CA1038872A - 1,2,3,4-tetrahydro-5-amino-8-hydroxy-quinolinium compounds - Google Patents
1,2,3,4-tetrahydro-5-amino-8-hydroxy-quinolinium compoundsInfo
- Publication number
- CA1038872A CA1038872A CA216,367A CA216367A CA1038872A CA 1038872 A CA1038872 A CA 1038872A CA 216367 A CA216367 A CA 216367A CA 1038872 A CA1038872 A CA 1038872A
- Authority
- CA
- Canada
- Prior art keywords
- carbon atoms
- tetrahydro
- alkyl group
- amino
- bromide
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- KQBOUJDEVFTLTE-UHFFFAOYSA-N 5-amino-1,2,3,4-tetrahydroquinolin-8-ol Chemical class N1CCCC2=C1C(O)=CC=C2N KQBOUJDEVFTLTE-UHFFFAOYSA-N 0.000 title abstract 2
- 150000001875 compounds Chemical class 0.000 claims abstract description 38
- 239000003795 chemical substances by application Substances 0.000 claims abstract description 34
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 28
- 238000000034 method Methods 0.000 claims abstract description 22
- 230000008569 process Effects 0.000 claims abstract description 21
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 20
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims abstract description 11
- 238000012546 transfer Methods 0.000 claims abstract description 11
- 125000004964 sulfoalkyl group Chemical group 0.000 claims abstract description 10
- 238000009792 diffusion process Methods 0.000 claims abstract description 8
- 150000001450 anions Chemical class 0.000 claims abstract description 5
- 229910052709 silver Inorganic materials 0.000 claims description 21
- 239000004332 silver Substances 0.000 claims description 21
- -1 compound N,N-dimethyl-1,2,3,4-tetrahydro-5-amino-8-hydroxyquinolinium bromide Chemical class 0.000 claims description 20
- 239000007822 coupling agent Substances 0.000 claims description 15
- 239000000203 mixture Substances 0.000 claims description 11
- ALEPMNFAFDTYOT-UHFFFAOYSA-N 5-amino-1,1-dimethyl-3,4-dihydro-2h-quinolin-1-ium-8-ol;bromide Chemical compound [Br-].C1=CC(O)=C2[N+](C)(C)CCCC2=C1N ALEPMNFAFDTYOT-UHFFFAOYSA-N 0.000 claims description 4
- ATISATDDBKHPGJ-UHFFFAOYSA-N 5-amino-1,1-dimethyl-7-propyl-3,4-dihydro-2h-quinolin-1-ium-8-ol;bromide Chemical compound [Br-].C1CC[N+](C)(C)C2=C(O)C(CCC)=CC(N)=C21 ATISATDDBKHPGJ-UHFFFAOYSA-N 0.000 claims description 4
- 239000000839 emulsion Substances 0.000 claims description 4
- POZCXHBHKWDMMC-UHFFFAOYSA-N 5-amino-1,1-diethyl-3,4-dihydro-2h-quinolin-1-ium-8-ol;bromide Chemical compound [Br-].C1=CC(O)=C2[N+](CC)(CC)CCCC2=C1N POZCXHBHKWDMMC-UHFFFAOYSA-N 0.000 claims description 2
- PLIKAWJENQZMHA-UHFFFAOYSA-N 4-aminophenol Chemical compound NC1=CC=C(O)C=C1 PLIKAWJENQZMHA-UHFFFAOYSA-N 0.000 abstract description 28
- 230000015572 biosynthetic process Effects 0.000 abstract description 5
- 125000004429 atom Chemical group 0.000 abstract 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 33
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 30
- 239000000975 dye Substances 0.000 description 25
- 239000000243 solution Substances 0.000 description 22
- 238000002360 preparation method Methods 0.000 description 20
- 239000000047 product Substances 0.000 description 19
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 19
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 18
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 description 17
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 15
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 14
- 150000003839 salts Chemical group 0.000 description 12
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 11
- 238000011161 development Methods 0.000 description 11
- 238000002844 melting Methods 0.000 description 11
- 230000008018 melting Effects 0.000 description 11
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 10
- 238000001816 cooling Methods 0.000 description 10
- 239000001257 hydrogen Substances 0.000 description 9
- 229910052739 hydrogen Inorganic materials 0.000 description 9
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 8
- 239000003054 catalyst Substances 0.000 description 8
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 8
- 239000005725 8-Hydroxyquinoline Substances 0.000 description 7
- 238000004821 distillation Methods 0.000 description 7
- 229960003540 oxyquinoline Drugs 0.000 description 7
- 238000012545 processing Methods 0.000 description 7
- 229910001220 stainless steel Inorganic materials 0.000 description 7
- 239000010935 stainless steel Substances 0.000 description 7
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 6
- 238000010521 absorption reaction Methods 0.000 description 6
- 238000004458 analytical method Methods 0.000 description 6
- GLJXLTCOXSLUCS-UHFFFAOYSA-M benzenediazonium;bromide Chemical compound [Br-].N#[N+]C1=CC=CC=C1 GLJXLTCOXSLUCS-UHFFFAOYSA-M 0.000 description 6
- GZUXJHMPEANEGY-UHFFFAOYSA-N bromomethane Chemical compound BrC GZUXJHMPEANEGY-UHFFFAOYSA-N 0.000 description 6
- 239000013078 crystal Substances 0.000 description 6
- 235000011121 sodium hydroxide Nutrition 0.000 description 6
- 239000002904 solvent Substances 0.000 description 6
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 5
- 238000006243 chemical reaction Methods 0.000 description 5
- 238000005984 hydrogenation reaction Methods 0.000 description 5
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 5
- 229910052757 nitrogen Inorganic materials 0.000 description 5
- 239000002244 precipitate Substances 0.000 description 5
- MCJGNVYPOGVAJF-UHFFFAOYSA-N quinolin-8-ol Chemical compound C1=CN=C2C(O)=CC=CC2=C1 MCJGNVYPOGVAJF-UHFFFAOYSA-N 0.000 description 5
- 239000011541 reaction mixture Substances 0.000 description 5
- 238000010992 reflux Methods 0.000 description 5
- 229940083608 sodium hydroxide Drugs 0.000 description 5
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 4
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- UXVMQQNJUSDDNG-UHFFFAOYSA-L Calcium chloride Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 description 4
- 238000013019 agitation Methods 0.000 description 4
- 239000001110 calcium chloride Substances 0.000 description 4
- 229910001628 calcium chloride Inorganic materials 0.000 description 4
- 238000005859 coupling reaction Methods 0.000 description 4
- 239000007788 liquid Substances 0.000 description 4
- 230000003647 oxidation Effects 0.000 description 4
- 238000007254 oxidation reaction Methods 0.000 description 4
- 235000010288 sodium nitrite Nutrition 0.000 description 4
- 230000003595 spectral effect Effects 0.000 description 4
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 3
- OKPSVYHYNXVYED-UHFFFAOYSA-N 7-propylquinolin-8-ol Chemical compound C1=CC=NC2=C(O)C(CCC)=CC=C21 OKPSVYHYNXVYED-UHFFFAOYSA-N 0.000 description 3
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonium chloride Substances [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 3
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 3
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical class [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 3
- 235000011114 ammonium hydroxide Nutrition 0.000 description 3
- SMWDFEZZVXVKRB-UHFFFAOYSA-N anhydrous quinoline Natural products N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 3
- 238000009835 boiling Methods 0.000 description 3
- 238000010168 coupling process Methods 0.000 description 3
- 238000004090 dissolution Methods 0.000 description 3
- AXONCVPTTFHNOI-UHFFFAOYSA-N kairine Chemical compound C1=CC(O)=C2N(C)CCCC2=C1 AXONCVPTTFHNOI-UHFFFAOYSA-N 0.000 description 3
- 229940102396 methyl bromide Drugs 0.000 description 3
- 239000001044 red dye Substances 0.000 description 3
- 230000009467 reduction Effects 0.000 description 3
- 229910000029 sodium carbonate Inorganic materials 0.000 description 3
- HULPQOQTNFOYSK-UHFFFAOYSA-N 1,1-dimethyl-5-(phenylhydrazinylidene)-3,4-dihydro-2h-quinolin-1-ium-8-one;bromide Chemical compound [Br-].C[N+]1(C)CCCC2=C1C(=O)C=C\C2=N/NC1=CC=CC=C1 HULPQOQTNFOYSK-UHFFFAOYSA-N 0.000 description 2
- KEHQGDGFJWHXFI-UHFFFAOYSA-N 1-ethyl-3,4-dihydro-2h-quinolin-8-ol Chemical compound C1=CC(O)=C2N(CC)CCCC2=C1 KEHQGDGFJWHXFI-UHFFFAOYSA-N 0.000 description 2
- CHEJLLKYVOCJJE-UHFFFAOYSA-N 1-methylquinolin-1-ium-8-ol;methyl sulfate Chemical compound COS([O-])(=O)=O.C1=CC(O)=C2[N+](C)=CC=CC2=C1 CHEJLLKYVOCJJE-UHFFFAOYSA-N 0.000 description 2
- QDPZZFJBSANDES-UHFFFAOYSA-N 7-prop-2-enylquinolin-8-ol Chemical compound C1=CN=C2C(O)=C(CC=C)C=CC2=C1 QDPZZFJBSANDES-UHFFFAOYSA-N 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 2
- 108010010803 Gelatin Proteins 0.000 description 2
- WGCNASOHLSPBMP-UHFFFAOYSA-N Glycolaldehyde Chemical compound OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 2
- 239000004354 Hydroxyethyl cellulose Substances 0.000 description 2
- 229920000663 Hydroxyethyl cellulose Polymers 0.000 description 2
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 2
- IOVCWXUNBOPUCH-UHFFFAOYSA-M Nitrite anion Chemical compound [O-]N=O IOVCWXUNBOPUCH-UHFFFAOYSA-M 0.000 description 2
- 239000007868 Raney catalyst Substances 0.000 description 2
- 229910000564 Raney nickel Inorganic materials 0.000 description 2
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 239000012267 brine Substances 0.000 description 2
- 230000008878 coupling Effects 0.000 description 2
- RXKJFZQQPQGTFL-UHFFFAOYSA-N dihydroxyacetone Chemical compound OCC(=O)CO RXKJFZQQPQGTFL-UHFFFAOYSA-N 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 229920000159 gelatin Polymers 0.000 description 2
- 239000008273 gelatin Substances 0.000 description 2
- 235000019322 gelatine Nutrition 0.000 description 2
- 235000011852 gelatine desserts Nutrition 0.000 description 2
- 239000005457 ice water Substances 0.000 description 2
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 2
- 229910052753 mercury Inorganic materials 0.000 description 2
- JZMJDSHXVKJFKW-UHFFFAOYSA-M methyl sulfate(1-) Chemical compound COS([O-])(=O)=O JZMJDSHXVKJFKW-UHFFFAOYSA-M 0.000 description 2
- 125000001820 oxy group Chemical group [*:1]O[*:2] 0.000 description 2
- CTRLRINCMYICJO-UHFFFAOYSA-N phenyl azide Chemical compound [N-]=[N+]=NC1=CC=CC=C1 CTRLRINCMYICJO-UHFFFAOYSA-N 0.000 description 2
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 230000003381 solubilizing effect Effects 0.000 description 2
- 239000002562 thickening agent Substances 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-M toluene-4-sulfonate Chemical compound CC1=CC=C(S([O-])(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-M 0.000 description 2
- BZCOSCNPHJNQBP-UPHRSURJSA-N (z)-2,3-dihydroxybut-2-enedioic acid Chemical compound OC(=O)C(\O)=C(\O)C(O)=O BZCOSCNPHJNQBP-UPHRSURJSA-N 0.000 description 1
- WHMXMEHTVCSXIB-UHFFFAOYSA-N 1,1-dimethyl-3,4-dihydro-2h-quinolin-1-ium-8-ol;bromide Chemical compound [Br-].C1=CC(O)=C2[N+](C)(C)CCCC2=C1 WHMXMEHTVCSXIB-UHFFFAOYSA-N 0.000 description 1
- AIRWBMXEZYYLNG-UHFFFAOYSA-N 1,1-dimethyl-7-propyl-3,4-dihydro-2h-quinolin-1-ium-8-ol;bromide Chemical compound [Br-].C1CC[N+](C)(C)C2=C(O)C(CCC)=CC=C21 AIRWBMXEZYYLNG-UHFFFAOYSA-N 0.000 description 1
- OCRDFTBPPRPHGM-UHFFFAOYSA-N 1,2,3,4-tetrahydroquinolin-1-ium;bromide Chemical compound Br.C1=CC=C2CCCNC2=C1 OCRDFTBPPRPHGM-UHFFFAOYSA-N 0.000 description 1
- WYKWUPMZBGOFOV-UHFFFAOYSA-N 1,2,3,4-tetrahydroquinolin-8-ol Chemical compound C1CCNC2=C1C=CC=C2O WYKWUPMZBGOFOV-UHFFFAOYSA-N 0.000 description 1
- ZRHUHDUEXWHZMA-UHFFFAOYSA-N 1,4-dihydropyrazol-5-one Chemical compound O=C1CC=NN1 ZRHUHDUEXWHZMA-UHFFFAOYSA-N 0.000 description 1
- CBCKQZAAMUWICA-UHFFFAOYSA-N 1,4-phenylenediamine Chemical compound NC1=CC=C(N)C=C1 CBCKQZAAMUWICA-UHFFFAOYSA-N 0.000 description 1
- QAQPOERHFUTXRO-UHFFFAOYSA-N 1-ethylquinolin-1-ium-8-ol;ethyl sulfate Chemical compound CCOS([O-])(=O)=O.C1=CC(O)=C2[N+](CC)=CC=CC2=C1 QAQPOERHFUTXRO-UHFFFAOYSA-N 0.000 description 1
- XEKPSFDJSYJDTO-UHFFFAOYSA-N 1-methyl-7-propyl-2h-quinolin-8-ol Chemical compound C1=CCN(C)C2=C(O)C(CCC)=CC=C21 XEKPSFDJSYJDTO-UHFFFAOYSA-N 0.000 description 1
- LZSOJHDEJXJTKW-UHFFFAOYSA-O 1-methyl-7-propylquinolin-1-ium-8-ol Chemical compound C[N+]1=CC=CC2=CC=C(C(=C12)O)CCC LZSOJHDEJXJTKW-UHFFFAOYSA-O 0.000 description 1
- FGRBYDKOBBBPOI-UHFFFAOYSA-N 10,10-dioxo-2-[4-(N-phenylanilino)phenyl]thioxanthen-9-one Chemical compound O=C1c2ccccc2S(=O)(=O)c2ccc(cc12)-c1ccc(cc1)N(c1ccccc1)c1ccccc1 FGRBYDKOBBBPOI-UHFFFAOYSA-N 0.000 description 1
- ZKEGGSPWBGCPNF-UHFFFAOYSA-N 2,5-dihydroxy-5-methyl-3-(piperidin-1-ylamino)cyclopent-2-en-1-one Chemical compound O=C1C(C)(O)CC(NN2CCCCC2)=C1O ZKEGGSPWBGCPNF-UHFFFAOYSA-N 0.000 description 1
- XEWOWFPCXPJKEV-UHFFFAOYSA-N 5-[[4-[3-(octadecylcarbamoyl)phenyl]sulfanyl-5-oxo-1-phenylpyrazolidin-3-ylidene]amino]benzene-1,3-dicarboxylic acid Chemical compound C1(=CC=CC=C1)N1N=C(C(C1=O)SC1=CC(=CC=C1)C(NCCCCCCCCCCCCCCCCCC)=O)NC1=CC(=CC(=C1)C(=O)O)C(=O)O XEWOWFPCXPJKEV-UHFFFAOYSA-N 0.000 description 1
- XPAZGLFMMUODDK-UHFFFAOYSA-N 6-nitro-1h-benzimidazole Chemical compound [O-][N+](=O)C1=CC=C2N=CNC2=C1 XPAZGLFMMUODDK-UHFFFAOYSA-N 0.000 description 1
- TVEXGJYMHHTVKP-UHFFFAOYSA-N 6-oxabicyclo[3.2.1]oct-3-en-7-one Chemical group C1C2C(=O)OC1C=CC2 TVEXGJYMHHTVKP-UHFFFAOYSA-N 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- CSGQJHQYWJLPKY-UHFFFAOYSA-N CITRAZINIC ACID Chemical compound OC(=O)C=1C=C(O)NC(=O)C=1 CSGQJHQYWJLPKY-UHFFFAOYSA-N 0.000 description 1
- 229920002284 Cellulose triacetate Polymers 0.000 description 1
- 238000003512 Claisen condensation reaction Methods 0.000 description 1
- MNQZXJOMYWMBOU-VKHMYHEASA-N D-glyceraldehyde Chemical compound OC[C@@H](O)C=O MNQZXJOMYWMBOU-VKHMYHEASA-N 0.000 description 1
- 229920001174 Diethylhydroxylamine Polymers 0.000 description 1
- KIWBPDUYBMNFTB-UHFFFAOYSA-N Ethyl hydrogen sulfate Chemical compound CCOS(O)(=O)=O KIWBPDUYBMNFTB-UHFFFAOYSA-N 0.000 description 1
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- JLTDJTHDQAWBAV-UHFFFAOYSA-N N,N-dimethylaniline Chemical compound CN(C)C1=CC=CC=C1 JLTDJTHDQAWBAV-UHFFFAOYSA-N 0.000 description 1
- 239000007832 Na2SO4 Substances 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 229910000831 Steel Inorganic materials 0.000 description 1
- NNLVGZFZQQXQNW-ADJNRHBOSA-N [(2r,3r,4s,5r,6s)-4,5-diacetyloxy-3-[(2s,3r,4s,5r,6r)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxy-6-[(2r,3r,4s,5r,6s)-4,5,6-triacetyloxy-2-(acetyloxymethyl)oxan-3-yl]oxyoxan-2-yl]methyl acetate Chemical compound O([C@@H]1O[C@@H]([C@H]([C@H](OC(C)=O)[C@H]1OC(C)=O)O[C@H]1[C@@H]([C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](COC(C)=O)O1)OC(C)=O)COC(=O)C)[C@@H]1[C@@H](COC(C)=O)O[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O NNLVGZFZQQXQNW-ADJNRHBOSA-N 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 125000001118 alkylidene group Chemical group 0.000 description 1
- BHELZAPQIKSEDF-UHFFFAOYSA-N allyl bromide Chemical compound BrCC=C BHELZAPQIKSEDF-UHFFFAOYSA-N 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 239000000987 azo dye Substances 0.000 description 1
- 125000005337 azoxy group Chemical group [N+]([O-])(=N*)* 0.000 description 1
- QFFVPLLCYGOFPU-UHFFFAOYSA-N barium chromate Chemical compound [Ba+2].[O-][Cr]([O-])(=O)=O QFFVPLLCYGOFPU-UHFFFAOYSA-N 0.000 description 1
- 150000001649 bromium compounds Chemical class 0.000 description 1
- RDHPKYGYEGBMSE-UHFFFAOYSA-N bromoethane Chemical compound CCBr RDHPKYGYEGBMSE-UHFFFAOYSA-N 0.000 description 1
- 239000006172 buffering agent Substances 0.000 description 1
- VNWKTOKETHGBQD-YPZZEJLDSA-N carbane Chemical group [10CH4] VNWKTOKETHGBQD-YPZZEJLDSA-N 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- LBJNMUFDOHXDFG-UHFFFAOYSA-N copper;hydrate Chemical compound O.[Cu].[Cu] LBJNMUFDOHXDFG-UHFFFAOYSA-N 0.000 description 1
- 230000002950 deficient Effects 0.000 description 1
- 239000012954 diazonium Substances 0.000 description 1
- 150000001989 diazonium salts Chemical class 0.000 description 1
- FVCOIAYSJZGECG-UHFFFAOYSA-N diethylhydroxylamine Chemical compound CCN(O)CC FVCOIAYSJZGECG-UHFFFAOYSA-N 0.000 description 1
- 229940120503 dihydroxyacetone Drugs 0.000 description 1
- 229940113088 dimethylacetamide Drugs 0.000 description 1
- 125000004119 disulfanediyl group Chemical group *SS* 0.000 description 1
- 239000012259 ether extract Substances 0.000 description 1
- ATCXSYYZLRWNDP-UHFFFAOYSA-N ethyl sulfate;quinolin-1-ium-8-ol Chemical compound CCOS([O-])(=O)=O.C1=C[NH+]=C2C(O)=CC=CC2=C1 ATCXSYYZLRWNDP-UHFFFAOYSA-N 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 150000004694 iodide salts Chemical class 0.000 description 1
- VUQUOGPMUUJORT-UHFFFAOYSA-N methyl 4-methylbenzenesulfonate Chemical compound COS(=O)(=O)C1=CC=C(C)C=C1 VUQUOGPMUUJORT-UHFFFAOYSA-N 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- MUMZUERVLWJKNR-UHFFFAOYSA-N oxoplatinum Chemical compound [Pt]=O MUMZUERVLWJKNR-UHFFFAOYSA-N 0.000 description 1
- 150000004989 p-phenylenediamines Chemical class 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- CMCWWLVWPDLCRM-UHFFFAOYSA-N phenidone Chemical class N1C(=O)CCN1C1=CC=CC=C1 CMCWWLVWPDLCRM-UHFFFAOYSA-N 0.000 description 1
- 235000021317 phosphate Nutrition 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- 229910003446 platinum oxide Inorganic materials 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- YGFSWYCTCIJKOJ-UHFFFAOYSA-N quinolin-8-ol;hydrobromide Chemical compound [Br-].C1=C[NH+]=C2C(O)=CC=CC2=C1 YGFSWYCTCIJKOJ-UHFFFAOYSA-N 0.000 description 1
- 230000005855 radiation Effects 0.000 description 1
- 238000007790 scraping Methods 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 239000010959 steel Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000000446 sulfanediyl group Chemical group *S* 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-L sulfite Chemical class [O-]S([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-L 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- ILJSQTXMGCGYMG-UHFFFAOYSA-N triacetic acid Chemical compound CC(=O)CC(=O)CC(O)=O ILJSQTXMGCGYMG-UHFFFAOYSA-N 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 238000004876 x-ray fluorescence Methods 0.000 description 1
Classifications
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03C—PHOTOSENSITIVE MATERIALS FOR PHOTOGRAPHIC PURPOSES; PHOTOGRAPHIC PROCESSES, e.g. CINE, X-RAY, COLOUR, STEREO-PHOTOGRAPHIC PROCESSES; AUXILIARY PROCESSES IN PHOTOGRAPHY
- G03C5/00—Photographic processes or agents therefor; Regeneration of such processing agents
- G03C5/26—Processes using silver-salt-containing photosensitive materials or agents therefor
- G03C5/29—Development processes or agents therefor
- G03C5/30—Developers
- G03C5/3021—Developers with oxydisable hydroxyl or amine groups linked to an aromatic ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/20—Oxygen atoms
- C07D215/24—Oxygen atoms attached in position 8
- C07D215/26—Alcohols; Ethers thereof
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/38—Nitrogen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Physics & Mathematics (AREA)
- General Physics & Mathematics (AREA)
- Quinoline Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR7400770A FR2257580B1 (https=) | 1974-01-10 | 1974-01-10 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1038872A true CA1038872A (en) | 1978-09-19 |
Family
ID=9133297
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA216,367A Expired CA1038872A (en) | 1974-01-10 | 1974-12-18 | 1,2,3,4-tetrahydro-5-amino-8-hydroxy-quinolinium compounds |
Country Status (4)
| Country | Link |
|---|---|
| US (1) | US3970454A (https=) |
| CA (1) | CA1038872A (https=) |
| FR (1) | FR2257580B1 (https=) |
| GB (1) | GB1443405A (https=) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| IT1037362B (it) * | 1975-04-15 | 1979-11-10 | Montedison Spa | Sali di alfa idrossiimino alchilchinolinio ad azioni antifungina |
| EP0138773B1 (de) * | 1983-10-18 | 1990-08-29 | Ciba-Geigy Ag | Verwendung von Chinolinderivaten zum Schützen von Kulturpflanzen |
| US4843082A (en) * | 1986-05-05 | 1989-06-27 | E. R. Squibb & Sons, Inc. | 1,2,3,4-tetrahydro-8-quinolinol derivatives and anti-allergic use thereof |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB189600371A (en) * | 1896-01-06 | 1896-11-14 | Lembach & Schleicher | Improvements in Photographic Developers. |
| BE421135A (https=) * | 1936-04-23 | |||
| US2196739A (en) * | 1938-09-23 | 1940-04-09 | Eastman Kodak Co | Photographic developer for color photography |
| US2387751A (en) * | 1942-01-21 | 1945-10-30 | Eastman Kodak Co | N-aryltetrahydroquinolines |
| US2566132A (en) * | 1947-01-09 | 1951-08-28 | Abbott Lab | Quaternary ammonium compounds |
| US2566259A (en) * | 1948-09-25 | 1951-08-28 | Eastman Kodak Co | 8-alkyl sulfonamidoethyl-n-substituted saturated heterocyclic developers |
| DE1049701B (https=) * | 1957-02-21 | |||
| US2944898A (en) * | 1957-11-27 | 1960-07-12 | Eastman Kodak Co | Sensitization of photographic emulsions |
| US3262906A (en) * | 1962-09-20 | 1966-07-26 | Monsanto Co | Stabilization of polyaldehydes with quinoline compounds |
| GB1191535A (en) * | 1967-05-24 | 1970-05-13 | Agfa Gevaert Nv | Improvements in or relating to Photographic Development |
-
1974
- 1974-01-10 FR FR7400770A patent/FR2257580B1/fr not_active Expired
- 1974-12-18 CA CA216,367A patent/CA1038872A/en not_active Expired
- 1974-12-30 US US05/537,221 patent/US3970454A/en not_active Expired - Lifetime
-
1975
- 1975-01-09 GB GB94875A patent/GB1443405A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| US3970454A (en) | 1976-07-20 |
| FR2257580A1 (https=) | 1975-08-08 |
| GB1443405A (en) | 1976-07-21 |
| FR2257580B1 (https=) | 1977-06-10 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JPS61201247A (ja) | ハロゲン化銀写真要素 | |
| JP3136010B2 (ja) | カラー写真材料及び写真カラー画像の形成方法 | |
| CA1247916A (en) | Method of forming a photographic image dye | |
| JP2578825B2 (ja) | 像形成要素 | |
| JPS6220538B2 (https=) | ||
| JPH0124295B2 (https=) | ||
| US4035188A (en) | N-alkoxyethoxyethylphenylenediamine color developing agents | |
| EP0045129B1 (en) | Masked antifoggant compounds for silver photographic systems | |
| JPH0546936B2 (https=) | ||
| US3615505A (en) | Silver halide emulsion containing 2-pyrazolin-5-one color coupler | |
| EP0073146B1 (en) | Method and material for the formation of silver halide color photographic image | |
| CA1038872A (en) | 1,2,3,4-tetrahydro-5-amino-8-hydroxy-quinolinium compounds | |
| JPH0247651A (ja) | 写真感光材料及び方法 | |
| CA1213891A (en) | Color-forming sulfonamidodiphenylamine dye precursor that produces phenazine dye | |
| JPS5941179B2 (ja) | 写真フイルムユニット | |
| US2886436A (en) | 5-amino-8-hydroxyquinolines as coupling components for azine dye images | |
| JPS6161100B2 (https=) | ||
| US4067872A (en) | Cyclic derivatives of 1,2,3,4 tetrahydroquinoline and indolene | |
| US4206139A (en) | Synthesis of benzaldehydes | |
| EP0079630B1 (en) | Photographic elements containing ballasted compounds | |
| US4166741A (en) | Yellow azomethine dye developers | |
| JPS61260243A (ja) | 写真要素 | |
| CA1169691A (en) | Color-forming para-sulfonamidodiphenylamine dye precursor and sulfonimide dye in photographic material and process | |
| JP2977888B2 (ja) | フェノール系シアン色素生成写真カプラー類の改良された合成方法 | |
| JP3097861B2 (ja) | 写真要素 |