AT278814B - Verfahren zur Herstellung neuer arylsubstituierter Piperazinylcarbonsäureanilide - Google Patents
Verfahren zur Herstellung neuer arylsubstituierter PiperazinylcarbonsäureanilideInfo
- Publication number
- AT278814B AT278814B AT96368A AT96368A AT278814B AT 278814 B AT278814 B AT 278814B AT 96368 A AT96368 A AT 96368A AT 96368 A AT96368 A AT 96368A AT 278814 B AT278814 B AT 278814B
- Authority
- AT
- Austria
- Prior art keywords
- substituted
- preparation
- acid anilides
- new aryl
- piperazinylcarboxylic
- Prior art date
Links
- YEQDVKYOHVLZPU-UHFFFAOYSA-N n-phenylpiperazine-1-carboxamide Chemical class C1CNCCN1C(=O)NC1=CC=CC=C1 YEQDVKYOHVLZPU-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/04—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms
- C07D295/14—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D295/145—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals with the ring nitrogen atoms and the carbon atoms with three bonds to hetero atoms attached to the same carbon chain, which is not interrupted by carbocyclic rings
- C07D295/15—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals with the ring nitrogen atoms and the carbon atoms with three bonds to hetero atoms attached to the same carbon chain, which is not interrupted by carbocyclic rings to an acyclic saturated chain
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEB0091744 | 1967-03-22 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| AT278814B true AT278814B (de) | 1970-02-10 |
Family
ID=6986011
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| AT96368A AT278814B (de) | 1967-03-22 | 1968-01-31 | Verfahren zur Herstellung neuer arylsubstituierter Piperazinylcarbonsäureanilide |
Country Status (9)
| Country | Link |
|---|---|
| AT (1) | AT278814B (enExample) |
| BE (1) | BE710768A (enExample) |
| CH (1) | CH507260A (enExample) |
| DE (1) | DE1670200A1 (enExample) |
| ES (1) | ES351896A1 (enExample) |
| FR (1) | FR1577338A (enExample) |
| GB (1) | GB1166595A (enExample) |
| NL (1) | NL6802185A (enExample) |
| SE (1) | SE343582B (enExample) |
Families Citing this family (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4202978A (en) * | 1978-02-08 | 1980-05-13 | Hoffmann-La Roche Inc. | (S)-1-[2-(4-(2-Hydroxy-s-(1-alkylaminopropoxy)phenylalkyl]-4-phenylpiperazines |
| US4336382A (en) * | 1979-09-06 | 1982-06-22 | Hoffmann-La Roche Inc. | 1,4-Disubstituted piperazine compounds |
| US4766125A (en) * | 1981-06-23 | 1988-08-23 | Janssen Pharmaceutica N.V. | N-aryl-piperazinealkanamides useful for protecting hearts from myocardial injury caused by ischaemia, anoxia or hypoxia |
| GB8303946D0 (en) * | 1983-02-12 | 1983-03-16 | Recordati Chem Pharm | Antihypertensive n-piperazinylalkanoylanilides |
| US5219855A (en) * | 1988-01-29 | 1993-06-15 | Mitsubishi Kasei Corporation | Anxiolytic drug |
| JP2712222B2 (ja) * | 1988-01-29 | 1998-02-10 | 三菱化学株式会社 | 抗不安薬 |
| US5364849A (en) * | 1989-04-22 | 1994-11-15 | John Wyeth & Brother, Limited | 1-[3 or 4-[1-[4-piperazinyl]]-2 arylpropionyl or butryl]-heterocyclic derivatives |
| US5382583A (en) * | 1989-04-22 | 1995-01-17 | John Wyeth & Brother, Limited | Piperazine derivatives |
| IT1254469B (it) * | 1992-02-25 | 1995-09-25 | Recordati Chem Pharm | Derivati benzopiranici e benzotiopiranici |
| US5474994A (en) * | 1992-05-26 | 1995-12-12 | Recordati S.A., Chemical And Pharmaceutical Company | Bicyclic heterocyclic derivatives having α1 -adrenergic and 5HT1A |
| US5605896A (en) * | 1992-02-25 | 1997-02-25 | Recordati S.A., Chemical And Pharmaceutical Company | Bicyclic heterocyclic derivatives having α1 adrenergic and 5HT1A activities |
| IT1258315B (it) * | 1992-04-10 | 1996-02-22 | Recordati Chem Pharm | Derivati del flavone |
-
1967
- 1967-03-22 DE DE19671670200 patent/DE1670200A1/de active Pending
-
1968
- 1968-01-31 AT AT96368A patent/AT278814B/de not_active IP Right Cessation
- 1968-01-31 CH CH149168A patent/CH507260A/de not_active IP Right Cessation
- 1968-02-14 BE BE710768D patent/BE710768A/xx unknown
- 1968-02-15 NL NL6802185A patent/NL6802185A/xx unknown
- 1968-02-21 GB GB850368A patent/GB1166595A/en not_active Expired
- 1968-03-13 SE SE329168A patent/SE343582B/xx unknown
- 1968-03-20 FR FR1577338D patent/FR1577338A/fr not_active Expired
- 1968-03-22 ES ES351896A patent/ES351896A1/es not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| ES351896A1 (es) | 1969-06-16 |
| BE710768A (enExample) | 1968-06-17 |
| DE1670200A1 (de) | 1972-03-02 |
| CH507260A (de) | 1971-05-15 |
| FR1577338A (enExample) | 1969-08-08 |
| GB1166595A (en) | 1969-10-08 |
| NL6802185A (enExample) | 1968-09-23 |
| SE343582B (enExample) | 1972-03-13 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CH516512A (de) | Verfahren zur Herstellung neuer substituierter 1-Phenoxy-2-aminopropane | |
| CH537410A (de) | Verfahren zur Herstellung neuer Thiazolylessigsäureester | |
| AT278814B (de) | Verfahren zur Herstellung neuer arylsubstituierter Piperazinylcarbonsäureanilide | |
| CH532556A (de) | Verfahren zur Herstellung neuer Hydrazon-N-dithiocarbonsäureester | |
| CH502341A (de) | Verfahren zur Herstellung Aniliden der Chinuclidin-2- und Chinuclidin-3-carbonsäure | |
| AT299916B (de) | Verfahren zur Herstellung neuer bis-Aminobenzoate | |
| AT289776B (de) | Verfahren zur Herstellung neuer 1-Carbamoyl-3-aroylpyrrolidine | |
| AT294854B (de) | Verfahren zur Herstellung neuer D-Glucofuranoside | |
| CH516591A (de) | Verfahren zur Herstellung neuer Thiazolopyrrolopyrimidine | |
| CH530988A (de) | Verfahren zur Herstellung neuer Diallylaminoalkanoylamide | |
| AT289840B (de) | Verfahren zur Herstellung neuer O-Alkyl-O-aryl-thiolphosphorsäureester | |
| CH489454A (de) | Verfahren zur Herstellung neuer a-Halogenxcyclobutanone | |
| AT278834B (de) | Verfahren zur Herstellung neuer Benzotriazinone | |
| AT305253B (de) | Verfahren zur Herstellung neuer Diphenoxyacetamide | |
| CH510660A (de) | Verfahren zur Herstellung neuer Glucofuranoside | |
| AT319914B (de) | Verfahren zur Herstellung neuer Triazapentadiene | |
| CH529735A (de) | Verfahren zur Herstellung neuer 3-Oxo-A-nor-B-homopregnadiene | |
| AT286960B (de) | Verfahren zur Herstellung der d-trans-Pyrethrinsäure | |
| CH513131A (de) | Verfahren zur Herstellung neuer Aminobenzocycloalkylnitrile | |
| AT280502B (de) | Verfahren zur Herstellung neuer 3-Oxogonatriene | |
| AT286511B (de) | Verfahren zur Herstellung neuer 4-Imino-19-nor-A-homo-steroid-triene | |
| CH535785A (de) | Verfahren zur Herstellung neuer Hydrazino-pyrimidine | |
| CH541575A (de) | Verfahren zur Herstellung neuer 1-Aza-9-oxafluorene | |
| AT281828B (de) | Verfahren zur Herstellung neuer Furan-2-carbonsäureester des 5-Nitro-8-hydroxychinolins | |
| CH518259A (de) | Verfahren zur Herstellung neuer substituierter 1-Phenoxy-2-aminoalkane |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| ELJ | Ceased due to non-payment of the annual fee |