ZA75165B - Xanthene derivatives - Google Patents
Xanthene derivativesInfo
- Publication number
- ZA75165B ZA75165B ZA00750165A ZA75165A ZA75165B ZA 75165 B ZA75165 B ZA 75165B ZA 00750165 A ZA00750165 A ZA 00750165A ZA 75165 A ZA75165 A ZA 75165A ZA 75165 B ZA75165 B ZA 75165B
- Authority
- ZA
- South Africa
- Prior art keywords
- xanthene derivatives
- xanthene
- derivatives
- Prior art date
Links
- 125000001834 xanthenyl group Chemical class C1=CC=CC=2OC3=CC=CC=C3C(C12)* 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D491/00—Heterocyclic compounds containing in the condensed ring system both one or more rings having oxygen atoms as the only ring hetero atoms and one or more rings having nitrogen atoms as the only ring hetero atoms, not provided for by groups C07D451/00 - C07D459/00, C07D463/00, C07D477/00 or C07D489/00
- C07D491/02—Heterocyclic compounds containing in the condensed ring system both one or more rings having oxygen atoms as the only ring hetero atoms and one or more rings having nitrogen atoms as the only ring hetero atoms, not provided for by groups C07D451/00 - C07D459/00, C07D463/00, C07D477/00 or C07D489/00 in which the condensed system contains two hetero rings
- C07D491/10—Spiro-condensed systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Saccharide Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB501674*[A GB1447583A (en) | 1974-02-04 | 1974-02-04 | Xanthene derivatives |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| ZA75165B true ZA75165B (en) | 1976-01-28 |
Family
ID=9788165
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| ZA00750165A ZA75165B (en) | 1974-02-04 | 1975-01-09 | Xanthene derivatives |
Country Status (22)
| Country | Link |
|---|---|
| US (2) | US4001419A (ja�@�@) |
| JP (1) | JPS50112374A (ja�@�@) |
| AT (1) | AT340417B (ja�@�@) |
| AU (1) | AU7725375A (ja�@�@) |
| BE (1) | BE825129A (ja�@�@) |
| CS (1) | CS188938B2 (ja�@�@) |
| DD (1) | DD118283A5 (ja�@�@) |
| DE (1) | DE2504643A1 (ja�@�@) |
| DK (1) | DK37675A (ja�@�@) |
| ES (1) | ES434431A1 (ja�@�@) |
| FI (1) | FI750302A7 (ja�@�@) |
| FR (1) | FR2259606B1 (ja�@�@) |
| GB (1) | GB1447583A (ja�@�@) |
| IL (1) | IL46440A (ja�@�@) |
| IN (1) | IN140039B (ja�@�@) |
| LU (1) | LU71791A1 (ja�@�@) |
| NL (1) | NL7501090A (ja�@�@) |
| NO (1) | NO750341L (ja�@�@) |
| PL (1) | PL97223B1 (ja�@�@) |
| SE (1) | SE7501159L (ja�@�@) |
| SU (1) | SU581869A3 (ja�@�@) |
| ZA (1) | ZA75165B (ja�@�@) |
Families Citing this family (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4198420A (en) * | 1979-01-10 | 1980-04-15 | American Hoechst Corporation | Spiro[dibenz(b,f)thiepin-piperidine]s |
| US4198419A (en) * | 1979-01-10 | 1980-04-15 | American Hoechst Corporation | Phenylthiophenylpiperidines |
| US4198418A (en) * | 1979-01-10 | 1980-04-15 | American Hoechst Corporation | Spiro[dibenz(b,f)oxepin-piperidine]s |
| US4198417A (en) * | 1979-01-10 | 1980-04-15 | American Hoechst Corporation | Phenoxyphenylpiperidines |
| EP0141962A1 (en) * | 1983-09-15 | 1985-05-22 | The Hilton - Davis Chemical Company | Hydrazine derivatives of fluorans and use thereof in electrochromic recording systems |
| US5149830A (en) * | 1990-02-23 | 1992-09-22 | Steadfast, Inc. | Substituted xanthene compounds |
| US7014925B2 (en) * | 2003-04-29 | 2006-03-21 | Canon Kabushiki Kaisha | Heterogeneous spiro compounds in organic light emitting device elements |
| DE102004017398A1 (de) * | 2004-04-05 | 2005-10-20 | Clariant Internat Ltd Muttenz | Fluorierte Xanthene und ihre Verwendung in Flüssigkristallmischungen |
| JP2010100573A (ja) * | 2008-10-24 | 2010-05-06 | Sumitomo Chemical Co Ltd | キサンテン誘導体及び該誘導体を含有する熱可塑性ポリマー組成物 |
| US9506929B2 (en) * | 2012-02-23 | 2016-11-29 | Portland State University | Selective detection of amino group containing thiols |
| RS56015B1 (sr) | 2013-01-31 | 2017-09-29 | Vertex Pharma | Piridon amidi kao modulatori natrijumovih kanala |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3048595A (en) * | 1960-11-14 | 1962-08-07 | Smith Kline French Lab | Spiro derivatives of thiazanthenes and xanthenes |
| US3652558A (en) * | 1969-04-21 | 1972-03-28 | Robins Co Inc A H | Spiro condensed aromatic compounds |
| BE758919A (fr) * | 1969-11-15 | 1971-05-13 | Merck Patent Gmbh | Spiro-composes |
-
1974
- 1974-02-04 GB GB501674*[A patent/GB1447583A/en not_active Expired
-
1975
- 1975-01-09 US US05/539,742 patent/US4001419A/en not_active Expired - Lifetime
- 1975-01-09 ZA ZA00750165A patent/ZA75165B/xx unknown
- 1975-01-13 IN IN78/CAL/75A patent/IN140039B/en unknown
- 1975-01-13 AU AU77253/75A patent/AU7725375A/en not_active Expired
- 1975-01-15 IL IL46440A patent/IL46440A/en unknown
- 1975-01-30 NL NL7501090A patent/NL7501090A/xx not_active Application Discontinuation
- 1975-02-01 PL PL1975192104A patent/PL97223B1/pl unknown
- 1975-02-03 LU LU71791A patent/LU71791A1/xx unknown
- 1975-02-03 NO NO750341A patent/NO750341L/no unknown
- 1975-02-03 BE BE153012A patent/BE825129A/xx unknown
- 1975-02-03 AT AT77375A patent/AT340417B/de not_active IP Right Cessation
- 1975-02-03 FR FR7503263A patent/FR2259606B1/fr not_active Expired
- 1975-02-04 DK DK37675*#A patent/DK37675A/da unknown
- 1975-02-04 DD DD183991A patent/DD118283A5/xx unknown
- 1975-02-04 JP JP50014763A patent/JPS50112374A/ja active Pending
- 1975-02-04 DE DE19752504643 patent/DE2504643A1/de not_active Ceased
- 1975-02-04 FI FI750302A patent/FI750302A7/fi not_active Application Discontinuation
- 1975-02-04 ES ES434431A patent/ES434431A1/es not_active Expired
- 1975-02-04 CS CS75718A patent/CS188938B2/cs unknown
- 1975-06-05 SE SE7501159A patent/SE7501159L/xx unknown
- 1975-12-25 SU SU7502302642A patent/SU581869A3/ru active
-
1976
- 1976-10-14 US US05/732,293 patent/US4268514A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| AU7725375A (en) | 1976-07-15 |
| ES434431A1 (es) | 1977-03-16 |
| IN140039B (ja�@�@) | 1976-09-04 |
| NL7501090A (nl) | 1975-08-06 |
| JPS50112374A (ja�@�@) | 1975-09-03 |
| LU71791A1 (ja�@�@) | 1976-08-19 |
| DE2504643A1 (de) | 1975-08-07 |
| DK37675A (ja�@�@) | 1975-09-29 |
| AT340417B (de) | 1977-12-12 |
| CS188938B2 (en) | 1979-03-30 |
| SU581869A3 (ru) | 1977-11-25 |
| IL46440A0 (en) | 1975-04-25 |
| IL46440A (en) | 1977-11-30 |
| NO750341L (ja�@�@) | 1975-09-01 |
| GB1447583A (en) | 1976-08-25 |
| DD118283A5 (ja�@�@) | 1976-02-20 |
| SE7501159L (ja�@�@) | 1975-08-05 |
| US4001419A (en) | 1977-01-04 |
| US4268514A (en) | 1981-05-19 |
| FR2259606B1 (ja�@�@) | 1980-01-25 |
| FI750302A7 (ja�@�@) | 1975-08-05 |
| ATA77375A (de) | 1977-04-15 |
| FR2259606A1 (ja�@�@) | 1975-08-29 |
| BE825129A (fr) | 1975-08-04 |
| PL97223B1 (pl) | 1978-02-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| PH11652A (en) | Arloxphenylpropylamines derivatives | |
| IL48592A0 (en) | Novel 1-substituted-4-benzylpiperidine derivatives | |
| IL48593A0 (en) | Novel 1-substituted-4-benzylidenepiperidine derivatives | |
| ZA753968B (en) | Novel benzimidazolinone derivatives | |
| IL46341A0 (en) | Alpha-aryl-4-substituted piperidinoalkanol derivatives | |
| AU498298B2 (en) | Piperidyliden xanthene derivatives | |
| PH12312A (en) | Thienothiazine derivatives | |
| AU1038176A (en) | 4-arylpiperidine derivatives | |
| ZA757828B (en) | 2-methoxy-benzamide derivatives | |
| GB1519811A (en) | Thienothaiazine derivatives | |
| PH13481A (en) | Rifanycin derivative | |
| GB1484049A (en) | 3-alkoxy-pyrazine-2-carboxamide derivatives | |
| AU7921975A (en) | Hexahydro-alpha-carboline derivatives | |
| AU7725375A (en) | Xanthene derivatives | |
| GB1521320A (en) | Quinolisidine derivatives | |
| ZA753315B (en) | Oxacyclohexane derivatives | |
| ZA751899B (en) | Benzo-bicyclononene derivatives | |
| ZA754602B (en) | Antiboiotic a2041 derivative | |
| ZA755543B (en) | Thiomethylcephem derivatives | |
| IL48409A0 (en) | Phenyl-pyridylamine derivatives | |
| ZA753299B (en) | Amidino-hydrazone derivatives | |
| JPS51115457A (en) | 166methyll9 alphaa halosteroid derivatives | |
| GB1486646A (en) | Thieno-pyridine derivatives | |
| GB1518083A (en) | Xanthene derivatives | |
| ZA753363B (en) | Benzazine derivatives |