AU470741B2 - Novel disubstituted xanthone carboxylic acid compounds - Google Patents
Novel disubstituted xanthone carboxylic acid compoundsInfo
- Publication number
- AU470741B2 AU470741B2 AU44459/72A AU4445972A AU470741B2 AU 470741 B2 AU470741 B2 AU 470741B2 AU 44459/72 A AU44459/72 A AU 44459/72A AU 4445972 A AU4445972 A AU 4445972A AU 470741 B2 AU470741 B2 AU 470741B2
- Authority
- AU
- Australia
- Prior art keywords
- carboxylic acid
- acid compounds
- novel disubstituted
- xanthone carboxylic
- disubstituted xanthone
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- WNKRYYFWYMHTGV-UHFFFAOYSA-N 9-oxoxanthene-1-carboxylic acid Chemical class O1C2=CC=CC=C2C(=O)C2=C1C=CC=C2C(=O)O WNKRYYFWYMHTGV-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D311/00—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings
- C07D311/02—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D311/78—Ring systems having three or more relevant rings
- C07D311/80—Dibenzopyrans; Hydrogenated dibenzopyrans
- C07D311/82—Xanthenes
- C07D311/84—Xanthenes with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached in position 9
- C07D311/86—Oxygen atoms, e.g. xanthones
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pyrane Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US21728872A | 1972-01-12 | 1972-01-12 | |
| USUS217,288 | 1972-01-12 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| AU4445972A AU4445972A (en) | 1974-01-17 |
| AU470741B2 true AU470741B2 (en) | 1976-03-25 |
Family
ID=22810419
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| AU44459/72A Expired AU470741B2 (en) | 1972-01-12 | 1972-07-12 | Novel disubstituted xanthone carboxylic acid compounds |
Country Status (11)
-
0
- BE BE793750D patent/BE793750A/xx unknown
-
1972
- 1972-06-12 DE DE2234252A patent/DE2234252A1/de active Pending
- 1972-07-12 ES ES404803A patent/ES404803A1/es not_active Expired
- 1972-07-12 IL IL39887A patent/IL39887A0/xx unknown
- 1972-07-12 ZA ZA724758A patent/ZA724758B/xx unknown
- 1972-07-12 JP JP47069846A patent/JPS4880564A/ja active Pending
- 1972-07-12 GB GB3253672A patent/GB1384145A/en not_active Expired
- 1972-07-12 AU AU44459/72A patent/AU470741B2/en not_active Expired
- 1972-07-12 NL NL7209621A patent/NL7209621A/xx unknown
- 1972-07-12 AT AT599272A patent/AT326652B/de not_active IP Right Cessation
- 1972-07-12 FR FR7225350A patent/FR2167488A1/fr not_active Withdrawn
Also Published As
| Publication number | Publication date |
|---|---|
| GB1384145A (en) | 1975-02-19 |
| IL39887A0 (en) | 1972-09-28 |
| BE793750A (fr) | 1973-07-09 |
| AU4445972A (en) | 1974-01-17 |
| ATA599272A (de) | 1975-03-15 |
| AT326652B (de) | 1975-12-29 |
| NL7209621A (enrdf_load_stackoverflow) | 1973-07-16 |
| DE2234252A1 (de) | 1973-07-19 |
| ES404803A1 (es) | 1976-01-01 |
| FR2167488A1 (enrdf_load_stackoverflow) | 1973-08-24 |
| JPS4880564A (enrdf_load_stackoverflow) | 1973-10-29 |
| ZA724758B (en) | 1974-02-27 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| ZA724756B (en) | Novel disubstituted xanthone carboxylic acid compounds | |
| AU470740B2 (en) | Novel substituted xanthone carboxylic acid compounds | |
| AU465363B2 (en) | Novel disubstituted xanthone carboxylic acid compounds | |
| CA990287A (en) | 13-bromo-lysergic acid compounds | |
| AU465362B2 (en) | Novel disubstituted xanthone carboxylic acid compounds | |
| CA1012543A (en) | Substituted xanthone carboxylic acid compounds | |
| AU470741B2 (en) | Novel disubstituted xanthone carboxylic acid compounds | |
| CA1017345A (en) | Disubstituted xanthone carboxylic acid compounds | |
| AU460222B2 (en) | Heterocyclic substituted xanthone carboxylic acid compounds | |
| CA1002061A (en) | Phenoxyallcyclic carboxylic acid derivatives | |
| AU478775B2 (en) | Novel substituted xanthone carboxylic acid compounds | |
| ZA747671B (en) | Disubstituted xanthone carboxylic acid compounds | |
| ZA728289B (en) | Unsaturated ether substituted xanthone carboxylic acid compounds | |
| CA902818A (en) | Unique carboxylic acid latices | |
| CA1002945A (en) | 13-bromo-lysergic acid compounds | |
| CA896564A (en) | Phenoxy carboxylic acid derivatives | |
| AU476552B2 (en) | Tetrahydro isoquinolyl carboxylic acid amides | |
| CA898815A (en) | Benzene polycarboxylic acid esters | |
| CA907636A (en) | Cycloalkane carboxylic acid derivatives | |
| AU480544B2 (en) | Novel cycloalkyl phenoxy carboxylic acid derivatives | |
| AU479678B2 (en) | New thiolphosphoric acid esters | |
| AU7062974A (en) | Novel cycloalkyl phenoxy carboxylic acid derivatives | |
| AU5630873A (en) | New thiolphosphoric acid esters | |
| AU1478570A (en) | Cyclic carboxylic acid derivatives |