AT88115B - Spherically, chromatically and astigmatically corrected objective consisting of four lenses. - Google Patents
Spherically, chromatically and astigmatically corrected objective consisting of four lenses.Info
- Publication number
- AT88115B AT88115B AT88115DA AT88115B AT 88115 B AT88115 B AT 88115B AT 88115D A AT88115D A AT 88115DA AT 88115 B AT88115 B AT 88115B
- Authority
- AT
- Austria
- Prior art keywords
- lenses
- chromatically
- spherically
- sep
- corrected objective
- Prior art date
Links
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims 1
- 239000004568 cement Substances 0.000 claims 1
- 239000005331 crown glasses (windows) Substances 0.000 claims 1
- 239000011521 glass Substances 0.000 claims 1
- 229910052708 sodium Inorganic materials 0.000 claims 1
- 239000011734 sodium Substances 0.000 claims 1
Landscapes
- Lenses (AREA)
Description
<Desc/Clms Page number 1>
Sphärisch, chromatisch und astigmatisch korrigiertes Objektiv aus vier Linsen.
EMI1.1
<Desc/Clms Page number 2>
EMI2.1
EMI2.2
<tb>
<tb> Krümmungshalbmesser <SEP> : <SEP> Dicken <SEP> und <SEP> Abstände <SEP> :
<tb> r1 <SEP> = <SEP> + <SEP> 2I#64 <SEP> dI <SEP> = <SEP> 3#49
<tb> r2 <SEP> = <SEP> ¯ <SEP> # <SEP> l <SEP> = <SEP> 3#I2
<tb> r3 <SEP> = <SEP> - <SEP> 57#88 <SEP> dII <SEP> = <SEP> I#44
<tb> r4 <SEP> = <SEP> + <SEP> 20#36 <SEP> bi <SEP> = <SEP> 3#I9
<tb> =-257-18 <SEP> , <SEP> = <SEP> 0-25
<tb> r6 <SEP> = <SEP> + <SEP> r7'04 <SEP> dm <SEP> = <SEP> 0'98
<tb> r7 <SEP> = <SEP> - <SEP> 36#23 <SEP> dIV <SEP> = <SEP> 5#76
<tb>
Uasarten :
EMI2.3
<tb>
<tb> I <SEP> II <SEP> III <SEP> IV
<tb> nD <SEP> I#5323 <SEP> I#5739 <SEP> I#5328 <SEP> I#6I76
<tb> γ58#3 <SEP> 42#6 <SEP> 5I#6 <SEP> 54#6
<tb>
<Desc / Clms Page number 1>
Spherically, chromatically and astigmatically corrected objective consisting of four lenses.
EMI1.1
<Desc / Clms Page number 2>
EMI2.1
EMI2.2
<tb>
<tb> Radius of curvature <SEP>: <SEP> Thicknesses <SEP> and <SEP> distances <SEP>:
<tb> r1 <SEP> = <SEP> + <SEP> 2I # 64 <SEP> dI <SEP> = <SEP> 3 # 49
<tb> r2 <SEP> = <SEP> ¯ <SEP> # <SEP> l <SEP> = <SEP> 3 # I2
<tb> r3 <SEP> = <SEP> - <SEP> 57 # 88 <SEP> dII <SEP> = <SEP> I # 44
<tb> r4 <SEP> = <SEP> + <SEP> 20 # 36 <SEP> to <SEP> = <SEP> 3 # I9
<tb> = -257-18 <SEP>, <SEP> = <SEP> 0-25
<tb> r6 <SEP> = <SEP> + <SEP> r7'04 <SEP> dm <SEP> = <SEP> 0'98
<tb> r7 <SEP> = <SEP> - <SEP> 36 # 23 <SEP> dIV <SEP> = <SEP> 5 # 76
<tb>
Uasarten:
EMI2.3
<tb>
<tb> I <SEP> II <SEP> III <SEP> IV
<tb> nD <SEP> I # 5323 <SEP> I # 5739 <SEP> I # 5328 <SEP> I # 6I76
<tb> γ 58 # 3 <SEP> 42 # 6 <SEP> 5I # 6 <SEP> 54 # 6
<tb>
Claims (1)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE88115X | 1917-10-15 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| AT88115B true AT88115B (en) | 1922-04-25 |
Family
ID=5642080
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| AT88115D AT88115B (en) | 1917-10-15 | 1919-02-17 | Spherically, chromatically and astigmatically corrected objective consisting of four lenses. |
Country Status (1)
| Country | Link |
|---|---|
| AT (1) | AT88115B (en) |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1140363B (en) * | 1959-06-27 | 1962-11-29 | Rodenstock Optik G | Four-lens photographic lens of high light intensity |
| DE1186235B (en) * | 1963-02-08 | 1965-01-28 | Rodenstock Optik G | Four-lens photographic lens of high light intensity |
-
1919
- 1919-02-17 AT AT88115D patent/AT88115B/en active
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1140363B (en) * | 1959-06-27 | 1962-11-29 | Rodenstock Optik G | Four-lens photographic lens of high light intensity |
| DE1186235B (en) * | 1963-02-08 | 1965-01-28 | Rodenstock Optik G | Four-lens photographic lens of high light intensity |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE665520C (en) | Photographic lens | |
| DE945959C (en) | Wide angle lens | |
| AT88115B (en) | Spherically, chromatically and astigmatically corrected objective consisting of four lenses. | |
| US1584271A (en) | Photographic lens | |
| AT127588B (en) | Projection lens. | |
| DE471565C (en) | Long-range photographic lens | |
| AT43771B (en) | Chromatically and spherically corrected distance lens. | |
| CH88587A (en) | Bright, spherically and chromatically corrected single lens with anastigmatic image flattening. | |
| DE396359C (en) | Photographic lens | |
| DE461062C (en) | Eyepiece consisting of three positive parts with a large field of view | |
| AT204301B (en) | Fast Gaussian double lens | |
| DE667453C (en) | Unbalanced photographic lens | |
| AT309847B (en) | Fast lens of the Gaussian type | |
| AT132194B (en) | Three-part photographic lens. | |
| DE388636C (en) | Photographic lens | |
| AT33776B (en) | Spherically, chromatically and astigmatically corrected double lens. | |
| AT145327B (en) | Anastigmatic lens for photography and projection. | |
| DE951175C (en) | Anamorphic auxiliary lens system | |
| DE349938C (en) | Spherically, chromatically and astigmatically corrected objective consisting of four lenses | |
| AT123167B (en) | Fast lens. | |
| AT215177B (en) | Bright projection lens | |
| DE1255343B (en) | Photographic lens | |
| AT99391B (en) | Two-lens achromatic additional lens system for photographic objectives. | |
| AT79458B (en) | Eyepiece. | |
| AT48974B (en) | Magnifying lens for nearsighted people. |