ZA725641B - Indol-2-ylphenylacetic acids and esters - Google Patents
Indol-2-ylphenylacetic acids and estersInfo
- Publication number
- ZA725641B ZA725641B ZA725641A ZA725641A ZA725641B ZA 725641 B ZA725641 B ZA 725641B ZA 725641 A ZA725641 A ZA 725641A ZA 725641 A ZA725641 A ZA 725641A ZA 725641 B ZA725641 B ZA 725641B
- Authority
- ZA
- South Africa
- Prior art keywords
- ylphenylacetic
- indol
- esters
- acids
- ylphenylacetic acids
- Prior art date
Links
- MKMDIRTXEVMDCI-UHFFFAOYSA-N 2-(1H-indol-2-yl)-2-phenylacetic acid Chemical class N1C(=CC2=CC=CC=C12)C(C(=O)O)C1=CC=CC=C1 MKMDIRTXEVMDCI-UHFFFAOYSA-N 0.000 title 1
- 150000002148 esters Chemical class 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C251/00—Compounds containing nitrogen atoms doubly-bound to a carbon skeleton
- C07C251/72—Hydrazones
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/02—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom condensed with one carbocyclic ring
- C07D209/04—Indoles; Hydrogenated indoles
- C07D209/10—Indoles; Hydrogenated indoles with substituted hydrocarbon radicals attached to carbon atoms of the hetero ring
- C07D209/18—Radicals substituted by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Indole Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US17414471A | 1971-08-23 | 1971-08-23 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| ZA725641B true ZA725641B (en) | 1973-04-25 |
Family
ID=22635011
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| ZA725641A ZA725641B (en) | 1971-08-23 | 1972-08-16 | Indol-2-ylphenylacetic acids and esters |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US3726898A (OSRAM) |
| JP (1) | JPS4829767A (OSRAM) |
| CA (1) | CA965098A (OSRAM) |
| CH (1) | CH554331A (OSRAM) |
| DE (1) | DE2241269A1 (OSRAM) |
| ES (1) | ES406031A1 (OSRAM) |
| FR (1) | FR2150823B1 (OSRAM) |
| GB (1) | GB1391097A (OSRAM) |
| ZA (1) | ZA725641B (OSRAM) |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2275461A1 (fr) * | 1974-06-18 | 1976-01-16 | Labaz | Nouveaux stabilisants des polymeres et copolymeres du chlorure de vinyle |
| JPS5130259A (en) * | 1974-09-09 | 1976-03-15 | Kuraray Plastics Co | Goseijushikatazohin no seizohoho |
| JPS5693511A (en) * | 1979-12-28 | 1981-07-29 | Kodama Kagaku Kogyo Kk | Monolithic molding of door trimming base material for automobile interior by heat press molding of thermoplastic resin |
| US4522808A (en) * | 1980-08-15 | 1985-06-11 | Societe Anonyme Dite: L'oreal | Anti-sunburn compositions containing 2-phenyl-indole derivatives |
| JPS58162573A (ja) * | 1982-03-19 | 1983-09-27 | Teikoku Hormone Mfg Co Ltd | 1−置換−2−フエニルインド−ル誘導体 |
| JPS59201814A (ja) * | 1983-04-30 | 1984-11-15 | Nippon Sekisoo Kogyo Kk | 車両用内装板の端部加工方法 |
-
1971
- 1971-08-23 US US00174144A patent/US3726898A/en not_active Expired - Lifetime
-
1972
- 1972-08-15 GB GB3806272A patent/GB1391097A/en not_active Expired
- 1972-08-16 CH CH1213972A patent/CH554331A/fr not_active IP Right Cessation
- 1972-08-16 ZA ZA725641A patent/ZA725641B/xx unknown
- 1972-08-22 FR FR7229955A patent/FR2150823B1/fr not_active Expired
- 1972-08-22 CA CA149,991A patent/CA965098A/en not_active Expired
- 1972-08-22 DE DE2241269A patent/DE2241269A1/de active Pending
- 1972-08-22 ES ES406031A patent/ES406031A1/es not_active Expired
- 1972-08-23 JP JP47083826A patent/JPS4829767A/ja active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| FR2150823B1 (OSRAM) | 1977-01-14 |
| DE2241269A1 (de) | 1973-03-08 |
| CA965098A (en) | 1975-03-25 |
| GB1391097A (en) | 1975-04-16 |
| US3726898A (en) | 1973-04-10 |
| CH554331A (fr) | 1974-09-30 |
| ES406031A1 (es) | 1975-09-16 |
| JPS4829767A (OSRAM) | 1973-04-19 |
| FR2150823A1 (OSRAM) | 1973-04-13 |
| AU4583572A (en) | 1974-02-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| IL39444A0 (en) | 1,4-dihydro-4-oxo-3-quinoline-carboxylic acids and esters and their preparation | |
| PH10201A (en) | 2,4-dienoic acids,esters and derivatives | |
| ZA718652B (en) | Cycloropane esters and acids thereof | |
| ZA725641B (en) | Indol-2-ylphenylacetic acids and esters | |
| IL39347A (en) | Benzamidoacetohydroxamic acids and their preparation | |
| CA970376A (en) | Isoxazolopyridine carboxylic acids and esters | |
| AU458136B2 (en) | New hyddroxy and alkoxy-acetamido-triiodobenzoic acids | |
| PH10552A (en) | 1h-tetrazole-l-acetate esters and acids | |
| IE36735L (en) | Unsaturated aliphatic esters and thioesters | |
| PH13980A (en) | Ester of thienobenzopyran and thiopyranobenzopyran | |
| ZA728855B (en) | Dialkylthionophosphoric esters | |
| ZA725797B (en) | Hydroxy-ether-carboxylic acids | |
| ZA726325B (en) | Dehydro-epi-androsterone esters and their use | |
| AU467119B2 (en) | Indol-2-ylphenylacetic acids and esters | |
| CA943541A (en) | Adamantylcarboxamido-phenylalkanoic acids and esters thereof | |
| CA882117A (en) | Adamantylcarboxamidophenyl-alkanoic acids and esters thereof | |
| ZA724921B (en) | Esters of 9a-fluoro-16-methylene-prednisolone | |
| ZA72726B (en) | New esters | |
| AU448870B2 (en) | Aliphataic esters and theiolesters | |
| IL42214A0 (en) | Indol-7-ylacetic acids and esters thereof | |
| CA867363A (en) | 9-d-psicofuranosylpurine and its esters | |
| IL37950A0 (en) | Esters of alpha-hydroperoxy-bis-p-halogenophenylacetic acids | |
| ZA712505B (en) | Esters of n-aryl-anthranilic acids | |
| AU5009772A (en) | Benztriazinonylmethyl-organophosphoric esters | |
| AU8412875A (en) | 2-acylamino-pyrimidin-4-ul esters of phosphonic and phos- phoramidic acids |