AT258265B - Verfahren zur Herstellung von 5-(3'-Hydroxypropyl)-5H-dibenzo[a,d]cyclohepten - Google Patents
Verfahren zur Herstellung von 5-(3'-Hydroxypropyl)-5H-dibenzo[a,d]cycloheptenInfo
- Publication number
- AT258265B AT258265B AT569963A AT569963A AT258265B AT 258265 B AT258265 B AT 258265B AT 569963 A AT569963 A AT 569963A AT 569963 A AT569963 A AT 569963A AT 258265 B AT258265 B AT 258265B
- Authority
- AT
- Austria
- Prior art keywords
- cycloheptene
- dibenzo
- hydroxypropyl
- preparation
- Prior art date
Links
- OLKUTMBZOHLAFL-UHFFFAOYSA-N 3-(11h-dibenzo[1,2-a:1',2'-e][7]annulen-11-yl)propan-1-ol Chemical compound C1=CC2=CC=CC=C2C(CCCO)C2=CC=CC=C21 OLKUTMBZOHLAFL-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C57/00—Unsaturated compounds having carboxyl groups bound to acyclic carbon atoms
- C07C57/46—Unsaturated compounds having carboxyl groups bound to acyclic carbon atoms containing six-membered aromatic rings and other rings, e.g. cyclohexylphenylacetic acid
- C07C57/50—Unsaturated compounds having carboxyl groups bound to acyclic carbon atoms containing six-membered aromatic rings and other rings, e.g. cyclohexylphenylacetic acid containing condensed ring systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C255/00—Carboxylic acid nitriles
- C07C255/45—Carboxylic acid nitriles having cyano groups bound to carbon atoms of rings other than six-membered aromatic rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US210832A US3317582A (en) | 1962-07-18 | 1962-07-18 | Dibenzocycloheptene compounds and processes for preparing the same |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| AT258265B true AT258265B (de) | 1967-11-10 |
Family
ID=22784433
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| AT569963A AT258265B (de) | 1962-07-18 | 1963-07-16 | Verfahren zur Herstellung von 5-(3'-Hydroxypropyl)-5H-dibenzo[a,d]cyclohepten |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US3317582A (enFirst) |
| AT (1) | AT258265B (enFirst) |
| BE (1) | BE635014A (enFirst) |
| CH (1) | CH447147A (enFirst) |
| DE (1) | DE1232956B (enFirst) |
| DK (1) | DK122655B (enFirst) |
| ES (1) | ES290184A1 (enFirst) |
| FR (1) | FR1531324A (enFirst) |
| GB (2) | GB1044422A (enFirst) |
| NL (1) | NL295433A (enFirst) |
| SE (4) | SE303285B (enFirst) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3366660A (en) * | 1966-05-23 | 1968-01-30 | American Home Prod | Dibenzo cycloheptene thioiminoesters |
| US3742000A (en) * | 1969-06-03 | 1973-06-26 | Grace W R & Co | Imidoether and amidine derivatives of substituted fatty amides |
| JPS5541227B2 (enFirst) * | 1972-10-24 | 1980-10-22 | ||
| US3979430A (en) * | 1975-09-08 | 1976-09-07 | Syntex (U.S.A.) Inc. | Solvolytic process for the preparation of 2-(5H-dibenzo[a,d]cyclohepten-5-on-2-yl)acetic, propionic and butyric acids |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2185141A (en) * | 1937-12-06 | 1939-12-26 | Dow Chemical Co | Preparation of beta-phenylethyl alcohol |
| US2151517A (en) * | 1938-07-21 | 1939-03-21 | Kamlet Jonas | Preparation of arylnitroalkanols |
| US2607794A (en) * | 1949-04-09 | 1952-08-19 | Merck & Co Inc | Process of preparing 2, 2-diphenyl-3-methyl-4-dimethylamino-butyronitrile |
| US2642455A (en) * | 1949-07-08 | 1953-06-16 | Socony Vacuum Oil Co Inc | 2-ethyl-hexanol-1 esters of the friedel-crafts maleic anhydride-aromatic hydrocarbon adducts and process |
| US2610979A (en) * | 1949-10-29 | 1952-09-16 | Gen Aniline & Film Corp | Process for preparing amino aroyl acetonitriles |
| US2726262A (en) * | 1950-08-24 | 1955-12-06 | Bergwerksverband Gmbh | Process for the preparation and purification of monocyclic aromatic polycarboxylic acids or mixtures thereof |
| US2748162A (en) * | 1952-03-31 | 1956-05-29 | Dow Chemical Co | Preparation of phthalaldehydic acid from pentachloroxylene |
| US2788365A (en) * | 1953-01-15 | 1957-04-09 | Searle & Co | Quaternary ammonium salts of dialkylaminoalkyl esters of 9, 10-dihydroanthracene-9-carboxylic acid and the preparation thereof |
-
1962
- 1962-07-18 US US210832A patent/US3317582A/en not_active Expired - Lifetime
-
1963
- 1963-07-04 GB GB35024/65A patent/GB1044422A/en not_active Expired
- 1963-07-04 GB GB26548/63A patent/GB1044421A/en not_active Expired
- 1963-07-08 SE SE7579/63A patent/SE303285B/xx unknown
- 1963-07-08 SE SE7381/65A patent/SE303288B/xx unknown
- 1963-07-08 SE SE7379/65A patent/SE303287B/xx unknown
- 1963-07-08 SE SE7380/65A patent/SE302962B/xx unknown
- 1963-07-10 CH CH858363A patent/CH447147A/de unknown
- 1963-07-13 ES ES290184A patent/ES290184A1/es not_active Expired
- 1963-07-16 DE DEM57517A patent/DE1232956B/de active Pending
- 1963-07-16 AT AT569963A patent/AT258265B/de active
- 1963-07-16 BE BE635014D patent/BE635014A/xx unknown
- 1963-07-17 NL NL295433D patent/NL295433A/xx unknown
- 1963-07-17 DK DK342163AA patent/DK122655B/da unknown
- 1963-07-17 FR FR941795A patent/FR1531324A/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| SE303287B (enFirst) | 1968-08-26 |
| NL295433A (enFirst) | 1965-04-26 |
| BE635014A (enFirst) | 1964-01-16 |
| GB1044421A (en) | 1966-09-28 |
| US3317582A (en) | 1967-05-02 |
| SE303288B (enFirst) | 1968-08-26 |
| DE1232956B (de) | 1967-01-26 |
| ES290184A1 (es) | 1963-08-16 |
| SE303285B (enFirst) | 1968-08-26 |
| SE302962B (enFirst) | 1968-08-12 |
| CH447147A (de) | 1967-11-30 |
| GB1044422A (en) | 1966-09-28 |
| DK122655B (da) | 1972-03-27 |
| FR1531324A (fr) | 1968-07-05 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CH453340A (de) | Verfahren zur Herstellung von trans-Dimethylolcyclohexan-1,4 | |
| AT244343B (de) | Verfahren zur Herstellung von neuen Dibenzo [a, d] cycloheptadienderivaten | |
| AT238720B (de) | Verfahren zur Herstellung von neuen 6,11-Dihydro-dibenz(b,e)-thiepin-Derivaten | |
| AT258265B (de) | Verfahren zur Herstellung von 5-(3'-Hydroxypropyl)-5H-dibenzo[a,d]cyclohepten | |
| CH476078A (de) | Verfahren zur Herstellung von 14-Acylamino-benz-(g)-naphth-(2,3-b-)indolizin-8,13-dion-Pigmenten | |
| AT277282B (de) | Verfahren zur Herstellung von neuen N,N'-Diglycidyl-bis-hydantoinyl-verbindungen | |
| AT246140B (de) | Verfahren zur Herstellung von neuen 5-[1'-(Piperidyl-2")-alkyliden]-5 H-dibenzo[a, d] cyclohepten-Derivaten | |
| CH476743A (de) | Verfahren zur Herstellung von Amidinen der Dibenzo (b,e) (1,4)-diazepin-Reihe | |
| CH446355A (de) | Verfahren zur Herstellung von neuen substituierten 5,6-Dihydro-1,3,4-oxadiazinen | |
| AT247308B (de) | Verfahren zur Herstellung von neuen basisch substituierten Naphthalin-(1,4,5,8)-tetracarbonsäurediimiden | |
| CH466250A (de) | Verfahren zur Herstellung von a,a,a',a'-Tetramethyl-xylylen-dicarbinolen | |
| AT235257B (de) | Verfahren zur Herstellung von Β, Β'-Dicyandiäthyläther | |
| AT250953B (de) | Verfahren zur Herstellung von neuen tertiärer Carbamyltriazole | |
| CH379507A (de) | Verfahren zur Herstellung von neuen 10-(1'-Hydroxyalkyl-pyrrolidyl-(3')-methyl)-phenothiazinen | |
| CH438337A (de) | Verfahren zur Herstellung von 1,3-Dihydro-3-hydroxy-2H-1,4-benzodiazepin-2-onen | |
| CH408013A (de) | Verfahren zur Herstellung von N-Trichlormethylmercapto-6 H-dibenzo (c,e) (1,2) thiazin-5,5-dioxyden | |
| CH430704A (de) | Verfahren zur Herstellung von 4,7-Dihalogen-1-methylindan-3-onen | |
| AT254165B (de) | Verfahren zur Herstellung von 5-substituierten 5H-Dibenzo[a,d]cycloheptenen und ihren Salzen | |
| AT248445B (de) | Verfahren zur Herstellung von neuen 1, 2-Dimehtylhexahydropyridazinen | |
| AT245571B (de) | Verfahren zur Herstellung von neuen Piperidinverbindungen | |
| CH426872A (de) | Verfahren zur Herstellung von neuen 6,11-Dihydro-dibenz(b,e)thiepinderivaten | |
| CH512446A (de) | Verfahren zur Herstellung von 5H-Dibenzo(a,d)cycloheptenen | |
| CH456585A (de) | Verfahren zur Herstellung von 8-(2',6',6'-Trimethyl-4'-methoxy-cyclohexen-(1')-yl-(1'))-2,6-dimethyl-octatrien-(2,4,6)-al-(1) | |
| AT241475B (de) | Verfahren zur Herstellung von neuen 3-Azabicyclo-(3, 2, 2)-nonan-Derivaten | |
| AT295493B (de) | Verfahren zur Herstellung von neuen 11-Hydroxy- oder 11-Acyloxy-10,11-dihydro-5,10-methano-5H-dibenzo[a,d]cycloheptenverbindungen |