ZA755688B - Basically substituted 3-sulfamoylbenzoic acid derivatives and process for their preparation - Google Patents
Basically substituted 3-sulfamoylbenzoic acid derivatives and process for their preparationInfo
- Publication number
- ZA755688B ZA755688B ZA00755688A ZA755688A ZA755688B ZA 755688 B ZA755688 B ZA 755688B ZA 00755688 A ZA00755688 A ZA 00755688A ZA 755688 A ZA755688 A ZA 755688A ZA 755688 B ZA755688 B ZA 755688B
- Authority
- ZA
- South Africa
- Prior art keywords
- preparation
- acid derivatives
- sulfamoylbenzoic acid
- basically substituted
- basically
- Prior art date
Links
- NAETXYOXMDYNLE-UHFFFAOYSA-N 3-sulfamoylbenzoic acid Chemical class NS(=O)(=O)C1=CC=CC(C(O)=O)=C1 NAETXYOXMDYNLE-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/04—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms
- C07D295/14—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D295/155—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals with the ring nitrogen atoms and the carbon atoms with three bonds to hetero atoms separated by carbocyclic rings or by carbon chains interrupted by carbocyclic rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2442851A DE2442851A1 (de) | 1974-09-06 | 1974-09-06 | Basisch substituierte 3-sulfamoylbenzoesaeurederivate und verfahren zu ihrer herstellung |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| ZA755688B true ZA755688B (en) | 1976-08-25 |
Family
ID=5925106
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| ZA00755688A ZA755688B (en) | 1974-09-06 | 1975-09-05 | Basically substituted 3-sulfamoylbenzoic acid derivatives and process for their preparation |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US4029787A (cs) |
| JP (1) | JPS5154574A (cs) |
| BE (1) | BE833184A (cs) |
| DE (1) | DE2442851A1 (cs) |
| DK (1) | DK399275A (cs) |
| ES (1) | ES440602A1 (cs) |
| FI (1) | FI752472A7 (cs) |
| FR (1) | FR2283683A1 (cs) |
| IL (1) | IL48048A0 (cs) |
| LU (1) | LU73330A1 (cs) |
| NL (1) | NL7510287A (cs) |
| SE (1) | SE7509897L (cs) |
| ZA (1) | ZA755688B (cs) |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| IT1176613B (it) * | 1984-08-14 | 1987-08-18 | Ravizza Spa | Derivati piperazinici farmacologicamente attivi e processo per la loro preparazione |
| US6316450B1 (en) * | 1997-07-11 | 2001-11-13 | Smithkline Beecham P.L.C. | Compounds |
| US7544676B2 (en) * | 2005-11-10 | 2009-06-09 | Adolor Corporation | Sulfamoyl benzamides and methods of their use |
| US8076491B2 (en) | 2007-08-21 | 2011-12-13 | Senomyx, Inc. | Compounds that inhibit (block) bitter taste in composition and use thereof |
| RO128637A2 (ro) * | 2007-08-21 | 2013-07-30 | Senomyx, Inc. | Identificarea receptorilor t2r umani care răspund la compuşii amari care extrag gustul amar din compoziţii, şi utilizarea acestora în analize pentru a identifica compuşii care inhibă () gustul amar în compoziţii şi utilizarea acestora |
| SG11202110950XA (en) * | 2019-04-02 | 2021-10-28 | Fondazione St Italiano Tecnologia | Modulators of intracellular chloride concentration |
-
1974
- 1974-09-06 DE DE2442851A patent/DE2442851A1/de active Pending
-
1975
- 1975-09-01 ES ES440602A patent/ES440602A1/es not_active Expired
- 1975-09-01 NL NL7510287A patent/NL7510287A/xx unknown
- 1975-09-03 FI FI752472A patent/FI752472A7/fi not_active Application Discontinuation
- 1975-09-04 US US05/610,388 patent/US4029787A/en not_active Expired - Lifetime
- 1975-09-04 IL IL48048A patent/IL48048A0/xx unknown
- 1975-09-04 LU LU73330A patent/LU73330A1/xx unknown
- 1975-09-05 FR FR7527352A patent/FR2283683A1/fr active Granted
- 1975-09-05 SE SE7509897A patent/SE7509897L/xx unknown
- 1975-09-05 DK DK399275A patent/DK399275A/da unknown
- 1975-09-05 ZA ZA00755688A patent/ZA755688B/xx unknown
- 1975-09-06 JP JP50107580A patent/JPS5154574A/ja active Pending
- 1975-09-08 BE BE159840A patent/BE833184A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| SE7509897L (sv) | 1976-03-08 |
| FR2283683A1 (fr) | 1976-04-02 |
| BE833184A (fr) | 1976-03-08 |
| DE2442851A1 (de) | 1976-03-18 |
| DK399275A (da) | 1976-03-07 |
| LU73330A1 (cs) | 1977-05-11 |
| IL48048A0 (en) | 1975-11-25 |
| US4029787A (en) | 1977-06-14 |
| NL7510287A (nl) | 1976-03-09 |
| FI752472A7 (cs) | 1976-03-07 |
| ES440602A1 (es) | 1977-03-01 |
| JPS5154574A (en) | 1976-05-13 |
| FR2283683B1 (cs) | 1978-07-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| YU174375A (en) | Process for preparing (4-trifluoromethyl-phenoxy)-phenoxypropionic acid and derivatives thereof | |
| HU174973B (hu) | Sposob poluchenija proizvodnykh 16-alkil-16-gidroksi-prostanovykh kislot | |
| GB1549047A (en) | Prost-16-ynoic acid and derivatives and process for their manufacture | |
| HU173040B (hu) | Sposob poluchenija 7-d-skobka-skobka zakryta-al'fa-amino-al'fa-skobka-n-gidroksifenilacetamido-skobka zakryta-dezacetoksi-cef-3-em-4-karbonovojj kisloty i proizvodnykh | |
| ZA753124B (en) | 3-amino-phenylacetic acid derivatives process for their preparation and their use as herbicides | |
| IL45294A (en) | 7-acylamido-3-cephem-4-carboxylic acid derivatives and process for their preparation | |
| IL47339A (en) | Macromolecular adenne derivatives and process for their preparation | |
| IL47141A0 (en) | Adenine derivatives and process for their preparation | |
| IL48276A (en) | 7-hydroxy-estradiols and process for their preparation | |
| IL47593A (en) | 15,15-ethylenedioxy-prostanoic acid derivatives and process for their manufacture | |
| GB1516509A (en) | Omikron-phenylenediamine derivatives and process for their preparation | |
| IL45628A0 (en) | New pyrazolyloxyacetic acid derivatives and process for their manufacture | |
| IL48048A0 (en) | Basically substituted 3-sulfamoylbenzoic acid derivatives and process for their preparation | |
| CH614191A5 (en) | Process for the preparation of novel dioxamic acid derivatives and compounds thus prepared | |
| IL45603A0 (en) | 7-trichloroacetamido-3-desacetoxy-cephalosporanic acid derivatives and processes for their preparation | |
| ZA765386B (en) | Process for the preparation of 5-oxo-hexanoic acid and its derivatives | |
| CS183813B2 (en) | Process for preparing 6-aminopenicilic and 7-aminocephalosporic acid | |
| YU37170B (en) | Process for obtaining penicillnic acid derivatives | |
| IL49402A0 (en) | Basically substituted 5-sulfamoyl-anthranilic acid derivatives and process for their manufacture | |
| YU125074A (en) | Process for preparing citric acid and derivatives thereof | |
| HU175444B (hu) | Sposob poluchenija deoksi-klavulannojj kisloty i ejj proizvodnykh | |
| IL48065A0 (en) | Pgfbeta-prostaglandins and process for their preparation | |
| IL48027A0 (en) | Process for the preparation of 9,11,15-trihydroxy-13,14-dehydro-prostaglandins and new prost-5-en-13-ynoic acid derivatives | |
| EG11957A (en) | Process for the preparation of otaconic acid and derivatives thereof | |
| GB1523178A (en) | 8-azaprostanoic acid derivatives and process for preparing the same |