AT319928B - Verfahren zur Herstellung neuer 9-(2-Hydroxy-3-Aminopropyl)-9,10-dihydro-9,10-äthanoanthracene - Google Patents
Verfahren zur Herstellung neuer 9-(2-Hydroxy-3-Aminopropyl)-9,10-dihydro-9,10-äthanoanthraceneInfo
- Publication number
- AT319928B AT319928B AT336073A AT336073A AT319928B AT 319928 B AT319928 B AT 319928B AT 336073 A AT336073 A AT 336073A AT 336073 A AT336073 A AT 336073A AT 319928 B AT319928 B AT 319928B
- Authority
- AT
- Austria
- Prior art keywords
- ethanoanthracenes
- aminopropyl
- dihydro
- hydroxy
- preparation
- Prior art date
Links
- MFFVUOWODXJKPA-UHFFFAOYSA-N desmethyllevoprotiline Chemical class C12=CC=CC=C2C2(CC(O)CN)C3=CC=CC=C3C1CC2 MFFVUOWODXJKPA-UHFFFAOYSA-N 0.000 title 1
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH257871A CH548364A (de) | 1971-02-23 | 1971-02-23 | Verfahren zur herstellung neuer 9-(2-hydroxy-3-aminopropyl-9,10-dihydro-9,10-aethanoanthracene. |
| AT335873A AT323726B (de) | 1971-02-23 | 1972-02-22 | Verfahren zur herstellung neuen 9-(2-hydroxy-3-aminopropyl-9,10-dihydro-9,10-äthanoanthracene |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| AT319928B true AT319928B (de) | 1975-01-10 |
Family
ID=32327183
Family Applications (5)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| AT335973A AT319927B (de) | 1971-02-23 | 1972-02-22 | Verfahren zur Herstellung neuer 9-(2-Hydroxy-3-Aminopropyl)-9,10-dihydro-9,10-äthanoanthracene |
| AT336073A AT319928B (de) | 1971-02-23 | 1972-02-22 | Verfahren zur Herstellung neuer 9-(2-Hydroxy-3-Aminopropyl)-9,10-dihydro-9,10-äthanoanthracene |
| AT335873A AT323726B (de) | 1971-02-23 | 1972-02-22 | Verfahren zur herstellung neuen 9-(2-hydroxy-3-aminopropyl-9,10-dihydro-9,10-äthanoanthracene |
| AT143372A AT317194B (de) | 1971-02-23 | 1972-02-22 | Verfahren zur Herstellung neuer 9-(2-Hydroxy-3-aminopropyl)-9,10-dihydro-9,10-äthanoanthracene |
| AT424674A AT331238B (de) | 1971-02-23 | 1974-05-22 | Verfahren zur herstellung neuer 9- (2-hydroxy-3-aminopropyl)-9,10-dihydro-9,10-athanoanthracene |
Family Applications Before (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| AT335973A AT319927B (de) | 1971-02-23 | 1972-02-22 | Verfahren zur Herstellung neuer 9-(2-Hydroxy-3-Aminopropyl)-9,10-dihydro-9,10-äthanoanthracene |
Family Applications After (3)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| AT335873A AT323726B (de) | 1971-02-23 | 1972-02-22 | Verfahren zur herstellung neuen 9-(2-hydroxy-3-aminopropyl-9,10-dihydro-9,10-äthanoanthracene |
| AT143372A AT317194B (de) | 1971-02-23 | 1972-02-22 | Verfahren zur Herstellung neuer 9-(2-Hydroxy-3-aminopropyl)-9,10-dihydro-9,10-äthanoanthracene |
| AT424674A AT331238B (de) | 1971-02-23 | 1974-05-22 | Verfahren zur herstellung neuer 9- (2-hydroxy-3-aminopropyl)-9,10-dihydro-9,10-athanoanthracene |
Country Status (2)
| Country | Link |
|---|---|
| AT (5) | AT319927B (de) |
| ZA (1) | ZA72990B (de) |
-
1972
- 1972-02-15 ZA ZA720990A patent/ZA72990B/xx unknown
- 1972-02-22 AT AT335973A patent/AT319927B/de not_active IP Right Cessation
- 1972-02-22 AT AT336073A patent/AT319928B/de not_active IP Right Cessation
- 1972-02-22 AT AT335873A patent/AT323726B/de not_active IP Right Cessation
- 1972-02-22 AT AT143372A patent/AT317194B/de not_active IP Right Cessation
-
1974
- 1974-05-22 AT AT424674A patent/AT331238B/de not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| AT317194B (de) | 1974-08-12 |
| ATA424674A (de) | 1975-11-15 |
| AT319927B (de) | 1975-01-10 |
| AT323726B (de) | 1975-07-25 |
| AT331238B (de) | 1976-08-10 |
| ZA72990B (en) | 1972-10-25 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CH531000A (de) | Verfahren zur Herstellung neuer Benzocycloheptathiophene | |
| AT329550B (de) | Verfahren zur herstellung neuer benzocycloalkendicarbonsauremonoalkylester | |
| AT319259B (de) | Verfahren zur Herstellung neuer Dihydropyridazone | |
| DD95565A5 (de) | Verfahren zur herstellung neuer pregnansaeurederivate | |
| AT298478B (de) | Verfahren zur Herstellung neuer 2-Aminoindanderivate | |
| AT315155B (de) | Verfahren zur Herstellung von mono- oder bis-(p-Hydroxybenzyl)-methanen | |
| AT301522B (de) | Verfahren zur Herstellung neuer substituierter 2-Phenyl-2-hydroxy- oder acyloxy-1,1-dihalogenäthane | |
| AT299916B (de) | Verfahren zur Herstellung neuer bis-Aminobenzoate | |
| AT317193B (de) | Verfahren zur Herstellung neuer 9-(3-Amino-1-propenyl)-9,10-dihydro-9,10-äthano-anthracene | |
| AT319929B (de) | Verfahren zur Herstellung neuer 9-(3-Amino-1-propenyl)-9,10-dihydro-9,10-äthano-anthracene | |
| CH530988A (de) | Verfahren zur Herstellung neuer Diallylaminoalkanoylamide | |
| CH516591A (de) | Verfahren zur Herstellung neuer Thiazolopyrrolopyrimidine | |
| AT318559B (de) | Verfahren zur Herstellung neuer 1-Phenyl-3-hydroxy-3-methyl-triazene | |
| AT319928B (de) | Verfahren zur Herstellung neuer 9-(2-Hydroxy-3-Aminopropyl)-9,10-dihydro-9,10-äthanoanthracene | |
| AT315160B (de) | Verfahren zur Herstellung neuer 9-(3-Oxo-1-propenyl)-9,10-dihydro-9,10-äthano-anthracene | |
| AT306047B (de) | Verfahren zur Herstellung neuer 2,9-Dioxatricyclo(4,3,1,0<3,7>decan-4-one | |
| CH539602A (de) | Verfahren zur Herstellung von neuen N-substituierten 9-(Aminoalkyl)-9,10-dihydro-9,10-äthano-anthrazenen | |
| CH540242A (de) | Verfahren zur Herstellung neuer 7a,18-Dialkylöstrene | |
| AT337168B (de) | Verfahren zur herstellung neuer fluorenonderivate | |
| ATA444875A (de) | Verfahren zur herstellung neuer 9-(2-hydroxy-3-aminopropyl-9,10-dihydro-9,10-athanoanthracene | |
| AT311566B (de) | Verfahren zur Herstellung neuer Halogensteroide | |
| CH541575A (de) | Verfahren zur Herstellung neuer 1-Aza-9-oxafluorene | |
| CH535785A (de) | Verfahren zur Herstellung neuer Hydrazino-pyrimidine | |
| AT342028B (de) | Verfahren zur herstellung neuer chloracetanilide | |
| AT323347B (de) | Verfahren zur herstellung neuer halogensteroide |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| ELA | Expired due to lapse of time |