1,2,3,4,7,7-hexachlorobicyclo[2.2.1]hept-2-ene-5,6-dicarboxylic acid Chemical compound ClC1=C(Cl)[C@]2(Cl)[C@H](C(=O)O)[C@H](C(O)=O)[C@@]1(Cl)C2(Cl)Cl DJKGDNKYTKCJKD-BPOCMEKLSA-N 0.000 description 1
- WHOZNOZYMBRCBL-OUKQBFOZSA-N (2E)-2-Tetradecenal Chemical compound CCCCCCCCCCC\C=C\C=O WHOZNOZYMBRCBL-OUKQBFOZSA-N 0.000 description 1
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 description 1
- 101150096672 CEL1 gene Proteins 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- 239000004709 Chlorinated polyethylene Substances 0.000 description 1
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 1
- GUTLYIVDDKVIGB-OUBTZVSYSA-N Cobalt-60 Chemical compound [60Co] GUTLYIVDDKVIGB-OUBTZVSYSA-N 0.000 description 1
- WZKSXHQDXQKIQJ-UHFFFAOYSA-N F[C](F)F Chemical compound F[C](F)F WZKSXHQDXQKIQJ-UHFFFAOYSA-N 0.000 description 1
- 241000282326 Felis catus Species 0.000 description 1
- CERQOIWHTDAKMF-UHFFFAOYSA-N Methacrylic acid Chemical compound CC(=C)C(O)=O CERQOIWHTDAKMF-UHFFFAOYSA-N 0.000 description 1
- 239000004677 Nylon Substances 0.000 description 1
- 229920001774 Perfluoroether Polymers 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- ABLZXFCXXLZCGV-UHFFFAOYSA-N Phosphorous acid Chemical group OP(O)=O ABLZXFCXXLZCGV-UHFFFAOYSA-N 0.000 description 1
- 240000005428 Pistacia lentiscus Species 0.000 description 1
- 229920001328 Polyvinylidene chloride Polymers 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- 206010037660 Pyrexia Diseases 0.000 description 1
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical group C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- LEHOTFFKMJEONL-UHFFFAOYSA-N Uric Acid Chemical compound N1C(=O)NC(=O)C2=C1NC(=O)N2 LEHOTFFKMJEONL-UHFFFAOYSA-N 0.000 description 1
- TVWHNULVHGKJHS-UHFFFAOYSA-N Uric acid Natural products N1C(=O)NC(=O)C2NC(=O)NC21 TVWHNULVHGKJHS-UHFFFAOYSA-N 0.000 description 1
- YUHVVTLNLCJEOB-UHFFFAOYSA-N [Cl].O=Cl=O Chemical compound [Cl].O=Cl=O YUHVVTLNLCJEOB-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 238000013019 agitation Methods 0.000 description 1
- 229910001508 alkali metal halide Inorganic materials 0.000 description 1
- 150000008045 alkali metal halides Chemical class 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- 150000008051 alkyl sulfates Chemical class 0.000 description 1
- 239000002168 alkylating agent Substances 0.000 description 1
- 229940100198 alkylating agent Drugs 0.000 description 1
- 238000005576 amination reaction Methods 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000007844 bleaching agent Substances 0.000 description 1
- 230000003139 buffering effect Effects 0.000 description 1
- 210000005056 cell body Anatomy 0.000 description 1
- 210000002421 cell wall Anatomy 0.000 description 1
- 150000003841 chloride salts Chemical class 0.000 description 1
- 238000007265 chloromethylation reaction Methods 0.000 description 1
- 239000002131 composite material Substances 0.000 description 1
- 238000010908 decantation Methods 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 238000010586 diagram Methods 0.000 description 1
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 230000008014 freezing Effects 0.000 description 1
- 238000007710 freezing Methods 0.000 description 1
- ZZUFCTLCJUWOSV-UHFFFAOYSA-N furosemide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC(C(O)=O)=C1NCC1=CC=CO1 ZZUFCTLCJUWOSV-UHFFFAOYSA-N 0.000 description 1
- 238000007499 fusion processing Methods 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 150000002367 halogens Chemical group 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- HCDGVLDPFQMKDK-UHFFFAOYSA-N hexafluoropropylene Chemical group FC(F)=C(F)C(F)(F)F HCDGVLDPFQMKDK-UHFFFAOYSA-N 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 230000000977 initiatory effect Effects 0.000 description 1
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 1
- 239000003456 ion exchange resin Substances 0.000 description 1
- 230000001788 irregular Effects 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 230000007774 longterm Effects 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 239000011159 matrix material Substances 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 230000003472 neutralizing effect Effects 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- 229920001778 nylon Polymers 0.000 description 1
- 229920000620 organic polymer Polymers 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- UJMWVICAENGCRF-UHFFFAOYSA-N oxygen difluoride Chemical compound FOF UJMWVICAENGCRF-UHFFFAOYSA-N 0.000 description 1
- 230000000149 penetrating effect Effects 0.000 description 1
- 229940044654 phenolsulfonic acid Drugs 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 230000010287 polarization Effects 0.000 description 1
- 229920001084 poly(chloroprene) Polymers 0.000 description 1
- 229920001281 polyalkylene Polymers 0.000 description 1
- 229920000768 polyamine Polymers 0.000 description 1
- 229920000728 polyester Polymers 0.000 description 1
- 229920006254 polymer film Polymers 0.000 description 1
- 229920005597 polymer membrane Polymers 0.000 description 1
- 230000000379 polymerizing effect Effects 0.000 description 1
- 239000005033 polyvinylidene chloride Substances 0.000 description 1
- 238000004076 pulp bleaching Methods 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 230000036647 reaction Effects 0.000 description 1
- 238000004064 recycling Methods 0.000 description 1
- 230000001172 regenerating effect Effects 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 229920003048 styrene butadiene rubber Polymers 0.000 description 1
- 150000003440 styrenes Chemical class 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-L sulfite Chemical class [O-]S([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-L 0.000 description 1
- 229940124530 sulfonamide Drugs 0.000 description 1
- 125000000565 sulfonamide group Chemical group 0.000 description 1
- 150000003456 sulfonamides Chemical class 0.000 description 1
- 125000001273 sulfonato group Chemical group [O-]S(*)(=O)=O 0.000 description 1
- 125000000542 sulfonic acid group Chemical group 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 229920003002 synthetic resin Polymers 0.000 description 1
- 239000000057 synthetic resin Substances 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- FAGUFWYHJQFNRV-UHFFFAOYSA-N tetraethylenepentamine Chemical compound NCCNCCNCCNCCN FAGUFWYHJQFNRV-UHFFFAOYSA-N 0.000 description 1
- 230000008719 thickening Effects 0.000 description 1
- 238000004448 titration Methods 0.000 description 1
- 125000003944 tolyl group Chemical group 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- 229940116269 uric acid Drugs 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C25—ELECTROLYTIC OR ELECTROPHORETIC PROCESSES; APPARATUS THEREFOR
- C25B—ELECTROLYTIC OR ELECTROPHORETIC PROCESSES FOR THE PRODUCTION OF COMPOUNDS OR NON-METALS; APPARATUS THEREFOR
- C25B1/00—Electrolytic production of inorganic compounds or non-metals
- C25B1/01—Products
- C25B1/28—Per-compounds
-
- C—CHEMISTRY; METALLURGY
- C25—ELECTROLYTIC OR ELECTROPHORETIC PROCESSES; APPARATUS THEREFOR
- C25B—ELECTROLYTIC OR ELECTROPHORETIC PROCESSES FOR THE PRODUCTION OF COMPOUNDS OR NON-METALS; APPARATUS THEREFOR
- C25B1/00—Electrolytic production of inorganic compounds or non-metals
- C25B1/01—Products
- C25B1/24—Halogens or compounds thereof
- C25B1/26—Chlorine; Compounds thereof
-
- C—CHEMISTRY; METALLURGY
- C25—ELECTROLYTIC OR ELECTROPHORETIC PROCESSES; APPARATUS THEREFOR
- C25B—ELECTROLYTIC OR ELECTROPHORETIC PROCESSES FOR THE PRODUCTION OF COMPOUNDS OR NON-METALS; APPARATUS THEREFOR
- C25B1/00—Electrolytic production of inorganic compounds or non-metals
- C25B1/01—Products
- C25B1/28—Per-compounds
- C25B1/29—Persulfates
-
- C—CHEMISTRY; METALLURGY
- C25—ELECTROLYTIC OR ELECTROPHORETIC PROCESSES; APPARATUS THEREFOR
- C25B—ELECTROLYTIC OR ELECTROPHORETIC PROCESSES FOR THE PRODUCTION OF COMPOUNDS OR NON-METALS; APPARATUS THEREFOR
- C25B1/00—Electrolytic production of inorganic compounds or non-metals
- C25B1/01—Products
- C25B1/34—Simultaneous production of alkali metal hydroxides and chlorine, oxyacids or salts of chlorine, e.g. by chlor-alkali electrolysis
- C25B1/46—Simultaneous production of alkali metal hydroxides and chlorine, oxyacids or salts of chlorine, e.g. by chlor-alkali electrolysis in diaphragm cells
Landscapes
- Chemical & Material Sciences (AREA)
- Inorganic Chemistry (AREA)
- Engineering & Computer Science (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Electrochemistry (AREA)
- Materials Engineering (AREA)
- Metallurgy (AREA)
- Organic Chemistry (AREA)
- Electrolytic Production Of Non-Metals, Compounds, Apparatuses Therefor (AREA)
- Separation Using Semi-Permeable Membranes (AREA)
- Manufacture Of Macromolecular Shaped Articles (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US429998A US3884777A (en) | 1974-01-02 | 1974-01-02 | Electrolytic process for manufacturing chlorine dioxide, hydrogen peroxide, chlorine, alkali metal hydroxide and hydrogen |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1043736A true CA1043736A (en) | 1978-12-05 |
Family
ID=23705635
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA216,840A Expired CA1043736A (en) | 1974-01-02 | 1974-12-20 | Electrolytic process for manufacturing chlorine dioxide, hydrogen peroxide, chlorine, alkali metal hydroxide and hydrogen |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US3884777A (enFirst) |
| JP (1) | JPS5322960B2 (enFirst) |
| AU (1) | AU7581574A (enFirst) |
| BR (1) | BR7410588D0 (enFirst) |
| CA (1) | CA1043736A (enFirst) |
| FI (1) | FI376974A7 (enFirst) |
| FR (1) | FR2256263B1 (enFirst) |
| SE (1) | SE409884B (enFirst) |
Families Citing this family (43)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS551351B2 (enFirst) * | 1974-03-07 | 1980-01-12 | ||
| DE2453739C3 (de) * | 1974-11-13 | 1980-03-27 | Kernforschungsanlage Juelich Gmbh, 5170 Juelich | Verfahren zur Herstellung von Wasserstoffperoxid |
| US4000057A (en) * | 1974-11-21 | 1976-12-28 | Hooker Chemicals & Plastics Corporation | Electrolytic cell membrane conditioning |
| JPS5214584A (en) * | 1975-07-25 | 1977-02-03 | Asahi Glass Co Ltd | Electrodialysis method of a base-containing solution |
| JPS5222866A (en) * | 1975-08-15 | 1977-02-21 | Victor Co Of Japan Ltd | Demodulation system for angle modulated signal wave |
| US4113585A (en) * | 1975-10-20 | 1978-09-12 | E. I. Du Pont De Nemours And Company | Method and apparatus for electrolysis of alkali or alkaline earth metal halide |
| SE425322B (sv) * | 1976-05-11 | 1982-09-20 | Kemanobel Ab | Forfarande vid framstellning av alkalimetall- eller jordalkalimetallklorit |
| US4253900A (en) * | 1977-02-28 | 1981-03-03 | Allied Chemical Corporation | Method of making novel two component bipolar ion exchange membranes |
| CA1120429A (en) * | 1977-03-04 | 1982-03-23 | Sirou Sujuki | Treatment of cation exchange membrane with monoamine its salt, or quaternary ammonium salt |
| JPS54500035A (enFirst) * | 1977-12-06 | 1979-10-11 | ||
| FR2449656A1 (fr) * | 1978-12-01 | 1980-09-19 | Sersen | Procede de dessalement de l'eau de mer |
| US4437968A (en) | 1980-09-10 | 1984-03-20 | Zerpol Corporation | Boiler apparatus |
| US4381290A (en) * | 1981-04-23 | 1983-04-26 | Diamond Shamrock Corporation | Method and catalyst for making chlorine dioxide |
| US4426263A (en) | 1981-04-23 | 1984-01-17 | Diamond Shamrock Corporation | Method and electrocatalyst for making chlorine dioxide |
| US4362707A (en) * | 1981-04-23 | 1982-12-07 | Diamond Shamrock Corporation | Preparation of chlorine dioxide with platinum group metal oxide catalysts |
| US4357217A (en) * | 1981-10-02 | 1982-11-02 | Occidental Research Corporation | Three compartment electrolytic cell method for producing hydrogen peroxide |
| US4501824A (en) * | 1982-02-01 | 1985-02-26 | Eltech Systems Corporation | Catalyst for making chlorine dioxide |
| US4731169A (en) * | 1986-10-29 | 1988-03-15 | Tenneco Canada Inc. | Selective removal of chlorine from solutions of chlorine dioxide and chlorine |
| US4780796A (en) * | 1987-01-13 | 1988-10-25 | The Japan Carlit Co., Ltd. | Solid electrolytic capacitor |
| CA1287815C (en) * | 1987-05-29 | 1991-08-20 | Marek Lipsztajn | Electrolytic production of chlorine dioxide |
| CA1322543C (en) * | 1988-10-20 | 1993-09-28 | Marek Lipsztajn | Production of chloric acid |
| WO1990010733A1 (en) * | 1989-03-15 | 1990-09-20 | Pulp And Paper Research Institute Of Canada | Process for generating chloric acid and chlorine dioxide |
| US5074975A (en) * | 1990-08-08 | 1991-12-24 | The University Of British Columbia | Electrochemical cogeneration of alkali metal halate and alkaline peroxide solutions |
| WO1993021106A1 (en) * | 1992-04-15 | 1993-10-28 | A. Ahlstrom Corporation | Production of bleaching chemicals on site at a pulp mill |
| US5256261A (en) * | 1992-08-21 | 1993-10-26 | Sterling Canada, Inc. | Membrane cell operation |
| SE501684C2 (sv) * | 1993-10-07 | 1995-04-24 | Eka Nobel Ab | Förfarande och anordning att framställa klorsyra |
| FR2731021B1 (fr) * | 1995-02-28 | 1997-05-16 | Chemoxal Sa | Procede et installation de fabrication de pate a papier utilisant les effluents de traitement basiques d'une installation de production de peroxyde d'hydrogene |
| CA2194609C (en) * | 1996-01-11 | 2005-08-23 | Gerald Cowley | Process for production of chlorine dioxide |
| CA2378601A1 (en) | 1999-08-05 | 2001-02-15 | Steris Inc. | Electrolytic synthesis of peracetic acid |
| RU2221741C1 (ru) * | 1999-11-26 | 2004-01-20 | Акцо Нобель Н.В. | Способ получения щелочного раствора пероксида водорода и диоксида хлора |
| WO2003106736A2 (en) * | 2001-01-02 | 2003-12-24 | Halox Technologies, Inc. | Electrolytic process and apparatus |
| JP2003050068A (ja) * | 2001-05-30 | 2003-02-21 | Permelec Electrode Ltd | 過酸化水素を含有する氷組成物及び生鮮食品の保存方法 |
| US7241435B2 (en) * | 2002-09-30 | 2007-07-10 | Halox Technologies, Inc. | System and process for producing halogen oxides |
| US6913741B2 (en) * | 2002-09-30 | 2005-07-05 | Halox Technologies, Inc. | System and process for producing halogen oxides |
| US7179363B2 (en) * | 2003-08-12 | 2007-02-20 | Halox Technologies, Inc. | Electrolytic process for generating chlorine dioxide |
| US7799198B2 (en) * | 2004-07-29 | 2010-09-21 | Pureline Treatment Systems, Llc | Chlorine dioxide solution generator with temperature control capability |
| US7399344B1 (en) * | 2005-01-28 | 2008-07-15 | Uop Llc | Hydrogen peroxide recovery with hydrophobic membrane |
| US8034227B2 (en) * | 2005-06-30 | 2011-10-11 | Akzo Nobel N.V. | Chemical process |
| US20070012578A1 (en) * | 2005-06-30 | 2007-01-18 | Akzo Nobel N.V. | Chemical process |
| EP1973842A2 (en) * | 2005-11-30 | 2008-10-01 | Pureline Treatment Systems, LLC | Chlorine dioxide generator |
| US20180370795A1 (en) * | 2016-06-22 | 2018-12-27 | Earl Lorenzo Hamm | Apparatus and method for hydrogen production from an alkali metal and hydrogen dioxide |
| FR3066199B1 (fr) * | 2017-05-10 | 2025-07-04 | Claude Agneletti | Dispositif de valorisation du gaz carbonique dans le cadre d'une cogeneration perfectionnee |
| CN114314765A (zh) * | 2021-12-28 | 2022-04-12 | 湖北华德莱节能减排科技有限公司 | 一种电化学资源化脱硫废水协同产氢的方法、装置及应用 |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE466741A (fr) * | 1946-01-31 | Solvay | Procédé et dispositif pour la fabrication de chlorites alcalins. | |
| NL122179C (enFirst) * | 1959-02-06 | 1966-12-15 | ||
| US3344053A (en) * | 1964-05-04 | 1967-09-26 | Dow Chemical Co | Chlorine cell |
| US3523755A (en) * | 1968-04-01 | 1970-08-11 | Ionics | Processes for controlling the ph of sulfur dioxide scrubbing system |
| US3784399A (en) * | 1971-09-08 | 1974-01-08 | Du Pont | Films of fluorinated polymer containing sulfonyl groups with one surface in the sulfonamide or sulfonamide salt form and a process for preparing such |
-
1974
- 1974-01-02 US US429998A patent/US3884777A/en not_active Expired - Lifetime
- 1974-11-27 AU AU75815/74A patent/AU7581574A/en not_active Expired
- 1974-12-18 BR BR10588/74A patent/BR7410588D0/pt unknown
- 1974-12-20 CA CA216,840A patent/CA1043736A/en not_active Expired
- 1974-12-26 JP JP751086A patent/JPS5322960B2/ja not_active Expired
- 1974-12-27 FI FI3769/74A patent/FI376974A7/fi unknown
- 1974-12-30 FR FR7443249A patent/FR2256263B1/fr not_active Expired
- 1974-12-30 SE SE7416364A patent/SE409884B/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| JPS5322960B2 (enFirst) | 1978-07-12 |
| US3884777A (en) | 1975-05-20 |
| JPS5098499A (enFirst) | 1975-08-05 |
| SE409884B (sv) | 1979-09-10 |
| SE7416364L (enFirst) | 1975-07-03 |
| BR7410588D0 (pt) | 1975-09-02 |
| AU7581574A (en) | 1976-05-27 |
| FR2256263B1 (enFirst) | 1976-12-31 |
| FI376974A7 (enFirst) | 1975-07-03 |
| FR2256263A1 (enFirst) | 1975-07-25 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1043736A (en) | Electrolytic process for manufacturing chlorine dioxide, hydrogen peroxide, chlorine, alkali metal hydroxide and hydrogen | |
| CA1073401A (en) | Electrolytic production of chlorine dioxide, chlorine, alkali metal hydroxide and hydrogen | |
| CA1073402A (en) | Electrolytic manufacture of chlorates using a plurality of electrolytic cells | |
| US5223103A (en) | Electrochemical process for producing chloric acid-alkali metal chlorate mixtures | |
| US4272338A (en) | Process for the treatment of anolyte brine | |
| US5106465A (en) | Electrochemical process for producing chlorine dioxide solutions from chlorites | |
| US3899403A (en) | Electrolytic method of making concentrated hydroxide solutions by sequential use of 3-compartment and 2-compartment electrolytic cells having separating compartment walls of particular cation-active permselective membranes | |
| AU654245B2 (en) | Apparatus for the production of chloric acid and perchloric acid | |
| CA1068640A (en) | Electrolytic production of hydrogen peroxide and alkali metal hydroxide | |
| US4124477A (en) | Electrolytic cell utilizing pretreated semi-permeable membranes | |
| WO1991009158A1 (en) | Electrochemical process for producing chlorine dioxide solutions from chlorites | |
| CA1066222A (en) | Electrolytic cell including buffer, sulphate, acid, and chlorine dioxide compartments | |
| US3878072A (en) | Electrolytic method for the manufacture of chlorates | |
| US4053376A (en) | Electrolytic production of hydrogen iodide | |
| US3954579A (en) | Electrolytic method for the simultaneous manufacture of concentrated and dilute aqueous hydroxide solutions | |
| CA1076060A (en) | Electrolytic method for the manufacture of hypochlorites | |
| US5248397A (en) | Chlorine dioxide generation from chloric acid - alkali metal chlorate mixtures | |
| US3905879A (en) | Electrolytic manufacture of dithionites | |
| US3920551A (en) | Electrolytic method for the manufacture of dithionites | |
| US3935096A (en) | Production of aqueous metal hydroxide solutions of low metal halide concentration | |
| US5242554A (en) | Electrolytic production of chloric acid and sodium chlorate mixtures for the generation of chlorine dioxide | |
| US5264089A (en) | Production of chlorine dioxide employing chloric acid - alkali metal chlorate mixtures | |
| US4061550A (en) | Process for electrolysis | |
| US5423960A (en) | Method and apparatus for manufacturing iodine-free iodides | |
| US5348683A (en) | Chloric acid - alkali metal chlorate mixtures and chlorine dioxide generation |