ZA724758B - Novel disubstituted xanthone carboxylic acid compounds - Google Patents
Novel disubstituted xanthone carboxylic acid compoundsInfo
- Publication number
- ZA724758B ZA724758B ZA724758A ZA724758A ZA724758B ZA 724758 B ZA724758 B ZA 724758B ZA 724758 A ZA724758 A ZA 724758A ZA 724758 A ZA724758 A ZA 724758A ZA 724758 B ZA724758 B ZA 724758B
- Authority
- ZA
- South Africa
- Prior art keywords
- carboxylic acid
- acid compounds
- novel disubstituted
- xanthone carboxylic
- disubstituted xanthone
- Prior art date
Links
- WNKRYYFWYMHTGV-UHFFFAOYSA-N 9-oxoxanthene-1-carboxylic acid Chemical class O1C2=CC=CC=C2C(=O)C2=C1C=CC=C2C(=O)O WNKRYYFWYMHTGV-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D311/00—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings
- C07D311/02—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D311/78—Ring systems having three or more relevant rings
- C07D311/80—Dibenzopyrans; Hydrogenated dibenzopyrans
- C07D311/82—Xanthenes
- C07D311/84—Xanthenes with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached in position 9
- C07D311/86—Oxygen atoms, e.g. xanthones
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pyrane Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US21728872A | 1972-01-12 | 1972-01-12 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| ZA724758B true ZA724758B (en) | 1974-02-27 |
Family
ID=22810419
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| ZA724758A ZA724758B (en) | 1972-01-12 | 1972-07-12 | Novel disubstituted xanthone carboxylic acid compounds |
Country Status (11)
-
0
- BE BE793750D patent/BE793750A/xx unknown
-
1972
- 1972-06-12 DE DE2234252A patent/DE2234252A1/de active Pending
- 1972-07-12 ES ES404803A patent/ES404803A1/es not_active Expired
- 1972-07-12 IL IL39887A patent/IL39887A0/xx unknown
- 1972-07-12 ZA ZA724758A patent/ZA724758B/xx unknown
- 1972-07-12 JP JP47069846A patent/JPS4880564A/ja active Pending
- 1972-07-12 GB GB3253672A patent/GB1384145A/en not_active Expired
- 1972-07-12 AU AU44459/72A patent/AU470741B2/en not_active Expired
- 1972-07-12 NL NL7209621A patent/NL7209621A/xx unknown
- 1972-07-12 AT AT599272A patent/AT326652B/de not_active IP Right Cessation
- 1972-07-12 FR FR7225350A patent/FR2167488A1/fr not_active Withdrawn
Also Published As
| Publication number | Publication date |
|---|---|
| GB1384145A (en) | 1975-02-19 |
| IL39887A0 (en) | 1972-09-28 |
| BE793750A (fr) | 1973-07-09 |
| AU4445972A (en) | 1974-01-17 |
| ATA599272A (de) | 1975-03-15 |
| AT326652B (de) | 1975-12-29 |
| NL7209621A (enrdf_load_stackoverflow) | 1973-07-16 |
| DE2234252A1 (de) | 1973-07-19 |
| ES404803A1 (es) | 1976-01-01 |
| FR2167488A1 (enrdf_load_stackoverflow) | 1973-08-24 |
| JPS4880564A (enrdf_load_stackoverflow) | 1973-10-29 |
| AU470741B2 (en) | 1976-03-25 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| PH12094A (en) | Substituted phenylacetic acid compounds | |
| ZA724756B (en) | Novel disubstituted xanthone carboxylic acid compounds | |
| IL37019A (en) | Dihydro-furo-quinoline carboxylic acid derivatives | |
| ZA744249B (en) | Novel cycloalkyl phenoxy carboxylic acid derivatives | |
| MY7600087A (en) | Novel substituted xanthone carboxylic acid compounds | |
| ZA724757B (en) | Novel disubstituted xanthone carboxylic acid compounds | |
| AU465362B2 (en) | Novel disubstituted xanthone carboxylic acid compounds | |
| HK30876A (en) | Novel substituted xanthone carboxylic acid compounds | |
| ZA724758B (en) | Novel disubstituted xanthone carboxylic acid compounds | |
| CA1017345A (en) | Disubstituted xanthone carboxylic acid compounds | |
| ZA724759B (en) | Heterocyclic substituted xanthone carboxylic acid compounds | |
| ZA728288B (en) | Alkenyl and alkynyl substituted xanthone carboxylic acid compounds | |
| ZA747671B (en) | Disubstituted xanthone carboxylic acid compounds | |
| AU5920273A (en) | Alpha-phenyl-fatty acid compounds | |
| ZA737591B (en) | 13-bromo-lysergic acid compounds | |
| ZA728289B (en) | Unsaturated ether substituted xanthone carboxylic acid compounds | |
| ZA733641B (en) | Phenoxy alicyclic carboxylic acid derivatives | |
| AU6201973A (en) | Terahydroindazole-5-carboxylic acid compounds | |
| GB1408722A (en) | Process for the preparation of an -ar-alkane carboxylic acid | |
| ZA721129B (en) | 5-n-pyrrylsalicylic acid | |
| ZA724755B (en) | Xanthone carboxylic acids & derivatives | |
| JPS55136290A (en) | Manufacture of 7betaaaminoocephamm33onee44 carboxylic acid compound | |
| AU476552B2 (en) | Tetrahydro isoquinolyl carboxylic acid amides | |
| ZA745117B (en) | Benzalicyolic carboxylic acid derivatives | |
| ZA733869B (en) | New thiolphosphoric acid esters |