AT263938B - Natriumdampfentladungslampe - Google Patents
NatriumdampfentladungslampeInfo
- Publication number
- AT263938B AT263938B AT1039666A AT1039666A AT263938B AT 263938 B AT263938 B AT 263938B AT 1039666 A AT1039666 A AT 1039666A AT 1039666 A AT1039666 A AT 1039666A AT 263938 B AT263938 B AT 263938B
- Authority
- AT
- Austria
- Prior art keywords
- discharge lamp
- sodium discharge
- sodium
- lamp
- discharge
- Prior art date
Links
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 title 1
- 229910052708 sodium Inorganic materials 0.000 title 1
- 239000011734 sodium Substances 0.000 title 1
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01J—ELECTRIC DISCHARGE TUBES OR DISCHARGE LAMPS
- H01J61/00—Gas-discharge or vapour-discharge lamps
- H01J61/02—Details
- H01J61/30—Vessels; Containers
- H01J61/35—Vessels; Containers provided with coatings on the walls thereof; Selection of materials for the coatings
Applications Claiming Priority (1)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
DEN27625A DE1260627B (de) | 1965-11-13 | 1965-11-13 | Natriumdampfentladungslampe |
Publications (1)
Publication Number | Publication Date |
---|---|
AT263938B true AT263938B (de) | 1968-08-12 |
Family
ID=7344332
Family Applications (1)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
AT1039666A AT263938B (de) | 1965-11-13 | 1966-11-10 | Natriumdampfentladungslampe |
Country Status (11)
Country | Link |
---|---|
US (1) | US3400288A (OSRAM) |
AT (1) | AT263938B (OSRAM) |
BE (1) | BE689623A (OSRAM) |
CH (1) | CH460948A (OSRAM) |
DE (1) | DE1260627B (OSRAM) |
DK (1) | DK120348B (OSRAM) |
ES (1) | ES333267A1 (OSRAM) |
FR (1) | FR1503022A (OSRAM) |
GB (1) | GB1140613A (OSRAM) |
NL (1) | NL155128B (OSRAM) |
NO (1) | NO118500B (OSRAM) |
Families Citing this family (21)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
US3546520A (en) * | 1967-12-20 | 1970-12-08 | Bell Telephone Labor Inc | Vidicon target comprising infrared absorber |
US3932783A (en) * | 1969-01-02 | 1976-01-13 | Sylvania Electric Products Inc. | Fluorescent lamp containing indium oxide |
US3662203A (en) * | 1969-05-20 | 1972-05-09 | Patent Treuhand Ges Fuer Elektrische Gluehlampen Mbh | High pressure saturated metal vapor, preferably sodium or metal halide vapor discharge lamp |
US3662208A (en) * | 1970-01-27 | 1972-05-09 | Tokyo Shibaura Electric Co | Reflector type incandescent lamps |
US3949259A (en) * | 1973-08-17 | 1976-04-06 | U.S. Philips Corporation | Light-transmitting, thermal-radiation reflecting filter |
NL7405071A (nl) * | 1974-04-16 | 1975-10-20 | Philips Nv | Gloeilamp met infrarood filter. |
US3931536A (en) * | 1974-07-15 | 1976-01-06 | Gte Sylvania Incorporated | Efficiency arc discharge lamp |
NL166818C (nl) * | 1974-11-14 | 1981-09-15 | Philips Nv | Lagedruknatriumdampontladingslamp. |
US4109175A (en) * | 1976-03-19 | 1978-08-22 | Matsushita Electronics Corporation | High pressure sodium vapor discharge lamp |
US4140385A (en) * | 1976-03-22 | 1979-02-20 | Xerox Corporation | Low pressure metal or metal halide lamps for photocopying applications |
NL180464C (nl) * | 1976-10-29 | 1987-02-16 | Philips Nv | Lagedruknatriumdampontladingslamp. |
JPS5473818A (en) * | 1977-11-24 | 1979-06-13 | Tokyo Denshi Kagaku Kk | Coating solution for forming transparent electric conductive layer and method of coating same |
US4467238A (en) * | 1981-09-03 | 1984-08-21 | General Electric Company | High-pressure sodium lamp with improved IR reflector |
US4391743A (en) * | 1981-11-30 | 1983-07-05 | Nippon Soda Company Limited | Composition for depositing metallic oxide film coatings |
US4490649A (en) * | 1982-10-20 | 1984-12-25 | General Electric Company | Thermal baffle inside a discharge lamp |
WO1986002775A1 (en) * | 1984-10-23 | 1986-05-09 | Duro-Test Corporation | Variable index film for transparent heat mirrors |
US4678960A (en) * | 1985-08-01 | 1987-07-07 | General Electric Company | Metallic halide electric discharge lamps |
DE10204691C1 (de) * | 2002-02-06 | 2003-04-24 | Philips Corp Intellectual Pty | Quecksilberfreie Hochdruckgasentladungslampe und Beleuchtungseinheit mit einer solchen Hochdruckgasentladungslampe |
US20080048541A1 (en) * | 2004-12-20 | 2008-02-28 | Sumrall Ernest N | Polymer-thermal shield for ultra-violet lamp |
CN102568978B (zh) * | 2012-01-18 | 2014-08-13 | 山东布莱特辉煌新能源有限公司 | 一种纳米金属氧化物的使用方法 |
KR20190045154A (ko) * | 2016-06-30 | 2019-05-02 | 예히 오아 라이트 크리에이션 리미티드 | 고효율 조명 시스템 |
Family Cites Families (3)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
US2564708A (en) * | 1947-09-03 | 1951-08-21 | Corning Glass Works | Heat screen |
NL269925A (OSRAM) * | 1961-10-04 | |||
US3295002A (en) * | 1963-12-27 | 1966-12-27 | Gen Electric | Light transmitting electrode including nu-type semiconductive in2o3 |
-
1965
- 1965-11-13 DE DEN27625A patent/DE1260627B/de not_active Withdrawn
-
1966
- 1966-11-08 US US592859A patent/US3400288A/en not_active Expired - Lifetime
- 1966-11-08 NL NL666615717A patent/NL155128B/xx not_active IP Right Cessation
- 1966-11-10 GB GB50454/66A patent/GB1140613A/en not_active Expired
- 1966-11-10 DK DK584266AA patent/DK120348B/da unknown
- 1966-11-10 CH CH1623866A patent/CH460948A/de unknown
- 1966-11-10 BE BE689623D patent/BE689623A/xx unknown
- 1966-11-10 AT AT1039666A patent/AT263938B/de active
- 1966-11-10 NO NO165531A patent/NO118500B/no unknown
- 1966-11-11 ES ES0333267A patent/ES333267A1/es not_active Expired
- 1966-11-14 FR FR83513A patent/FR1503022A/fr not_active Expired
Also Published As
Publication number | Publication date |
---|---|
NL155128B (nl) | 1977-11-15 |
FR1503022A (fr) | 1967-11-24 |
GB1140613A (en) | 1969-01-22 |
BE689623A (OSRAM) | 1967-05-10 |
DK120348B (da) | 1971-05-17 |
ES333267A1 (es) | 1967-07-16 |
DE1260627B (de) | 1968-02-08 |
US3400288A (en) | 1968-09-03 |
NO118500B (OSRAM) | 1970-01-05 |
CH460948A (de) | 1968-08-15 |
NL6615717A (OSRAM) | 1967-05-16 |
Similar Documents
Publication | Publication Date | Title |
---|---|---|
AT263938B (de) | Natriumdampfentladungslampe | |
AT252388B (de) | Leuchte | |
FR1512244A (fr) | Luminaire | |
FR1501063A (fr) | Perfectionnements aux ballasts de lampes à décharge | |
AT280370B (de) | Leuchtschirm | |
CH443488A (de) | Gasentladungslampe | |
AT242803B (de) | Natriumdampfentladungslampe | |
AT269284B (de) | Leuchte | |
NL151212B (nl) | Lagedrukkwikdampontladingslamp. | |
AT264662B (de) | Hochdruckentladungslampe | |
AT261746B (de) | Glimmentladungslampe | |
AT286446B (de) | Leuchte | |
AT330295B (de) | Entladungslampe | |
FR1492072A (fr) | Luminaire | |
AT274137B (de) | Natriumdampfentladungslampe | |
CH490205A (de) | Leuchte | |
AT268451B (de) | Jodlampe | |
FR1529681A (fr) | Luminaire | |
FR1489939A (fr) | Abat-jour | |
ES111407Y (es) | Lámpara | |
FI37785A (fi) | Valaisin | |
CH430874A (de) | Quecksilberdampf-Halogen-Entladungslampe | |
FR1477170A (fr) | Abat-jour | |
AT242801B (de) | Leuchte | |
AT249801B (de) | Natriumdampf-Entladungslampe |