ZA732013B - New 2-benzoyl-3-amino-pyridines - Google Patents
New 2-benzoyl-3-amino-pyridinesInfo
- Publication number
- ZA732013B ZA732013B ZA732013A ZA732013A ZA732013B ZA 732013 B ZA732013 B ZA 732013B ZA 732013 A ZA732013 A ZA 732013A ZA 732013 A ZA732013 A ZA 732013A ZA 732013 B ZA732013 B ZA 732013B
- Authority
- ZA
- South Africa
- Prior art keywords
- pyridines
- benzoyl
- amino
- new
- Prior art date
Links
- MUXPIKKNIKZVHU-UHFFFAOYSA-N (3-aminopyridin-2-yl)-phenylmethanone Chemical class NC1=CC=CN=C1C(=O)C1=CC=CC=C1 MUXPIKKNIKZVHU-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/62—Oxygen or sulfur atoms
- C07D213/63—One oxygen atom
- C07D213/64—One oxygen atom attached in position 2 or 6
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/24—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D213/54—Radicals substituted by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D213/57—Nitriles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/61—Halogen atoms or nitro radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/72—Nitrogen atoms
- C07D213/73—Unsubstituted amino or imino radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/72—Nitrogen atoms
- C07D213/74—Amino or imino radicals substituted by hydrocarbon or substituted hydrocarbon radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/72—Nitrogen atoms
- C07D213/75—Amino or imino radicals, acylated by carboxylic or carbonic acids, or by sulfur or nitrogen analogues thereof, e.g. carbamates
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pyridine Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| AT411372A AT321303B (de) | 1972-05-10 | 1972-05-10 | Verfahren zur Herstellung von neuen 2-Benzoyl-3-amino-pyridin-Verbindungen und deren Salzen |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| ZA732013B true ZA732013B (en) | 1974-04-24 |
Family
ID=3559825
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| ZA732013A ZA732013B (en) | 1972-05-10 | 1973-03-22 | New 2-benzoyl-3-amino-pyridines |
Country Status (23)
| Country | Link |
|---|---|
| US (1) | US3875176A (enExample) |
| JP (1) | JPS4948674A (enExample) |
| AR (2) | AR207633Q (enExample) |
| AT (1) | AT321303B (enExample) |
| AU (1) | AU469111B2 (enExample) |
| BE (1) | BE799339A (enExample) |
| CA (1) | CA991189A (enExample) |
| CH (2) | CH605761A5 (enExample) |
| CS (1) | CS181238B2 (enExample) |
| DD (1) | DD106378A5 (enExample) |
| DE (1) | DE2319872A1 (enExample) |
| EG (1) | EG11137A (enExample) |
| ES (3) | ES413175A1 (enExample) |
| FR (1) | FR2184077B1 (enExample) |
| GB (1) | GB1416459A (enExample) |
| HU (1) | HU169037B (enExample) |
| IL (1) | IL42007A (enExample) |
| NL (1) | NL7306170A (enExample) |
| PL (1) | PL91935B1 (enExample) |
| RO (1) | RO63441A (enExample) |
| SE (1) | SE415974B (enExample) |
| SU (4) | SU538662A3 (enExample) |
| ZA (1) | ZA732013B (enExample) |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4007290A (en) * | 1974-01-09 | 1977-02-08 | General Foods Corporation | Caffeine antagonim |
| DE3067662D1 (en) * | 1980-01-16 | 1984-06-07 | Lacer Sa | New 2-halo-pyridines, their production and pharmaceutical compositions |
| JPH01104580U (enExample) * | 1988-01-05 | 1989-07-14 | ||
| JP2531989B2 (ja) * | 1988-09-14 | 1996-09-04 | 吉富製薬株式会社 | ピリジン化合物 |
| RU2255088C2 (ru) * | 2001-02-09 | 2005-06-27 | Исихара Сангио Кайся, Лтд. | Производное бензоилпиридина или его соль, содержащий его в качестве активного ингредиента фунгицид, способы его получения и промежуточные соединения для его получения |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3781360A (en) * | 1966-01-14 | 1973-12-25 | Schering Corp | 2-polyfluoroloweralkylamino benzophenones |
| US3763178A (en) * | 1968-09-05 | 1973-10-02 | American Home Prod | Imidazolinyl phenyl carbonyl acid addition salts and related compounds |
-
1972
- 1972-05-10 AT AT411372A patent/AT321303B/de not_active IP Right Cessation
-
1973
- 1973-01-01 AR AR251133A patent/AR207633Q/es unknown
- 1973-03-22 ZA ZA732013A patent/ZA732013B/xx unknown
- 1973-03-27 DD DD169761A patent/DD106378A5/xx unknown
- 1973-03-30 ES ES413175A patent/ES413175A1/es not_active Expired
- 1973-03-30 ES ES413174A patent/ES413174A1/es not_active Expired
- 1973-03-30 ES ES413173A patent/ES413173A1/es not_active Expired
- 1973-04-03 US US347361A patent/US3875176A/en not_active Expired - Lifetime
- 1973-04-11 IL IL42007A patent/IL42007A/en unknown
- 1973-04-19 DE DE2319872A patent/DE2319872A1/de not_active Withdrawn
- 1973-04-26 SU SU1914703A patent/SU538662A3/ru active
- 1973-05-03 NL NL7306170A patent/NL7306170A/xx not_active Application Discontinuation
- 1973-05-07 CH CH381676A patent/CH605761A5/xx not_active IP Right Cessation
- 1973-05-07 CH CH643373A patent/CH582150A5/xx not_active IP Right Cessation
- 1973-05-08 CS CS7300003271A patent/CS181238B2/cs unknown
- 1973-05-08 EG EG168/73A patent/EG11137A/xx active
- 1973-05-08 PL PL1973162405A patent/PL91935B1/pl unknown
- 1973-05-09 RO RO7300074727A patent/RO63441A/ro unknown
- 1973-05-09 BE BE6044150A patent/BE799339A/xx unknown
- 1973-05-09 HU HUDE817A patent/HU169037B/hu unknown
- 1973-05-10 CA CA170,937A patent/CA991189A/en not_active Expired
- 1973-05-10 JP JP48052056A patent/JPS4948674A/ja active Pending
- 1973-05-10 SE SE7306625A patent/SE415974B/xx unknown
- 1973-05-10 GB GB2229873A patent/GB1416459A/en not_active Expired
- 1973-05-10 AU AU55537/73A patent/AU469111B2/en not_active Expired
- 1973-05-10 AR AR247950A patent/AR201105A1/es active
- 1973-05-10 FR FR7316947A patent/FR2184077B1/fr not_active Expired
-
1974
- 1974-06-17 SU SU742043814A patent/SU597338A3/ru active
- 1974-07-17 SU SU2043813A patent/SU561508A3/ru active
- 1974-07-17 SU SU742043816A patent/SU677653A3/ru active
Also Published As
| Publication number | Publication date |
|---|---|
| IL42007A0 (en) | 1973-06-29 |
| CS181238B2 (en) | 1978-03-31 |
| CH605761A5 (enExample) | 1978-10-13 |
| CH582150A5 (enExample) | 1976-11-30 |
| SE415974B (sv) | 1980-11-17 |
| JPS4948674A (enExample) | 1974-05-11 |
| ES413175A1 (es) | 1976-06-01 |
| ES413173A1 (es) | 1976-01-16 |
| DE2319872A1 (de) | 1973-11-22 |
| ES413174A1 (es) | 1976-01-16 |
| HU169037B (enExample) | 1976-09-28 |
| US3875176A (en) | 1975-04-01 |
| SU597338A3 (ru) | 1978-03-05 |
| AT321303B (de) | 1975-03-25 |
| SU538662A3 (ru) | 1976-12-05 |
| NL7306170A (enExample) | 1973-11-13 |
| SU677653A3 (ru) | 1979-07-30 |
| RO63441A (fr) | 1978-05-15 |
| AR201105A1 (es) | 1975-02-14 |
| AR207633Q (es) | 1976-10-22 |
| IL42007A (en) | 1977-06-30 |
| EG11137A (en) | 1978-06-30 |
| BE799339A (fr) | 1973-11-09 |
| SU561508A3 (ru) | 1977-06-05 |
| FR2184077A1 (enExample) | 1973-12-21 |
| AU5553773A (en) | 1974-11-14 |
| FR2184077B1 (enExample) | 1976-07-02 |
| DD106378A5 (enExample) | 1974-06-12 |
| AU469111B2 (en) | 1976-02-05 |
| GB1416459A (en) | 1975-12-03 |
| PL91935B1 (enExample) | 1977-03-31 |
| CA991189A (en) | 1976-06-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CS609973A2 (en) | Nosic informace | |
| CS283873A2 (en) | Zpusob rafinace tavenin zeleznych kovu | |
| GB1405253A (en) | 1- 2-substituted-chromonyloxy-w-hydroxy-3-phenoxy-propanes | |
| AU6329873A (en) | Flameprofing | |
| GB1407713A (en) | 2-alkoxy-cephalosporins | |
| AU6362373A (en) | N-propargylacetanilide herbicedes | |
| AU5993373A (en) | N-sulphenylated carbamidoximes | |
| GB1402226A (en) | 3-cyanochromones | |
| GB1401579A (en) | Indolo-quinolizines | |
| GB1408010A (en) | Sulphamoylphenyl-imidazolidinones | |
| IL42007A0 (en) | New 2-benzoyl-3-amino-pyridines | |
| AU5711073A (en) | Benzenesulfonyl-ureas benzenesulfonyl-ureas | |
| GB1401735A (en) | Imino-lactams | |
| AU6332973A (en) | Bulbholders | |
| HK45678A (en) | Imino-isoindolinones | |
| AU5191873A (en) | Benzylpyrimidines | |
| AU5233473A (en) | Nitro-imidazolyl-pyrimidines | |
| GB1415691A (en) | Bracks | |
| AU5983773A (en) | Alkylsulphonyl-2-trifluoromethyl-benzimidazoles | |
| GB1400667A (en) | 4-spirocyclopropyl-androstenes | |
| GB1405254A (en) | Bis- substituted-henoxy- propanes | |
| AU5900173A (en) | Thiazolopyrimidines | |
| HK10479A (en) | Weatherbar | |
| GB1402045A (en) | 11-o-methanesulphonylerythromycins | |
| AU6379973A (en) | Goniolens |