ZA747671B - Disubstituted xanthone carboxylic acid compounds - Google Patents
Disubstituted xanthone carboxylic acid compoundsInfo
- Publication number
- ZA747671B ZA747671B ZA00747671A ZA747671A ZA747671B ZA 747671 B ZA747671 B ZA 747671B ZA 00747671 A ZA00747671 A ZA 00747671A ZA 747671 A ZA747671 A ZA 747671A ZA 747671 B ZA747671 B ZA 747671B
- Authority
- ZA
- South Africa
- Prior art keywords
- carboxylic acid
- acid compounds
- xanthone carboxylic
- disubstituted
- disubstituted xanthone
- Prior art date
Links
- WNKRYYFWYMHTGV-UHFFFAOYSA-N 9-oxoxanthene-1-carboxylic acid Chemical class O1C2=CC=CC=C2C(=O)C2=C1C=CC=C2C(=O)O WNKRYYFWYMHTGV-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C323/00—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D311/00—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings
- C07D311/02—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D311/78—Ring systems having three or more relevant rings
- C07D311/80—Dibenzopyrans; Hydrogenated dibenzopyrans
- C07D311/82—Xanthenes
- C07D311/84—Xanthenes with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached in position 9
- C07D311/86—Oxygen atoms, e.g. xanthones
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pyrane Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05431794 US3894049A (en) | 1972-06-05 | 1974-01-08 | Disubstituted xanthone carboxylic acid compounds |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| ZA747671B true ZA747671B (en) | 1976-07-28 |
Family
ID=23713448
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| ZA00747671A ZA747671B (en) | 1974-01-08 | 1974-12-02 | Disubstituted xanthone carboxylic acid compounds |
Country Status (14)
| Country | Link |
|---|---|
| JP (1) | JPS50126667A (Direct) |
| AT (1) | AT339297B (Direct) |
| AU (1) | AU7571774A (Direct) |
| BE (1) | BE823030R (Direct) |
| DE (1) | DE2461059A1 (Direct) |
| DK (1) | DK645674A (Direct) |
| ES (1) | ES433626A2 (Direct) |
| FI (1) | FI334874A7 (Direct) |
| FR (1) | FR2256755B2 (Direct) |
| GB (2) | GB1464562A (Direct) |
| NL (1) | NL7500218A (Direct) |
| NO (1) | NO744506L (Direct) |
| SE (1) | SE7415844L (Direct) |
| ZA (1) | ZA747671B (Direct) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB2136227A (en) * | 1983-03-07 | 1984-09-12 | Nat Res Dev | Direct Current Circuit Breakers |
-
1974
- 1974-11-20 FI FI3348/74A patent/FI334874A7/fi unknown
- 1974-11-25 AU AU75717/74A patent/AU7571774A/en not_active Expired
- 1974-12-02 ZA ZA00747671A patent/ZA747671B/xx unknown
- 1974-12-06 BE BE151224A patent/BE823030R/xx active
- 1974-12-11 DK DK645674A patent/DK645674A/da unknown
- 1974-12-13 NO NO744506A patent/NO744506L/no unknown
- 1974-12-17 SE SE7415844A patent/SE7415844L/xx unknown
- 1974-12-23 DE DE19742461059 patent/DE2461059A1/de active Pending
- 1974-12-24 GB GB4009076A patent/GB1464562A/en not_active Expired
- 1974-12-24 GB GB1296674A patent/GB1464561A/en not_active Expired
- 1974-12-24 JP JP50001055A patent/JPS50126667A/ja active Pending
-
1975
- 1975-01-07 FR FR7500380A patent/FR2256755B2/fr not_active Expired
- 1975-01-07 ES ES433626A patent/ES433626A2/es not_active Expired
- 1975-01-08 AT AT9475A patent/AT339297B/de not_active IP Right Cessation
- 1975-01-08 NL NL7500218A patent/NL7500218A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| GB1464562A (en) | 1977-02-16 |
| DK645674A (Direct) | 1975-09-01 |
| ES433626A2 (es) | 1977-07-01 |
| NL7500218A (nl) | 1975-07-10 |
| DE2461059A1 (de) | 1975-07-17 |
| AT339297B (de) | 1977-10-10 |
| BE823030R (fr) | 1975-06-06 |
| AU7571774A (en) | 1976-05-27 |
| JPS50126667A (Direct) | 1975-10-04 |
| SE7415844L (Direct) | 1975-07-09 |
| ATA9475A (de) | 1977-02-15 |
| FR2256755B2 (Direct) | 1978-06-30 |
| NO744506L (Direct) | 1975-08-04 |
| FI334874A7 (Direct) | 1975-07-09 |
| FR2256755A2 (Direct) | 1975-08-01 |
| GB1464561A (en) | 1977-02-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| IL47019A (en) | Benzylphenoxylakanoic acid derivates | |
| EG12508A (en) | 2-higher alkyl-3-hydroxy-1,4-naphthoquinone carboxylic acid esters | |
| GB1516656A (en) | 3-sulphonyloxy-cephem-4-carboxylic acid derivatives | |
| ZA753952B (en) | Vincaminic acid esters | |
| YU40121B (en) | Proacess for producing alpha-amino-alpha-(p-acykoxypenyl)-acetamido-cephalosporanic acid | |
| GB1484395A (en) | Substituted phenoxy-thiobenzoic acid esters | |
| AU8504375A (en) | Naphthenohydroxamic acid | |
| ZA724756B (en) | Novel disubstituted xanthone carboxylic acid compounds | |
| ZA744249B (en) | Novel cycloalkyl phenoxy carboxylic acid derivatives | |
| ZA724754B (en) | Novel substituted xanthone carboxylic acid compounds | |
| ZA754128B (en) | Monochromone-2-carboxylic acid | |
| ZA724757B (en) | Novel disubstituted xanthone carboxylic acid compounds | |
| AU7903975A (en) | Indolylacetyl-amino acid derivatives | |
| ZA747671B (en) | Disubstituted xanthone carboxylic acid compounds | |
| HK30876A (en) | Novel substituted xanthone carboxylic acid compounds | |
| IE42138L (en) | Tetrahydropyridinecarboxylic acid esters | |
| GB1518199A (en) | Prostenoic acid derivatives | |
| AU465362B2 (en) | Novel disubstituted xanthone carboxylic acid compounds | |
| AU478775B2 (en) | Novel substituted xanthone carboxylic acid compounds | |
| AU7855075A (en) | O-ethyl-o-npropyl-o-vinyl-thionophosphoric acid esters | |
| ZA724758B (en) | Novel disubstituted xanthone carboxylic acid compounds | |
| JPS51138693A (en) | Isoklabaranic acid derivative | |
| CA1017345A (en) | Disubstituted xanthone carboxylic acid compounds | |
| AU496664B2 (en) | Trifluoromethyl-substituted aliphatic carboxylic acid compounds | |
| AU8661975A (en) | Trifluoromethyl-substituted aliphatic carboxylic acid compounds |