AT348980B - Verfahren zur herstellung von neuen 2,2-dimethyl-3-(2',2'-dichlorvinyl)- cyclopropan-carbonsaeure-derivaten - Google Patents
Verfahren zur herstellung von neuen 2,2-dimethyl-3-(2',2'-dichlorvinyl)- cyclopropan-carbonsaeure-derivatenInfo
- Publication number
- AT348980B AT348980B AT107077A AT107077A AT348980B AT 348980 B AT348980 B AT 348980B AT 107077 A AT107077 A AT 107077A AT 107077 A AT107077 A AT 107077A AT 348980 B AT348980 B AT 348980B
- Authority
- AT
- Austria
- Prior art keywords
- dichlorvinyl
- dimethyl
- acid derivatives
- carbonic acid
- producing new
- Prior art date
Links
- INIJYAPNCKTGRV-UHFFFAOYSA-N carbonic acid;2-(2,2-dichloroethenyl)-1,1-dimethylcyclopropane Chemical class OC(O)=O.CC1(C)CC1C=C(Cl)Cl INIJYAPNCKTGRV-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C255/00—Carboxylic acid nitriles
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19762606635 DE2606635A1 (de) | 1976-02-19 | 1976-02-19 | Verfahren zur herstellung von 2,2-dimethyl-3-(2',2'-dichlorvinyl) -cyclopropan-1-carbonsaeure |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| ATA107077A ATA107077A (de) | 1978-08-15 |
| AT348980B true AT348980B (de) | 1979-03-12 |
Family
ID=5970284
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| AT107077A AT348980B (de) | 1976-02-19 | 1977-02-17 | Verfahren zur herstellung von neuen 2,2-dimethyl-3-(2',2'-dichlorvinyl)- cyclopropan-carbonsaeure-derivaten |
Country Status (10)
| Country | Link |
|---|---|
| JP (1) | JPS52100451A (de) |
| AT (1) | AT348980B (de) |
| BE (1) | BE851524A (de) |
| BR (1) | BR7700999A (de) |
| DE (1) | DE2606635A1 (de) |
| DK (1) | DK71077A (de) |
| FR (1) | FR2341553A1 (de) |
| GB (3) | GB1571433A (de) |
| IL (1) | IL51465A0 (de) |
| NL (1) | NL7701695A (de) |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NZ185635A (en) * | 1976-11-18 | 1980-04-28 | Ici Ltd | Preparation of 3-dihalovinyl-2,2-dimethylcyclopropane carboxylic acid derivatives |
| US4334091A (en) * | 1978-08-14 | 1982-06-08 | Air Products And Chemicals, Inc. | Process for preparing halovinyl cyclopropane carboxylic acid salts |
| DE2923773A1 (de) * | 1979-06-12 | 1980-12-18 | Bayer Ag | Verfahren zur herstellung von trans-3,3-dimethyl-cyclopropan-1,2-dicarbonsaeure |
| FR2541997B1 (fr) * | 1983-03-01 | 1985-07-19 | Roussel Uclaf | Nouveau procede de preparation de derives de l'acide pent-4-enoique |
| JP4645155B2 (ja) * | 2003-11-07 | 2011-03-09 | 住友化学株式会社 | 3,3−ジメチル−2−(1−プロペニル)シクロプロパンカルボン酸エステルの製造方法 |
| ES2399634T3 (es) | 2003-11-07 | 2013-04-02 | Sumitomo Chemical Company, Limited | Método para la producción de 3,3-dimetil-2-(1-propenil)ciclopropanocarboxilato |
Family Cites Families (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1519290A (en) * | 1974-08-14 | 1978-07-26 | Ici Ltd | Process for preparing substituted cyclopropanes |
| IN142702B (de) * | 1974-09-10 | 1977-08-20 | Sagami Chem Res | |
| AT347917B (de) * | 1974-11-30 | 1979-01-25 | Sagami Chem Res | Verfahren zur herstellung von 2-dihalogen- vinylcyclopropancarbonsaeureestern |
| DE2552615A1 (de) * | 1974-11-30 | 1976-06-16 | Kuraray Co | Verfahren zur herstellung von dihalogenvinylcyclopropancarboxylaten |
| FR2351943A1 (fr) * | 1974-11-30 | 1977-12-16 | Sagami Chem Res | Nouveaux hexenoates d'ethyle substitues utilisables comme intermediaires pour la fabrication d'insecticides |
| JPS5195043A (en) * | 1975-02-12 | 1976-08-20 | beeta jiharogenoetenirushikuropuropanjudotaino seizohoho | |
| JPS5721173B2 (de) * | 1975-02-12 | 1982-05-06 | ||
| FR2351944A1 (fr) * | 1975-02-24 | 1977-12-16 | Sagami Chem Res | Nouveaux hexenoates d'ethyle substitues utiles comme intermediaires pour la fabrication d'insecticides |
| AU511383B2 (en) * | 1975-05-16 | 1980-08-14 | Imperial Chemical Industries Ltd | Intermediates inthe preparation of cyclopropanoid insecticides |
| JPS51136619A (en) * | 1975-05-20 | 1976-11-26 | Ajinomoto Co Inc | Process for preparing l-cysteine and/or l-cystine |
| JPS5253839A (en) * | 1975-10-30 | 1977-04-30 | Sumitomo Chem Co Ltd | Preparation of 2-(2,2-dihalovinyl) cyclopropane crboxylic acids |
| DE2623848A1 (de) * | 1976-05-28 | 1977-12-08 | Bayer Ag | Verfahren zur herstellung von 2,2- dimethyl-3-(2',2'-dihalogenvinyl)-cyclopropan-1-carbonsaeureester |
| GB1580202A (en) * | 1976-06-22 | 1980-11-26 | Shell Int Research | Process for the preparation of cyclopropanecarbonitriles |
| GB1578139A (en) * | 1976-07-07 | 1980-11-05 | Ici Ltd | Preparation of alicyclic compounds |
| DE2638356A1 (de) * | 1976-08-26 | 1978-03-02 | Bayer Ag | Verfahren zur herstellung vinylsubstituierter cyclopropancarbonsaeureester |
-
1976
- 1976-02-19 DE DE19762606635 patent/DE2606635A1/de active Pending
-
1977
- 1977-02-16 GB GB39954/77A patent/GB1571433A/en not_active Expired
- 1977-02-16 IL IL51465A patent/IL51465A0/xx unknown
- 1977-02-16 GB GB6465/77A patent/GB1571432A/en not_active Expired
- 1977-02-16 GB GB39955/77A patent/GB1571434A/en not_active Expired
- 1977-02-17 BR BR7700999A patent/BR7700999A/pt unknown
- 1977-02-17 AT AT107077A patent/AT348980B/de not_active IP Right Cessation
- 1977-02-17 BE BE175010A patent/BE851524A/xx unknown
- 1977-02-17 NL NL7701695A patent/NL7701695A/xx not_active Application Discontinuation
- 1977-02-18 JP JP1630277A patent/JPS52100451A/ja active Pending
- 1977-02-18 DK DK71077A patent/DK71077A/da unknown
- 1977-02-18 FR FR7704753A patent/FR2341553A1/fr active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| NL7701695A (nl) | 1977-08-23 |
| DK71077A (da) | 1977-08-20 |
| GB1571434A (en) | 1980-07-16 |
| ATA107077A (de) | 1978-08-15 |
| DE2606635A1 (de) | 1977-08-25 |
| BE851524A (fr) | 1977-08-17 |
| GB1571432A (en) | 1980-07-16 |
| BR7700999A (pt) | 1977-11-01 |
| IL51465A0 (en) | 1977-04-29 |
| FR2341553A1 (fr) | 1977-09-16 |
| JPS52100451A (en) | 1977-08-23 |
| GB1571433A (en) | 1980-07-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| AT358728B (de) | Verfahren zur herstellung von neuen synisomeren von 3,7-disubstituierten 3-cephem-4-carbon- saeureverbindungen | |
| AT360663B (de) | Verfahren zur herstellung von neuen 6,7- -benzomorphanen | |
| AT353958B (de) | Verfahren zur herstellung von neuen 3,7- disubstituierten 3-cephem-4-carbonsaeurever- bindungen | |
| AT363467B (de) | Verfahren zur herstellung von neuen substituierten thiazolidin-, thiazan- und verwandten carbonsaeuren und von deren salzen und isomeren | |
| AT356671B (de) | Verfahren zur herstellung von neuen n,n'-thio- -di-carbamaten | |
| ATA33277A (de) | Verfahren zur herstellung von neuen diphosphonalkancarbonsauren | |
| AT354626B (de) | Verfahren zur herstellung von neuen 7-acyl- amino-8-oxo-3-oxa-1-azabicyclo/4.2.0/octan-2- carbonsaeure-derivaten | |
| AT350043B (de) | Verfahren zur herstellung von neuen 3-polyhalogenaethyl-2, 2-dimethylcyclopropan- carbonsaeuren | |
| AT367432B (de) | Verfahren zur herstellung von neuen 3",4"diacyltylosinderivaten | |
| AT354434B (de) | Verfahren zur herstellung von neuen 1,4- diphenyl-3-pyrazolin-5-onen | |
| AT348980B (de) | Verfahren zur herstellung von neuen 2,2-dimethyl-3-(2',2'-dichlorvinyl)- cyclopropan-carbonsaeure-derivaten | |
| AT365588B (de) | Verfahren zur herstellung von neuen spiropyridochroman-4',5-hydantoinen | |
| ATA374977A (de) | Verfahren zur herstellung von 2,2-dimethyl-3- (2',2'-dihalogenvinyl)-cyclopropan-1-carbonsaeureestern | |
| AT358034B (de) | Verfahren zur herstellung von neuen substi- tuierten 2,3-alkylen-bis(oxy)benzamiden | |
| DD132497A1 (de) | Verfahren zur herstellung von neuen gona-4,9(10)-dienen | |
| AT362877B (de) | Verfahren zur herstellung von neuen 3,7disubstituierten 3-cephem-4-carbonsaeureverbindungen | |
| ATA160879A (de) | Verfahren zur herstellung von neuen 3,7-di- substituierten 3-cephem-4-carbonsaeurever- bindungen | |
| AT347920B (de) | Verfahren zur herstellung des neuen 2,5- dichlor-4-bromphenylazo-4-chlorphenylsulfids | |
| ATA530778A (de) | Verfahren zur herstellung von neuen substituierten 3'-phenoxybenzyl-3-vinyl-2,2-dimethyl-cycloprop n carboxylaten | |
| ATA272280A (de) | Verfahren zur herstellung von neuen 1,4dihydropyridinverbindungen | |
| AT361940B (de) | Verfahren zur herstellung von neuen n,n'-thio- -bis-oximcarbamaten | |
| AT362505B (de) | Verfahren zur herstellung von neuen synisomeren von 3,7-disubstituierten 3-cephem-4-carbon- saeureverbindungen | |
| ATA222879A (de) | Verfahren zur herstellung von neuen 3,7-disubstituierten 3-cephem-4-carbonsaeuren | |
| ATA228581A (de) | Verfahren zur herstellung von neuen 3,7disubstituierten 3-cephem-4-carbonsaeuren | |
| ATA160279A (de) | Verfahren zur herstellung von neuen unsymetrischen n,n'-thio-di-carbamaten |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| RER | Ceased as to paragraph 5 lit. 3 law introducing patent treaties |