ZA7670B - Blasting composition containing calcium nitrate and sulfur - Google Patents
Blasting composition containing calcium nitrate and sulfurInfo
- Publication number
- ZA7670B ZA7670B ZA00760070A ZA7670A ZA7670B ZA 7670 B ZA7670 B ZA 7670B ZA 00760070 A ZA00760070 A ZA 00760070A ZA 7670 A ZA7670 A ZA 7670A ZA 7670 B ZA7670 B ZA 7670B
- Authority
- ZA
- South Africa
- Prior art keywords
- sulfur
- composition containing
- calcium nitrate
- containing calcium
- blasting composition
- Prior art date
Links
- ZCCIPPOKBCJFDN-UHFFFAOYSA-N calcium nitrate Chemical compound [Ca+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O ZCCIPPOKBCJFDN-UHFFFAOYSA-N 0.000 title 2
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 title 1
- 238000005422 blasting Methods 0.000 title 1
- 239000011593 sulfur Substances 0.000 title 1
- 229910052717 sulfur Inorganic materials 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C06—EXPLOSIVES; MATCHES
- C06B—EXPLOSIVES OR THERMIC COMPOSITIONS; MANUFACTURE THEREOF; USE OF SINGLE SUBSTANCES AS EXPLOSIVES
- C06B47/00—Compositions in which the components are separately stored until the moment of burning or explosion, e.g. "Sprengel"-type explosives; Suspensions of solid component in a normally non-explosive liquid phase, including a thickened aqueous phase
- C06B47/14—Compositions in which the components are separately stored until the moment of burning or explosion, e.g. "Sprengel"-type explosives; Suspensions of solid component in a normally non-explosive liquid phase, including a thickened aqueous phase comprising a solid component and an aqueous phase
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Paints Or Removers (AREA)
- Air Bags (AREA)
- Solid Fuels And Fuel-Associated Substances (AREA)
- Compounds Of Alkaline-Earth Elements, Aluminum Or Rare-Earth Metals (AREA)
- Treating Waste Gases (AREA)
- Compositions Of Macromolecular Compounds (AREA)
- Confectionery (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/542,280 US4032375A (en) | 1975-01-20 | 1975-01-20 | Blasting composition containing calcium nitrate and sulfur |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| ZA7670B true ZA7670B (en) | 1976-12-29 |
Family
ID=24163108
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| ZA00760070A ZA7670B (en) | 1975-01-20 | 1976-01-06 | Blasting composition containing calcium nitrate and sulfur |
Country Status (22)
| Country | Link |
|---|---|
| US (1) | US4032375A (show.php) |
| JP (1) | JPS5813519B2 (show.php) |
| AT (1) | AT343031B (show.php) |
| BE (1) | BE837565A (show.php) |
| BR (1) | BR7600306A (show.php) |
| CA (1) | CA1069312A (show.php) |
| CH (1) | CH618954A5 (show.php) |
| CS (1) | CS200185B2 (show.php) |
| DE (1) | DE2601162C2 (show.php) |
| ES (1) | ES444352A1 (show.php) |
| FR (1) | FR2297822A1 (show.php) |
| GB (1) | GB1525991A (show.php) |
| IE (1) | IE42393B1 (show.php) |
| IN (1) | IN145385B (show.php) |
| IT (1) | IT1052941B (show.php) |
| LU (1) | LU74201A1 (show.php) |
| NL (1) | NL7600540A (show.php) |
| NO (1) | NO142344C (show.php) |
| PL (1) | PL102552B1 (show.php) |
| SE (1) | SE418494B (show.php) |
| SU (1) | SU698527A3 (show.php) |
| ZA (1) | ZA7670B (show.php) |
Families Citing this family (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4322258A (en) * | 1979-11-09 | 1982-03-30 | Ireco Chemicals | Thermally stable emulsion explosive composition |
| US4456494A (en) * | 1980-05-29 | 1984-06-26 | Energy Sciences Partners, Ltd. | System for making an aqueous slurry-type blasting composition |
| US4364782A (en) * | 1980-09-12 | 1982-12-21 | Ireco Chemicals | Permissible slurry explosive |
| AR241896A1 (es) * | 1982-05-12 | 1993-01-29 | Union Explosivos Rio Tinto | Composicion y procedimiento para la obtencion de explosivos en emulsion. |
| US4585495A (en) * | 1985-03-11 | 1986-04-29 | Du Pont Of Canada, Inc. | Stable nitrate/slurry explosives |
| GB9221886D0 (en) * | 1992-10-19 | 1992-12-02 | Explosive Dev Ltd | Improvements in or relating to explosives |
| US5320691A (en) * | 1993-07-08 | 1994-06-14 | The United States Of America As Represented By The Secretary Of The Army | Charcoal-free black powder type granules and method of production |
| RU2171246C1 (ru) * | 1999-12-23 | 2001-07-27 | Институт химии и технологии редких элементов и минерального сырья им. И.В. Тананаева Кольского научного центра РАН | Способ получения водосодержащего взрывчатого вещества |
| RU2172729C1 (ru) * | 1999-12-31 | 2001-08-27 | Семочкин Владимир Семенович | Способ получения водосодержащего взрывчатого вещества |
| UA65043C2 (en) * | 2003-05-15 | 2007-04-25 | Viktor Stepanovych Prokopenko | Method for manufacturing of charge of water-containing explosive material, water-containing liquid (variants) and water-containing explosive material |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US27095A (en) * | 1860-02-14 | Spring egg-cup | ||
| USRE27095E (en) * | 1970-01-14 | 1971-03-23 | Ammonium nitrate slurry blasting composition containing sulfur- sodium nitrate sensitizer | |
| US3653996A (en) * | 1970-01-22 | 1972-04-04 | Atlas Chem Ind | Controlled gelation in aqueous explosives containing boric acid |
| US3713917A (en) * | 1970-11-16 | 1973-01-30 | Ireco Chemicals | Blasting slurry compositions contain-ing calcium nitrate and method of preparation |
| US3787254A (en) * | 1971-06-01 | 1974-01-22 | Ireco Chemicals | Explosive compositions containing calcium nitrate |
| US3886010A (en) * | 1972-07-24 | 1975-05-27 | Ireco Chemicals | Stabilized and aerated blasting slurry containing thiourea and a nitrite gassing agent |
-
1975
- 1975-01-20 US US05/542,280 patent/US4032375A/en not_active Expired - Lifetime
-
1976
- 1976-01-06 ZA ZA00760070A patent/ZA7670B/xx unknown
- 1976-01-07 CA CA243,078A patent/CA1069312A/en not_active Expired
- 1976-01-09 GB GB782/76A patent/GB1525991A/en not_active Expired
- 1976-01-09 IE IE36/76A patent/IE42393B1/en unknown
- 1976-01-14 DE DE2601162A patent/DE2601162C2/de not_active Expired
- 1976-01-14 BE BE163513A patent/BE837565A/xx not_active IP Right Cessation
- 1976-01-15 ES ES444352A patent/ES444352A1/es not_active Expired
- 1976-01-15 IT IT47650/76A patent/IT1052941B/it active
- 1976-01-19 FR FR7601265A patent/FR2297822A1/fr active Granted
- 1976-01-19 JP JP51004842A patent/JPS5813519B2/ja not_active Expired
- 1976-01-19 CS CS76327A patent/CS200185B2/cs unknown
- 1976-01-19 LU LU74201A patent/LU74201A1/xx unknown
- 1976-01-19 BR BR7600306A patent/BR7600306A/pt unknown
- 1976-01-19 NO NO760163A patent/NO142344C/no unknown
- 1976-01-19 SE SE7600501A patent/SE418494B/xx not_active IP Right Cessation
- 1976-01-19 IN IN103/CAL/76A patent/IN145385B/en unknown
- 1976-01-19 CH CH58476A patent/CH618954A5/de not_active IP Right Cessation
- 1976-01-20 PL PL1976186653A patent/PL102552B1/pl unknown
- 1976-01-20 SU SU762318197A patent/SU698527A3/ru active
- 1976-01-20 NL NL7600540A patent/NL7600540A/xx not_active Application Discontinuation
- 1976-01-20 AT AT33676A patent/AT343031B/de not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| JPS5813519B2 (ja) | 1983-03-14 |
| US4032375A (en) | 1977-06-28 |
| NO142344C (no) | 1980-08-06 |
| BE837565A (fr) | 1976-05-03 |
| JPS51104014A (show.php) | 1976-09-14 |
| SU698527A3 (ru) | 1979-11-15 |
| PL102552B1 (pl) | 1979-04-30 |
| IE42393L (en) | 1976-07-20 |
| NO760163L (show.php) | 1976-07-21 |
| AT343031B (de) | 1978-05-10 |
| IE42393B1 (en) | 1980-07-30 |
| CA1069312A (en) | 1980-01-08 |
| SE418494B (sv) | 1981-06-09 |
| NO142344B (no) | 1980-04-28 |
| CS200185B2 (en) | 1980-08-29 |
| IT1052941B (it) | 1981-08-31 |
| NL7600540A (nl) | 1976-07-22 |
| BR7600306A (pt) | 1976-08-31 |
| ES444352A1 (es) | 1977-12-01 |
| DE2601162C2 (de) | 1986-08-07 |
| AU1015776A (en) | 1977-07-14 |
| LU74201A1 (show.php) | 1976-07-23 |
| CH618954A5 (show.php) | 1980-08-29 |
| FR2297822B1 (show.php) | 1981-12-24 |
| IN145385B (show.php) | 1978-09-30 |
| DE2601162A1 (de) | 1976-07-22 |
| SE7600501L (sv) | 1976-07-21 |
| FR2297822A1 (fr) | 1976-08-13 |
| ATA33676A (de) | 1977-08-15 |
| GB1525991A (en) | 1978-09-27 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JPS528793A (en) | Illuminating pyrotechnical composition | |
| ZW6679A1 (en) | Blasting explosives composition | |
| JPS521035A (en) | Vihicle composition containing 11substituted azacycloalkanee22 one | |
| GB1557917A (en) | Aquueous blasting composition | |
| ZA777137B (en) | Slurry explosive composition | |
| ZA743305B (en) | Calcium nitrate explosive composition | |
| GB1518041A (en) | Oxadiazolinone derivatives and compositions containing them | |
| JPS5347510A (en) | Stable hydroussgel explosive composition | |
| JPS5219696A (en) | Thienopyridine derivative and treating composition containing same | |
| ZA7670B (en) | Blasting composition containing calcium nitrate and sulfur | |
| JPS5236632A (en) | Composition containing impurityydecreasing bissbiguanide | |
| JPS5225014A (en) | Antiperspirant composition | |
| JPS5231814A (en) | Hydroussgelatinized explosive composition stabilized and foamed | |
| JPS5265529A (en) | Primer composition | |
| PH11054A (en) | Alkanolamine derivatives and composition containing them | |
| JPS5275693A (en) | Manufacture of sulfur | |
| PH14015A (en) | Naphthyridinylisoindolinones and pharmaceucal compositions containing them | |
| JPS5275680A (en) | Manufacture of granular desulfurizing agents | |
| NZ180650A (en) | Blasting cartidge | |
| NZ182703A (en) | Tickicidal compostions containing diphenylcarbodiimides | |
| JPS5210275A (en) | Novel sulfur containing flavor imparting agent | |
| JPS5283902A (en) | Slurry explosive composition | |
| AU495415B2 (en) | An aqueous gel or slurry type blasting composition containing calcium nitrate and sulfur | |
| PH12289A (en) | Naphtyridine derivatives and composition containing them | |
| AU1329576A (en) | Explosive composition |