AU1390276A - Anthraquinone-bis-amidines - Google Patents
Anthraquinone-bis-amidinesInfo
- Publication number
- AU1390276A AU1390276A AU13902/76A AU1390276A AU1390276A AU 1390276 A AU1390276 A AU 1390276A AU 13902/76 A AU13902/76 A AU 13902/76A AU 1390276 A AU1390276 A AU 1390276A AU 1390276 A AU1390276 A AU 1390276A
- Authority
- AU
- Australia
- Prior art keywords
- amidines
- anthraquinone
- bis
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- SXEWICNCOHPMNJ-UHFFFAOYSA-N 9,10-dioxoanthracene-1,2-dicarboximidamide Chemical class C1=CC=C2C(=O)C3=C(C(N)=N)C(C(=N)N)=CC=C3C(=O)C2=C1 SXEWICNCOHPMNJ-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/16—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms acylated on ring nitrogen atoms
- C07D295/18—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms acylated on ring nitrogen atoms by radicals derived from carboxylic acids, or sulfur or nitrogen analogues thereof
- C07D295/195—Radicals derived from nitrogen analogues of carboxylic acids
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/18—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member
- C07D207/22—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/68—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member
- C07D211/72—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member with hetero atoms or with carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D223/00—Heterocyclic compounds containing seven-membered rings having one nitrogen atom as the only ring hetero atom
- C07D223/02—Heterocyclic compounds containing seven-membered rings having one nitrogen atom as the only ring hetero atom not condensed with other rings
- C07D223/06—Heterocyclic compounds containing seven-membered rings having one nitrogen atom as the only ring hetero atom not condensed with other rings with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Pyrrole Compounds (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19752521357 DE2521357A1 (de) | 1975-05-14 | 1975-05-14 | Anthrachinon-bis-amidine und verfahren zu ihrer herstellung |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| AU1390276A true AU1390276A (en) | 1977-11-17 |
Family
ID=5946482
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| AU13902/76A Expired AU1390276A (en) | 1975-05-14 | 1976-05-13 | Anthraquinone-bis-amidines |
Country Status (16)
| Country | Link |
|---|---|
| US (1) | US4078086A (OSRAM) |
| JP (1) | JPS51138667A (OSRAM) |
| AU (1) | AU1390276A (OSRAM) |
| BE (1) | BE841862A (OSRAM) |
| DE (1) | DE2521357A1 (OSRAM) |
| DK (1) | DK213176A (OSRAM) |
| ES (5) | ES447732A1 (OSRAM) |
| FI (1) | FI761344A7 (OSRAM) |
| FR (1) | FR2310752A1 (OSRAM) |
| GR (1) | GR59335B (OSRAM) |
| IL (1) | IL49568A0 (OSRAM) |
| LU (1) | LU74926A1 (OSRAM) |
| NL (1) | NL7604911A (OSRAM) |
| NO (1) | NO761650L (OSRAM) |
| PT (1) | PT65095B (OSRAM) |
| SE (1) | SE7605500L (OSRAM) |
Families Citing this family (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4118498A (en) * | 1975-08-22 | 1978-10-03 | American Cyanamid Company | 2,6-Bis(1-piperidinoalkylideneamino)anthraquinones and method of treating cecal and hepatic amebic infections therewith |
| US4141992A (en) * | 1975-08-22 | 1979-02-27 | American Cyanamid Company | Cycloalkylcarboxyamidines and halobenzamidines as anti-amebic agents |
| US4131676A (en) | 1977-02-25 | 1978-12-26 | American Cyanamid Company | 2,6-Bis(1-morpholinoalkylideneamino)anthraquinones as anti-amebic agents |
| FR2387271A1 (fr) * | 1977-04-11 | 1978-11-10 | Minnesota Mining & Mfg | Colorants pleochroiques et dispositifs d'affichage electro-optique les utilisant |
| DE2835067A1 (de) * | 1978-08-10 | 1980-02-21 | Bayer Ag | Anthrachinon-derivate |
| DE2917312A1 (de) * | 1979-04-28 | 1980-11-06 | Bayer Ag | Anthrachinon-derivate |
| DE2931711A1 (de) * | 1979-08-04 | 1981-02-19 | Bayer Ag | Anthrachinon-azomethin-verbindungen, verfahren zu ihrer herstellung sowie verfahren zum pigmentieren organischer makromolekularer stoffe |
| DE2931710A1 (de) * | 1979-08-04 | 1981-02-19 | Bayer Ag | Anthrachinon-azomethin-verbindungen, verfahren zu ihrer herstellung, verfahren zum faerben synthetischer fasermaterialien sowie zum pigmentieren organischer makromolekularer stoffe |
| US4371543A (en) * | 1981-06-05 | 1983-02-01 | E. R. Squibb & Sons, Inc. | Bis-amidine indene ketones, compositions containing same and method of use |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3184482A (en) * | 1961-11-20 | 1965-05-18 | Hoffmann La Roche | Anthraquinone formamidines of primary amines |
-
1975
- 1975-05-14 DE DE19752521357 patent/DE2521357A1/de active Pending
-
1976
- 1976-05-07 NL NL7604911A patent/NL7604911A/xx unknown
- 1976-05-08 ES ES447732A patent/ES447732A1/es not_active Expired
- 1976-05-12 FI FI761344A patent/FI761344A7/fi not_active Application Discontinuation
- 1976-05-12 IL IL49568A patent/IL49568A0/xx unknown
- 1976-05-12 LU LU74926A patent/LU74926A1/xx unknown
- 1976-05-12 US US05/685,792 patent/US4078086A/en not_active Expired - Lifetime
- 1976-05-13 AU AU13902/76A patent/AU1390276A/en not_active Expired
- 1976-05-13 PT PT65095A patent/PT65095B/pt unknown
- 1976-05-13 NO NO761650A patent/NO761650L/no unknown
- 1976-05-13 DK DK213176A patent/DK213176A/da unknown
- 1976-05-13 GR GR50707A patent/GR59335B/el unknown
- 1976-05-14 SE SE7605500A patent/SE7605500L/xx unknown
- 1976-05-14 JP JP51055242A patent/JPS51138667A/ja active Pending
- 1976-05-14 FR FR7614610A patent/FR2310752A1/fr not_active Withdrawn
- 1976-05-14 BE BE167061A patent/BE841862A/xx unknown
-
1977
- 1977-05-30 ES ES459296A patent/ES459296A1/es not_active Expired
- 1977-05-30 ES ES459297A patent/ES459297A1/es not_active Expired
- 1977-05-30 ES ES459295A patent/ES459295A1/es not_active Expired
- 1977-05-30 ES ES459294A patent/ES459294A1/es not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| IL49568A0 (en) | 1976-07-30 |
| US4078086A (en) | 1978-03-07 |
| SE7605500L (sv) | 1976-11-15 |
| DE2521357A1 (de) | 1976-11-25 |
| ES459296A1 (es) | 1978-03-16 |
| ES459295A1 (es) | 1978-03-16 |
| DK213176A (da) | 1976-11-15 |
| JPS51138667A (en) | 1976-11-30 |
| BE841862A (fr) | 1976-11-16 |
| NL7604911A (nl) | 1976-11-16 |
| LU74926A1 (OSRAM) | 1977-02-11 |
| GR59335B (en) | 1977-12-14 |
| PT65095B (de) | 1978-02-06 |
| PT65095A (de) | 1976-06-01 |
| ES459294A1 (es) | 1978-03-16 |
| FR2310752A1 (fr) | 1976-12-10 |
| ES459297A1 (es) | 1978-03-16 |
| ES447732A1 (es) | 1977-10-01 |
| FI761344A7 (OSRAM) | 1976-11-15 |
| NO761650L (OSRAM) | 1976-11-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| GB1517403A (en) | Dimethoxyquinazolines | |
| GB1518404A (en) | Benzisothiazolines | |
| CS831476A2 (en) | Barevna obrazovka | |
| BG27526A4 (en) | Herbicid antipoison | |
| CS225976A2 (en) | Razove ustroji pohanene tlakovym prostredim | |
| AU1175076A (en) | Indolylalkylpiperidines | |
| AU1271076A (en) | Push-toy | |
| CS254876A2 (en) | Zpusob vyroby isolacni omitnute fasady | |
| EG12510A (en) | Dregers | |
| AU1169176A (en) | Pyrimidinylureas | |
| GB1519719A (en) | Noroxymorphones | |
| AU1390276A (en) | Anthraquinone-bis-amidines | |
| AU1804476A (en) | Phenylbenzofurans | |
| CS188141B2 (en) | Ski-brake | |
| AU1804276A (en) | 3-phenylbenzofurans | |
| AU1261376A (en) | Diarylbutanolamines | |
| GB1518055A (en) | Omega-trialkoxyalkanoates and -alkanethioates | |
| AU1616876A (en) | Cloches | |
| CS189776A2 (en) | Zpusob regenerace paladiovych katalyzatoru | |
| AU1100476A (en) | Electropaints | |
| AU1715276A (en) | Phenylsulfenylpiperazines | |
| AU1105976A (en) | 5-nitrothiazolylimidazolidine | |
| BG27522A3 (en) | Fungicde compositiow | |
| CH610841A5 (en) | Skibob | |
| CS384476A2 (en) | Elektronicky casovy spinac |