ZA804539B - Monacolin k derivatives - Google Patents
Monacolin k derivativesInfo
- Publication number
- ZA804539B ZA804539B ZA00804539A ZA804539A ZA804539B ZA 804539 B ZA804539 B ZA 804539B ZA 00804539 A ZA00804539 A ZA 00804539A ZA 804539 A ZA804539 A ZA 804539A ZA 804539 B ZA804539 B ZA 804539B
- Authority
- ZA
- South Africa
- Prior art keywords
- monacolin
- derivatives
- Prior art date
Links
- PCZOHLXUXFIOCF-BXMDZJJMSA-N lovastatin Chemical class C([C@H]1[C@@H](C)C=CC2=C[C@H](C)C[C@@H]([C@H]12)OC(=O)[C@@H](C)CC)C[C@@H]1C[C@@H](O)CC(=O)O1 PCZOHLXUXFIOCF-BXMDZJJMSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C59/00—Compounds having carboxyl groups bound to acyclic carbon atoms and containing any of the groups OH, O—metal, —CHO, keto, ether, groups, groups, or groups
- C07C59/40—Unsaturated compounds
- C07C59/42—Unsaturated compounds containing hydroxy or O-metal groups
- C07C59/46—Unsaturated compounds containing hydroxy or O-metal groups containing rings other than six-membered aromatic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C69/00—Esters of carboxylic acids; Esters of carbonic or haloformic acids
- C07C69/66—Esters of carboxylic acids having esterified carboxylic groups bound to acyclic carbon atoms and having any of the groups OH, O—metal, —CHO, keto, ether, acyloxy, groups, groups, or in the acid moiety
- C07C69/73—Esters of carboxylic acids having esterified carboxylic groups bound to acyclic carbon atoms and having any of the groups OH, O—metal, —CHO, keto, ether, acyloxy, groups, groups, or in the acid moiety of unsaturated acids
- C07C69/732—Esters of carboxylic acids having esterified carboxylic groups bound to acyclic carbon atoms and having any of the groups OH, O—metal, —CHO, keto, ether, acyloxy, groups, groups, or in the acid moiety of unsaturated acids of unsaturated hydroxy carboxylic acids
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Preparation Of Compounds By Using Micro-Organisms (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP9581479A JPS5621594A (en) | 1979-07-27 | 1979-07-27 | Mb-530b carboxylic acid metal salt and its preparation |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| ZA804539B true ZA804539B (en) | 1981-08-26 |
Family
ID=14147884
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| ZA00804539A ZA804539B (en) | 1979-07-27 | 1980-07-28 | Monacolin k derivatives |
Country Status (3)
| Country | Link |
|---|---|
| JP (1) | JPS5621594A (en) |
| BE (1) | BE884518A (en) |
| ZA (1) | ZA804539B (en) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS6056600U (en) * | 1983-09-26 | 1985-04-20 | 井上エムテ−ピ−株式会社 | Decorative resin mold |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5925599B2 (en) * | 1979-02-20 | 1984-06-19 | 三共株式会社 | New physiologically active substance monacolin K and its production method |
-
1979
- 1979-07-27 JP JP9581479A patent/JPS5621594A/en active Pending
-
1980
- 1980-07-28 BE BE0/201560A patent/BE884518A/en not_active IP Right Cessation
- 1980-07-28 ZA ZA00804539A patent/ZA804539B/en unknown
Also Published As
| Publication number | Publication date |
|---|---|
| JPS5621594A (en) | 1981-02-28 |
| BE884518A (en) | 1981-01-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| GB2055813B (en) | Aminoalkylbenzene derivatives | |
| GB2054560B (en) | Benzylimdiazole derivatives | |
| GB2058765B (en) | Deformyltylosin derivatives | |
| ZA803076B (en) | Alkyl-ketohexopyranoside derivatives | |
| NZ193801A (en) | 7-amino-cephalosporin derivatives | |
| AU6083980A (en) | Monacolin k derivatives | |
| NZ193799A (en) | 3-vinyl-cephalosporin derivatives | |
| GB2046734B (en) | 7-(-oximino-pyrazolyl(-acetamido)-cephen derivatives | |
| GB2055818B (en) | 3-methyleneazetidine derivatives | |
| GB2056452B (en) | Halovincamone derivatives | |
| MY8500273A (en) | Pyrrlidine derivatives | |
| GB2065111B (en) | Decaprenylamine derivatives | |
| GB2052493B (en) | Imidazobenzodiazepine derivatives | |
| GB2062464B (en) | Eburnamenine derivatives | |
| GB2053899B (en) | Terahydrophthalamide derivatives | |
| GB2055368B (en) | E-homoeburnane derivatives | |
| MY8400201A (en) | Isopropylamino-pyrimidine derivatives | |
| GB2050377B (en) | Pyrazinoquinoxaline derivatives | |
| GB2059954B (en) | 1-phenethylimidazole derivatives | |
| GB2043064B (en) | Oximidazoquinoxaline derivatives | |
| ZA804539B (en) | Monacolin k derivatives | |
| GB2065110B (en) | Decaprenylamine derivatives | |
| GB2065109B (en) | Decaprenylamine derivatives | |
| GB2042508B (en) | 3-alkoxy-penem derivatives | |
| ZA805651B (en) | Pyridazopyridazine derivatives |