AT262994B - Verfahren zur Herstellung eines neuen Phenylbutazonderivates - Google Patents
Verfahren zur Herstellung eines neuen PhenylbutazonderivatesInfo
- Publication number
- AT262994B AT262994B AT827166A AT827166A AT262994B AT 262994 B AT262994 B AT 262994B AT 827166 A AT827166 A AT 827166A AT 827166 A AT827166 A AT 827166A AT 262994 B AT262994 B AT 262994B
- Authority
- AT
- Austria
- Prior art keywords
- phenylbutazone
- derivative
- preparation
- new
- phenylbutazone derivative
- Prior art date
Links
- VYMDGNCVAMGZFE-UHFFFAOYSA-N phenylbutazonum Chemical class O=C1C(CCCC)C(=O)N(C=2C=CC=CC=2)N1C1=CC=CC=C1 VYMDGNCVAMGZFE-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D231/00—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings
- C07D231/02—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings
- C07D231/10—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D231/14—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D231/28—Two oxygen or sulfur atoms
- C07D231/30—Two oxygen or sulfur atoms attached in positions 3 and 5
- C07D231/32—Oxygen atoms
- C07D231/34—Oxygen atoms with only hydrogen atoms or radicals containing only hydrogen and carbon atoms, attached in position 4
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR30820A FR5404M (enFirst) | 1965-09-08 | 1965-09-08 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| AT262994B true AT262994B (de) | 1968-07-10 |
Family
ID=8588003
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| AT827166A AT262994B (de) | 1965-09-08 | 1966-09-01 | Verfahren zur Herstellung eines neuen Phenylbutazonderivates |
Country Status (10)
| Country | Link |
|---|---|
| US (2) | US3457273A (enFirst) |
| AT (1) | AT262994B (enFirst) |
| BE (1) | BE686133A (enFirst) |
| BR (1) | BR6682613D0 (enFirst) |
| CH (1) | CH460789A (enFirst) |
| DE (1) | DE1670378A1 (enFirst) |
| FR (1) | FR5404M (enFirst) |
| GB (1) | GB1091109A (enFirst) |
| NL (1) | NL6612592A (enFirst) |
| SE (1) | SE306321B (enFirst) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3760080A (en) * | 1969-12-05 | 1973-09-18 | Ciba Geigy Corp | Phenylbutazone-sodium-monoglycerate in the treatment of inflammation |
| US3876641A (en) * | 1973-02-21 | 1975-04-08 | Realisations Scient En Abrege | Salt of n-methyl-piperazine and 1,2-diphenyl-3,5-dioxo-4-n-butyl pyrazolidine |
| US3994910A (en) * | 1973-03-30 | 1976-11-30 | Antonia Gallardo, S.A. | Derivatives of 1,2-diphenyl-3,5-dioxo-4-N-butyl-pyrazolidine and process for making same |
| DE2436882A1 (de) * | 1974-07-29 | 1976-02-19 | Schering Ag | Neue oxyphenylbutazon-derivate und ihre herstellung |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2562830A (en) * | 1951-07-31 | Derivatives | ||
| US569415A (en) * | 1896-10-13 | Werke | ||
| US2541651A (en) * | 1951-02-13 | Gentisic acid compounds of | ||
| US1068083A (en) * | 1912-03-29 | 1913-07-22 | Leon Givaudan | Process of manufacturing new pharmaceutical preparations. |
| US1871950A (en) * | 1925-04-23 | 1932-08-16 | Winthrop Chem Co Inc | The trichloro ethyl urethane salt of 4-dimethyl amino-1-phenyl-2.3-dimethyl pyrazolone |
| US2345385A (en) * | 1938-10-13 | 1944-03-28 | Schering Corp | Pyrazolone salts of sulphonamides |
| US2887474A (en) * | 1957-02-11 | 1959-05-19 | Abbott Lab | Addition compounds of piperazinediones |
| US3202675A (en) * | 1961-10-26 | 1965-08-24 | Sterling Drug Inc | 1-benzyl-2, 5-bis (chloromethyl) pyrrolidine and acid-addition salts thereof |
-
1965
- 1965-09-08 FR FR30820A patent/FR5404M/fr not_active Expired
-
1966
- 1966-08-26 GB GB38436/66A patent/GB1091109A/en not_active Expired
- 1966-08-26 US US575248A patent/US3457273A/en not_active Expired - Lifetime
- 1966-08-27 DE DE19661670378 patent/DE1670378A1/de active Pending
- 1966-08-29 BE BE686133D patent/BE686133A/xx not_active IP Right Cessation
- 1966-08-29 CH CH1244966A patent/CH460789A/fr unknown
- 1966-09-01 AT AT827166A patent/AT262994B/de active
- 1966-09-05 BR BR182613/66A patent/BR6682613D0/pt unknown
- 1966-09-07 NL NL6612592A patent/NL6612592A/xx unknown
- 1966-09-07 SE SE12031/66A patent/SE306321B/xx unknown
-
1968
- 1968-03-06 US US729851*A patent/US3491190A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| DE1670378A1 (de) | 1970-08-06 |
| US3491190A (en) | 1970-01-20 |
| NL6612592A (enFirst) | 1967-03-09 |
| BE686133A (enFirst) | 1967-02-28 |
| US3457273A (en) | 1969-07-22 |
| FR5404M (enFirst) | 1967-09-25 |
| BR6682613D0 (pt) | 1973-12-27 |
| GB1091109A (en) | 1967-11-15 |
| SE306321B (enFirst) | 1968-11-25 |
| CH460789A (fr) | 1968-08-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CH488705A (de) | Verfahren zur Herstellung eines neuen Tetrahydroazepinderivates | |
| AT286291B (de) | Verfahren zur herstellung eines neuen 2-diazo-1-naphthol-5-sulfonamids | |
| CH498122A (de) | Verfahren zur Herstellung eines neuen Tetrahydroazepinderivates | |
| CH427803A (de) | Verfahren zur Herstellung eines neuen Isoxazolderivates | |
| CH464957A (de) | Verfahren zur Herstellung eines neuen Glucosids | |
| AT305491B (de) | Verfahren zur Herstellung eines neuen Kombinationspräparates | |
| CH465771A (de) | Verfahren zur Herstellung eines neuen Antibioticums | |
| AT279816B (de) | Verfahren zur Herstellung eines neuen Dekapeptids | |
| CH439274A (de) | Verfahren zur Herstellung eines Cyclopentenonderivates | |
| AT285065B (de) | Verfahren zur Herstellung eines neuen Pentacosapeptids | |
| CH484172A (de) | Verfahren zur Herstellung eines neuen Oxazolidinons | |
| AT262994B (de) | Verfahren zur Herstellung eines neuen Phenylbutazonderivates | |
| CH481097A (de) | Verfahren zur Herstellung eines neuen Glucosids | |
| CH469089A (de) | Verfahren zur Herstellung eines neuen Antibiotikums | |
| CH471782A (de) | Verfahren zur Herstellung eines neuen, substituierten 2,3-Pyridindiols | |
| AT267063B (de) | Verfahren zur Herstellung eines neuen Antibioticums | |
| AT298681B (de) | Verfahren zur Herstellung eines neuen Glucosids | |
| AT262260B (de) | Verfahren zur Herstellung eines neuen Thiamphenikol-Derivates | |
| CH517762A (de) | Verfahren zur Herstellung eines neuen D-6-Methylergolenderivates | |
| CH465608A (de) | Verfahren zur Herstellung eines neuen Bis-pyridyl-methyl-disulfids | |
| AT254208B (de) | Verfahren zur Herstellung eines neuen Harnstoffderivates | |
| AT297920B (de) | Verfahren zur Herstellung eines Arzneimittels | |
| AT256876B (de) | Verfahren zur Herstellung eines neuen Thiocarbanilids | |
| CH442302A (de) | Verfahren zur Herstellung eines neuen Indolderivates | |
| CH459190A (de) | Verfahren zur Herstellung eines neuen Cardenolids |