AU571988B2 - Amino-anthracenedione-platinum complexes - Google Patents
Amino-anthracenedione-platinum complexesInfo
- Publication number
 - AU571988B2 AU571988B2 AU45733/85A AU4573385A AU571988B2 AU 571988 B2 AU571988 B2 AU 571988B2 AU 45733/85 A AU45733/85 A AU 45733/85A AU 4573385 A AU4573385 A AU 4573385A AU 571988 B2 AU571988 B2 AU 571988B2
 - Authority
 - AU
 - Australia
 - Prior art keywords
 - anthracenedione
 - amino
 - platinum complexes
 - complexes
 - platinum
 - Prior art date
 - Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
 - Ceased
 
Links
- OPEJZQFCUBLFRA-UHFFFAOYSA-N 3-aminoanthracene-1,2-dione;platinum Chemical class [Pt].C1=CC=C2C=C(C(=O)C(C(N)=C3)=O)C3=CC2=C1 OPEJZQFCUBLFRA-UHFFFAOYSA-N 0.000 title 1
 
Classifications
- 
        
- C—CHEMISTRY; METALLURGY
 - C07—ORGANIC CHEMISTRY
 - C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
 - C07F15/00—Compounds containing elements of Groups 8, 9, 10 or 18 of the Periodic Table
 - C07F15/0006—Compounds containing elements of Groups 8, 9, 10 or 18 of the Periodic Table compounds of the platinum group
 - C07F15/0086—Platinum compounds
 - C07F15/0093—Platinum compounds without a metal-carbon linkage
 
 
Landscapes
- Chemical & Material Sciences (AREA)
 - Organic Chemistry (AREA)
 - Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
 
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title | 
|---|---|---|---|
| IT22224/84 | 1984-08-03 | ||
| IT8422224A IT1213205B (it) | 1984-08-03 | 1984-08-03 | Amminoantrachinoni cis-platino complessi e loro impiego come agenti antitumorali. | 
| IT21324/85 | 1985-06-27 | ||
| IT21324/85A IT1201425B (it) | 1985-06-27 | 1985-06-27 | Cis-platino complessi e loro impiego come agenti antitumorali | 
Publications (2)
| Publication Number | Publication Date | 
|---|---|
| AU4573385A AU4573385A (en) | 1986-02-06 | 
| AU571988B2 true AU571988B2 (en) | 1988-04-28 | 
Family
ID=26327865
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date | 
|---|---|---|---|
| AU45733/85A Ceased AU571988B2 (en) | 1984-08-03 | 1985-08-02 | Amino-anthracenedione-platinum complexes | 
Country Status (11)
| Country | Link | 
|---|---|
| US (1) | US4732893A (enEXAMPLES) | 
| EP (1) | EP0170290B1 (enEXAMPLES) | 
| AU (1) | AU571988B2 (enEXAMPLES) | 
| CA (1) | CA1251203A (enEXAMPLES) | 
| DE (1) | DE3578180D1 (enEXAMPLES) | 
| DK (1) | DK352285A (enEXAMPLES) | 
| ES (1) | ES8604248A1 (enEXAMPLES) | 
| GR (1) | GR851903B (enEXAMPLES) | 
| HU (1) | HU193339B (enEXAMPLES) | 
| IL (1) | IL76002A0 (enEXAMPLES) | 
| NZ (1) | NZ212976A (enEXAMPLES) | 
Families Citing this family (9)
| Publication number | Priority date | Publication date | Assignee | Title | 
|---|---|---|---|---|
| US4732970A (en) * | 1986-06-13 | 1988-03-22 | American Cyanamid Company | Antitumor amino acid and peptide derivatives of 1,4-bis(aminoalkyl and hydroxy-aminoalkyl)amino)-5,8-dihydroxyanthraquinones | 
| US4772735A (en) * | 1986-08-25 | 1988-09-20 | University Of Delaware | Coordination complexes of platinum with amides | 
| AU2817589A (en) * | 1987-12-18 | 1989-07-19 | Boehringer Biochemia Robin S.P.A | Amino anthracenediones-bis platinum complexes, useful as antitumoral agents | 
| US5436243A (en) * | 1993-11-17 | 1995-07-25 | Research Triangle Institute Duke University | Aminoanthraquinone derivatives to combat multidrug resistance | 
| DE19635557C2 (de) * | 1996-09-02 | 1998-09-03 | Baykut Goekhan Dr | Neue Hydroxyanthrachinon-Derivate | 
| FR2786484B1 (fr) * | 1998-11-30 | 2001-01-05 | Oreal | Aminoanthraquinones cationiques, leur utilisation pour la teinture des fibres keratiniques, compositions tinctoriales les renfermant et procedes de teinture | 
| HUP0303719A2 (hu) * | 2000-10-16 | 2004-03-01 | Neopharm, Inc. | Mitoxantron hatóanyag-tartalmú liposzómás gyógyszerkészítmények és eljárás az előállításukra | 
| US7138520B2 (en) * | 2003-01-13 | 2006-11-21 | Massachusetts Institute Of Technology | Coordination complexes having tethered therapeutic agents and/or targeting moieties, and methods of making and using the same | 
| CN105254679B (zh) * | 2013-11-19 | 2018-05-15 | 辽宁大学 | 单6-(氮杂环取代)蒽醌二氯化铂配合物及其制备方法和应用 | 
Citations (2)
| Publication number | Priority date | Publication date | Assignee | Title | 
|---|---|---|---|---|
| AU7095381A (en) * | 1981-05-22 | 1982-01-07 | American Cyanamid Company | Hetero alkylene bis antraquinones | 
| AU3915185A (en) * | 1984-02-27 | 1985-09-05 | American Cyanamid Company | Method of treating multiple sclerosis, rheumatoid arthritis or organ transplant rejection | 
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title | 
|---|---|---|---|---|
| US2166076A (en) * | 1936-02-27 | 1939-07-11 | Baker & Co Inc | Platinum metal compounds and methods of making them | 
| US3876675A (en) * | 1969-01-21 | 1975-04-08 | Du Pont | Bis-chelate derivatives of palladium | 
| DE2730342C3 (de) * | 1976-07-07 | 1980-12-18 | Ciba-Geigy Ag, Basel (Schweiz) | Verfahren zur Herstellung von Anthrachinonverbindungen | 
| US4197249A (en) * | 1977-08-15 | 1980-04-08 | American Cyanamid Company | 1,4-Bis(substituted-amino)-5,8-dihydroxyanthraquinones and leuco bases thereof | 
| DE2845371A1 (de) * | 1977-10-19 | 1979-04-26 | Johnson Matthey Co Ltd | Platinkomplexverbindung, pharmazeutische stoffzusammensetzung mit einer solchen verbindung und deren anwendung | 
| SE7903361L (sv) * | 1978-04-20 | 1979-10-21 | Johnson Matthey Co Ltd | Kompositioner innehallande platina | 
| US4283342A (en) * | 1980-01-31 | 1981-08-11 | University Of Delaware | Anticancer agents and methods of manufacture | 
| US4296030A (en) * | 1980-04-09 | 1981-10-20 | American Cyanamid Company | Metal chelates of 1,4-bis(substituted-amino-5,8-dihydroxy-anthraquinones | 
| US4588831A (en) * | 1984-11-09 | 1986-05-13 | Natec | Platinum complex compounds of substituted 5,8-dihydroxyl-1,4-naphthoquinone, and process for their production and use | 
- 
        1985
        
- 1985-08-01 IL IL76002A patent/IL76002A0/xx not_active IP Right Cessation
 - 1985-08-02 NZ NZ212976A patent/NZ212976A/xx unknown
 - 1985-08-02 GR GR851903A patent/GR851903B/el unknown
 - 1985-08-02 DE DE8585109732T patent/DE3578180D1/de not_active Expired - Lifetime
 - 1985-08-02 HU HU852973A patent/HU193339B/hu not_active IP Right Cessation
 - 1985-08-02 DK DK352285A patent/DK352285A/da not_active Application Discontinuation
 - 1985-08-02 AU AU45733/85A patent/AU571988B2/en not_active Ceased
 - 1985-08-02 CA CA000488014A patent/CA1251203A/en not_active Expired
 - 1985-08-02 ES ES545861A patent/ES8604248A1/es not_active Expired
 - 1985-08-02 EP EP85109732A patent/EP0170290B1/en not_active Expired - Lifetime
 - 1985-08-02 US US06/761,787 patent/US4732893A/en not_active Expired - Fee Related
 
 
Patent Citations (2)
| Publication number | Priority date | Publication date | Assignee | Title | 
|---|---|---|---|---|
| AU7095381A (en) * | 1981-05-22 | 1982-01-07 | American Cyanamid Company | Hetero alkylene bis antraquinones | 
| AU3915185A (en) * | 1984-02-27 | 1985-09-05 | American Cyanamid Company | Method of treating multiple sclerosis, rheumatoid arthritis or organ transplant rejection | 
Also Published As
| Publication number | Publication date | 
|---|---|
| DE3578180D1 (de) | 1990-07-19 | 
| CA1251203A (en) | 1989-03-14 | 
| AU4573385A (en) | 1986-02-06 | 
| EP0170290B1 (en) | 1990-06-13 | 
| GR851903B (enEXAMPLES) | 1985-12-03 | 
| DK352285D0 (da) | 1985-08-02 | 
| HUT38366A (en) | 1986-05-28 | 
| ES545861A0 (es) | 1986-01-16 | 
| NZ212976A (en) | 1989-10-27 | 
| HU193339B (en) | 1987-09-28 | 
| EP0170290A2 (en) | 1986-02-05 | 
| EP0170290A3 (en) | 1986-04-23 | 
| DK352285A (da) | 1986-02-04 | 
| ES8604248A1 (es) | 1986-01-16 | 
| IL76002A0 (en) | 1985-12-31 | 
| US4732893A (en) | 1988-03-22 | 
Similar Documents
| Publication | Publication Date | Title | 
|---|---|---|
| AU586831B2 (en) | Metal complexes | |
| AU4770185A (en) | Antibody-metal ion complexes | |
| AU4568985A (en) | Tryptamine-5-methanesulfonamide | |
| AU4401185A (en) | Belastungsabhangig frequenzvariabler herzschrittmacher | |
| AU4222285A (en) | Pyrrolobenzimidazoles | |
| AU4254685A (en) | Arylhydroxamates | |
| AU3749685A (en) | Induktionsmotor | |
| AU4105285A (en) | Tetrahydrofuran-2-ylmethylamines | |
| AU4061285A (en) | Schaltersicherungseinheit | |
| AU582153B2 (en) | Iron complexes | |
| AU4604585A (en) | Co-dispenser | |
| AU5173685A (en) | Platinum-macromolecular carrier complexes | |
| AU4118385A (en) | Verbindungselement | |
| AU4299085A (en) | Medizinisches schwingbett | |
| AU4541685A (en) | Bandspanne | |
| AU4422985A (en) | Leucotriene-antagonistic thioethehers | |
| AU4542985A (en) | Linear-antriebsvorrichtung | |
| AU571988B2 (en) | Amino-anthracenedione-platinum complexes | |
| EP0182611A3 (en) | Platinum-phosphine-vinylsiloxane complexes | |
| AU4544085A (en) | Fiberdoseringsanordning | |
| AU4357485A (en) | Injektionsspritze | |
| AU4603785A (en) | Mulltransportfahrzeug | |
| AU4061585A (en) | Automatisk fadolsaftapningsanlaeg | |
| AU4274285A (en) | Cycloalkane-indene-carboximidamides | |
| AU4216685A (en) | Aminocarnitines |