AU605018B2 - Aqueous liquid bleach composition - Google Patents
Aqueous liquid bleach composition Download PDFInfo
- Publication number
- AU605018B2 AU605018B2 AU29810/89A AU2981089A AU605018B2 AU 605018 B2 AU605018 B2 AU 605018B2 AU 29810/89 A AU29810/89 A AU 29810/89A AU 2981089 A AU2981089 A AU 2981089A AU 605018 B2 AU605018 B2 AU 605018B2
- Authority
- AU
- Australia
- Prior art keywords
- acid
- composition according
- weight
- present
- amount
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Ceased
Links
- 239000000203 mixture Substances 0.000 title claims description 55
- 239000007788 liquid Substances 0.000 title claims description 16
- 239000007844 bleaching agent Substances 0.000 title description 6
- -1 alkyl monocarboxylic acid Chemical class 0.000 claims description 23
- 235000014113 dietary fatty acids Nutrition 0.000 claims description 22
- 239000000194 fatty acid Substances 0.000 claims description 22
- 229930195729 fatty acid Natural products 0.000 claims description 22
- 150000004665 fatty acids Chemical class 0.000 claims description 21
- 150000004965 peroxy acids Chemical class 0.000 claims description 14
- 150000004967 organic peroxy acids Chemical class 0.000 claims description 12
- JXLHNMVSKXFWAO-UHFFFAOYSA-N azane;7-fluoro-2,1,3-benzoxadiazole-4-sulfonic acid Chemical compound N.OS(=O)(=O)C1=CC=C(F)C2=NON=C12 JXLHNMVSKXFWAO-UHFFFAOYSA-N 0.000 claims description 10
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 claims description 9
- 239000003945 anionic surfactant Substances 0.000 claims description 8
- 239000002736 nonionic surfactant Substances 0.000 claims description 8
- 239000007787 solid Substances 0.000 claims description 7
- 238000004061 bleaching Methods 0.000 claims description 6
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 claims description 4
- 150000004996 alkyl benzenes Chemical group 0.000 claims description 4
- 238000005191 phase separation Methods 0.000 claims description 4
- 150000001335 aliphatic alkanes Chemical group 0.000 claims description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 2
- DNIAPMSPPWPWGF-GSVOUGTGSA-N (R)-(-)-Propylene glycol Chemical compound C[C@@H](O)CO DNIAPMSPPWPWGF-GSVOUGTGSA-N 0.000 claims 1
- 239000002253 acid Substances 0.000 description 18
- 239000004094 surface-active agent Substances 0.000 description 11
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 8
- 150000007513 acids Chemical class 0.000 description 8
- 229910021645 metal ion Inorganic materials 0.000 description 7
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 7
- LMYSNFBROWBKMB-UHFFFAOYSA-N 4-[2-(dipropylamino)ethyl]benzene-1,2-diol Chemical compound CCCN(CCC)CCC1=CC=C(O)C(O)=C1 LMYSNFBROWBKMB-UHFFFAOYSA-N 0.000 description 5
- 125000000217 alkyl group Chemical group 0.000 description 4
- 125000000129 anionic group Chemical group 0.000 description 4
- 239000008139 complexing agent Substances 0.000 description 4
- 239000003599 detergent Substances 0.000 description 4
- WJJMNDUMQPNECX-UHFFFAOYSA-N dipicolinic acid Chemical compound OC(=O)C1=CC=CC(C(O)=O)=N1 WJJMNDUMQPNECX-UHFFFAOYSA-N 0.000 description 4
- 238000009472 formulation Methods 0.000 description 4
- 239000004615 ingredient Substances 0.000 description 4
- 150000003138 primary alcohols Chemical class 0.000 description 4
- 229910052938 sodium sulfate Inorganic materials 0.000 description 4
- 235000011152 sodium sulphate Nutrition 0.000 description 4
- 238000003860 storage Methods 0.000 description 4
- 239000002562 thickening agent Substances 0.000 description 4
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- 125000001931 aliphatic group Chemical group 0.000 description 3
- 125000003118 aryl group Chemical group 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- 239000002245 particle Substances 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- 125000001273 sulfonato group Chemical group [O-]S(*)(=O)=O 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- 239000003760 tallow Substances 0.000 description 3
- BAERPNBPLZWCES-UHFFFAOYSA-N (2-hydroxy-1-phosphonoethyl)phosphonic acid Chemical compound OCC(P(O)(O)=O)P(O)(O)=O BAERPNBPLZWCES-UHFFFAOYSA-N 0.000 description 2
- 235000013162 Cocos nucifera Nutrition 0.000 description 2
- 244000060011 Cocos nucifera Species 0.000 description 2
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 2
- DBVJJBKOTRCVKF-UHFFFAOYSA-N Etidronic acid Chemical compound OP(=O)(O)C(O)(C)P(O)(O)=O DBVJJBKOTRCVKF-UHFFFAOYSA-N 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- 229920002472 Starch Polymers 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 239000012736 aqueous medium Substances 0.000 description 2
- 239000007900 aqueous suspension Substances 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 238000004140 cleaning Methods 0.000 description 2
- 235000019864 coconut oil Nutrition 0.000 description 2
- 239000003240 coconut oil Substances 0.000 description 2
- 239000007859 condensation product Substances 0.000 description 2
- 239000000470 constituent Substances 0.000 description 2
- 239000000356 contaminant Substances 0.000 description 2
- 238000000354 decomposition reaction Methods 0.000 description 2
- POULHZVOKOAJMA-UHFFFAOYSA-N dodecanoic acid Chemical compound CCCCCCCCCCCC(O)=O POULHZVOKOAJMA-UHFFFAOYSA-N 0.000 description 2
- 229960001484 edetic acid Drugs 0.000 description 2
- 239000003792 electrolyte Substances 0.000 description 2
- 229910001651 emery Inorganic materials 0.000 description 2
- 239000004744 fabric Substances 0.000 description 2
- 229910052736 halogen Inorganic materials 0.000 description 2
- 150000002367 halogens Chemical group 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 2
- 239000012535 impurity Substances 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- 125000000896 monocarboxylic acid group Chemical group 0.000 description 2
- IPCSVZSSVZVIGE-UHFFFAOYSA-N palmitic acid group Chemical group C(CCCCCCCCCCCCCCC)(=O)O IPCSVZSSVZVIGE-UHFFFAOYSA-N 0.000 description 2
- 239000002304 perfume Substances 0.000 description 2
- 125000000864 peroxy group Chemical group O(O*)* 0.000 description 2
- SIOXPEMLGUPBBT-UHFFFAOYSA-N picolinic acid Chemical compound OC(=O)C1=CC=CC=N1 SIOXPEMLGUPBBT-UHFFFAOYSA-N 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 235000019698 starch Nutrition 0.000 description 2
- 239000008107 starch Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 229910021653 sulphate ion Inorganic materials 0.000 description 2
- NIXOWILDQLNWCW-UHFFFAOYSA-N Acrylic acid Chemical compound OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 1
- 229910014033 C-OH Inorganic materials 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- 229910014570 C—OH Inorganic materials 0.000 description 1
- RPNUMPOLZDHAAY-UHFFFAOYSA-N Diethylenetriamine Chemical compound NCCNCCN RPNUMPOLZDHAAY-UHFFFAOYSA-N 0.000 description 1
- 239000004150 EU approved colour Substances 0.000 description 1
- 102000004190 Enzymes Human genes 0.000 description 1
- 108090000790 Enzymes Proteins 0.000 description 1
- SHBUUTHKGIVMJT-UHFFFAOYSA-N Hydroxystearate Chemical compound CCCCCCCCCCCCCCCCCC(=O)OO SHBUUTHKGIVMJT-UHFFFAOYSA-N 0.000 description 1
- 239000005639 Lauric acid Substances 0.000 description 1
- SCKXCAADGDQQCS-UHFFFAOYSA-N Performic acid Chemical compound OOC=O SCKXCAADGDQQCS-UHFFFAOYSA-N 0.000 description 1
- ABLZXFCXXLZCGV-UHFFFAOYSA-N Phosphorous acid Chemical class OP(O)=O ABLZXFCXXLZCGV-UHFFFAOYSA-N 0.000 description 1
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- ULUAUXLGCMPNKK-UHFFFAOYSA-N Sulfobutanedioic acid Chemical class OC(=O)CC(C(O)=O)S(O)(=O)=O ULUAUXLGCMPNKK-UHFFFAOYSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 1
- 239000003082 abrasive agent Substances 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 150000007933 aliphatic carboxylic acids Chemical class 0.000 description 1
- 125000002947 alkylene group Chemical group 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 229920001577 copolymer Polymers 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- UNWDCFHEVIWFCW-UHFFFAOYSA-N decanediperoxoic acid Chemical compound OOC(=O)CCCCCCCCC(=O)OO UNWDCFHEVIWFCW-UHFFFAOYSA-N 0.000 description 1
- 239000008367 deionised water Substances 0.000 description 1
- 229910021641 deionized water Inorganic materials 0.000 description 1
- 230000001687 destabilization Effects 0.000 description 1
- 230000000368 destabilizing effect Effects 0.000 description 1
- 230000001627 detrimental effect Effects 0.000 description 1
- BRDYCNFHFWUBCZ-UHFFFAOYSA-N dodecaneperoxoic acid Chemical compound CCCCCCCCCCCC(=O)OO BRDYCNFHFWUBCZ-UHFFFAOYSA-N 0.000 description 1
- MOTZDAYCYVMXPC-UHFFFAOYSA-N dodecyl hydrogen sulfate Chemical compound CCCCCCCCCCCCOS(O)(=O)=O MOTZDAYCYVMXPC-UHFFFAOYSA-N 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 1
- 239000013020 final formulation Substances 0.000 description 1
- 239000003752 hydrotrope Substances 0.000 description 1
- 230000003993 interaction Effects 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 238000004900 laundering Methods 0.000 description 1
- 239000012263 liquid product Substances 0.000 description 1
- 229910044991 metal oxide Inorganic materials 0.000 description 1
- 150000004706 metal oxides Chemical class 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- SXLLDUPXUVRMEE-UHFFFAOYSA-N nonanediperoxoic acid Chemical compound OOC(=O)CCCCCCCC(=O)OO SXLLDUPXUVRMEE-UHFFFAOYSA-N 0.000 description 1
- 239000012457 nonaqueous media Substances 0.000 description 1
- 229920000847 nonoxynol Polymers 0.000 description 1
- SNQQPOLDUKLAAF-UHFFFAOYSA-N nonylphenol Chemical class CCCCCCCCCC1=CC=CC=C1O SNQQPOLDUKLAAF-UHFFFAOYSA-N 0.000 description 1
- 229940006093 opthalmologic coloring agent diagnostic Drugs 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 239000012188 paraffin wax Substances 0.000 description 1
- 150000002978 peroxides Chemical class 0.000 description 1
- 125000000843 phenylene group Chemical group C1(=C(C=CC=C1)*)* 0.000 description 1
- 125000002467 phosphate group Chemical class [H]OP(=O)(O[H])O[*] 0.000 description 1
- 150000003009 phosphonic acids Chemical class 0.000 description 1
- 229940081066 picolinic acid Drugs 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000002689 soil Substances 0.000 description 1
- 239000000243 solution Substances 0.000 description 1
- 238000010186 staining Methods 0.000 description 1
- 125000005156 substituted alkylene group Chemical group 0.000 description 1
- 125000005650 substituted phenylene group Chemical group 0.000 description 1
- 239000001117 sulphuric acid Substances 0.000 description 1
- 235000011149 sulphuric acid Nutrition 0.000 description 1
- 239000000375 suspending agent Substances 0.000 description 1
- 230000002195 synergetic effect Effects 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D3/00—Other compounding ingredients of detergent compositions covered in group C11D1/00
- C11D3/39—Organic or inorganic per-compounds
- C11D3/3947—Liquid compositions
Landscapes
- Chemical & Material Sciences (AREA)
- Inorganic Chemistry (AREA)
- Life Sciences & Earth Sciences (AREA)
- Engineering & Computer Science (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Wood Science & Technology (AREA)
- Organic Chemistry (AREA)
- Detergent Compositions (AREA)
- Medicinal Preparation (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US07/173,329 US4828747A (en) | 1988-03-25 | 1988-03-25 | Suspending system for insoluble peroxy acid bleach |
| US173329 | 1988-03-25 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| AU2981089A AU2981089A (en) | 1989-09-28 |
| AU605018B2 true AU605018B2 (en) | 1991-01-03 |
Family
ID=22631534
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| AU29810/89A Ceased AU605018B2 (en) | 1988-03-25 | 1989-02-09 | Aqueous liquid bleach composition |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US4828747A (Direct) |
| EP (1) | EP0334404B1 (Direct) |
| JP (1) | JPH0388899A (Direct) |
| AU (1) | AU605018B2 (Direct) |
| BR (1) | BR8900972A (Direct) |
| CA (1) | CA1289303C (Direct) |
| DE (1) | DE68922237T2 (Direct) |
| ES (1) | ES2071640T3 (Direct) |
| NO (1) | NO173028C (Direct) |
| TR (1) | TR23792A (Direct) |
| ZA (1) | ZA89978B (Direct) |
Families Citing this family (25)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5004558A (en) * | 1986-11-03 | 1991-04-02 | Monsanto Company | Sulfone peroxycarboxylic acids |
| GB8806704D0 (en) * | 1988-03-21 | 1988-04-20 | Unilever Plc | Stable liquid bleach compositions |
| US4824592A (en) * | 1988-03-25 | 1989-04-25 | Lever Brothers Company | Suspending system for insoluble peroxy acid bleach |
| DE3822798A1 (de) * | 1988-07-06 | 1990-01-11 | Huels Chemische Werke Ag | Verfahren zur herstellung von phlegmatisierten aliphatischen diperoxidicarbonsaeuren |
| US5039447A (en) * | 1988-12-12 | 1991-08-13 | Monsanto Company | Pourable sulfone peracid compositions |
| DE3907131A1 (de) * | 1989-03-06 | 1990-09-13 | Henkel Kgaa | Bleichmittelsuspension |
| AU653915B2 (en) * | 1989-03-10 | 1994-10-20 | Trustees Of Columbia University In The City Of New York, The | Molecular cloning of genomic and cDNA sequences encoding cellular receptors for poliovirus |
| JPH05502471A (ja) * | 1990-02-08 | 1993-04-28 | ユニリーバー・ナームローゼ・ベンノートシヤープ | 液体漂白組成物 |
| TW291496B (Direct) * | 1991-02-01 | 1996-11-21 | Hoechst Ag | |
| EP0504952A1 (en) * | 1991-02-15 | 1992-09-23 | The Procter & Gamble Company | Stable liquid amidoperoxyacid bleach |
| US5234617A (en) * | 1992-04-20 | 1993-08-10 | Kathleen B. Hunter | Aqueous liquid bleach compositions with fluorescent whitening agent and polyvinyl pyrrolidone or polyvinyl alcohol |
| EP0592033A1 (en) * | 1992-10-07 | 1994-04-13 | The Procter & Gamble Company | Process for making peroxyacid containing particles |
| US5409632A (en) * | 1992-11-16 | 1995-04-25 | The Procter & Gamble Company | Cleaning and bleaching composition with amidoperoxyacid |
| FR2710233B1 (fr) * | 1993-09-22 | 1995-12-15 | Lvmh Rech | Procédé pour favoriser l'embryogénèse somatique secondaire et application à la régénération de plantes en particulier de la vigne. |
| US5932532A (en) * | 1993-10-14 | 1999-08-03 | Procter & Gamble Company | Bleach compositions comprising protease enzyme |
| EP0677575A1 (en) * | 1994-04-12 | 1995-10-18 | The Procter & Gamble Company | Bleaching compositions |
| US5902354A (en) * | 1994-04-12 | 1999-05-11 | The Procter & Gamble Company | Bleaching compositions |
| GB9425882D0 (en) * | 1994-12-21 | 1995-02-22 | Solvay Interox Ltd | Thickened peracid compositions |
| GB9425881D0 (en) * | 1994-12-21 | 1995-02-22 | Solvay Interox Ltd | Thickened peracid compositions |
| EP1010749B1 (en) * | 1995-03-27 | 2006-02-22 | The Procter & Gamble Company | Activated liquid bleaching compositions |
| IT1293587B1 (it) * | 1997-07-08 | 1999-03-08 | Manitoba Italia Spa | Composizioni a base di acidi percarbossilici come smacchianti e igienizzanti |
| US6844305B1 (en) | 1999-08-27 | 2005-01-18 | The Proctor & Gamble Company | Aqueous liquid detergent compositions comprising a polymeric stabilization system |
| DE10361084A1 (de) | 2003-06-13 | 2005-01-05 | Henkel Kgaa | Lagerstabile Bleichmittelzusammensetzungen auf Basis von Peroxycarbonsäuren |
| US7596974B2 (en) | 2006-06-19 | 2009-10-06 | S.C. Johnson & Son, Inc. | Instant stain removing device, formulation and absorbent means |
| GB2496132A (en) | 2011-10-31 | 2013-05-08 | Reckitt Benckiser Nv | Pthalimidopercaproic acid sugar suspension |
Family Cites Families (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL254297A (Direct) * | 1959-07-28 | |||
| US3996152A (en) * | 1975-03-27 | 1976-12-07 | The Procter & Gamble Company | Bleaching composition |
| US4017412A (en) * | 1975-03-27 | 1977-04-12 | The Procter & Gamble Company | Bleaching composition |
| US4126573A (en) * | 1976-08-27 | 1978-11-21 | The Procter & Gamble Company | Peroxyacid bleach compositions having increased solubility |
| US4443352A (en) * | 1982-03-04 | 1984-04-17 | Colgate-Palmolive Company | Silicate-free bleaching and laundering composition |
| US4455249A (en) * | 1982-10-21 | 1984-06-19 | Colgate-Palmolive Company | Stabilized bleach and laundering composition |
| US4450089A (en) * | 1982-10-21 | 1984-05-22 | Colgate-Palmolive Company | Stabilized bleaching and laundering composition |
| EP0160342B2 (en) * | 1984-05-01 | 1992-11-11 | Unilever N.V. | Liquid bleaching compositions |
| US4655781A (en) * | 1984-07-02 | 1987-04-07 | The Clorox Company | Stable bleaching compositions |
| NL8402957A (nl) * | 1984-09-28 | 1986-04-16 | Akzo Nv | Toepassing van peroxycarbonzuur-bevattende suspensies als bleeksamenstelling. |
| DE3660350D1 (en) * | 1985-05-07 | 1988-08-04 | Akzo Nv | Pourable detergent and bleach compositions |
| KR940006254B1 (ko) * | 1986-03-31 | 1994-07-13 | 더 프록터 앤드 갬블 캄파니 | 안정한 액상 디퍼옥시산 표백제 조성물 |
| DE3762630D1 (de) * | 1986-05-28 | 1990-06-13 | Akzo Nv | Verfahren zur herstellung von diperoxidodecandionsaeure enthaltenden agglomeraten und die verwendung derselben in bleichmitteln. |
-
1988
- 1988-03-25 US US07/173,329 patent/US4828747A/en not_active Expired - Fee Related
-
1989
- 1989-02-07 NO NO890505A patent/NO173028C/no unknown
- 1989-02-08 ZA ZA89978A patent/ZA89978B/xx unknown
- 1989-02-09 AU AU29810/89A patent/AU605018B2/en not_active Ceased
- 1989-02-10 CA CA000591047A patent/CA1289303C/en not_active Expired - Fee Related
- 1989-02-14 ES ES89200345T patent/ES2071640T3/es not_active Expired - Lifetime
- 1989-02-14 EP EP89200345A patent/EP0334404B1/en not_active Expired - Lifetime
- 1989-02-14 DE DE68922237T patent/DE68922237T2/de not_active Expired - Fee Related
- 1989-02-22 TR TR89/0177A patent/TR23792A/xx unknown
- 1989-03-02 BR BR898900972A patent/BR8900972A/pt not_active IP Right Cessation
- 1989-03-20 JP JP1069124A patent/JPH0388899A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| AU2981089A (en) | 1989-09-28 |
| US4828747A (en) | 1989-05-09 |
| JPH0388899A (ja) | 1991-04-15 |
| ZA89978B (en) | 1990-10-31 |
| NO173028C (no) | 1993-10-13 |
| CA1289303C (en) | 1991-09-24 |
| NO890505D0 (no) | 1989-02-07 |
| NO890505L (no) | 1989-09-26 |
| NO173028B (no) | 1993-07-05 |
| JPH0531919B2 (Direct) | 1993-05-13 |
| TR23792A (tr) | 1990-09-13 |
| ES2071640T3 (es) | 1995-07-01 |
| DE68922237D1 (de) | 1995-05-24 |
| EP0334404A3 (en) | 1990-06-06 |
| EP0334404A2 (en) | 1989-09-27 |
| DE68922237T2 (de) | 1995-08-31 |
| EP0334404B1 (en) | 1995-04-19 |
| BR8900972A (pt) | 1989-10-24 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| AU605018B2 (en) | Aqueous liquid bleach composition | |
| CA1319077C (en) | Liquid detergent containing solid peroxygen bleach | |
| AU662501B2 (en) | Liquid detergent compositions containing a suspended peroxygen bleach | |
| JP2505537B2 (ja) | ペルボレ―ト漂白剤を含有する液体洗剤 | |
| US4929377A (en) | Stable, aqueous bleach compositions containing solid organic peroxy acid | |
| US5264143A (en) | Stabilized, bleach containing, liquid detergent compositions | |
| JPH04214800A (ja) | 水性液体漂白剤組成物 | |
| US5275753A (en) | Stabilized alkaline liquid detergent compositions containing enzyme and peroxygen bleach | |
| JP2749415B2 (ja) | 酵素と酵素安定化系を含む液体洗剤組成物 | |
| EP0482275A1 (en) | Stable liquid detergent compositions containing bleach | |
| US5250212A (en) | Liquid detergent containing solid peroxygen bleach and solvent system comprising water and lower aliphatic monoalcohol | |
| AU606780B2 (en) | Aqueous liquid bleach composition | |
| US4822510A (en) | Stably suspended 4,4'-sulfonylbisperoxybenzoic acid bleach in an aqueous liquid | |
| EP0429124A1 (en) | Chlorine-free liquid automatic dishwashing compositions | |
| CA2159983A1 (en) | Concentrated liquid detergent containing suspended peroxygen bleach, organic solvent and 5-20% water | |
| JPH04506535A (ja) | 液体漂白剤組成物 |