ZA756231B - Pharmaceutical compositions comprising substituted 3-cinnamoyl-2h-pyran-2.6(3h)-diones - Google Patents
Pharmaceutical compositions comprising substituted 3-cinnamoyl-2h-pyran-2.6(3h)-dionesInfo
- Publication number
- ZA756231B ZA756231B ZA00756231A ZA756231A ZA756231B ZA 756231 B ZA756231 B ZA 756231B ZA 00756231 A ZA00756231 A ZA 00756231A ZA 756231 A ZA756231 A ZA 756231A ZA 756231 B ZA756231 B ZA 756231B
- Authority
- ZA
- South Africa
- Prior art keywords
- diones
- cinnamoyl
- pyran
- substituted
- pharmaceutical compositions
- Prior art date
Links
- NKPVIJNMEQRGPN-UHFFFAOYSA-N 3-(3-phenylprop-2-enoyl)-3h-pyran-2,6-dione Chemical class C1=CC(=O)OC(=O)C1C(=O)C=CC1=CC=CC=C1 NKPVIJNMEQRGPN-UHFFFAOYSA-N 0.000 title 1
- 239000008194 pharmaceutical composition Substances 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D309/00—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only ring hetero atom, not condensed with other rings
- C07D309/34—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only ring hetero atom, not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members
- C07D309/36—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only ring hetero atom, not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members with oxygen atoms directly attached to ring carbon atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Pyrane Compounds (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US51115374A | 1974-10-02 | 1974-10-02 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| ZA756231B true ZA756231B (en) | 1976-09-29 |
Family
ID=24033666
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| ZA00756231A ZA756231B (en) | 1974-10-02 | 1975-10-01 | Pharmaceutical compositions comprising substituted 3-cinnamoyl-2h-pyran-2.6(3h)-diones |
Country Status (8)
| Country | Link |
|---|---|
| JP (1) | JPS5159869A (esLanguage) |
| BE (1) | BE834081A (esLanguage) |
| CA (1) | CA1076591A (esLanguage) |
| DE (1) | DE2544131C2 (esLanguage) |
| FR (1) | FR2286647A1 (esLanguage) |
| GB (1) | GB1527236A (esLanguage) |
| IE (1) | IE41905B1 (esLanguage) |
| ZA (1) | ZA756231B (esLanguage) |
-
1975
- 1975-09-11 GB GB37418/75A patent/GB1527236A/en not_active Expired
- 1975-09-29 JP JP50118229A patent/JPS5159869A/ja active Pending
- 1975-09-29 IE IE2126/75A patent/IE41905B1/en unknown
- 1975-10-01 CA CA236,817A patent/CA1076591A/en not_active Expired
- 1975-10-01 ZA ZA00756231A patent/ZA756231B/xx unknown
- 1975-10-01 BE BE160597A patent/BE834081A/xx not_active IP Right Cessation
- 1975-10-02 DE DE2544131A patent/DE2544131C2/de not_active Expired
- 1975-10-02 FR FR7530206A patent/FR2286647A1/fr active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| IE41905L (en) | 1976-04-02 |
| FR2286647B1 (esLanguage) | 1979-09-14 |
| AU8538075A (en) | 1977-04-07 |
| GB1527236A (en) | 1978-10-04 |
| JPS5159869A (esLanguage) | 1976-05-25 |
| FR2286647A1 (fr) | 1976-04-30 |
| DE2544131A1 (de) | 1976-04-15 |
| CA1076591A (en) | 1980-04-29 |
| DE2544131C2 (de) | 1984-04-19 |
| IE41905B1 (en) | 1980-04-23 |
| BE834081A (fr) | 1976-04-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| HK34380A (en) | Pharmaceutical compositions | |
| ZA74385B (en) | Pharmaceutical compositions | |
| IL53485A0 (en) | 2,3-dioxypiperazine derivatives | |
| ZA755998B (en) | Pharmaceutical compositions | |
| IL45516A (en) | 3,20-dioxo-17aalpha-hydroxy-d-homopregn-4-enes their manufacture and pharmaceutical compositions containing them | |
| MY8100372A (en) | Pharmaceutical compositions | |
| NZ175497A (en) | 1-substituted-4-hydroxy or acyloxy-4-(3,4-methylenedloxyphenyl)-piperidine and pharmaceutical compositions | |
| GB1487457A (en) | 5,7-dihydroxy-tetraisoquinoline derivatives | |
| HK26379A (en) | 2,3-dioxopiperazine derivatives | |
| NZ179530A (en) | 9-aminoalk(en)yl-9,10-dihydro9,10-methanoanthracenes and pharmaceutical compositions | |
| IL49344A (en) | 2-substituted-7-halo-1,8-maphthyridine compounds,processesfor preparing the same and pharmaceutical compositions containing the same | |
| IL47792A0 (en) | Substituted 2h-pyran-2,6(3h)-dione derivatives | |
| ZA755665B (en) | U.v.-curable resinous compounds and compositions | |
| ZA755802B (en) | Pharmaceutical compositions | |
| ZA756231B (en) | Pharmaceutical compositions comprising substituted 3-cinnamoyl-2h-pyran-2.6(3h)-diones | |
| ZA757067B (en) | Pharmaceutical compositions comprising substituted 4,6-dihydroxy-2h-pyran-2-ones | |
| HK73178A (en) | Pharmaceutical compositions | |
| PH12855A (en) | Pharmaceutical compositions | |
| AU492176B2 (en) | Pharmaceutical compositions comprising substituted 3-cinnamoyl 2h-pyran-2, 6(3h)-diones | |
| NZ178645A (en) | 2-amino-4-azido-6-formylamino-1,3,5-triazines and compositions | |
| PH11939A (en) | 5,6-dibenzyloxy-2-aminotetralol derivatives | |
| IL36536A (en) | Substituted 1,2,4,5-tetrahydro-(3h)-3-benzazepines,their preparation and pharmaceutical compositions containing them | |
| GB1408658A (en) | Compounds derivaed from dioxabicyclooctane-diones and the prepar ation thereof | |
| NZ178646A (en) | 2,3-dihydro-1-benzothiepin-4-carboxamides and pharmaceutical compositions | |
| ZA754199B (en) | Substituted 2h-pyran-2,6(3h)-dione derivatives |