ZA731711B - The antibiotic thermozymocidin and a process for its preparation - Google Patents
The antibiotic thermozymocidin and a process for its preparationInfo
- Publication number
- ZA731711B ZA731711B ZA731711A ZA731711A ZA731711B ZA 731711 B ZA731711 B ZA 731711B ZA 731711 A ZA731711 A ZA 731711A ZA 731711 A ZA731711 A ZA 731711A ZA 731711 B ZA731711 B ZA 731711B
- Authority
- ZA
- South Africa
- Prior art keywords
- thermozymocidin
- antibiotic
- preparation
- antibiotic thermozymocidin
- Prior art date
Links
- ZZIKIHCNFWXKDY-UHFFFAOYSA-N Myriocin Natural products CCCCCCC(=O)CCCCCCC=CCC(O)C(O)C(N)(CO)C(O)=O ZZIKIHCNFWXKDY-UHFFFAOYSA-N 0.000 title 1
- 230000003115 biocidal effect Effects 0.000 title 1
- ZZIKIHCNFWXKDY-GNTQXERDSA-N myriocin Chemical compound CCCCCCC(=O)CCCCCC\C=C\C[C@@H](O)[C@H](O)[C@@](N)(CO)C(O)=O ZZIKIHCNFWXKDY-GNTQXERDSA-N 0.000 title 1
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US23474472A | 1972-03-15 | 1972-03-15 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| ZA731711B true ZA731711B (en) | 1974-01-30 |
Family
ID=22882626
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| ZA731711A ZA731711B (en) | 1972-03-15 | 1973-03-12 | The antibiotic thermozymocidin and a process for its preparation |
Country Status (9)
| Country | Link |
|---|---|
| AU (1) | AU5310873A (cs) |
| BE (1) | BE796682A (cs) |
| BR (1) | BR7301816D0 (cs) |
| CH (1) | CH574499A5 (cs) |
| DE (1) | DE2312696A1 (cs) |
| FR (1) | FR2181819A1 (cs) |
| LU (1) | LU67208A1 (cs) |
| NL (1) | NL7303044A (cs) |
| ZA (1) | ZA731711B (cs) |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3438864A (en) * | 1966-01-19 | 1969-04-15 | Moses D Tendler | Production of cellulase,antibiotic and anti-tumor substances by growing eumyces atcc 16425 |
-
1973
- 1973-03-01 CH CH302873A patent/CH574499A5/xx not_active IP Right Cessation
- 1973-03-05 NL NL7303044A patent/NL7303044A/xx unknown
- 1973-03-08 AU AU53108/73A patent/AU5310873A/en not_active Expired
- 1973-03-12 ZA ZA731711A patent/ZA731711B/xx unknown
- 1973-03-13 BE BE128714A patent/BE796682A/xx unknown
- 1973-03-13 LU LU67208D patent/LU67208A1/xx unknown
- 1973-03-14 BR BR181673A patent/BR7301816D0/pt unknown
- 1973-03-14 DE DE19732312696 patent/DE2312696A1/de active Pending
- 1973-03-14 FR FR7309162A patent/FR2181819A1/fr active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| BE796682A (fr) | 1973-07-02 |
| AU5310873A (en) | 1974-09-12 |
| FR2181819A1 (en) | 1973-12-07 |
| DE2312696A1 (de) | 1973-10-04 |
| BR7301816D0 (pt) | 1974-08-29 |
| CH574499A5 (cs) | 1976-04-15 |
| FR2181819B1 (cs) | 1976-12-31 |
| NL7303044A (cs) | 1973-09-18 |
| LU67208A1 (cs) | 1973-05-22 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| PH9723A (en) | Antibiotic at-125 and process for its preparation | |
| GB1400676A (en) | Antibiotic derivatives and a process for the preparation thereof | |
| IL41540A0 (en) | The novel antibiotic a-25822 and its production | |
| ZA735908B (en) | Antibacterial agents and a process for their preparation | |
| MY8000015A (en) | Antibiotic a-2315 and process for preparation thereof | |
| AU474345B2 (en) | Benzenesulfonyl-ureas and processes for preparing them | |
| ZA732916B (en) | Antibiotics | |
| GB1401164A (en) | As-triazino-5,6-c-quinoline derivatives and a process for the preparation thereof | |
| ZA735893B (en) | Antibacterial agents and a process for their preparation | |
| CA954055A (en) | Antibiotic proticin and a process for preparing it | |
| CA1023343A (en) | Bis-piperazino-androstane derivatives and a process for the preparation thereof | |
| CA1014559A (en) | Amino-imidazo and amino-pyrazolo-isoquinolines and process for the preparation thereof | |
| ZA734194B (en) | Benzenesulfonyl-ureas and process for their preparation | |
| IL41352A0 (en) | Nitroimidazolyl-triazolo-pyridazines and process for the preparation thereof | |
| AU471940B2 (en) | Process | |
| CA1026334A (en) | Nitroimidazolyl-triazolo-pyridazines and process for their preparation | |
| CA1004689A (en) | Enaminosulfoxides and a process for their preparation | |
| ZA731711B (en) | The antibiotic thermozymocidin and a process for its preparation | |
| HK42977A (en) | Antibiotic bm123 and production thereof | |
| ZA731060B (en) | Antibiotic a-25822 and process for producing the same | |
| GB1405283A (en) | Antibiotics and processes for their preparation | |
| AU466195B2 (en) | Process | |
| CA898279A (en) | Hydroxy-hydroperoxides and a process for the preparation thereof | |
| AU6166273A (en) | Antibiotics | |
| CA913066A (en) | 2-androstene-17-ethers and process for the preparation thereof |