CA1039730A - 4-benzyloxymethyl-2,4-dialkyl-1,3-dioxolane-2-carboxamide compounds - Google Patents
4-benzyloxymethyl-2,4-dialkyl-1,3-dioxolane-2-carboxamide compoundsInfo
- Publication number
- CA1039730A CA1039730A CA200,856A CA200856A CA1039730A CA 1039730 A CA1039730 A CA 1039730A CA 200856 A CA200856 A CA 200856A CA 1039730 A CA1039730 A CA 1039730A
- Authority
- CA
- Canada
- Prior art keywords
- carbon atoms
- group
- alkyl
- substituted
- phenyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 97
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 51
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims abstract description 35
- 239000000460 chlorine Chemical group 0.000 claims abstract description 21
- -1 carbamoylmethyl Chemical group 0.000 claims abstract description 20
- 229910052801 chlorine Inorganic materials 0.000 claims abstract description 20
- 125000001309 chloro group Chemical group Cl* 0.000 claims abstract description 19
- 125000003545 alkoxy group Chemical group 0.000 claims abstract description 18
- 125000003342 alkenyl group Chemical group 0.000 claims abstract description 16
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 claims abstract description 14
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims abstract description 13
- 150000001408 amides Chemical class 0.000 claims abstract description 13
- 125000004414 alkyl thio group Chemical group 0.000 claims abstract description 12
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims abstract description 12
- 125000000753 cycloalkyl group Chemical group 0.000 claims abstract description 12
- 229910052731 fluorine Inorganic materials 0.000 claims abstract description 12
- 239000011737 fluorine Substances 0.000 claims abstract description 12
- 125000001188 haloalkyl group Chemical group 0.000 claims abstract description 11
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims abstract description 10
- 125000005037 alkyl phenyl group Chemical group 0.000 claims abstract description 8
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims abstract description 7
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical group BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims abstract description 7
- 229910052794 bromium Inorganic materials 0.000 claims abstract description 7
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical group [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims abstract description 6
- 229910052736 halogen Inorganic materials 0.000 claims abstract description 6
- 150000002367 halogens Chemical group 0.000 claims abstract description 6
- 125000000623 heterocyclic group Chemical group 0.000 claims abstract description 6
- 125000005090 alkenylcarbonyl group Chemical group 0.000 claims abstract description 5
- 125000003118 aryl group Chemical group 0.000 claims abstract description 5
- 125000001153 fluoro group Chemical group F* 0.000 claims abstract description 5
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 claims abstract description 5
- 125000005059 halophenyl group Chemical group 0.000 claims abstract description 4
- 125000005079 alkoxycarbonylmethyl group Chemical group 0.000 claims abstract description 3
- 125000005129 aryl carbonyl group Chemical group 0.000 claims abstract description 3
- 150000001875 compounds Chemical class 0.000 claims description 16
- 241000196324 Embryophyta Species 0.000 claims description 9
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 8
- 238000000034 method Methods 0.000 claims description 8
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 8
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical group FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 7
- 125000005036 alkoxyphenyl group Chemical group 0.000 claims description 7
- 125000006501 nitrophenyl group Chemical group 0.000 claims description 7
- 125000004448 alkyl carbonyl group Chemical group 0.000 claims description 4
- 229910052757 nitrogen Inorganic materials 0.000 claims description 4
- 125000004076 pyridyl group Chemical group 0.000 claims description 4
- 125000000335 thiazolyl group Chemical group 0.000 claims description 4
- 125000004188 dichlorophenyl group Chemical group 0.000 claims description 3
- 125000003709 fluoroalkyl group Chemical group 0.000 claims description 3
- 125000003944 tolyl group Chemical group 0.000 claims description 3
- 125000002252 acyl group Chemical group 0.000 claims description 2
- 150000001412 amines Chemical class 0.000 claims description 2
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 claims description 2
- 125000000068 chlorophenyl group Chemical group 0.000 claims description 2
- 125000001207 fluorophenyl group Chemical group 0.000 claims description 2
- 229910052740 iodine Inorganic materials 0.000 claims description 2
- 239000012948 isocyanate Substances 0.000 claims description 2
- 150000002513 isocyanates Chemical class 0.000 claims description 2
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 claims description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims 2
- 239000011630 iodine Substances 0.000 claims 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 19
- 239000000203 mixture Substances 0.000 description 14
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 11
- 229940060038 chlorine Drugs 0.000 description 9
- 235000017168 chlorine Nutrition 0.000 description 9
- 239000002689 soil Substances 0.000 description 8
- 239000000243 solution Substances 0.000 description 8
- 238000004458 analytical method Methods 0.000 description 7
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- 239000002904 solvent Substances 0.000 description 5
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- 239000004480 active ingredient Substances 0.000 description 4
- 239000000654 additive Substances 0.000 description 4
- 239000002270 dispersing agent Substances 0.000 description 4
- 230000002363 herbicidal effect Effects 0.000 description 4
- 239000003208 petroleum Substances 0.000 description 4
- 239000007787 solid Substances 0.000 description 4
- 239000003381 stabilizer Substances 0.000 description 4
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 3
- 125000004429 atom Chemical group 0.000 description 3
- 239000006185 dispersion Substances 0.000 description 3
- 239000000839 emulsion Substances 0.000 description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 3
- 239000008187 granular material Substances 0.000 description 3
- 229910052760 oxygen Inorganic materials 0.000 description 3
- 229910000104 sodium hydride Inorganic materials 0.000 description 3
- 239000012312 sodium hydride Substances 0.000 description 3
- 238000005507 spraying Methods 0.000 description 3
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- 240000004713 Pisum sativum Species 0.000 description 2
- 235000010582 Pisum sativum Nutrition 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- GKIRPKYJQBWNGO-OCEACIFDSA-N clomifene Chemical compound C1=CC(OCCN(CC)CC)=CC=C1C(\C=1C=CC=CC=1)=C(\Cl)C1=CC=CC=C1 GKIRPKYJQBWNGO-OCEACIFDSA-N 0.000 description 2
- 239000012141 concentrate Substances 0.000 description 2
- 238000005260 corrosion Methods 0.000 description 2
- 230000007797 corrosion Effects 0.000 description 2
- 239000004495 emulsifiable concentrate Substances 0.000 description 2
- 239000003995 emulsifying agent Substances 0.000 description 2
- 239000000284 extract Substances 0.000 description 2
- 238000009472 formulation Methods 0.000 description 2
- 239000004615 ingredient Substances 0.000 description 2
- 239000003112 inhibitor Substances 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- VAMXMNNIEUEQDV-UHFFFAOYSA-N methyl anthranilate Chemical compound COC(=O)C1=CC=CC=C1N VAMXMNNIEUEQDV-UHFFFAOYSA-N 0.000 description 2
- 239000000741 silica gel Substances 0.000 description 2
- 229910002027 silica gel Inorganic materials 0.000 description 2
- 239000007921 spray Substances 0.000 description 2
- 239000004094 surface-active agent Substances 0.000 description 2
- 239000004546 suspension concentrate Substances 0.000 description 2
- 231100000167 toxic agent Toxicity 0.000 description 2
- 239000003440 toxic substance Substances 0.000 description 2
- ZMANZCXQSJIPKH-UHFFFAOYSA-N triethylamine Natural products CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 2
- 239000004563 wettable powder Substances 0.000 description 2
- AJBWCCGRJOFXSJ-UHFFFAOYSA-N 2,4-dimethyl-4-(phenylmethoxymethyl)-1,3-dioxolane-2-carboxylic acid Chemical compound C(C1=CC=CC=C1)OCC1(OC(OC1)(C(=O)O)C)C AJBWCCGRJOFXSJ-UHFFFAOYSA-N 0.000 description 1
- VIUDTWATMPPKEL-UHFFFAOYSA-N 3-(trifluoromethyl)aniline Chemical compound NC1=CC=CC(C(F)(F)F)=C1 VIUDTWATMPPKEL-UHFFFAOYSA-N 0.000 description 1
- 241000335053 Beta vulgaris Species 0.000 description 1
- 235000021533 Beta vulgaris Nutrition 0.000 description 1
- 241000219310 Beta vulgaris subsp. vulgaris Species 0.000 description 1
- 235000006463 Brassica alba Nutrition 0.000 description 1
- 244000056139 Brassica cretica Species 0.000 description 1
- 235000003351 Brassica cretica Nutrition 0.000 description 1
- 244000140786 Brassica hirta Species 0.000 description 1
- 235000003343 Brassica rupestris Nutrition 0.000 description 1
- 241000905957 Channa melasoma Species 0.000 description 1
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 1
- 244000058871 Echinochloa crus-galli Species 0.000 description 1
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 241000208204 Linum Species 0.000 description 1
- 240000006240 Linum usitatissimum Species 0.000 description 1
- 235000004431 Linum usitatissimum Nutrition 0.000 description 1
- 240000007594 Oryza sativa Species 0.000 description 1
- 235000007164 Oryza sativa Nutrition 0.000 description 1
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 1
- 235000021536 Sugar beet Nutrition 0.000 description 1
- 240000008042 Zea mays Species 0.000 description 1
- 235000016383 Zea mays subsp huehuetenangensis Nutrition 0.000 description 1
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 1
- 230000000895 acaricidal effect Effects 0.000 description 1
- 239000003929 acidic solution Substances 0.000 description 1
- 239000011149 active material Substances 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 239000000443 aerosol Substances 0.000 description 1
- 238000005054 agglomeration Methods 0.000 description 1
- 230000002776 aggregation Effects 0.000 description 1
- 229910000102 alkali metal hydride Inorganic materials 0.000 description 1
- 150000008046 alkali metal hydrides Chemical class 0.000 description 1
- 239000007798 antifreeze agent Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- QKSKPIVNLNLAAV-UHFFFAOYSA-N bis(2-chloroethyl) sulfide Chemical compound ClCCSCCCl QKSKPIVNLNLAAV-UHFFFAOYSA-N 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 239000012876 carrier material Substances 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 239000000084 colloidal system Substances 0.000 description 1
- 239000002361 compost Substances 0.000 description 1
- 239000006184 cosolvent Substances 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 238000007865 diluting Methods 0.000 description 1
- 229960001760 dimethyl sulfoxide Drugs 0.000 description 1
- 239000000428 dust Substances 0.000 description 1
- 235000004426 flaxseed Nutrition 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- 239000000499 gel Substances 0.000 description 1
- 239000004009 herbicide Substances 0.000 description 1
- 238000005470 impregnation Methods 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 239000012669 liquid formulation Substances 0.000 description 1
- 235000009973 maize Nutrition 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 239000008268 mayonnaise Substances 0.000 description 1
- 235000010746 mayonnaise Nutrition 0.000 description 1
- MYWUZJCMWCOHBA-VIFPVBQESA-N methamphetamine Chemical compound CN[C@@H](C)CC1=CC=CC=C1 MYWUZJCMWCOHBA-VIFPVBQESA-N 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- 229940102398 methyl anthranilate Drugs 0.000 description 1
- 125000002816 methylsulfanyl group Chemical group [H]C([H])([H])S[*] 0.000 description 1
- 235000010460 mustard Nutrition 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 239000003415 peat Substances 0.000 description 1
- 230000000361 pesticidal effect Effects 0.000 description 1
- 239000000575 pesticide Substances 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 230000001681 protective effect Effects 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 235000009566 rice Nutrition 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 238000004062 sedimentation Methods 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 230000003595 spectral effect Effects 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000000375 suspending agent Substances 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 239000013008 thixotropic agent Substances 0.000 description 1
- 239000010455 vermiculite Substances 0.000 description 1
- 229910052902 vermiculite Inorganic materials 0.000 description 1
- 235000019354 vermiculite Nutrition 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D405/00—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom
- C07D405/02—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings
- C07D405/12—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D317/00—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms
- C07D317/08—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3
- C07D317/10—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 not condensed with other rings
- C07D317/32—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 not condensed with other rings with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Plural Heterocyclic Compounds (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB3160473A GB1469530A (en) | 1973-07-03 | 1973-07-03 | 1,3-dioxolane-2-carboxamide derivatives and their use as herbicidal agents |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1039730A true CA1039730A (en) | 1978-10-03 |
Family
ID=10325629
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA200,856A Expired CA1039730A (en) | 1973-07-03 | 1974-05-27 | 4-benzyloxymethyl-2,4-dialkyl-1,3-dioxolane-2-carboxamide compounds |
Country Status (13)
| Country | Link |
|---|---|
| US (3) | US3890352A (https=) |
| JP (1) | JPS5036466A (https=) |
| BE (1) | BE817111A (https=) |
| BR (1) | BR7405416D0 (https=) |
| CA (1) | CA1039730A (https=) |
| CH (1) | CH601997A5 (https=) |
| DE (1) | DE2431525A1 (https=) |
| ES (1) | ES427843A1 (https=) |
| FR (1) | FR2235939B1 (https=) |
| GB (1) | GB1469530A (https=) |
| IT (1) | IT1048179B (https=) |
| NL (1) | NL7408834A (https=) |
| ZA (1) | ZA744225B (https=) |
Families Citing this family (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4089865A (en) * | 1971-10-27 | 1978-05-16 | Syntex (U.S.A.) Inc. | Certain thiazole compounds |
| US3986861A (en) * | 1973-07-03 | 1976-10-19 | Shell Oil Company | Herbicidal amide compositions |
| US4000149A (en) * | 1973-07-03 | 1976-12-28 | Shell Oil Company | Herbicidal amide derivatives |
| GB1521685A (en) * | 1974-09-23 | 1978-08-16 | Shell Int Research | 2-halobenzyl ethers |
| US4042369A (en) * | 1974-06-21 | 1977-08-16 | Shell Oil Company | Compositions and methods of combatting weeds in crops with 2,6-dihalobenzyl ether |
| HU193416B (en) * | 1983-09-28 | 1987-10-28 | Nitrokemia Ipartelepek | Fungicide compositions containing glyoxylic acid derivatives as active agents and process for producing the active agents |
| JPS63276509A (ja) * | 1987-05-08 | 1988-11-14 | Tokai Techno Kk | 樹脂・金属複合材の再生処理方法とその装置 |
| JPH03263716A (ja) * | 1990-03-13 | 1991-11-25 | Yazaki Corp | 電線スクラップの再生前処理装置 |
| JPH0847926A (ja) * | 1995-07-12 | 1996-02-20 | Hitachi Ltd | プラスチックの分別方法及びその装置 |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1145822A (en) * | 1965-03-10 | 1969-03-19 | May & Baker Ltd | Thiazole derivatives |
| US3496187A (en) * | 1967-03-20 | 1970-02-17 | American Home Prod | N-(heterocyclyl)aconamides |
-
1973
- 1973-07-03 GB GB3160473A patent/GB1469530A/en not_active Expired
-
1974
- 1974-05-27 CA CA200,856A patent/CA1039730A/en not_active Expired
- 1974-06-25 US US482933A patent/US3890352A/en not_active Expired - Lifetime
- 1974-06-25 US US482935A patent/US3920675A/en not_active Expired - Lifetime
- 1974-06-25 US US482936A patent/US3891675A/en not_active Expired - Lifetime
- 1974-06-28 IT IT24624/74A patent/IT1048179B/it active
- 1974-07-01 FR FR7422864A patent/FR2235939B1/fr not_active Expired
- 1974-07-01 ES ES427843A patent/ES427843A1/es not_active Expired
- 1974-07-01 DE DE2431525A patent/DE2431525A1/de not_active Withdrawn
- 1974-07-01 JP JP49074383A patent/JPS5036466A/ja active Pending
- 1974-07-01 CH CH899474A patent/CH601997A5/xx not_active IP Right Cessation
- 1974-07-01 BE BE146100A patent/BE817111A/xx unknown
- 1974-07-01 NL NL7408834A patent/NL7408834A/xx not_active Application Discontinuation
- 1974-07-01 BR BR5416/74A patent/BR7405416D0/pt unknown
- 1974-07-01 ZA ZA00744225A patent/ZA744225B/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| BR7405416D0 (pt) | 1975-05-20 |
| AU7065674A (en) | 1976-01-08 |
| IT1048179B (it) | 1980-11-20 |
| US3920675A (en) | 1975-11-18 |
| ES427843A1 (es) | 1976-12-16 |
| FR2235939B1 (https=) | 1978-11-10 |
| FR2235939A1 (https=) | 1975-01-31 |
| ZA744225B (en) | 1975-07-30 |
| NL7408834A (nl) | 1975-01-07 |
| GB1469530A (en) | 1977-04-06 |
| DE2431525A1 (de) | 1975-01-30 |
| US3891675A (en) | 1975-06-24 |
| US3890352A (en) | 1975-06-17 |
| JPS5036466A (https=) | 1975-04-05 |
| BE817111A (fr) | 1975-01-02 |
| CH601997A5 (https=) | 1978-07-14 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE69324552T2 (de) | N'-substituierte-N,N'Diacylhydrazin-Insektizide | |
| DE69304057T2 (de) | Indole fungizide | |
| DE2804299A1 (de) | Fungizide mittel | |
| CA1039730A (en) | 4-benzyloxymethyl-2,4-dialkyl-1,3-dioxolane-2-carboxamide compounds | |
| GB1591093A (en) | 2-benzyloxymethylfuran derivatives and their use as herbicides | |
| US3919252A (en) | 2,6 Dihalobenzyl ethers | |
| DE69018404T2 (de) | Herbizide Acrylonitrilderivate. | |
| AU638349B2 (en) | Heterocycle-substituted benzene derivative, production thereof, and herbicide containing the same as active ingredient | |
| EP0257294B1 (de) | E/Z-Isomerengemische und reine Z-Isomere von N alpha-(2-Cyan-2-alkoximinoacetyl) aminosäurederivaten und- peptiden | |
| CA1053259A (en) | Unsaturated haloacetamides and their use as herbicides and as plant-growth regulators | |
| CA1052797A (en) | Spiro-cyclopropanes | |
| US3887472A (en) | Cyclic oxime derivatives | |
| DE4029054A1 (de) | N-acylpyrrolidin-derivate | |
| AU612651B2 (en) | Oximino ether compounds | |
| DE3885316T2 (de) | Glycinverbindungen. | |
| EP0183174B1 (en) | Substituted phenoxy urea, processes for its preparation and herbicide containing it as active ingredient | |
| DE3625460A1 (de) | N-(2-cyan-2-oximinoacetyl)-aminonitrile | |
| EP0010166B1 (de) | N-(1,2-Azolyl)alkyl-chloracetanilide, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Herbizide | |
| EP0276721A1 (de) | 2-Cyan-2-oximino-acetamide | |
| US4000149A (en) | Herbicidal amide derivatives | |
| EP0008091A1 (de) | Substituierte N-Pyrazolylmethyl-halogenacetanilide, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Herbizide | |
| EP0286153B1 (en) | Herbicidal vinylamine derivatives | |
| EP0257295B1 (de) | (Z)-2-Cyan-2-oximino-acetyl-chloride sowie ein Verfahren zu ihrer Herstellung | |
| Zhae et al. | Design, synthesis, and insecticidal activity of novel neonicotinoid derivatives containing N-oxalyl groups | |
| US3224937A (en) | Sydnone-containing insecticidal compositions and methods |