AT305252B - Verfahren zur Herstellung von o-(β-Diäthylaminoäthoxy)-3-phenylpropiophenon-hydrochlorid - Google Patents
Verfahren zur Herstellung von o-(β-Diäthylaminoäthoxy)-3-phenylpropiophenon-hydrochloridInfo
- Publication number
- AT305252B AT305252B AT284370A AT284370A AT305252B AT 305252 B AT305252 B AT 305252B AT 284370 A AT284370 A AT 284370A AT 284370 A AT284370 A AT 284370A AT 305252 B AT305252 B AT 305252B
- Authority
- AT
- Austria
- Prior art keywords
- diethylaminoethoxy
- preparation
- phenylpropiophenone
- hydrochloride
- phenylpropiophenone hydrochloride
- Prior art date
Links
- BYWIEEUABBZFEE-UHFFFAOYSA-N Dialicor Chemical compound Cl.CCN(CC)CCOC1=CC=CC=C1C(=O)CCC1=CC=CC=C1 BYWIEEUABBZFEE-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C217/00—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton
- C07C217/02—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton
- C07C217/04—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated
- C07C217/06—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated having only one etherified hydroxy group and one amino group bound to the carbon skeleton, which is not further substituted
- C07C217/14—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated having only one etherified hydroxy group and one amino group bound to the carbon skeleton, which is not further substituted the oxygen atom of the etherified hydroxy group being further bound to a carbon atom of a six-membered aromatic ring
- C07C217/18—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated having only one etherified hydroxy group and one amino group bound to the carbon skeleton, which is not further substituted the oxygen atom of the etherified hydroxy group being further bound to a carbon atom of a six-membered aromatic ring the six-membered aromatic ring or condensed ring system containing that ring being further substituted
- C07C217/22—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated having only one etherified hydroxy group and one amino group bound to the carbon skeleton, which is not further substituted the oxygen atom of the etherified hydroxy group being further bound to a carbon atom of a six-membered aromatic ring the six-membered aromatic ring or condensed ring system containing that ring being further substituted by carbon atoms having at least two bonds to oxygen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19691917562 DE1917562C3 (de) | 1969-04-02 | Verfahren zur Herstellung von o-(2- Diäthylaminoäthoxy) -omega-phenylpropiophenon |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| AT305252B true AT305252B (de) | 1973-02-26 |
Family
ID=5730424
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| AT284370A AT305252B (de) | 1969-04-02 | 1970-03-26 | Verfahren zur Herstellung von o-(β-Diäthylaminoäthoxy)-3-phenylpropiophenon-hydrochlorid |
Country Status (11)
| Country | Link |
|---|---|
| JP (1) | JPS4837260B1 (pl) |
| AT (1) | AT305252B (pl) |
| BE (1) | BE746035A (pl) |
| BR (1) | BR7017930D0 (pl) |
| CH (1) | CH535200A (pl) |
| ES (1) | ES375198A1 (pl) |
| FR (1) | FR2085658A1 (pl) |
| LU (1) | LU60559A1 (pl) |
| NL (1) | NL164270C (pl) |
| PL (1) | PL87283B1 (pl) |
| SE (1) | SE372259B (pl) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5067063U (pl) * | 1973-10-26 | 1975-06-16 |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR1315712A (fr) * | 1960-05-25 | 1963-01-25 | Guidotti & Co Spa Lab | Méthode de préparation de [o (bêta-diéthylaminoéthoxyphényl)]-1-phényl-3-propanone |
-
1969
- 1969-08-29 CH CH1312469A patent/CH535200A/de not_active IP Right Cessation
- 1969-09-24 JP JP44075304A patent/JPS4837260B1/ja active Pending
-
1970
- 1970-01-07 ES ES375198A patent/ES375198A1/es not_active Expired
- 1970-02-03 FR FR7003727A patent/FR2085658A1/fr active Granted
- 1970-02-16 BE BE746035D patent/BE746035A/xx unknown
- 1970-03-03 NL NL7002984.A patent/NL164270C/xx not_active IP Right Cessation
- 1970-03-20 LU LU60559D patent/LU60559A1/xx unknown
- 1970-03-26 AT AT284370A patent/AT305252B/de not_active IP Right Cessation
- 1970-04-01 BR BR217930/70A patent/BR7017930D0/pt unknown
- 1970-04-01 SE SE7004430A patent/SE372259B/xx unknown
- 1970-04-02 PL PL1970139765A patent/PL87283B1/pl unknown
Also Published As
| Publication number | Publication date |
|---|---|
| CH535200A (de) | 1973-03-31 |
| LU60559A1 (pl) | 1970-05-21 |
| FR2085658A1 (en) | 1971-12-31 |
| PL87283B1 (pl) | 1976-06-30 |
| BR7017930D0 (pt) | 1973-02-13 |
| DE1917562A1 (de) | 1970-11-05 |
| NL164270B (nl) | 1980-07-15 |
| BE746035A (fr) | 1970-07-31 |
| NL7002984A (pl) | 1970-10-06 |
| ES375198A1 (es) | 1972-03-01 |
| DE1917562B2 (de) | 1974-06-12 |
| JPS4837260B1 (pl) | 1973-11-09 |
| SE372259B (pl) | 1974-12-16 |
| NL164270C (nl) | 1980-12-15 |
| FR2085658B1 (pl) | 1974-04-12 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| AT298508B (de) | Verfahren zur Herstellung von Mercaptoalkylalkoxysilanen | |
| AT302277B (de) | Verfahren zur Herstellung von Chinondiiminen | |
| CH526566A (de) | Verfahren zur Herstellung von 5-Pyridyl-2-imidazolonen | |
| CH508604A (de) | Verfahren zur Herstellung von Ureidophenylguanidinen | |
| AT304774B (de) | Verfahren zur Herstellung von 16β-Methyl-9α-fluor-steroiden | |
| CH525881A (de) | Verfahren zur Herstellung von 4-Alkylprolinen | |
| CH505041A (de) | Verfahren zur Herstellung von Cycloalkenonen | |
| CH531480A (de) | Verfahren zur Herstellung von Aminoadamantanen | |
| AT296961B (de) | Verfahren zur Herstellung von Alkyldihydroxybenzolen | |
| AT319485B (de) | Verfahren zur Herstellung von 19-Norsteroiden | |
| CH511225A (de) | Verfahren zur Herstellung von Amidophenylthioharnstoffen | |
| CH529108A (de) | Verfahren zur Herstellung von y-Cyanbutyraldiminen | |
| AT308086B (de) | Verfahren zur Herstellung von 1-Alkoxyanthrachinonen | |
| CH530408A (de) | Verfahren zur Herstellung von Chinolylpiperazinen | |
| AT305252B (de) | Verfahren zur Herstellung von o-(β-Diäthylaminoäthoxy)-3-phenylpropiophenon-hydrochlorid | |
| AT299905B (de) | Verfahren zur Herstellung von β-Acetoxypivalinaldehyd | |
| AT296297B (de) | Verfahren zur Herstellung von N-Tritylimidazolen und -triazolen | |
| CH535204A (de) | Verfahren zur Herstellung N-substituierter a-Chloracylanilide | |
| CH532070A (de) | Verfahren zur Herstellung von 3-Methyl-isoxazol | |
| CH530358A (de) | Verfahren zur Herstellung von 2-Methyl-4-halogen-but-2-en-1-alen | |
| AT299251B (de) | Verfahren zur Herstellung von Organo-H-chlorsilanen | |
| AT296298B (de) | Verfahren zur Herstellung von N-Tritylimidazolen und -triazolen | |
| AT294834B (de) | Verfahren zur Herstellung von 4-Alkoxy-piperidinen | |
| AT294833B (de) | Verfahren zur Herstellung von N-Tritylimidazolen und -triazolen | |
| AT299252B (de) | Verfahren zur Herstellung von Organo-H-chlorsilanen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| EFA | Change in the company name | ||
| ELA | Expired due to lapse of time |