ZA722883B - Cephalosporin and penicillin intermediates - Google Patents
Cephalosporin and penicillin intermediatesInfo
- Publication number
- ZA722883B ZA722883B ZA722883A ZA722883A ZA722883B ZA 722883 B ZA722883 B ZA 722883B ZA 722883 A ZA722883 A ZA 722883A ZA 722883 A ZA722883 A ZA 722883A ZA 722883 B ZA722883 B ZA 722883B
- Authority
- ZA
- South Africa
- Prior art keywords
- cephalosporin
- penicillin
- intermediates
- penicillin intermediates
- Prior art date
Links
- 229930186147 Cephalosporin Natural products 0.000 title 1
- 229930182555 Penicillin Natural products 0.000 title 1
- JGSARLDLIJGVTE-MBNYWOFBSA-N Penicillin G Chemical compound N([C@H]1[C@H]2SC([C@@H](N2C1=O)C(O)=O)(C)C)C(=O)CC1=CC=CC=C1 JGSARLDLIJGVTE-MBNYWOFBSA-N 0.000 title 1
- 229940124587 cephalosporin Drugs 0.000 title 1
- 150000001780 cephalosporins Chemical class 0.000 title 1
- 239000000543 intermediate Substances 0.000 title 1
- 229940049954 penicillin Drugs 0.000 title 1
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB1300871 | 1971-04-30 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| ZA722883B true ZA722883B (en) | 1973-12-19 |
Family
ID=10015149
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| ZA722883A ZA722883B (en) | 1971-04-30 | 1972-04-28 | Cephalosporin and penicillin intermediates |
Country Status (4)
| Country | Link |
|---|---|
| AT (2) | AT323322B (cs) |
| AU (1) | AU471071B2 (cs) |
| CS (1) | CS182221B2 (cs) |
| ZA (1) | ZA722883B (cs) |
-
1972
- 1972-04-18 AU AU41306/72A patent/AU471071B2/en not_active Expired
- 1972-04-26 AT AT367372A patent/AT323322B/de not_active IP Right Cessation
- 1972-04-26 AT AT768174*1A patent/AT325209B/de not_active IP Right Cessation
- 1972-04-28 CS CS292972A patent/CS182221B2/cs unknown
- 1972-04-28 ZA ZA722883A patent/ZA722883B/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| AT325209B (de) | 1975-10-10 |
| AU4130672A (en) | 1973-10-25 |
| CS182221B2 (en) | 1978-04-28 |
| AT323322B (de) | 1975-07-10 |
| AU471071B2 (en) | 1976-04-08 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| KE2632A (en) | Penicillins and cephalosporins | |
| AU474062B2 (en) | &- hydroxyiminoacylamido and & - acyloxyiminoacylamido penicillin and cephalosporin antibiotics | |
| ZA73407B (en) | Novel penicillin and cephalosporin compounds | |
| AU470085B2 (en) | Penicillins and cephalosporins | |
| ZA724135B (en) | 7-heterocyclic substituted cephalosporins | |
| CA1001153A (en) | Cephalosporin and penicillin intermediates | |
| AU5321073A (en) | Penicillins and cephalosporins | |
| AU474148B2 (en) | Processes to prepare cephalosporin and penicillin intermediates | |
| CA1014496A (en) | Penicillin acylase | |
| IE36987L (en) | 3-alkylthiomethyl cephalosporins | |
| PH13639A (en) | Halogenated phenylthioacetamido cephalosporins | |
| IE37940L (en) | Isocyano penicillins and cephalosporins | |
| ZA722883B (en) | Cephalosporin and penicillin intermediates | |
| ZA722023B (en) | Penicillins | |
| IE38412L (en) | Thioacetyl penicillins and cephalosporins | |
| IE36041L (en) | Acylamido cephalosporins and penicillins | |
| IE37109L (en) | Penicillins and cephalosporins | |
| AU4901572A (en) | Penicillin acylase | |
| IE39743L (en) | Penicillin and cephalosporin derivatives | |
| AU470859B2 (en) | Penicillin and cephalosporin derivatives | |
| HK71776A (en) | Penicillins and cephalosporins | |
| AU4523072A (en) | Penicillins | |
| AU474902B2 (en) | Hydroxyiminoacylamido and (-acyloxyiminiacyl-amido penicillin and cepholosporin antibiotics | |
| CA885426A (en) | Penicillin intermediate | |
| IE37758L (en) | Penicillin and cephalosporin esters |