CA1041521A - Process for the production of indole - Google Patents
Process for the production of indoleInfo
- Publication number
- CA1041521A CA1041521A CA209,049A CA209049A CA1041521A CA 1041521 A CA1041521 A CA 1041521A CA 209049 A CA209049 A CA 209049A CA 1041521 A CA1041521 A CA 1041521A
- Authority
- CA
- Canada
- Prior art keywords
- catalyst
- reaction
- aminostyrene
- ethylaniline
- percent
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- SIKJAQJRHWYJAI-UHFFFAOYSA-N Indole Chemical compound C1=CC=C2NC=CC2=C1 SIKJAQJRHWYJAI-UHFFFAOYSA-N 0.000 title claims abstract description 39
- 238000000034 method Methods 0.000 title claims abstract description 30
- 230000008569 process Effects 0.000 title claims abstract description 30
- PZOUSPYUWWUPPK-UHFFFAOYSA-N indole Natural products CC1=CC=CC2=C1C=CN2 PZOUSPYUWWUPPK-UHFFFAOYSA-N 0.000 title claims abstract description 19
- RKJUIXBNRJVNHR-UHFFFAOYSA-N indolenine Natural products C1=CC=C2CC=NC2=C1 RKJUIXBNRJVNHR-UHFFFAOYSA-N 0.000 title claims abstract description 19
- 238000004519 manufacturing process Methods 0.000 title claims abstract description 6
- MLPVBIWIRCKMJV-UHFFFAOYSA-N 2-ethylaniline Chemical compound CCC1=CC=CC=C1N MLPVBIWIRCKMJV-UHFFFAOYSA-N 0.000 claims abstract description 52
- 239000003054 catalyst Substances 0.000 claims abstract description 39
- KURPPWHPIYBYBS-UHFFFAOYSA-N 2-ethenylaniline Chemical compound NC1=CC=CC=C1C=C KURPPWHPIYBYBS-UHFFFAOYSA-N 0.000 claims abstract description 14
- 150000001875 compounds Chemical class 0.000 claims abstract description 12
- 239000007789 gas Substances 0.000 claims abstract description 10
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims abstract description 9
- 239000001301 oxygen Substances 0.000 claims abstract description 9
- 229910052760 oxygen Inorganic materials 0.000 claims abstract description 9
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 claims abstract description 6
- 230000003197 catalytic effect Effects 0.000 claims abstract description 4
- 229910017052 cobalt Inorganic materials 0.000 claims abstract description 4
- 239000010941 cobalt Substances 0.000 claims abstract description 4
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 claims abstract description 4
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 claims abstract description 3
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 claims abstract description 3
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 claims abstract description 3
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 claims abstract description 3
- QCWXUUIWCKQGHC-UHFFFAOYSA-N Zirconium Chemical compound [Zr] QCWXUUIWCKQGHC-UHFFFAOYSA-N 0.000 claims abstract description 3
- 229910052804 chromium Inorganic materials 0.000 claims abstract description 3
- 239000011651 chromium Substances 0.000 claims abstract description 3
- 229910052802 copper Inorganic materials 0.000 claims abstract description 3
- 239000010949 copper Substances 0.000 claims abstract description 3
- 229910052742 iron Inorganic materials 0.000 claims abstract description 3
- 239000010936 titanium Substances 0.000 claims abstract description 3
- 229910052719 titanium Inorganic materials 0.000 claims abstract description 3
- 229910052720 vanadium Inorganic materials 0.000 claims abstract description 3
- GPPXJZIENCGNKB-UHFFFAOYSA-N vanadium Chemical compound [V]#[V] GPPXJZIENCGNKB-UHFFFAOYSA-N 0.000 claims abstract description 3
- 229910052725 zinc Inorganic materials 0.000 claims abstract description 3
- 239000011701 zinc Substances 0.000 claims abstract description 3
- 229910052726 zirconium Inorganic materials 0.000 claims abstract description 3
- 238000006243 chemical reaction Methods 0.000 claims description 30
- QVQLCTNNEUAWMS-UHFFFAOYSA-N barium oxide Chemical compound [Ba]=O QVQLCTNNEUAWMS-UHFFFAOYSA-N 0.000 claims description 15
- 239000000203 mixture Substances 0.000 claims description 11
- 239000003701 inert diluent Substances 0.000 claims description 8
- JGDFBJMWFLXCLJ-UHFFFAOYSA-N copper chromite Chemical group [Cu]=O.[Cu]=O.O=[Cr]O[Cr]=O JGDFBJMWFLXCLJ-UHFFFAOYSA-N 0.000 claims description 7
- UWRZIZXBOLBCON-UHFFFAOYSA-N 2-phenylethenamine Chemical compound NC=CC1=CC=CC=C1 UWRZIZXBOLBCON-UHFFFAOYSA-N 0.000 claims description 5
- -1 alkali metal anhydride Chemical class 0.000 claims description 5
- 239000000376 reactant Substances 0.000 claims description 5
- 150000001341 alkaline earth metal compounds Chemical class 0.000 claims description 4
- 229910052783 alkali metal Inorganic materials 0.000 claims description 3
- 150000001339 alkali metal compounds Chemical class 0.000 claims description 3
- 229910052784 alkaline earth metal Inorganic materials 0.000 claims description 3
- 239000007795 chemical reaction product Substances 0.000 claims description 3
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Substances N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 3
- 229910052757 nitrogen Inorganic materials 0.000 claims description 2
- 229930195734 saturated hydrocarbon Natural products 0.000 claims description 2
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 claims 1
- JQOAZIZLIIOXEW-UHFFFAOYSA-N zinc;chromium(3+);oxygen(2-) Chemical group [O-2].[O-2].[O-2].[O-2].[Cr+3].[Cr+3].[Zn+2] JQOAZIZLIIOXEW-UHFFFAOYSA-N 0.000 claims 1
- 239000003513 alkali Substances 0.000 abstract description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 13
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 4
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 4
- UQSXHKLRYXJYBZ-UHFFFAOYSA-N Iron oxide Chemical compound [Fe]=O UQSXHKLRYXJYBZ-UHFFFAOYSA-N 0.000 description 4
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Substances [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 4
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 3
- 239000004568 cement Substances 0.000 description 3
- 150000002894 organic compounds Chemical class 0.000 description 3
- 229910000027 potassium carbonate Inorganic materials 0.000 description 3
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 2
- 239000011398 Portland cement Substances 0.000 description 2
- 229910052786 argon Inorganic materials 0.000 description 2
- 229910002092 carbon dioxide Inorganic materials 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- QWTDNUCVQCZILF-UHFFFAOYSA-N isopentane Chemical compound CCC(C)C QWTDNUCVQCZILF-UHFFFAOYSA-N 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 2
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 230000008929 regeneration Effects 0.000 description 2
- 238000011069 regeneration method Methods 0.000 description 2
- CWPVCLBFFRPRCL-UHFFFAOYSA-N 2-ethenylaniline 1H-indole Chemical compound C1=CC=C2NC=CC2=C1.NC1=CC=CC=C1C=C CWPVCLBFFRPRCL-UHFFFAOYSA-N 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N Alumina Chemical compound [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- IIOUWPSJYWPDKM-UHFFFAOYSA-N C(C)C1=C(C=C)C=CC=C1.N1C=CC2=CC=CC=C12 Chemical compound C(C)C1=C(C=C)C=CC=C1.N1C=CC2=CC=CC=C12 IIOUWPSJYWPDKM-UHFFFAOYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- 241000282326 Felis catus Species 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 229910020396 K2CO3—KOH Inorganic materials 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- JLNTWVDSQRNWFU-UHFFFAOYSA-N OOOOOOO Chemical compound OOOOOOO JLNTWVDSQRNWFU-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 150000001491 aromatic compounds Chemical class 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 229910052788 barium Inorganic materials 0.000 description 1
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 description 1
- 150000001553 barium compounds Chemical class 0.000 description 1
- 229910052790 beryllium Inorganic materials 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 229910052792 caesium Inorganic materials 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 239000000571 coke Substances 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- AFABGHUZZDYHJO-UHFFFAOYSA-N dimethyl butane Natural products CCCC(C)C AFABGHUZZDYHJO-UHFFFAOYSA-N 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 229910052730 francium Inorganic materials 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 238000007689 inspection Methods 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- 229910052697 platinum Inorganic materials 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 235000015320 potassium carbonate Nutrition 0.000 description 1
- 150000003112 potassium compounds Chemical class 0.000 description 1
- 230000007420 reactivation Effects 0.000 description 1
- 229910052701 rubidium Inorganic materials 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/02—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom condensed with one carbocyclic ring
- C07D209/04—Indoles; Hydrogenated indoles
- C07D209/08—Indoles; Hydrogenated indoles with only hydrogen atoms or radicals containing only hydrogen and carbon atoms, directly attached to carbon atoms of the hetero ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Catalysts (AREA)
- Indole Compounds (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH1309173A CH589054A5 (enExample) | 1973-09-12 | 1973-09-12 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1041521A true CA1041521A (en) | 1978-10-31 |
Family
ID=4389219
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA209,049A Expired CA1041521A (en) | 1973-09-12 | 1974-09-12 | Process for the production of indole |
Country Status (14)
| Country | Link |
|---|---|
| US (1) | US3984434A (enExample) |
| JP (1) | JPS5076067A (enExample) |
| AT (1) | AT337171B (enExample) |
| BE (1) | BE819840A (enExample) |
| CA (1) | CA1041521A (enExample) |
| CH (1) | CH589054A5 (enExample) |
| DD (1) | DD113533A5 (enExample) |
| DE (1) | DE2441439C2 (enExample) |
| FR (1) | FR2243190B1 (enExample) |
| GB (1) | GB1410585A (enExample) |
| IT (1) | IT1032074B (enExample) |
| LU (1) | LU70890A1 (enExample) |
| NL (1) | NL7411512A (enExample) |
| SU (1) | SU510996A3 (enExample) |
Families Citing this family (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS56150062A (en) * | 1980-04-22 | 1981-11-20 | Mitsui Toatsu Chem Inc | Production of indole or indole derivative |
| JPS5923306B2 (ja) | 1980-06-03 | 1984-06-01 | 三井東圧化学株式会社 | インド−ルまたはインド−ル誘導体の製造方法 |
| US4436917A (en) | 1981-04-15 | 1984-03-13 | Mitsui Toatsu Chemicals, Inc. | Process for the preparation of indoles |
| US4456760A (en) * | 1981-04-15 | 1984-06-26 | Mitsui Toatsu Chemicals, Incorporated | Process for the preparation of indoles |
| US4376205A (en) * | 1981-04-15 | 1983-03-08 | Mitsui Toatsu Chemicals, Inc. | Process for the preparation of indoles from anilines and ethanolamines |
| DE3464756D1 (en) * | 1983-03-23 | 1987-08-20 | Lonza Ag | Process for the preparation of 7-alkyl indoles |
| US4520206A (en) * | 1984-02-27 | 1985-05-28 | Ashland Oil, Inc. | Process for preparing maleimide |
| US4659841A (en) * | 1984-07-10 | 1987-04-21 | Research Association For Utilization Of Light Oil | Process for the preparation of indoles |
| JPS61118361A (ja) * | 1984-11-12 | 1986-06-05 | Res Assoc Util Of Light Oil | インド−ル類の製造方法 |
| WO1996032391A1 (de) * | 1995-04-11 | 1996-10-17 | Lonza Ag | Verfahren zur herstellung von azaindolen mit aktiviertem kupferchromit katalysator durch katalytische dehydrocyclisierung von alkyl-pyridylaminen (pyridopyridinen) |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA684736A (en) * | 1964-04-21 | L. O'connor George | Dehydrocyclization process | |
| US2409676A (en) * | 1944-09-20 | 1946-10-22 | Du Pont | Preparation of indole |
| US3271414A (en) * | 1964-05-12 | 1966-09-06 | Mobil Oil Corp | Preparation of benzofuran, benzothiophene, and indoles |
| CS174823B2 (enExample) * | 1970-09-07 | 1977-04-29 | Snam Progetti | |
| CA935819A (en) * | 1970-09-30 | 1973-10-23 | Snamprogetti S.P.A. | Process for producing di-or polynuclear heterocyclic compounds |
| IT941402B (it) * | 1971-05-13 | 1973-03-01 | Snam Progetti | Procedimento per la preparazione di composti eterociclici azotati del gruppo dell indolo o della chinolina |
-
1973
- 1973-09-12 CH CH1309173A patent/CH589054A5/xx not_active IP Right Cessation
-
1974
- 1974-08-19 GB GB3637174A patent/GB1410585A/en not_active Expired
- 1974-08-29 DE DE2441439A patent/DE2441439C2/de not_active Expired
- 1974-08-29 NL NL7411512A patent/NL7411512A/xx not_active Application Discontinuation
- 1974-09-10 SU SU2058372A patent/SU510996A3/ru active
- 1974-09-10 IT IT52946/74A patent/IT1032074B/it active
- 1974-09-11 JP JP49105451A patent/JPS5076067A/ja active Pending
- 1974-09-12 CA CA209,049A patent/CA1041521A/en not_active Expired
- 1974-09-12 US US05/505,517 patent/US3984434A/en not_active Expired - Lifetime
- 1974-09-12 BE BE148459A patent/BE819840A/xx not_active IP Right Cessation
- 1974-09-12 FR FR7430903A patent/FR2243190B1/fr not_active Expired
- 1974-09-12 DD DD181068A patent/DD113533A5/xx unknown
- 1974-09-12 AT AT737774A patent/AT337171B/de not_active IP Right Cessation
- 1974-09-12 LU LU70890A patent/LU70890A1/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| NL7411512A (nl) | 1975-03-14 |
| DD113533A5 (enExample) | 1975-06-12 |
| JPS5076067A (enExample) | 1975-06-21 |
| AT337171B (de) | 1977-06-10 |
| FR2243190A1 (enExample) | 1975-04-04 |
| LU70890A1 (enExample) | 1975-05-28 |
| BE819840A (fr) | 1975-03-12 |
| DE2441439C2 (de) | 1983-10-13 |
| US3984434A (en) | 1976-10-05 |
| IT1032074B (it) | 1979-05-30 |
| ATA737774A (de) | 1976-10-15 |
| DE2441439A1 (de) | 1975-03-13 |
| SU510996A3 (ru) | 1976-04-15 |
| CH589054A5 (enExample) | 1977-06-30 |
| GB1410585A (en) | 1975-10-22 |
| FR2243190B1 (enExample) | 1978-10-27 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| AU2002217114B2 (en) | Process for preparing oxirane compounds | |
| US4375566A (en) | Process for producing ortho-alkylated phenols from anisoles | |
| AU2002217114A1 (en) | Process for preparing oxirane compounds | |
| CA1041521A (en) | Process for the production of indole | |
| US3836603A (en) | Process for preparing para-xylene | |
| US4218572A (en) | Process for the production of polyphenyls | |
| US2446132A (en) | Silver catalysts | |
| US4683329A (en) | Beneficial use of water in catalytic conversion of formamides to isocyanates | |
| US6274764B1 (en) | Process for one step gas phase production of acetic acid from ethylene | |
| US3950438A (en) | Preparation of resorcinol and alkyl-substituted derivatives thereof | |
| US3792086A (en) | Process for the preparation of acrylic and methacrylic acids | |
| US4035428A (en) | Process for production of orthophenylphenol | |
| US4026820A (en) | Solid catalysts for oxidative dehydrogenation of alkenes or alkadienes to furan compounds | |
| US3928389A (en) | Oxidative dehydrogenation of alkenes or alkadienes to furan compounds | |
| US4202992A (en) | Process for producing hydroperoxides | |
| US4384146A (en) | Process for butanediols | |
| JPS62145076A (ja) | 1,4−ビス(2−ヒドロキシエチル)ピペラジンの製造方法 | |
| US4075122A (en) | Catalyst and method of oxydehydrogenation of alkyl aromatic compounds | |
| US3636156A (en) | Process for the direct production of ketones from olefins | |
| US3253051A (en) | Process of producing isoprene | |
| US4073787A (en) | Manufacture of pyridine and methylpyridines | |
| US4045484A (en) | Process for preparing N'-methyl acethydrazide | |
| US4429175A (en) | Process for the production of ethylbenzene | |
| CA1048517A (en) | Process for making 4-butyrolactone | |
| US3923881A (en) | Process for the preparation of C{HD 4 {B dicarboxylic acids from 2-butene |