AT280419B - Niederdrucknatriumdampfentladungslampe und Verfahren zu ihrer Herstellung - Google Patents
Niederdrucknatriumdampfentladungslampe und Verfahren zu ihrer HerstellungInfo
- Publication number
- AT280419B AT280419B AT654968A AT654968A AT280419B AT 280419 B AT280419 B AT 280419B AT 654968 A AT654968 A AT 654968A AT 654968 A AT654968 A AT 654968A AT 280419 B AT280419 B AT 280419B
- Authority
- AT
- Austria
- Prior art keywords
- manufacture
- low pressure
- discharge lamp
- vapor discharge
- pressure sodium
- Prior art date
Links
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 title 1
- 238000004519 manufacturing process Methods 0.000 title 1
- 238000000034 method Methods 0.000 title 1
- 229910052708 sodium Inorganic materials 0.000 title 1
- 239000011734 sodium Substances 0.000 title 1
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01J—ELECTRIC DISCHARGE TUBES OR DISCHARGE LAMPS
- H01J61/00—Gas-discharge or vapour-discharge lamps
- H01J61/02—Details
- H01J61/24—Means for obtaining or maintaining the desired pressure within the vessel
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01J—ELECTRIC DISCHARGE TUBES OR DISCHARGE LAMPS
- H01J61/00—Gas-discharge or vapour-discharge lamps
- H01J61/70—Lamps with low-pressure unconstricted discharge having a cold pressure < 400 Torr
- H01J61/74—Lamps with low-pressure unconstricted discharge having a cold pressure < 400 Torr having a main light-emitting filling of difficult vaporisable metal vapour, e.g. sodium
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NL6709573A NL6709573A (enExample) | 1967-07-10 | 1967-07-10 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| AT280419B true AT280419B (de) | 1970-04-10 |
Family
ID=19800674
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| AT654968A AT280419B (de) | 1967-07-10 | 1968-07-08 | Niederdrucknatriumdampfentladungslampe und Verfahren zu ihrer Herstellung |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US3548240A (enExample) |
| AT (1) | AT280419B (enExample) |
| BE (1) | BE717798A (enExample) |
| CH (1) | CH485319A (enExample) |
| ES (1) | ES355868A1 (enExample) |
| FR (1) | FR1572848A (enExample) |
| GB (1) | GB1199535A (enExample) |
| NL (1) | NL6709573A (enExample) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3784863A (en) * | 1973-01-11 | 1974-01-08 | Thorn Electrical Ind Ltd | Vapour discharge lamps |
| NL7906203A (nl) * | 1979-08-15 | 1981-02-17 | Philips Nv | Lagedrukkwikdampontladingslamp. |
| US4835442A (en) * | 1987-01-29 | 1989-05-30 | Kabushiki Kaisha Toshiba | Lamp for generating ultraviolet radiation |
| US10663116B2 (en) | 2015-02-26 | 2020-05-26 | Signify Holding B.V. | Lighting device with dispenser for a reactive substance |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2103039A (en) * | 1929-07-10 | 1937-12-21 | Gen Electric | Gaseous electric discharge device |
| DE684934C (de) * | 1936-12-05 | 1939-12-08 | Quarzlampen Gmbh | Elektrische Metalldampfbogenlampe mit festen, zu hoher Elektronenemission aktivierten Elektroden und einem Vorratsbehaelter fuer das zu verdampfende Metall |
| US3331977A (en) * | 1965-03-15 | 1967-07-18 | Westinghouse Electric Corp | High output discharge lamp with vapor pressure control means |
-
1967
- 1967-07-10 NL NL6709573A patent/NL6709573A/xx unknown
-
1968
- 1968-06-25 US US739830A patent/US3548240A/en not_active Expired - Lifetime
- 1968-07-05 GB GB32169/68A patent/GB1199535A/en not_active Expired
- 1968-07-08 CH CH1016968A patent/CH485319A/de not_active IP Right Cessation
- 1968-07-08 BE BE717798D patent/BE717798A/xx unknown
- 1968-07-08 AT AT654968A patent/AT280419B/de not_active IP Right Cessation
- 1968-07-08 ES ES355868A patent/ES355868A1/es not_active Expired
- 1968-07-10 FR FR1572848D patent/FR1572848A/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| US3548240A (en) | 1970-12-15 |
| NL6709573A (enExample) | 1969-01-14 |
| ES355868A1 (es) | 1970-03-16 |
| BE717798A (enExample) | 1969-01-08 |
| DE1764615B2 (de) | 1976-07-29 |
| DE1764615A1 (de) | 1971-09-09 |
| FR1572848A (enExample) | 1969-06-27 |
| GB1199535A (en) | 1970-07-22 |
| CH485319A (de) | 1970-01-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| AT292121B (de) | Niederdruck-Quecksilberdampf-Entladungslampe und Verfahren zu ihrer Herstellung | |
| CH483117A (de) | Elektrische Gasentladungslampe und Verfahren zu ihrer Herstellung | |
| DE1639111B2 (de) | Hochdruck natriumdampflampe | |
| AT300956B (de) | Quecksilberdampfniederdruckentladungslampe | |
| AT279735B (de) | Niederdruckquecksilberdampfentladungslampe | |
| AT297848B (de) | Hochdruck-Quecksilberdampf-Jodid-Entladungslampe | |
| DE1905646B2 (de) | Niederdruck quecksilberdampfentladungslampe | |
| AT280419B (de) | Niederdrucknatriumdampfentladungslampe und Verfahren zu ihrer Herstellung | |
| AT286450B (de) | Niederdruck-Quecksilberdampf-Entladungslampe | |
| AT286449B (de) | Längliche Hochdruck-Quecksilberdampfentladungslampe | |
| NL156861B (nl) | Hoge-druk xenonontladingslamp. | |
| CH461637A (de) | Niederdruck-Quecksilberdampfentladungslampe und Verfahren zu ihrer Herstellung | |
| AT287847B (de) | Niederdruck-Natriumdampf-Entladungslampe | |
| DE2059577B2 (de) | Niederdruck-natriumdampf-entladungslampe | |
| AT278969B (de) | Hochdruck-Quecksilberdampfentladungslampe und Verfahren zunihrer Herstellung | |
| AT264662B (de) | Hochdruckentladungslampe | |
| DK106874C (da) | Natriumdampudladningslampe. | |
| AT292846B (de) | Hochdruck-Quecksilberdampfentladungslampe | |
| AT274958B (de) | Niederdruckquecksilberdampfentladungslampe | |
| AT261060B (de) | Langgestreckte Glühlampe und Verfahren zu ihrer Herstellung | |
| AT271626B (de) | Niederdruckquecksilberdampfentladungslampe | |
| AT263935B (de) | Hochdruckentladungslampe | |
| AT266996B (de) | Hochdruckentladungslampe | |
| CA754711A (en) | High pressure discharge lamp | |
| CA768744A (en) | Discharge lamp manufacture |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| ELJ | Ceased due to non-payment of the annual fee |