ZA751001B - 1-(3-phenylpropyl)-4-furoylpiperazine derivatives - Google Patents
1-(3-phenylpropyl)-4-furoylpiperazine derivativesInfo
- Publication number
- ZA751001B ZA751001B ZA00751001A ZA751001A ZA751001B ZA 751001 B ZA751001 B ZA 751001B ZA 00751001 A ZA00751001 A ZA 00751001A ZA 751001 A ZA751001 A ZA 751001A ZA 751001 B ZA751001 B ZA 751001B
- Authority
- ZA
- South Africa
- Prior art keywords
- furoylpiperazine
- phenylpropyl
- derivatives
- furoylpiperazine derivatives
- Prior art date
Links
- GGHWLRIOGLYBBG-UHFFFAOYSA-N furan-2-yl-[4-(3-phenylpropyl)piperazin-1-yl]methanone Chemical class C=1C=COC=1C(=O)N(CC1)CCN1CCCC1=CC=CC=C1 GGHWLRIOGLYBBG-UHFFFAOYSA-N 0.000 title 1
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP2606774A JPS50131974A (OSRAM) | 1974-03-06 | 1974-03-06 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| ZA751001B true ZA751001B (en) | 1976-01-28 |
Family
ID=12183327
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| ZA00751001A ZA751001B (en) | 1974-03-06 | 1975-02-18 | 1-(3-phenylpropyl)-4-furoylpiperazine derivatives |
Country Status (3)
| Country | Link |
|---|---|
| JP (1) | JPS50131974A (OSRAM) |
| BE (1) | BE826339A (OSRAM) |
| ZA (1) | ZA751001B (OSRAM) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| SE8304361D0 (sv) * | 1983-08-10 | 1983-08-10 | Ferrosan Ab | Novel 1-acylpiperazine derivatives novel 1-acylpiperazine derivatives |
-
1974
- 1974-03-06 JP JP2606774A patent/JPS50131974A/ja active Pending
-
1975
- 1975-02-18 ZA ZA00751001A patent/ZA751001B/xx unknown
- 1975-03-06 BE BE2054189A patent/BE826339A/fr not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| JPS50131974A (OSRAM) | 1975-10-18 |
| BE826339A (fr) | 1975-06-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| PH11652A (en) | Arloxphenylpropylamines derivatives | |
| ZA757193B (en) | Triazole derivatives | |
| ZA7548B (en) | 2-aryl-4-substituted piperidinoalkanol derivatives | |
| PH12312A (en) | Thienothiazine derivatives | |
| ZA757828B (en) | 2-methoxy-benzamide derivatives | |
| GB1519811A (en) | Thienothaiazine derivatives | |
| AU1038176A (en) | 4-arylpiperidine derivatives | |
| MY8200149A (en) | Benzodiazepine derivatives | |
| GB1533607A (en) | 1-(3-phenylpropyl)-4-acylpiperazine derivatives | |
| AU7921975A (en) | Hexahydro-alpha-carboline derivatives | |
| GB1484049A (en) | 3-alkoxy-pyrazine-2-carboxamide derivatives | |
| GB1521320A (en) | Quinolisidine derivatives | |
| ZA753315B (en) | Oxacyclohexane derivatives | |
| PH12265A (en) | Benzo-bicyclononene derivatives | |
| ZA755543B (en) | Thiomethylcephem derivatives | |
| AU8332175A (en) | New hydroxyphenyl-butazone derivatives | |
| IL48409A0 (en) | Phenyl-pyridylamine derivatives | |
| ZA753299B (en) | Amidino-hydrazone derivatives | |
| JPS51115457A (en) | 166methyll9 alphaa halosteroid derivatives | |
| GB1486646A (en) | Thieno-pyridine derivatives | |
| ZA751001B (en) | 1-(3-phenylpropyl)-4-furoylpiperazine derivatives | |
| ZA753363B (en) | Benzazine derivatives | |
| HK28879A (en) | 2-aminomethylphenol derivatives | |
| KE3004A (en) | Benzodiazepine derivatives | |
| GB1482503A (en) | Benzodiazepine derivatives |