ATE192141T1 - Aromatische hydroxamsäure-verbindungen, ihre herstellung und verwendung - Google Patents
Aromatische hydroxamsäure-verbindungen, ihre herstellung und verwendungInfo
- Publication number
- ATE192141T1 ATE192141T1 AT96304582T AT96304582T ATE192141T1 AT E192141 T1 ATE192141 T1 AT E192141T1 AT 96304582 T AT96304582 T AT 96304582T AT 96304582 T AT96304582 T AT 96304582T AT E192141 T1 ATE192141 T1 AT E192141T1
- Authority
- AT
- Austria
- Prior art keywords
- group
- optionally substituted
- preparation
- acid compounds
- hydroxamic acid
- Prior art date
Links
- 150000001875 compounds Chemical class 0.000 title abstract 2
- NEAQRZUHTPSBBM-UHFFFAOYSA-N 2-hydroxy-3,3-dimethyl-7-nitro-4h-isoquinolin-1-one Chemical compound C1=C([N+]([O-])=O)C=C2C(=O)N(O)C(C)(C)CC2=C1 NEAQRZUHTPSBBM-UHFFFAOYSA-N 0.000 title 1
- 239000002253 acid Substances 0.000 title 1
- 125000002252 acyl group Chemical group 0.000 abstract 2
- 125000003118 aryl group Chemical group 0.000 abstract 2
- 125000001931 aliphatic group Chemical group 0.000 abstract 1
- 230000002555 anti-neurodegenerative effect Effects 0.000 abstract 1
- 239000003795 chemical substances by application Substances 0.000 abstract 1
- 125000006575 electron-withdrawing group Chemical group 0.000 abstract 1
- 125000001183 hydrocarbyl group Chemical group 0.000 abstract 1
- 150000003839 salts Chemical class 0.000 abstract 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C271/00—Derivatives of carbamic acids, i.e. compounds containing any of the groups, the nitrogen atom not being part of nitro or nitroso groups
- C07C271/60—Derivatives of carbamic acids, i.e. compounds containing any of the groups, the nitrogen atom not being part of nitro or nitroso groups having oxygen atoms of carbamate groups bound to nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C259/00—Compounds containing carboxyl groups, an oxygen atom of a carboxyl group being replaced by a nitrogen atom, this nitrogen atom being further bound to an oxygen atom and not being part of nitro or nitroso groups
- C07C259/04—Compounds containing carboxyl groups, an oxygen atom of a carboxyl group being replaced by a nitrogen atom, this nitrogen atom being further bound to an oxygen atom and not being part of nitro or nitroso groups without replacement of the other oxygen atom of the carboxyl group, e.g. hydroxamic acids
- C07C259/06—Compounds containing carboxyl groups, an oxygen atom of a carboxyl group being replaced by a nitrogen atom, this nitrogen atom being further bound to an oxygen atom and not being part of nitro or nitroso groups without replacement of the other oxygen atom of the carboxyl group, e.g. hydroxamic acids having carbon atoms of hydroxamic groups bound to hydrogen atoms or to acyclic carbon atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP15441495 | 1995-06-21 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| ATE192141T1 true ATE192141T1 (de) | 2000-05-15 |
Family
ID=15583642
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| AT96304582T ATE192141T1 (de) | 1995-06-21 | 1996-06-20 | Aromatische hydroxamsäure-verbindungen, ihre herstellung und verwendung |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US5891916A (de) |
| EP (1) | EP0749957B1 (de) |
| AT (1) | ATE192141T1 (de) |
| CA (1) | CA2179462A1 (de) |
| DE (1) | DE69607890T2 (de) |
| HU (1) | HUP9601701A3 (de) |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US6503947B1 (en) | 1998-01-27 | 2003-01-07 | Brigham And Women's Hospital | Method of treating cytotoxic damage |
| EP1365740A1 (de) * | 2001-02-08 | 2003-12-03 | Pharmacia Corporation | Arzneizmittel mit schnellem wirkungseintritt zur behandlung von sexuellen dysfunktion |
| US8796330B2 (en) * | 2006-12-19 | 2014-08-05 | Methylgene Inc. | Inhibitors of histone deacetylase and prodrugs thereof |
| EP1973872A4 (de) * | 2006-12-19 | 2012-05-09 | Methylgene Inc | Histondeacetylase-hemmer und propharmaka daraus |
| DK3180335T3 (da) | 2014-08-11 | 2021-08-09 | Angion Biomedica Corp | Cytokrom-p450-inhibitorer og anvendelser deraf |
| EP3240778A4 (de) | 2014-12-31 | 2018-07-11 | Angion Biomedica Corp. | Verfahren und mittel zur behandlung von krankheiten |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1050465A (de) * | 1900-01-01 | |||
| CH564527A5 (de) * | 1972-04-13 | 1975-07-31 | Sandoz Ag | |
| MX9203040A (es) * | 1984-08-01 | 1992-07-31 | Takeda Chemical Industries Ltd | Derivados de quinona y composicion farmaceutica que los contiene. |
| FR2601673B2 (fr) * | 1986-07-21 | 1989-06-02 | Lafon Labor | Derives de l'acetamide et medicaments qui en contiennent |
| US4681894A (en) * | 1986-09-26 | 1987-07-21 | Ortho Pharmaceutical Corporation | Hydroxamic acids and esters |
| DE3869692D1 (de) * | 1987-07-29 | 1992-05-07 | Takeda Chemical Industries Ltd | Zellproliferationsinhibitor. |
| US5272180A (en) * | 1987-07-29 | 1993-12-21 | Takeda Chemical Industries, Ltd. | Cell proliferation inhibitor |
| EP0601477A1 (de) * | 1992-12-08 | 1994-06-15 | Hoechst Schering AgrEvo GmbH | Substituierte Zimtsäurehydroxyamide, Verfahren zu ihrer Herstellung, diese enthaltende Mittel und ihre Verwendung |
| GB2276618A (en) * | 1993-03-29 | 1994-10-05 | Merck & Co Inc | Inhibitors of isoprenylated protein endoprotease |
| CA2118985A1 (en) * | 1993-04-02 | 1994-10-03 | Dinesh V. Patel | Heterocyclic inhibitors of farnesyl protein transferase |
-
1996
- 1996-06-14 US US08/662,240 patent/US5891916A/en not_active Expired - Fee Related
- 1996-06-19 CA CA002179462A patent/CA2179462A1/en not_active Abandoned
- 1996-06-20 EP EP96304582A patent/EP0749957B1/de not_active Expired - Lifetime
- 1996-06-20 AT AT96304582T patent/ATE192141T1/de not_active IP Right Cessation
- 1996-06-20 DE DE69607890T patent/DE69607890T2/de not_active Expired - Fee Related
- 1996-06-20 HU HU9601701A patent/HUP9601701A3/hu unknown
Also Published As
| Publication number | Publication date |
|---|---|
| EP0749957B1 (de) | 2000-04-26 |
| HUP9601701A3 (en) | 1997-08-28 |
| HUP9601701A2 (en) | 1997-05-28 |
| DE69607890T2 (de) | 2000-10-05 |
| EP0749957A1 (de) | 1996-12-27 |
| DE69607890D1 (de) | 2000-05-31 |
| US5891916A (en) | 1999-04-06 |
| HU9601701D0 (en) | 1996-08-28 |
| CA2179462A1 (en) | 1996-12-22 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| ATE210635T1 (de) | Aromatische hydroxamsäure-verbindungen, ihre herstellung und verwendung | |
| ATE174592T1 (de) | Sulfonamide und derivate zur modulierung der endothelin aktivitat | |
| ATE129998T1 (de) | Guanidinderivate, ihre herstellung und insektizide. | |
| DK0634408T3 (da) | Depsipeptidderivater, fremstilling og anvendelse deraf | |
| DE69736642D1 (de) | Heterocyclische Verbindungen, ihre Herstellung und Verwendung | |
| ES2070660B1 (es) | Un procedimiento para la preparacion de 2,5-damino-3-hidroxihexanos sustituidos, utiles como inhibidores de proteasas retrovirales. | |
| BRPI0211844B8 (pt) | composto de ácido fenóxi-acético ou um de seus sais farmaceuticamente aceitáveis, e, composição farmacêutica | |
| DE69820248D1 (de) | Pyrrolidin-derivate die eine phospholipase-a2-hemmende wirkung haben | |
| DE69432611D1 (de) | Herstellung einer substituierten 2,5-Diamino-3-hydroxyhexan | |
| DE3688374D1 (de) | Pyrazolsulfonamidderivat, verfahren zu seiner herstellung und dieses enthaltendes herbizid. | |
| ZA901834B (en) | Trifluoromethylphenylazolylmethyloxiranes,the preparation thereof and the use thereof as crop protection agents | |
| DE69129175D1 (de) | 1-Methylcarbapenemderivate und Verfahren zu ihrer Herstellung | |
| DK0695755T3 (da) | Pyrrolocarbazoler | |
| DK240084D0 (da) | New beta-carboline-3-oxadiazolyl derivatives | |
| NO913087L (no) | Ny tricyklisk forbindelse eller salter derav, fremgangsmaate for fremstilling derav og antimikrobielt middel inneholdende slike. | |
| GB8828669D0 (en) | Organic compounds | |
| ATE92489T1 (de) | Imid-derivate, ihre herstellung und verwendung. | |
| ATE141272T1 (de) | Beta-lactam-verbindungen und ihre herstellung | |
| ATE192141T1 (de) | Aromatische hydroxamsäure-verbindungen, ihre herstellung und verwendung | |
| MX9206930A (es) | Nuevos compuestos | |
| DK0387489T3 (da) | Anvendelse af 2,2,6,6-tetramethyl-4-aminopiperidinamider som fungicider | |
| ATE146481T1 (de) | Epoxysuccinamidsäurederivat | |
| NO304314B1 (no) | Cykloheksanderivater og anvendelse av forbindelsene for fremstilling av legemidler | |
| ES2067164T3 (es) | Composiciones para antiincrustacion acuatica. | |
| ES2045335T3 (es) | Un procedimiento para la preparacion de nuevas s-difluorometilhomocisteinas. |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| RER | Ceased as to paragraph 5 lit. 3 law introducing patent treaties |